Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | VE-P | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | 500 nM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| In Vivo Experiment Model | Model Type |
|
Cell lysate | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Osteosarcoma [ICD-11:2B51] | |||||
| Model Name | Human osteosarcoma cell lysate (U2OS) | |||||
| Note | Negative probe:C#CCCC1(N=N1)CCC(=O)NC2=CC=CC=C2 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | |||||
|---|---|---|---|---|---|---|
| LDTP12639 | 1-acyl-sn-glycerol-3-phosphate acyltransferase epsilon (AGPAT5) | |||||
| LDTP06286 | 116 kDa U5 small nuclear ribonucleoprotein component (EFTUD2) | |||||
| LDTP10828 | 2-aminoethanethiol dioxygenase (ADO) | |||||
| LDTP05341 | 2-oxoglutarate dehydrogenase complex component E1 (OGDH) | |||||
| LDTP13667 | 26S proteasome non-ATPase regulatory subunit 13 (PSMD13) | |||||
| LDTP05782 | 26S proteasome non-ATPase regulatory subunit 2 (PSMD2) | |||||
| LDTP04655 | 26S proteasome non-ATPase regulatory subunit 4 (PSMD4) | |||||
| LDTP06532 | 26S proteasome non-ATPase regulatory subunit 5 (PSMD5) | |||||
| LDTP04441 | 26S proteasome non-ATPase regulatory subunit 7 (PSMD7) | |||||
| LDTP04987 | 26S proteasome regulatory subunit 10B (PSMC6) | |||||
| LDTP04962 | 26S proteasome regulatory subunit 4 (PSMC1) | |||||
| LDTP04061 | 26S proteasome regulatory subunit 6B (PSMC4) | |||||
| LDTP03797 | 26S proteasome regulatory subunit 7 (PSMC2) | |||||
| LDTP04963 | 26S proteasome regulatory subunit 8 (PSMC5) | |||||
| LDTP10649 | 28S rRNA (cytosine-C(5))-methyltransferase (NSUN5) | |||||
| LDTP01697 | 3'(2'),5'-bisphosphate nucleotidase 1 (BPNT1) | |||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | |||||
| LDTP03611 | 3-hydroxyisobutyrate dehydrogenase, mitochondrial (HIBADH) | |||||
| LDTP07483 | 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial (HIBCH) | |||||
| LDTP04768 | 3-keto-steroid reductase/17-beta-hydroxysteroid dehydrogenase 7 (HSD17B7) | |||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | |||||
| LDTP10424 | 4-hydroxyphenylpyruvate dioxygenase-like protein (HPDL) | |||||
| LDTP04232 | 4-trimethylaminobutyraldehyde dehydrogenase (ALDH9A1) | |||||
| LDTP11701 | 5'-3' exoribonuclease 2 (XRN2) | |||||
| LDTP14027 | 5'-AMP-activated protein kinase subunit beta-1 (PRKAB1) | |||||
| LDTP17247 | 5'-nucleotidase domain-containing protein 1 (NT5DC1) | |||||
| LDTP04499 | 6-phosphogluconate dehydrogenase, decarboxylating (PGD) | |||||
| LDTP02522 | 60 kDa heat shock protein, mitochondrial (HSPD1) | |||||
| LDTP13131 | 7-dehydrocholesterol reductase (DHCR7) | |||||
| LDTP15291 | Acetoacetyl-CoA synthetase (AACS) | |||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | |||||
| LDTP03291 | Acetyl-CoA acetyltransferase, mitochondrial (ACAT1) | |||||
| LDTP10982 | Aconitate hydratase, mitochondrial (ACO2) | |||||
| LDTP05069 | Actin, alpha cardiac muscle 1 (ACTC1) | |||||
| LDTP04876 | Actin, cytoplasmic 1 (ACTB) | |||||
| LDTP01699 | Acyl-CoA 6-desaturase (FADS2) | |||||
| LDTP16274 | Acyl-coenzyme A thioesterase 9, mitochondrial (ACOT9) | |||||
| LDTP07323 | Acyl-coenzyme A thioesterase MBLAC2 (MBLAC2) | |||||
| LDTP03242 | Adenosylhomocysteinase (AHCY) | |||||
| LDTP03551 | Adenylosuccinate lyase (ADSL) | |||||
| LDTP03541 | Adenylosuccinate synthetase isozyme 2 (ADSS2) | |||||
| LDTP12293 | Adipocyte plasma membrane-associated protein (APMAP) | |||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | |||||
| LDTP13462 | ADP-sugar pyrophosphatase (NUDT5) | |||||
| LDTP14075 | AFG3-like protein 2 (AFG3L2) | |||||
| LDTP09416 | Alanine aminotransferase 2 (GPT2) | |||||
| LDTP04262 | Alanine--tRNA ligase, cytoplasmic (AARS1) | |||||
| LDTP07015 | Alanine--tRNA ligase, mitochondrial (AARS2) | |||||
| LDTP02587 | Alcohol dehydrogenase class-3 (ADH5) | |||||
| LDTP03560 | Aldehyde dehydrogenase X, mitochondrial (ALDH1B1) | |||||
| LDTP02729 | Aldo-keto reductase family 1 member A1 (AKR1A1) | |||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | |||||
| LDTP08401 | All trans-polyprenyl-diphosphate synthase PDSS2 (PDSS2) | |||||
| LDTP02159 | Alpha-enolase (ENO1) | |||||
| LDTP15993 | Aminopeptidase B (RNPEP) | |||||
| LDTP04601 | Arginine--tRNA ligase, cytoplasmic (RARS1) | |||||
| LDTP01807 | Argininosuccinate synthase (ASS1) | |||||
| LDTP02807 | Arylsulfatase B (ARSB) | |||||
| LDTP02264 | Asparagine synthetase [glutamine-hydrolyzing] (ASNS) | |||||
| LDTP10413 | Asparaginyl-tRNA synthetase (NARS2) | |||||
| LDTP02888 | Aspartate aminotransferase, cytoplasmic (GOT1) | |||||
| LDTP01783 | Aspartate aminotransferase, mitochondrial (GOT2) | |||||
| LDTP02752 | Aspartate--tRNA ligase, cytoplasmic (DARS1) | |||||
| LDTP13527 | Aspartyl aminopeptidase (DNPEP) | |||||
| LDTP02150 | ATP synthase subunit beta, mitochondrial (ATP5F1B) | |||||
| LDTP04909 | ATP-binding cassette sub-family E member 1 (ABCE1) | |||||
| LDTP04561 | ATP-citrate synthase (ACLY) | |||||
| LDTP02925 | ATP-dependent 6-phosphofructokinase, liver type (PFKL) | |||||
| LDTP05314 | ATP-dependent 6-phosphofructokinase, platelet type (PFKP) | |||||
| LDTP01382 | ATP-dependent Clp protease ATP-binding subunit clpX-like, mitochondrial (CLPX) | |||||
| LDTP04083 | ATP-dependent DNA helicase Q1 (RECQL) | |||||
| LDTP05550 | ATP-dependent RNA helicase A (DHX9) | |||||
| LDTP09766 | ATP-dependent RNA helicase DDX1 (DDX1) | |||||
| LDTP12646 | ATP-dependent RNA helicase DDX19A (DDX19A) | |||||
| LDTP00192 | ATP-dependent RNA helicase DDX39A (DDX39A) | |||||
| LDTP08369 | ATP-dependent RNA helicase DDX42 (DDX42) | |||||
| LDTP09428 | ATP-dependent RNA helicase DDX54 (DDX54) | |||||
| LDTP00684 | ATP-dependent RNA helicase DHX15 (DHX15) | |||||
| LDTP08641 | ATP-dependent RNA helicase SUPV3L1, mitochondrial (SUPV3L1) | |||||
| LDTP10801 | ATPase WRNIP1 (WRNIP1) | |||||
| LDTP00491 | Aurora kinase A (AURKA) | |||||
| LDTP03308 | Beta-adrenergic receptor kinase 1 (GRK2) | |||||
| LDTP02216 | Beta-hexosaminidase subunit beta (HEXB) | |||||
| LDTP00282 | Beta-mannosidase (MANBA) | |||||
| LDTP02222 | Bifunctional glutamate/proline--tRNA ligase (EPRS1) | |||||
| LDTP05992 | Bleomycin hydrolase (BLMH) | |||||
| LDTP04622 | Branched-chain-amino-acid aminotransferase, cytosolic (BCAT1) | |||||
| LDTP00624 | Branched-chain-amino-acid aminotransferase, mitochondrial (BCAT2) | |||||
| LDTP02580 | C-1-tetrahydrofolate synthase, cytoplasmic (MTHFD1) | |||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | |||||
| LDTP14297 | Calpain-7 (CAPN7) | |||||
| LDTP02909 | cAMP-dependent protein kinase catalytic subunit alpha (PRKACA) | |||||
| LDTP03188 | cAMP-dependent protein kinase catalytic subunit beta (PRKACB) | |||||
| LDTP08773 | Cap-specific mRNA (nucleoside-2'-O-)-methyltransferase 1 (CMTR1) | |||||
| LDTP03710 | Carbonic anhydrase-related protein (CA8) | |||||
| LDTP04358 | Carnitine O-palmitoyltransferase 1, liver isoform (CPT1A) | |||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | |||||
| LDTP04209 | Casein kinase I isoform alpha (CSNK1A1) | |||||
| LDTP03985 | Caspase-2 (CASP2) | |||||
| LDTP02001 | Catalase (CAT) | |||||
| LDTP02198 | Cathepsin D (CTSD) | |||||
| LDTP01024 | Cell cycle checkpoint protein RAD1 (RAD1) | |||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | |||||
| LDTP11336 | Chitinase domain-containing protein 1 (CHID1) | |||||
| LDTP03787 | Choline kinase alpha (CHKA) | |||||
| LDTP01539 | Chromosome-associated kinesin KIF4A (KIF4A) | |||||
| LDTP13053 | Cleavage and polyadenylation specificity factor subunit 2 (CPSF2) | |||||
| LDTP13675 | COP9 signalosome complex subunit 3 (COPS3) | |||||
| LDTP02922 | CTP synthase 1 (CTPS1) | |||||
| LDTP08296 | Cullin-associated NEDD8-dissociated protein 1 (CAND1) | |||||
| LDTP03299 | Cyclin-dependent kinase 2 (CDK2) | |||||
| LDTP05245 | Cyclin-dependent kinase 5 (CDK5) | |||||
| LDTP05244 | Cyclin-dependent kinase 6 (CDK6) | |||||
| LDTP00497 | Cyclin-G-associated kinase (GAK) | |||||
| LDTP01772 | Cytochrome c oxidase subunit 1 (MT-CO1) | |||||
| LDTP03110 | Cytoplasmic aconitate hydratase (ACO1) | |||||
| LDTP15267 | Cytoplasmic tRNA 2-thiolation protein 1 (CTU1) | |||||
| LDTP03455 | Cytosol aminopeptidase (LAP3) | |||||
| LDTP00194 | Cytosolic acyl coenzyme A thioester hydrolase (ACOT7) | |||||
| LDTP04124 | Cytosolic phospholipase A2 (PLA2G4A) | |||||
| LDTP00701 | D-3-phosphoglycerate dehydrogenase (PHGDH) | |||||
| LDTP15311 | Deaminated glutathione amidase (NIT1) | |||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | |||||
| LDTP13959 | Dehydrogenase/reductase SDR family member 7 (DHRS7) | |||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | |||||
| LDTP05724 | Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial (ECH1) | |||||
| LDTP04646 | Delta-1-pyrroline-5-carboxylate synthase (ALDH18A1) | |||||
| LDTP02684 | Delta-aminolevulinic acid dehydratase (ALAD) | |||||
| LDTP11225 | Deoxyhypusine hydroxylase (DOHH) | |||||
| LDTP04248 | Deoxyhypusine synthase (DHPS) | |||||
| LDTP08942 | Deubiquitinase OTUD6B (OTUD6B) | |||||
| LDTP10466 | Deubiquitinating protein VCPIP1 (VCPIP1) | |||||
| LDTP13836 | Developmentally-regulated GTP-binding protein 1 (DRG1) | |||||
| LDTP04656 | Developmentally-regulated GTP-binding protein 2 (DRG2) | |||||
| LDTP03829 | Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial (DLST) | |||||
| LDTP09613 | Dimethyladenosine transferase 1, mitochondrial (TFB1M) | |||||
| LDTP11960 | Dimethyladenosine transferase 2, mitochondrial (TFB2M) | |||||
| LDTP04567 | Diphosphomevalonate decarboxylase (MVD) | |||||
| LDTP11835 | Diphthine methyl ester synthase (DPH5) | |||||
| LDTP13251 | DNA dC->dU-editing enzyme APOBEC-3B (APOBEC3B) | |||||
| LDTP04334 | DNA ligase 3 (LIG3) | |||||
| LDTP06069 | DNA polymerase alpha subunit B (POLA2) | |||||
| LDTP04272 | DNA primase small subunit (PRIM1) | |||||
| LDTP03398 | DNA repair nuclease/redox regulator APEX1 (APEX1) | |||||
| LDTP04286 | DNA replication licensing factor MCM2 (MCM2) | |||||
| LDTP03316 | DNA replication licensing factor MCM3 (MCM3) | |||||
| LDTP03680 | DNA replication licensing factor MCM4 (MCM4) | |||||
| LDTP03681 | DNA replication licensing factor MCM5 (MCM5) | |||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | |||||
| LDTP03682 | DNA replication licensing factor MCM7 (MCM7) | |||||
| LDTP02568 | DNA topoisomerase 2-alpha (TOP2A) | |||||
| LDTP05136 | DNA-dependent protein kinase catalytic subunit (PRKDC) | |||||
| LDTP11642 | DNA-directed RNA polymerase I subunit RPA49 (POLR1E) | |||||
| LDTP02992 | DNA-directed RNA polymerase II subunit RPB3 (POLR2C) | |||||
| LDTP11762 | DNA-directed RNA polymerase III subunit RPC6 (POLR3F) | |||||
| LDTP14087 | DNA-directed RNA polymerase III subunit RPC8 (POLR3H) | |||||
| LDTP00557 | DNA-directed RNA polymerases I and III subunit RPAC1 (POLR1C) | |||||
| LDTP08590 | DnaJ homolog subfamily C member 10 (DNAJC10) | |||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | |||||
| LDTP09388 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B (STT3B) | |||||
| LDTP14214 | Dolichyl-phosphate beta-glucosyltransferase (ALG5) | |||||
| LDTP04103 | Dual specificity mitogen-activated protein kinase kinase 3 (MAP2K3) | |||||
| LDTP13663 | Dual specificity protein phosphatase 12 (DUSP12) | |||||
| LDTP00273 | Dynamin-1-like protein (DNM1L) | |||||
| LDTP04374 | Dynamin-2 (DNM2) | |||||
| LDTP13655 | E3 ubiquitin-protein ligase CHIP (STUB1) | |||||
| LDTP10441 | E3 ubiquitin-protein ligase Itchy homolog (ITCH) | |||||
| LDTP07672 | E3 ubiquitin-protein ligase LRSAM1 (LRSAM1) | |||||
| LDTP08116 | E3 ubiquitin-protein ligase RBBP6 (RBBP6) | |||||
| LDTP05496 | E3 ubiquitin-protein ligase RING1 (RING1) | |||||
| LDTP10877 | E3 ubiquitin-protein ligase RING2 (RNF2) | |||||
| LDTP08203 | E3 ubiquitin-protein ligase synoviolin (SYVN1) | |||||
| LDTP10845 | E3 ubiquitin-protein ligase UHRF1 (UHRF1) | |||||
| LDTP01444 | E3 UFM1-protein ligase 1 (UFL1) | |||||
| LDTP08947 | eEF1A lysine and N-terminal methyltransferase (METTL13) | |||||
| LDTP10798 | EKC/KEOPS complex subunit TP53RK (TP53RK) | |||||
| LDTP02694 | Electron transfer flavoprotein subunit alpha, mitochondrial (ETFA) | |||||
| LDTP05071 | Elongation factor 1-alpha 1 (EEF1A1) | |||||
| LDTP02672 | Elongation factor 2 (EEF2) | |||||
| LDTP04251 | Elongation factor Tu, mitochondrial (TUFM) | |||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | |||||
| LDTP02534 | Endoplasmic reticulum chaperone BiP (HSPA5) | |||||
| LDTP06910 | Endoribonuclease LACTB2 (LACTB2) | |||||
| LDTP13314 | Enolase-phosphatase E1 (ENOPH1) | |||||
| LDTP11271 | Enoyl-[acyl-carrier-protein] reductase, mitochondrial (MECR) | |||||
| LDTP02582 | Eosinophil peroxidase (EPX) | |||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | |||||
| LDTP09817 | ER degradation-enhancing alpha-mannosidase-like protein 1 (EDEM1) | |||||
| LDTP04878 | Eukaryotic initiation factor 4A-I (EIF4A1) | |||||
| LDTP06089 | Eukaryotic initiation factor 4A-II (EIF4A2) | |||||
| LDTP03861 | Eukaryotic initiation factor 4A-III (EIF4A3) | |||||
| LDTP02770 | Eukaryotic peptide chain release factor GTP-binding subunit ERF3A (GSPT1) | |||||
| LDTP08642 | Eukaryotic peptide chain release factor GTP-binding subunit ERF3B (GSPT2) | |||||
| LDTP03915 | Eukaryotic translation initiation factor 2 subunit 3 (EIF2S3) | |||||
| LDTP00246 | Eukaryotic translation initiation factor 3 subunit F (EIF3F) | |||||
| LDTP10110 | Exosome complex component RRP43 (EXOSC8) | |||||
| LDTP16132 | F-box/LRR-repeat protein 12 (FBXL12) | |||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | |||||
| LDTP02721 | Farnesyl pyrophosphate synthase (FDPS) | |||||
| LDTP10049 | FAST kinase domain-containing protein 4 (TBRG4) | |||||
| LDTP01634 | Fatty acid CoA ligase Acsl3 (ACSL3) | |||||
| LDTP04243 | Fatty acid synthase (FASN) | |||||
| LDTP09628 | Fatty acyl-CoA reductase 1 (FAR1) | |||||
| LDTP02008 | Fructose-bisphosphate aldolase A (ALDOA) | |||||
| LDTP02386 | Fructose-bisphosphate aldolase C (ALDOC) | |||||
| LDTP02235 | Fumarate hydratase, mitochondrial (FH) | |||||
| LDTP18161 | Fumarylacetoacetate hydrolase domain-containing protein 2A (FAHD2A) | |||||
| LDTP10157 | Galactose mutarotase (GALM) | |||||
| LDTP09886 | Gamma-glutamyl hydrolase (GGH) | |||||
| LDTP01618 | GDH/6PGL endoplasmic bifunctional protein (H6PD) | |||||
| LDTP11905 | GDP-fucose protein O-fucosyltransferase 1 (POFUT1) | |||||
| LDTP13471 | General transcription factor 3C polypeptide 4 (GTF3C4) | |||||
| LDTP04568 | Geranylgeranyl transferase type-1 subunit beta (PGGT1B) | |||||
| LDTP09956 | Glomulin (GLMN) | |||||
| LDTP04113 | Glucosamine-6-phosphate isomerase 1 (GNPDA1) | |||||
| LDTP02569 | Glucose-6-phosphate 1-dehydrogenase (G6PD) | |||||
| LDTP02162 | Glucose-6-phosphate isomerase (GPI) | |||||
| LDTP01768 | Glutamate dehydrogenase 1, mitochondrial (GLUD1) | |||||
| LDTP01465 | Glutaminase kidney isoform, mitochondrial (GLS) | |||||
| LDTP05481 | Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 1 (GFPT1) | |||||
| LDTP04135 | Glutamine--tRNA ligase (QARS1) | |||||
| LDTP07399 | Glutamine-dependent NAD(+) synthetase (NADSYN1) | |||||
| LDTP12790 | Glutaminyl-peptide cyclotransferase-like protein (QPCTL) | |||||
| LDTP01374 | Glutaredoxin-3 (GLRX3) | |||||
| LDTP01771 | Glutathione reductase, mitochondrial (GSR) | |||||
| LDTP04200 | Glutathione synthetase (GSS) | |||||
| LDTP02038 | Glyceraldehyde-3-phosphate dehydrogenase (GAPDH) | |||||
| LDTP08814 | Glycerol-3-phosphate dehydrogenase 1-like protein (GPD1L) | |||||
| LDTP04032 | Glycerol-3-phosphate dehydrogenase, mitochondrial (GPD2) | |||||
| LDTP00089 | Glycerol-3-phosphate phosphatase (PGP) | |||||
| LDTP03946 | Glycine--tRNA ligase (GARS1) | |||||
| LDTP02552 | Glycogen phosphorylase, brain form (PYGB) | |||||
| LDTP02161 | Glycogen phosphorylase, liver form (PYGL) | |||||
| LDTP02696 | Glycogen [starch] synthase, muscle (GYS1) | |||||
| LDTP13145 | Glyoxylate reductase/hydroxypyruvate reductase (GRHPR) | |||||
| LDTP04333 | GMP synthase [glutamine-hydrolyzing] (GMPS) | |||||
| LDTP12763 | Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase (BPNT2) | |||||
| LDTP09835 | GPI-anchor transamidase (PIGK) | |||||
| LDTP12260 | GPN-loop GTPase 1 (GPN1) | |||||
| LDTP16204 | GPN-loop GTPase 3 (GPN3) | |||||
| LDTP05007 | GTP-binding nuclear protein Ran (RAN) | |||||
| LDTP14415 | GTP-binding protein 1 (GTPBP1) | |||||
| LDTP00062 | GTP-binding protein 10 (GTPBP10) | |||||
| LDTP01275 | GTPase Era, mitochondrial (ERAL1) | |||||
| LDTP14676 | Guanine nucleotide-binding protein-like 1 (GNL1) | |||||
| LDTP18330 | Haloacid dehalogenase-like hydrolase domain-containing 5 (HDHD5) | |||||
| LDTP02541 | Heat shock cognate 71 kDa protein (HSPA8) | |||||
| LDTP02225 | Heat shock protein HSP 90-alpha (HSP90AA1) | |||||
| LDTP07931 | Heme A synthase COX15 (COX15) | |||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | |||||
| LDTP00479 | Histone acetyltransferase type B catalytic subunit (HAT1) | |||||
| LDTP05918 | Histone deacetylase 1 (HDAC1) | |||||
| LDTP09865 | Histone deacetylase 2 (HDAC2) | |||||
| LDTP12743 | Histone PARylation factor 1 (HPF1) | |||||
| LDTP08352 | Histone-arginine methyltransferase CARM1 (CARM1) | |||||
| LDTP09186 | Histone-lysine N-methyltransferase 2C (KMT2C) | |||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | |||||
| LDTP05301 | Hydroxymethylglutaryl-CoA synthase, cytoplasmic (HMGCS1) | |||||
| LDTP07762 | Hydroxysteroid dehydrogenase-like protein 2 (HSDL2) | |||||
| LDTP19838 | Immunity-related GTPase family Q protein (IRGQ) | |||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | |||||
| LDTP14854 | Inorganic pyrophosphatase (PPA1) | |||||
| LDTP00413 | Inositol monophosphatase 2 (IMPA2) | |||||
| LDTP02743 | Insulin-degrading enzyme (IDE) | |||||
| LDTP08436 | Interferon regulatory factor 2-binding protein 1 (IRF2BP1) | |||||
| LDTP13488 | Isobutyryl-CoA dehydrogenase, mitochondrial (ACAD8) | |||||
| LDTP01333 | Isocitrate dehydrogenase [NADP] cytoplasmic (IDH1) | |||||
| LDTP04345 | Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial (IDH3A) | |||||
| LDTP00885 | Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial (IDH3B) | |||||
| LDTP04423 | Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial (IDH3G) | |||||
| LDTP12588 | Isoleucine--tRNA ligase, mitochondrial (IARS2) | |||||
| LDTP16025 | Ketosamine-3-kinase (FN3KRP) | |||||
| LDTP04519 | Kinesin-like protein KIF11 (KIF11) | |||||
| LDTP08286 | Kinesin-like protein KIF27 (KIF27) | |||||
| LDTP00188 | Kinesin-like protein KIF2A (KIF2A) | |||||
| LDTP10935 | Kinesin-like protein KIF2C (KIF2C) | |||||
| LDTP11309 | Kinesin-like protein KIFC1 (KIFC1) | |||||
| LDTP12524 | L-aminoadipate-semialdehyde dehydrogenase-phosphopantetheinyl transferase (AASDHPPT) | |||||
| LDTP01766 | L-lactate dehydrogenase A chain (LDHA) | |||||
| LDTP02179 | L-lactate dehydrogenase B chain (LDHB) | |||||
| LDTP12835 | Large ribosomal subunit protein mL39 (MRPL39) | |||||
| LDTP13429 | Lariat debranching enzyme (DBR1) | |||||
| LDTP13337 | Leucine carboxyl methyltransferase 1 (LCMT1) | |||||
| LDTP13056 | Leucine--tRNA ligase, cytoplasmic (LARS1) | |||||
| LDTP15404 | Leucine-rich repeat-containing protein 47 (LRRC47) | |||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | |||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | |||||
| LDTP00496 | Long-chain fatty acid transport protein 2 (SLC27A2) | |||||
| LDTP07511 | Long-chain fatty acid transport protein 4 (SLC27A4) | |||||
| LDTP00982 | Long-chain-fatty-acid--CoA ligase 4 (ACSL4) | |||||
| LDTP04104 | Lys-63-specific deubiquitinase BRCC36 (BRCC3) | |||||
| LDTP06294 | Lysine--tRNA ligase (KARS1) | |||||
| LDTP07982 | Lysine-specific demethylase 3B (KDM3B) | |||||
| LDTP00957 | Lysine-specific histone demethylase 1A (KDM1A) | |||||
| LDTP07967 | Lysophosphatidylcholine acyltransferase 2 (LPCAT2) | |||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | |||||
| LDTP00338 | Lysosomal alpha-mannosidase (MAN2B1) | |||||
| LDTP10163 | m7GpppX diphosphatase (DCPS) | |||||
| LDTP03907 | Malate dehydrogenase, cytoplasmic (MDH1) | |||||
| LDTP03908 | Malate dehydrogenase, mitochondrial (MDH2) | |||||
| LDTP08512 | Malonyl-CoA-acyl carrier protein transacylase, mitochondrial (MCAT) | |||||
| LDTP14141 | Mannose-1-phosphate guanyltransferase beta (GMPPB) | |||||
| LDTP12893 | Maspardin (SPG21) | |||||
| LDTP12915 | Methionine adenosyltransferase 2 subunit beta (MAT2B) | |||||
| LDTP04565 | Methionine aminopeptidase 1 (METAP1) | |||||
| LDTP04730 | Methionine--tRNA ligase, cytoplasmic (MARS1) | |||||
| LDTP10776 | Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial (MCCC1) | |||||
| LDTP10368 | Methylthioribulose-1-phosphate dehydratase (APIP) | |||||
| LDTP06810 | Mitochondrial import inner membrane translocase subunit TIM50 (TIMM50) | |||||
| LDTP10981 | Mitochondrial intermediate peptidase (MIPEP) | |||||
| LDTP01284 | Mitochondrial tRNA-specific 2-thiouridylase 1 (TRMU) | |||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | |||||
| LDTP01503 | Mitofusin-2 (MFN2) | |||||
| LDTP03445 | Mitogen-activated protein kinase 1 (MAPK1) | |||||
| LDTP01005 | Multifunctional procollagen lysine hydroxylase and glycosyltransferase LH3 (PLOD3) | |||||
| LDTP02094 | Myeloperoxidase (MPO) | |||||
| LDTP12154 | MYG1 exonuclease (MYG1) | |||||
| LDTP03764 | Myosin-9 (MYH9) | |||||
| LDTP08164 | N-acetylgalactosaminyltransferase 7 (GALNT7) | |||||
| LDTP06262 | N-alpha-acetyltransferase 25, NatB auxiliary subunit (NAA25) | |||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | |||||
| LDTP03220 | NAD-dependent malic enzyme, mitochondrial (ME2) | |||||
| LDTP12771 | NAD-dependent protein deacylase sirtuin-5, mitochondrial (SIRT5) | |||||
| LDTP06631 | NADH dehydrogenase 1 alpha subcomplex subunit 9, mitochondrial (NDUFA9) | |||||
| LDTP13303 | NADH-cytochrome b5 reductase 1 (CYB5R1) | |||||
| LDTP01770 | NADH-cytochrome b5 reductase 3 (CYB5R3) | |||||
| LDTP01985 | NADH-ubiquinone oxidoreductase chain 4 (MT-ND4) | |||||
| LDTP01986 | NADH-ubiquinone oxidoreductase chain 5 (MT-ND5) | |||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | |||||
| LDTP11494 | Neurolysin, mitochondrial (NLN) | |||||
| LDTP06192 | Neutral alpha-glucosidase AB (GANAB) | |||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | |||||
| LDTP07750 | Nicotinate phosphoribosyltransferase (NAPRT) | |||||
| LDTP06346 | Nicotinate-nucleotide pyrophosphorylase [carboxylating] (QPRT) | |||||
| LDTP13940 | Nitric oxide synthase-interacting protein (NOSIP) | |||||
| LDTP12190 | NmrA-like family domain-containing protein 1 (NMRAL1) | |||||
| LDTP12469 | Nucleolar RNA helicase 2 (DDX21) | |||||
| LDTP02796 | Nucleoside diphosphate kinase A (NME1) | |||||
| LDTP12610 | Obg-like ATPase 1 (OLA1) | |||||
| LDTP12428 | Omega-amidase NIT2 (NIT2) | |||||
| LDTP09070 | Outer mitochondrial transmembrane helix translocase (ATAD1) | |||||
| LDTP03813 | Oxygen-dependent coproporphyrinogen-III oxidase, mitochondrial (CPOX) | |||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | |||||
| LDTP05573 | Peptidyl-prolyl cis-trans isomerase D (PPID) | |||||
| LDTP05255 | Peptidyl-prolyl cis-trans isomerase FKBP3 (FKBP3) | |||||
| LDTP05372 | Peptidyl-prolyl cis-trans isomerase FKBP4 (FKBP4) | |||||
| LDTP05877 | Peptidyl-prolyl cis-trans isomerase FKBP5 (FKBP5) | |||||
| LDTP15620 | Peptidyl-prolyl cis-trans isomerase-like 4 (PPIL4) | |||||
| LDTP05773 | Peroxiredoxin-4 (PRDX4) | |||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | |||||
| LDTP13831 | Phenylalanine--tRNA ligase alpha subunit (FARSA) | |||||
| LDTP12586 | Phenylalanine--tRNA ligase beta subunit (FARSB) | |||||
| LDTP10144 | Phosphatidate cytidylyltransferase, mitochondrial (TAMM41) | |||||
| LDTP09895 | Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 1 (INPP5D) | |||||
| LDTP00252 | Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform (PIK3CD) | |||||
| LDTP03981 | Phosphatidylinositol 4-kinase alpha (PI4KA) | |||||
| LDTP05104 | Phosphatidylinositol 5-phosphate 4-kinase type-2 beta (PIP4K2B) | |||||
| LDTP09355 | Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma (PIP4K2C) | |||||
| LDTP01787 | Phosphoglycerate kinase 1 (PGK1) | |||||
| LDTP02774 | Phosphoglycerate mutase 2 (PGAM2) | |||||
| LDTP12120 | Phosphopantothenate--cysteine ligase (PPCS) | |||||
| LDTP10326 | Phosphopentomutase (PGM2) | |||||
| LDTP06146 | Phosphoribosyl pyrophosphate synthase-associated protein 1 (PRPSAP1) | |||||
| LDTP00927 | Phosphoribosyl pyrophosphate synthase-associated protein 2 (PRPSAP2) | |||||
| LDTP18130 | Phosphotriesterase-related protein (PTER) | |||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | |||||
| LDTP11453 | Polycomb group RING finger protein 6 (PCGF6) | |||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | |||||
| LDTP09955 | Polyribonucleotide 5'-hydroxyl-kinase Clp1 (CLP1) | |||||
| LDTP09390 | Polyribonucleotide nucleotidyltransferase 1, mitochondrial (PNPT1) | |||||
| LDTP13623 | Pre-mRNA-processing factor 19 (PRPF19) | |||||
| LDTP14888 | Pre-rRNA-processing protein TSR1 homolog (TSR1) | |||||
| LDTP00845 | Probable 18S rRNA (guanine-N(7))-methyltransferase (BUD23) | |||||
| LDTP04084 | Probable 28S rRNA (cytosine(4447)-C(5))-methyltransferase (NOP2) | |||||
| LDTP09899 | Probable ATP-dependent RNA helicase DDX17 (DDX17) | |||||
| LDTP13285 | Probable ATP-dependent RNA helicase DDX20 (DDX20) | |||||
| LDTP11248 | Probable ATP-dependent RNA helicase DDX23 (DDX23) | |||||
| LDTP13401 | Probable ATP-dependent RNA helicase DDX41 (DDX41) | |||||
| LDTP11730 | Probable ATP-dependent RNA helicase DDX47 (DDX47) | |||||
| LDTP16335 | Probable ATP-dependent RNA helicase DDX49 (DDX49) | |||||
| LDTP03348 | Probable ATP-dependent RNA helicase DDX6 (DDX6) | |||||
| LDTP01647 | Probable bifunctional dTTP/UTP pyrophosphatase/methyltransferase protein (ASMTL) | |||||
| LDTP16026 | Probable cysteine--tRNA ligase, mitochondrial (CARS2) | |||||
| LDTP13673 | Probable dimethyladenosine transferase (DIMT1) | |||||
| LDTP12742 | Probable tRNA(His) guanylyltransferase (THG1L) | |||||
| LDTP09055 | Procollagen galactosyltransferase 1 (COLGALT1) | |||||
| LDTP05373 | Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 (PLOD1) | |||||
| LDTP13750 | Proliferation-associated protein 2G4 (PA2G4) | |||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | |||||
| LDTP08883 | Prolyl 3-hydroxylase OGFOD1 (OGFOD1) | |||||
| LDTP04163 | Prolyl endopeptidase (PREP) | |||||
| LDTP06849 | Prolyl endopeptidase-like (PREPL) | |||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | |||||
| LDTP03330 | Proteasome subunit alpha type-1 (PSMA1) | |||||
| LDTP03331 | Proteasome subunit alpha type-2 (PSMA2) | |||||
| LDTP03332 | Proteasome subunit alpha type-3 (PSMA3) | |||||
| LDTP03413 | Proteasome subunit alpha type-5 (PSMA5) | |||||
| LDTP10862 | Proteasome subunit beta type-7 (PSMB7) | |||||
| LDTP00418 | Protein arginine N-methyltransferase 5 (PRMT5) | |||||
| LDTP10538 | Protein arginine N-methyltransferase 6 (PRMT6) | |||||
| LDTP13492 | Protein argonaute-2 (AGO2) | |||||
| LDTP02188 | Protein disulfide-isomerase (P4HB) | |||||
| LDTP03521 | Protein disulfide-isomerase A3 (PDIA3) | |||||
| LDTP02677 | Protein disulfide-isomerase A4 (PDIA4) | |||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | |||||
| LDTP03960 | Protein kinase C iota type (PRKCI) | |||||
| LDTP03788 | Protein phosphatase 1A (PPM1A) | |||||
| LDTP01292 | Protein phosphatase 1B (PPM1B) | |||||
| LDTP00616 | Protein phosphatase 1G (PPM1G) | |||||
| LDTP19609 | Protein prenyltransferase alpha subunit repeat-containing protein 1 (PTAR1) | |||||
| LDTP10709 | Pseudouridylate synthase 7 homolog (PUS7) | |||||
| LDTP09649 | Pseudouridylate synthase TRUB1 (TRUB1) | |||||
| LDTP01781 | Purine nucleoside phosphorylase (PNP) | |||||
| LDTP07110 | Putative transferase CAF17, mitochondrial (IBA57) | |||||
| LDTP00343 | Pyridoxal kinase (PDXK) | |||||
| LDTP10159 | Pyrroline-5-carboxylate reductase 2 (PYCR2) | |||||
| LDTP02549 | Pyruvate dehydrogenase E1 component subunit beta, mitochondrial (PDHB) | |||||
| LDTP00253 | Pyruvate dehydrogenase protein X component, mitochondrial (PDHX) | |||||
| LDTP02733 | Pyruvate kinase PKM (PKM) | |||||
| LDTP12080 | Queuine tRNA-ribosyltransferase accessory subunit 2 (QTRT2) | |||||
| LDTP05551 | Quinone oxidoreductase (CRYZ) | |||||
| LDTP05812 | Ras GTPase-activating protein-binding protein 1 (G3BP1) | |||||
| LDTP12166 | Ras-related GTP-binding protein C (RRAGC) | |||||
| LDTP09921 | Regulator of nonsense transcripts 1 (UPF1) | |||||
| LDTP03910 | Replication factor C subunit 5 (RFC5) | |||||
| LDTP09364 | Retinol dehydrogenase 11 (RDH11) | |||||
| LDTP09061 | Retinol dehydrogenase 13 (RDH13) | |||||
| LDTP12180 | Retinol dehydrogenase 14 (RDH14) | |||||
| LDTP05881 | Rho-associated protein kinase 1 (ROCK1) | |||||
| LDTP01311 | Ribonuclease H2 subunit A (RNASEH2A) | |||||
| LDTP07175 | Ribonuclease H2 subunit B (RNASEH2B) | |||||
| LDTP05099 | Ribonuclease P protein subunit p38 (RPP38) | |||||
| LDTP03259 | Ribonucleoside-diphosphate reductase large subunit (RRM1) | |||||
| LDTP03592 | Ribonucleoside-diphosphate reductase subunit M2 (RRM2) | |||||
| LDTP04236 | Ribose-5-phosphate isomerase (RPIA) | |||||
| LDTP04882 | Ribose-phosphate pyrophosphokinase 1 (PRPS1) | |||||
| LDTP02592 | Ribose-phosphate pyrophosphokinase 2 (PRPS2) | |||||
| LDTP08451 | Ribosomal oxygenase 2 (RIOX2) | |||||
| LDTP04471 | Ribosomal protein S6 kinase alpha-3 (RPS6KA3) | |||||
| LDTP06188 | Ribosome biogenesis protein BMS1 homolog (BMS1) | |||||
| LDTP10030 | Ribosome-releasing factor 2, mitochondrial (GFM2) | |||||
| LDTP11690 | RNA cytidine acetyltransferase (NAT10) | |||||
| LDTP05588 | RNA cytosine C(5)-methyltransferase NSUN2 (NSUN2) | |||||
| LDTP07547 | RNA demethylase ALKBH5 (ALKBH5) | |||||
| LDTP11639 | RNA exonuclease 4 (REXO4) | |||||
| LDTP00946 | RNA helicase aquarius (AQR) | |||||
| LDTP19750 | RNA ligase 1 (RLIG1) | |||||
| LDTP12315 | RNA polymerase II subunit A C-terminal domain phosphatase SSU72 (SSU72) | |||||
| LDTP13992 | RNA-splicing ligase RtcB homolog (RTCB) | |||||
| LDTP07416 | rRNA methyltransferase 1, mitochondrial (MRM1) | |||||
| LDTP13816 | RuvB-like 1 (RUVBL1) | |||||
| LDTP13787 | RuvB-like 2 (RUVBL2) | |||||
| LDTP03577 | S-adenosylmethionine synthase isoform type-2 (MAT2A) | |||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | |||||
| LDTP09976 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 (ATP2A3) | |||||
| LDTP14311 | SEC23-interacting protein (SEC23IP) | |||||
| LDTP04328 | Selenide, water dikinase 1 (SEPHS1) | |||||
| LDTP10917 | Selenide, water dikinase 2 (SEPHS2) | |||||
| LDTP10406 | Selenocysteine lyase (SCLY) | |||||
| LDTP14723 | Selenocysteine-specific elongation factor (EEFSEC) | |||||
| LDTP06279 | Septin-2 (SEPTIN2) | |||||
| LDTP13272 | Septin-9 (SEPTIN9) | |||||
| LDTP03688 | Serine hydroxymethyltransferase, cytosolic (SHMT1) | |||||
| LDTP03689 | Serine hydroxymethyltransferase, mitochondrial (SHMT2) | |||||
| LDTP00773 | Serine protease HTRA2, mitochondrial (HTRA2) | |||||
| LDTP05776 | Serine/threonine-protein kinase PAK 2 (PAK2) | |||||
| LDTP13455 | Serine/threonine-protein kinase tousled-like 1 (TLK1) | |||||
| LDTP05046 | Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform (PPP2R2A) | |||||
| LDTP15060 | Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform (PPP2R2D) | |||||
| LDTP06546 | Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform (PPP2R5E) | |||||
| LDTP05841 | Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform (PPP2R5C) | |||||
| LDTP03522 | Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform (PPP2R1A) | |||||
| LDTP04998 | Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform (PPP2CB) | |||||
| LDTP00333 | Serine/threonine-protein phosphatase 6 catalytic subunit (PPP6C) | |||||
| LDTP10399 | Serine/threonine-protein phosphatase PGAM5, mitochondrial (PGAM5) | |||||
| LDTP04959 | Serine/threonine-protein phosphatase PP1-alpha catalytic subunit (PPP1CA) | |||||
| LDTP04960 | Serine/threonine-protein phosphatase PP1-beta catalytic subunit (PPP1CB) | |||||
| LDTP03819 | Serine/threonine-protein phosphatase PP1-gamma catalytic subunit (PPP1CC) | |||||
| LDTP04072 | Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial (ACADSB) | |||||
| LDTP12473 | Sialic acid synthase (NANS) | |||||
| LDTP03223 | Small ribosomal subunit protein uS3 (RPS3) | |||||
| LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | |||||
| LDTP03008 | Spermidine synthase (SRM) | |||||
| LDTP00544 | Sphingolipid delta(4)-desaturase DES1 (DEGS1) | |||||
| LDTP05991 | Spliceosome RNA helicase DDX39B (DDX39B) | |||||
| LDTP03842 | Squalene synthase (FDFT1) | |||||
| LDTP07929 | Staphylococcal nuclease domain-containing protein 1 (SND1) | |||||
| LDTP00344 | Stearoyl-CoA desaturase (SCD) | |||||
| LDTP06455 | Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating (NSDHL) | |||||
| LDTP03572 | Succinate dehydrogenase flavoprotein subunit, mitochondrial (SDHA) | |||||
| LDTP04438 | Succinate-semialdehyde dehydrogenase, mitochondrial (ALDH5A1) | |||||
| LDTP14278 | Sulfide:quinone oxidoreductase, mitochondrial (SQOR) | |||||
| LDTP13107 | SUMO-activating enzyme subunit 1 (SAE1) | |||||
| LDTP13156 | SUMO-activating enzyme subunit 2 (UBA2) | |||||
| LDTP00931 | SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A member 5 (SMARCA5) | |||||
| LDTP10887 | Synaptic vesicle membrane protein VAT-1 homolog (VAT1) | |||||
| LDTP04428 | Thiopurine S-methyltransferase (TPMT) | |||||
| LDTP06620 | Thiosulfate sulfurtransferase (TST) | |||||
| LDTP03365 | Threonine--tRNA ligase 1, cytoplasmic (TARS1) | |||||
| LDTP02055 | Thymidylate synthase (TYMS) | |||||
| LDTP02006 | Tissue alpha-L-fucosidase (FUCA1) | |||||
| LDTP00399 | Torsin-1A (TOR1A) | |||||
| LDTP00400 | Torsin-1B (TOR1B) | |||||
| LDTP03847 | Transaldolase (TALDO1) | |||||
| LDTP05240 | Transcription initiation factor IIB (GTF2B) | |||||
| LDTP05808 | Transcription intermediary factor 1-beta (TRIM28) | |||||
| LDTP04665 | Transitional endoplasmic reticulum ATPase (VCP) | |||||
| LDTP03487 | Transketolase (TKT) | |||||
| LDTP04093 | Translation initiation factor IF-2, mitochondrial (MTIF2) | |||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | |||||
| LDTP04671 | Trifunctional enzyme subunit beta, mitochondrial (HADHB) | |||||
| LDTP03156 | Trifunctional purine biosynthetic protein adenosine-3 (GART) | |||||
| LDTP04851 | Triosephosphate isomerase (TPI1) | |||||
| LDTP03469 | Tripeptidyl-peptidase 2 (TPP2) | |||||
| LDTP15236 | TRMT1-like protein (TRMT1L) | |||||
| LDTP10320 | tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A (TRMT61A) | |||||
| LDTP06751 | tRNA (guanine(37)-N1)-methyltransferase (TRMT5) | |||||
| LDTP13140 | tRNA (guanine-N(7)-)-methyltransferase (METTL1) | |||||
| LDTP08687 | tRNA (uracil-5-)-methyltransferase homolog A (TRMT2A) | |||||
| LDTP07937 | tRNA methyltransferase 10 homolog C (TRMT10C) | |||||
| LDTP07515 | tRNA N(3)-methylcytidine methyltransferase METTL2B (METTL2B) | |||||
| LDTP12354 | tRNA N6-adenosine threonylcarbamoyltransferase (OSGEP) | |||||
| LDTP03222 | Tryptophan--tRNA ligase, cytoplasmic (WARS1) | |||||
| LDTP13238 | Tryptophan--tRNA ligase, mitochondrial (WARS2) | |||||
| LDTP11074 | Tubulin alpha-1C chain (TUBA1C) | |||||
| LDTP05075 | Tubulin alpha-4A chain (TUBA4A) | |||||
| LDTP06067 | Tubulin--tyrosine ligase-like protein 12 (TTLL12) | |||||
| LDTP04617 | Tyrosine--tRNA ligase, cytoplasmic (YARS1) | |||||
| LDTP05478 | Tyrosine-protein kinase BTK (BTK) | |||||
| LDTP02232 | Tyrosine-protein kinase Lyn (LYN) | |||||
| LDTP04048 | Tyrosine-protein kinase SYK (SYK) | |||||
| LDTP02935 | Tyrosine-protein phosphatase non-receptor type 1 (PTPN1) | |||||
| LDTP05475 | Tyrosine-protein phosphatase non-receptor type 11 (PTPN11) | |||||
| LDTP02917 | Tyrosine-protein phosphatase non-receptor type 2 (PTPN2) | |||||
| LDTP03478 | Tyrosine-protein phosphatase non-receptor type 6 (PTPN6) | |||||
| LDTP03718 | Tyrosine-protein phosphatase non-receptor type 7 (PTPN7) | |||||
| LDTP01629 | Tyrosyl-DNA phosphodiesterase 2 (TDP2) | |||||
| LDTP01283 | U5 small nuclear ribonucleoprotein 200 kDa helicase (SNRNP200) | |||||
| LDTP09959 | Ubiquitin carboxyl-terminal hydrolase 13 (USP13) | |||||
| LDTP14051 | Ubiquitin carboxyl-terminal hydrolase 15 (USP15) | |||||
| LDTP04074 | Ubiquitin carboxyl-terminal hydrolase 5 (USP5) | |||||
| LDTP06047 | Ubiquitin conjugation factor E4 A (UBE4A) | |||||
| LDTP09060 | Ubiquitin-associated domain-containing protein 2 (UBAC2) | |||||
| LDTP08146 | Ubiquitin-conjugating enzyme E2 Q1 (UBE2Q1) | |||||
| LDTP04254 | Ubiquitin-conjugating enzyme E2 R1 (CDC34) | |||||
| LDTP07897 | Ubiquitin-conjugating enzyme E2 R2 (UBE2R2) | |||||
| LDTP09629 | Ubiquitin-like domain-containing CTD phosphatase 1 (UBLCP1) | |||||
| LDTP03166 | Ubiquitin-like modifier-activating enzyme 1 (UBA1) | |||||
| LDTP11675 | Ubiquitin-like modifier-activating enzyme 5 (UBA5) | |||||
| LDTP00013 | Ubiquitin-like modifier-activating enzyme 6 (UBA6) | |||||
| LDTP05446 | Ubiquitin-protein ligase E3A (UBE3A) | |||||
| LDTP06111 | UDP-glucose 4-epimerase (GALE) | |||||
| LDTP00601 | UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit (OGT) | |||||
| LDTP02643 | Uracil-DNA glycosylase (UNG) | |||||
| LDTP11571 | Uridine-cytidine kinase 2 (UCK2) | |||||
| LDTP02135 | Uroporphyrinogen decarboxylase (UROD) | |||||
| LDTP03859 | V-type proton ATPase catalytic subunit A (ATP6V1A) | |||||
| LDTP13639 | Vacuolar protein sorting-associated protein 4A (VPS4A) | |||||
| LDTP03366 | Valine--tRNA ligase (VARS1) | |||||
| LDTP11311 | Very long chain fatty acid elongase 1 (ELOVL1) | |||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | |||||
| LDTP07715 | WD repeat-containing protein 82 (WDR82) | |||||
| LDTP02642 | X-ray repair cross-complementing protein 5 (XRCC5) | |||||
| LDTP02640 | X-ray repair cross-complementing protein 6 (XRCC6) | |||||
| LDTP08666 | Xaa-Arg dipeptidase (PM20D2) | |||||
| LDTP09053 | Xyloside xylosyltransferase 1 (XXYLT1) | |||||
| LDTP11054 | Zinc phosphodiesterase ELAC protein 2 (ELAC2) | |||||
Transporter and channel
| Target ID | Target Name | |||||
|---|---|---|---|---|---|---|
| LDTP04969 | 14-3-3 protein epsilon (YWHAE) | |||||
| LDTP04953 | 14-3-3 protein gamma (YWHAG) | |||||
| LDTP03385 | 14-3-3 protein theta (YWHAQ) | |||||
| LDTP05043 | 14-3-3 protein zeta/delta (YWHAZ) | |||||
| LDTP01601 | Activator of 90 kDa heat shock protein ATPase homolog 1 (AHSA1) | |||||
| LDTP16115 | Adaptin ear-binding coat-associated protein 2 (NECAP2) | |||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | |||||
| LDTP02087 | ADP/ATP translocase 2 (SLC25A5) | |||||
| LDTP07564 | Alpha- and gamma-adaptin-binding protein p34 (AAGAB) | |||||
| LDTP02010 | Annexin A1 (ANXA1) | |||||
| LDTP04393 | Annexin A11 (ANXA11) | |||||
| LDTP02307 | Annexin A5 (ANXA5) | |||||
| LDTP02247 | Annexin A6 (ANXA6) | |||||
| LDTP06855 | Anoctamin-6 (ANO6) | |||||
| LDTP00855 | AP-1 complex subunit gamma-1 (AP1G1) | |||||
| LDTP01673 | AP-2 complex subunit alpha-1 (AP2A1) | |||||
| LDTP01477 | AP-2 complex subunit alpha-2 (AP2A2) | |||||
| LDTP01936 | Apolipoprotein E (APOE) | |||||
| LDTP03327 | ATP synthase subunit alpha, mitochondrial (ATP5F1A) | |||||
| LDTP12517 | ATP-binding cassette sub-family B member 10, mitochondrial (ABCB10) | |||||
| LDTP09149 | ATP-binding cassette sub-family F member 1 (ABCF1) | |||||
| LDTP18526 | ATP-binding cassette sub-family F member 2 (ABCF2) | |||||
| LDTP04426 | B-cell receptor-associated protein 31 (BCAP31) | |||||
| LDTP05631 | Bone marrow stromal antigen 2 (BST2) | |||||
| LDTP10036 | BOS complex subunit NCLN (NCLN) | |||||
| LDTP08673 | Calcium uptake protein 2, mitochondrial (MICU2) | |||||
| LDTP03405 | Calnexin (CANX) | |||||
| LDTP03402 | Calreticulin (CALR) | |||||
| LDTP03061 | Cation-dependent mannose-6-phosphate receptor (M6PR) | |||||
| LDTP00244 | Chloride intracellular channel protein 1 (CLIC1) | |||||
| LDTP14222 | Chloride intracellular channel protein 4 (CLIC4) | |||||
| LDTP05252 | Clathrin heavy chain 1 (CLTC) | |||||
| LDTP06177 | Clathrin interactor 1 (CLINT1) | |||||
| LDTP02352 | Clathrin light chain A (CLTA) | |||||
| LDTP02353 | Clathrin light chain B (CLTB) | |||||
| LDTP05510 | Complement component 1 Q subcomponent-binding protein, mitochondrial (C1QBP) | |||||
| LDTP12793 | DnaJ homolog subfamily B member 12 (DNAJB12) | |||||
| LDTP02057 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 (RPN1) | |||||
| LDTP02058 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 (RPN2) | |||||
| LDTP01301 | Electrogenic aspartate/glutamate antiporter SLC25A12, mitochondrial (SLC25A12) | |||||
| LDTP13953 | Endophilin-B1 (SH3GLB1) | |||||
| LDTP10985 | Equilibrative nucleoside transporter 1 (SLC29A1) | |||||
| LDTP12661 | Exocyst complex component 1 (EXOC1) | |||||
| LDTP10069 | Exocyst complex component 4 (EXOC4) | |||||
| LDTP00501 | Exportin-1 (XPO1) | |||||
| LDTP04662 | Exportin-2 (CSE1L) | |||||
| LDTP12142 | Exportin-5 (XPO5) | |||||
| LDTP13335 | Exportin-7 (XPO7) | |||||
| LDTP00810 | Exportin-T (XPOT) | |||||
| LDTP11161 | Extended synaptotagmin-1 (ESYT1) | |||||
| LDTP07847 | FERM domain-containing protein 7 (FRMD7) | |||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | |||||
| LDTP04463 | H(+)/Cl(-) exchange transporter 7 (CLCN7) | |||||
| LDTP02262 | Heat shock protein HSP 90-beta (HSP90AB1) | |||||
| LDTP05084 | Hemoglobin subunit alpha (HBA1; HBA2) | |||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | |||||
| LDTP06549 | Hsp90 co-chaperone Cdc37 (CDC37) | |||||
| LDTP04501 | Importin subunit alpha-1 (KPNA2) | |||||
| LDTP00328 | Importin subunit alpha-3 (KPNA4) | |||||
| LDTP06242 | Importin subunit beta-1 (KPNB1) | |||||
| LDTP13322 | Importin-11 (IPO11) | |||||
| LDTP09515 | Importin-4 (IPO4) | |||||
| LDTP00266 | Importin-5 (IPO5) | |||||
| LDTP01574 | Importin-7 (IPO7) | |||||
| LDTP00630 | Importin-8 (IPO8) | |||||
| LDTP10663 | Importin-9 (IPO9) | |||||
| LDTP14461 | Integral membrane protein 2A (ITM2A) | |||||
| LDTP02994 | Leukocyte surface antigen CD53 (CD53) | |||||
| LDTP12636 | Lysosomal cobalamin transport escort protein LMBD1 (LMBRD1) | |||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | |||||
| LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | |||||
| LDTP11732 | Magnesium transporter protein 1 (MAGT1) | |||||
| LDTP04597 | Methylosome subunit pICln (CLNS1A) | |||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | |||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | |||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | |||||
| LDTP09038 | Mixed lineage kinase domain-like protein (MLKL) | |||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | |||||
| LDTP00635 | Monocarboxylate transporter 4 (SLC16A3) | |||||
| LDTP00419 | Na(+)/H(+) exchange regulatory cofactor NHE-RF1 (NHERF1) | |||||
| LDTP04013 | Neutral amino acid transporter A (SLC1A4) | |||||
| LDTP06462 | Neutral amino acid transporter B(0) (SLC1A5) | |||||
| LDTP05591 | Nuclear cap-binding protein subunit 1 (NCBP1) | |||||
| LDTP09579 | Nuclear pore complex protein Nup133 (NUP133) | |||||
| LDTP09825 | Nuclear pore complex protein Nup205 (NUP205) | |||||
| LDTP13498 | Nuclear pore complex protein Nup50 (NUP50) | |||||
| LDTP08769 | Nuclear pore complex protein Nup93 (NUP93) | |||||
| LDTP09502 | Nuclear pore membrane glycoprotein 210 (NUP210) | |||||
| LDTP09315 | Nuclear protein localization protein 4 homolog (NPLOC4) | |||||
| LDTP10256 | Nucleoporin SEH1 (SEH1L) | |||||
| LDTP02612 | Nucleoprotein TPR (TPR) | |||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | |||||
| LDTP04749 | Peroxisomal biogenesis factor 3 (PEX3) | |||||
| LDTP09948 | Peroxisomal membrane protein PEX13 (PEX13) | |||||
| LDTP04213 | Phosphatidylinositol transfer protein beta isoform (PITPNB) | |||||
| LDTP12043 | Phosphorylated adapter RNA export protein (PHAX) | |||||
| LDTP11855 | Pinin (PNN) | |||||
| LDTP02547 | Protein 4.1 (EPB41) | |||||
| LDTP04707 | Protein SEC13 homolog (SEC13) | |||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | |||||
| LDTP14274 | Proton-coupled zinc antiporter SLC30A1 (SLC30A1) | |||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | |||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | |||||
| LDTP04082 | Ran GTPase-activating protein 1 (RANGAP1) | |||||
| LDTP03952 | Reduced folate transporter (SLC19A1) | |||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | |||||
| LDTP00451 | Secretory carrier-associated membrane protein 3 (SCAMP3) | |||||
| LDTP12090 | Sideroflexin-1 (SFXN1) | |||||
| LDTP05057 | Small ribosomal subunit protein RACK1 (RACK1) | |||||
| LDTP01505 | Snurportin-1 (SNUPN) | |||||
| LDTP14184 | Sodium channel protein type 10 subunit alpha (SCN10A) | |||||
| LDTP09588 | Sodium-coupled neutral amino acid transporter 5 (SLC38A5) | |||||
| LDTP02544 | Solute carrier family 2, facilitated glucose transporter member 1 (SLC2A1) | |||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | |||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | |||||
| LDTP08817 | Solute carrier family 35 member F6 (SLC35F6) | |||||
| LDTP17162 | Solute carrier family 45 member 4 (SLC45A4) | |||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | |||||
| LDTP05938 | Sorting nexin-1 (SNX1) | |||||
| LDTP06288 | Sorting nexin-17 (SNX17) | |||||
| LDTP01043 | Sorting nexin-2 (SNX2) | |||||
| LDTP14174 | Sorting nexin-5 (SNX5) | |||||
| LDTP05273 | Spectrin beta chain, non-erythrocytic 1 (SPTBN1) | |||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | |||||
| LDTP03380 | Stomatin (STOM) | |||||
| LDTP13416 | Stomatin-like protein 2, mitochondrial (STOML2) | |||||
| LDTP13256 | SUN domain-containing protein 2 (SUN2) | |||||
| LDTP05667 | Syntaxin-4 (STX4) | |||||
| LDTP04391 | T-complex protein 1 subunit delta (CCT4) | |||||
| LDTP14031 | Talin-1 (TLN1) | |||||
| LDTP08274 | THO complex subunit 4 (ALYREF) | |||||
| LDTP08315 | THO complex subunit 6 homolog (THOC6) | |||||
| LDTP13243 | Translocation protein SEC63 homolog (SEC63) | |||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | |||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | |||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | |||||
| LDTP07477 | Transmembrane protein 214 (TMEM214) | |||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | |||||
| LDTP09949 | Transportin-1 (TNPO1) | |||||
| LDTP07779 | Tripartite motif-containing protein 72 (TRIM72) | |||||
| LDTP11916 | Tubulin beta-1 chain (TUBB1) | |||||
| LDTP01568 | Ubiquitin-like modifier-activating enzyme ATG7 (ATG7) | |||||
| LDTP15581 | Uncharacterized protein CXorf38 (CXorf38) | |||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | |||||
| LDTP03104 | V-type proton ATPase subunit B, brain isoform (ATP6V1B2) | |||||
| LDTP03105 | V-type proton ATPase subunit C 1 (ATP6V1C1) | |||||
| LDTP03811 | V-type proton ATPase subunit E 1 (ATP6V1E1) | |||||
| LDTP01185 | V-type proton ATPase subunit G 1 (ATP6V1G1) | |||||
| LDTP13319 | V-type proton ATPase subunit H (ATP6V1H) | |||||
| LDTP01218 | Vacuolar protein sorting-associated protein 26A (VPS26A) | |||||
| LDTP17131 | Vacuolar protein sorting-associated protein 26B (VPS26B) | |||||
| LDTP05690 | Vesicular integral-membrane protein VIP36 (LMAN2) | |||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | |||||
| LDTP06197 | Voltage-gated potassium channel subunit beta-1 (KCNAB1) | |||||
| LDTP05817 | Voltage-gated potassium channel subunit beta-2 (KCNAB2) | |||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | |||||
Transcription factor
| Target ID | Target Name | |||||
|---|---|---|---|---|---|---|
| LDTP11834 | Activity-dependent neuroprotector homeobox protein (ADNP) | |||||
| LDTP10995 | AT-rich interactive domain-containing protein 3A (ARID3A) | |||||
| LDTP12792 | CDKN2A-interacting protein (CDKN2AIP) | |||||
| LDTP10868 | Cell division cycle 5-like protein (CDC5L) | |||||
| LDTP05577 | FACT complex subunit SSRP1 (SSRP1) | |||||
| LDTP05101 | General transcription factor II-I (GTF2I) | |||||
| LDTP10453 | Hypermethylated in cancer 2 protein (HIC2) | |||||
| LDTP08097 | Interferon regulatory factor 2-binding protein 2 (IRF2BP2) | |||||
| LDTP06748 | Leucine-rich repeat flightless-interacting protein 1 (LRRFIP1) | |||||
| LDTP03930 | Myeloid cell nuclear differentiation antigen (MNDA) | |||||
| LDTP06341 | Non-POU domain-containing octamer-binding protein (NONO) | |||||
| LDTP05883 | Nuclear factor of activated T-cells, cytoplasmic 2 (NFATC2) | |||||
| LDTP11322 | Replication initiator 1 (REPIN1) | |||||
| LDTP03969 | Signal transducer and activator of transcription 1-alpha/beta (STAT1) | |||||
| LDTP03903 | Signal transducer and activator of transcription 3 (STAT3) | |||||
| LDTP04454 | Signal transducer and activator of transcription 5B (STAT5B) | |||||
| LDTP03212 | Splicing factor, proline- and glutamine-rich (SFPQ) | |||||
| LDTP09932 | SWI/SNF complex subunit SMARCC1 (SMARCC1) | |||||
| LDTP10743 | Transcriptional regulator protein Pur-beta (PURB) | |||||
| LDTP06725 | Transcriptional regulator QRICH1 (QRICH1) | |||||
| LDTP04281 | Transcriptional repressor CTCF (CTCF) | |||||
| LDTP02402 | Zinc finger protein 688 (ZNF688) | |||||
GPCR
| Target ID | Target Name | |||||
|---|---|---|---|---|---|---|
| LDTP14360 | Olfactory receptor 51F1 (OR51F1) | |||||
Immunoglobulin
| Target ID | Target Name | |||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | |||||
| LDTP14203 | Junctional adhesion molecule A (F11R) | |||||
| LDTP17519 | Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 2 (LINGO2) | |||||
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | |||||
Cytokine and receptor
| Target ID | Target Name | |||||
|---|---|---|---|---|---|---|
| LDTP05757 | Protein Red (IK) | |||||
| LDTP14287 | Tumor necrosis factor receptor superfamily member 11A (TNFRSF11A) | |||||
Other
| Target ID | Target Name | |||||
|---|---|---|---|---|---|---|
| LDTP03617 | 14-3-3 protein beta/alpha (YWHAB) | |||||
| LDTP05442 | 14-3-3 protein eta (YWHAH) | |||||
| LDTP00849 | 17S U2 SnRNP complex component HTATSF1 (HTATSF1) | |||||
| LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | |||||
| LDTP09843 | Acidic leucine-rich nuclear phosphoprotein 32 family member B (ANP32B) | |||||
| LDTP11207 | Acidic leucine-rich nuclear phosphoprotein 32 family member E (ANP32E) | |||||
| LDTP14298 | Actin-binding protein WASF2 (WASF2) | |||||
| LDTP01756 | Actin-like protein 6A (ACTL6A) | |||||
| LDTP04903 | Actin-related protein 2 (ACTR2) | |||||
| LDTP15664 | Actin-related protein 2/3 complex subunit 1A (ARPC1A) | |||||
| LDTP00550 | Actin-related protein 2/3 complex subunit 1B (ARPC1B) | |||||
| LDTP00551 | Actin-related protein 2/3 complex subunit 2 (ARPC2) | |||||
| LDTP04902 | Actin-related protein 3 (ACTR3) | |||||
| LDTP09433 | Actin-related protein T1 (ACTRT1) | |||||
| LDTP13585 | Activator of basal transcription 1 (ABT1) | |||||
| LDTP15861 | Acyl-CoA-binding domain-containing protein 6 (ACBD6) | |||||
| LDTP05294 | Adenylyl cyclase-associated protein 1 (CAP1) | |||||
| LDTP02631 | Alpha-actinin-1 (ACTN1) | |||||
| LDTP00843 | Alpha-actinin-4 (ACTN4) | |||||
| LDTP13159 | Alpha-catulin (CTNNAL1) | |||||
| LDTP03886 | Alpha-taxilin (TXLNA) | |||||
| LDTP05687 | Aminoacyl tRNA synthase complex-interacting multifunctional protein 1 (AIMP1) | |||||
| LDTP05770 | Aminoacyl tRNA synthase complex-interacting multifunctional protein 2 (AIMP2) | |||||
| LDTP13412 | Anaphase-promoting complex subunit 2 (ANAPC2) | |||||
| LDTP13411 | Anaphase-promoting complex subunit 4 (ANAPC4) | |||||
| LDTP03030 | Annexin A7 (ANXA7) | |||||
| LDTP01327 | AP-1 complex subunit gamma-like 2 (AP1G2) | |||||
| LDTP07618 | Apolipoprotein A-V (APOA5) | |||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | |||||
| LDTP06302 | Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 (ACAP2) | |||||
| LDTP16118 | Arginine and glutamate-rich protein 1 (ARGLU1) | |||||
| LDTP12692 | Armadillo repeat-containing protein 1 (ARMC1) | |||||
| LDTP15002 | Armadillo-like helical domain-containing protein 3 (ARMH3) | |||||
| LDTP13091 | Ataxin-10 (ATXN10) | |||||
| LDTP09655 | Ataxin-2-like protein (ATXN2L) | |||||
| LDTP10128 | Axin interactor, dorsalization-associated protein (AIDA) | |||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | |||||
| LDTP14951 | Beta-actin-like protein 2 (ACTBL2) | |||||
| LDTP03612 | Bifunctional purine biosynthesis protein ATIC (ATIC) | |||||
| LDTP02687 | Bone marrow proteoglycan (PRG2) | |||||
| LDTP05081 | BOS complex subunit NOMO3 (NOMO3) | |||||
| LDTP13030 | BRCA2 and CDKN1A-interacting protein (BCCIP) | |||||
| LDTP12788 | BRISC and BRCA1-A complex member 2 (BABAM2) | |||||
| LDTP06278 | BRISC complex subunit Abraxas 2 (ABRAXAS2) | |||||
| LDTP06304 | Bromodomain-containing protein 3 (BRD3) | |||||
| LDTP15705 | BTB/POZ domain-containing protein KCTD12 (KCTD12) | |||||
| LDTP10814 | BTB/POZ domain-containing protein KCTD15 (KCTD15) | |||||
| LDTP09151 | Calcium uniporter protein, mitochondrial (MCU) | |||||
| LDTP13955 | Calcium-binding protein 39 (CAB39) | |||||
| LDTP02697 | cAMP-dependent protein kinase type II-alpha regulatory subunit (PRKAR2A) | |||||
| LDTP06121 | Caprin-1 (CAPRIN1) | |||||
| LDTP03143 | Cartilage matrix protein (MATN1) | |||||
| LDTP00078 | CCR4-NOT transcription complex subunit 1 (CNOT1) | |||||
| LDTP12087 | CCR4-NOT transcription complex subunit 10 (CNOT10) | |||||
| LDTP08760 | Cell cycle and apoptosis regulator protein 2 (CCAR2) | |||||
| LDTP04258 | Centromere protein F (CENPF) | |||||
| LDTP00720 | Centromere/kinetochore protein zw10 homolog (ZW10) | |||||
| LDTP11435 | Charged multivesicular body protein 4a (CHMP4A) | |||||
| LDTP12948 | Charged multivesicular body protein 5 (CHMP5) | |||||
| LDTP01085 | Checkpoint protein HUS1 (HUS1) | |||||
| LDTP05751 | Chromatin assembly factor 1 subunit B (CHAF1B) | |||||
| LDTP04781 | Cilia- and flagella-associated protein 298 (CFAP298) | |||||
| LDTP15365 | Cilia- and flagella-associated protein 46 (CFAP46) | |||||
| LDTP14812 | Cleavage stimulation factor subunit 1 (CSTF1) | |||||
| LDTP05719 | Cleavage stimulation factor subunit 3 (CSTF3) | |||||
| LDTP04570 | Coatomer subunit beta (COPB1) | |||||
| LDTP03767 | Coatomer subunit beta' (COPB2) | |||||
| LDTP04181 | Coatomer subunit delta (ARCN1) | |||||
| LDTP14216 | Coatomer subunit gamma-1 (COPG1) | |||||
| LDTP10187 | Coiled-coil domain-containing protein 124 (CCDC124) | |||||
| LDTP08507 | Coiled-coil domain-containing protein 50 (CCDC50) | |||||
| LDTP06515 | Coiled-coil domain-containing protein 6 (CCDC6) | |||||
| LDTP01252 | Cold shock domain-containing protein E1 (CSDE1) | |||||
| LDTP16123 | COMM domain-containing protein 8 (COMMD8) | |||||
| LDTP06281 | Condensin complex subunit 1 (NCAPD2) | |||||
| LDTP11040 | Condensin complex subunit 3 (NCAPG) | |||||
| LDTP13689 | Conserved oligomeric Golgi complex subunit 5 (COG5) | |||||
| LDTP01195 | Core histone macro-H2A.1 (MACROH2A1) | |||||
| LDTP03573 | Coronin-1A (CORO1A) | |||||
| LDTP11101 | Coronin-1B (CORO1B) | |||||
| LDTP04092 | Crk-like protein (CRKL) | |||||
| LDTP11901 | CUE domain-containing protein 2 (CUEDC2) | |||||
| LDTP15066 | CWF19-like protein 1 (CWF19L1) | |||||
| LDTP01002 | Cyclin-T1 (CCNT1) | |||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | |||||
| LDTP13269 | Cysteine and histidine-rich domain-containing protein 1 (CHORDC1) | |||||
| LDTP10027 | Cytoplasmic 60S subunit biogenesis factor ZNF622 (ZNF622) | |||||
| LDTP06083 | Cytoplasmic dynein 1 heavy chain 1 (DYNC1H1) | |||||
| LDTP06021 | Cytoskeleton-associated protein 5 (CKAP5) | |||||
| LDTP04560 | Cytosolic Fe-S cluster assembly factor NUBP1 (NUBP1) | |||||
| LDTP12652 | DDB1- and CUL4-associated factor 13 (DCAF13) | |||||
| LDTP10403 | DDRGK domain-containing protein 1 (DDRGK1) | |||||
| LDTP09815 | Dedicator of cytokinesis protein 2 (DOCK2) | |||||
| LDTP11920 | Differentially expressed in FDCP 6 homolog (DEF6) | |||||
| LDTP00239 | DNA fragmentation factor subunit alpha (DFFA) | |||||
| LDTP04028 | DNA mismatch repair protein Msh2 (MSH2) | |||||
| LDTP04518 | DNA mismatch repair protein Msh6 (MSH6) | |||||
| LDTP06300 | DNA polymerase delta subunit 3 (POLD3) | |||||
| LDTP05497 | DNA repair protein RAD51 homolog 1 (RAD51) | |||||
| LDTP09791 | DNA topoisomerase 2-binding protein 1 (TOPBP1) | |||||
| LDTP03606 | DnaJ homolog subfamily A member 1 (DNAJA1) | |||||
| LDTP01073 | DnaJ homolog subfamily A member 2 (DNAJA2) | |||||
| LDTP10282 | DnaJ homolog subfamily A member 3, mitochondrial (DNAJA3) | |||||
| LDTP03325 | DnaJ homolog subfamily B member 1 (DNAJB1) | |||||
| LDTP13152 | DnaJ homolog subfamily B member 11 (DNAJB11) | |||||
| LDTP01158 | DnaJ homolog subfamily B member 6 (DNAJB6) | |||||
| LDTP18473 | DnaJ homolog subfamily C member 17 (DNAJC17) | |||||
| LDTP06967 | DnaJ homolog subfamily C member 21 (DNAJC21) | |||||
| LDTP11894 | DnaJ homolog subfamily C member 5 (DNAJC5) | |||||
| LDTP10920 | DnaJ homolog subfamily C member 7 (DNAJC7) | |||||
| LDTP00911 | Double-strand-break repair protein rad21 homolog (RAD21) | |||||
| LDTP13399 | Drebrin-like protein (DBNL) | |||||
| LDTP05922 | Dynactin subunit 2 (DCTN2) | |||||
| LDTP15788 | Dynein axonemal assembly factor 10 (DNAAF10) | |||||
| LDTP07193 | EF-hand calcium-binding domain-containing protein 6 (EFCAB6) | |||||
| LDTP06450 | ELAV-like protein 1 (ELAVL1) | |||||
| LDTP03367 | Elongation factor 1-gamma (EEF1G) | |||||
| LDTP04064 | Elongation factor Ts, mitochondrial (TSFM) | |||||
| LDTP07400 | Elongator complex protein 2 (ELP2) | |||||
| LDTP03509 | Endoplasmic reticulum resident protein 29 (ERP29) | |||||
| LDTP11144 | Endoplasmic reticulum resident protein 44 (ERP44) | |||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | |||||
| LDTP02734 | Endoplasmin (HSP90B1) | |||||
| LDTP09794 | Engulfment and cell motility protein 1 (ELMO1) | |||||
| LDTP07521 | Enhancer of mRNA-decapping protein 4 (EDC4) | |||||
| LDTP15997 | ESF1 homolog (ESF1) | |||||
| LDTP02101 | Eukaryotic translation initiation factor 2 subunit 1 (EIF2S1) | |||||
| LDTP03027 | Eukaryotic translation initiation factor 2 subunit 2 (EIF2S2) | |||||
| LDTP03928 | Eukaryotic translation initiation factor 2D (EIF2D) | |||||
| LDTP06055 | Eukaryotic translation initiation factor 3 subunit A (EIF3A) | |||||
| LDTP04718 | Eukaryotic translation initiation factor 3 subunit B (EIF3B) | |||||
| LDTP10919 | Eukaryotic translation initiation factor 3 subunit C (EIF3C) | |||||
| LDTP00619 | Eukaryotic translation initiation factor 3 subunit D (EIF3D) | |||||
| LDTP04853 | Eukaryotic translation initiation factor 3 subunit E (EIF3E) | |||||
| LDTP05834 | Eukaryotic translation initiation factor 3 subunit I (EIF3I) | |||||
| LDTP01320 | Eukaryotic translation initiation factor 3 subunit J (EIF3J) | |||||
| LDTP13813 | Eukaryotic translation initiation factor 3 subunit L (EIF3L) | |||||
| LDTP07947 | Eukaryotic translation initiation factor 3 subunit M (EIF3M) | |||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | |||||
| LDTP05993 | Exosome complex component RRP4 (EXOSC2) | |||||
| LDTP12434 | Exosome complex component RRP40 (EXOSC3) | |||||
| LDTP08376 | Extracellular matrix organizing protein FRAS1 (FRAS1) | |||||
| LDTP04544 | F-actin-capping protein subunit alpha-1 (CAPZA1) | |||||
| LDTP04126 | F-actin-capping protein subunit alpha-2 (CAPZA2) | |||||
| LDTP13993 | F-box only protein 7 (FBXO7) | |||||
| LDTP12680 | Fanconi anemia group I protein (FANCI) | |||||
| LDTP10078 | Far upstream element-binding protein 1 (FUBP1) | |||||
| LDTP06598 | Fascin (FSCN1) | |||||
| LDTP08263 | Fermitin family homolog 3 (FERMT3) | |||||
| LDTP03092 | Filaggrin (FLG) | |||||
| LDTP00205 | Galectin-9 (LGALS9) | |||||
| LDTP12183 | Gamma-parvin (PARVG) | |||||
| LDTP11159 | Gamma-tubulin complex component 2 (TUBGCP2) | |||||
| LDTP10191 | Gamma-tubulin complex component 3 (TUBGCP3) | |||||
| LDTP09324 | Ganglioside-induced differentiation-associated protein 1 (GDAP1) | |||||
| LDTP14148 | General transcription factor 3C polypeptide 3 (GTF3C3) | |||||
| LDTP14147 | General transcription factor 3C polypeptide 5 (GTF3C5) | |||||
| LDTP01048 | General vesicular transport factor p115 (USO1) | |||||
| LDTP12073 | Golgi reassembly-stacking protein 2 (GORASP2) | |||||
| LDTP07964 | Golgi to ER traffic protein 4 homolog (GET4) | |||||
| LDTP09783 | Golgi-specific brefeldin A-resistance guanine nucleotide exchange factor 1 (GBF1) | |||||
| LDTP10799 | GPI transamidase component PIG-S (PIGS) | |||||
| LDTP10015 | GPI transamidase component PIG-T (PIGT) | |||||
| LDTP07758 | GRB10-interacting GYF protein 2 (GIGYF2) | |||||
| LDTP10180 | GRIP and coiled-coil domain-containing protein 1 (GCC1) | |||||
| LDTP02059 | Guanine nucleotide-binding protein G(i) subunit alpha-2 (GNAI2) | |||||
| LDTP04342 | Guanine nucleotide-binding protein G(q) subunit alpha (GNAQ) | |||||
| LDTP01692 | Guanine nucleotide-binding protein subunit alpha-14 (GNA14) | |||||
| LDTP03555 | Guanine nucleotide-binding protein subunit alpha-15 (GNA15) | |||||
| LDTP12141 | Guanine nucleotide-binding protein subunit beta-4 (GNB4) | |||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | |||||
| LDTP15253 | HEAT repeat-containing protein 3 (HEATR3) | |||||
| LDTP02434 | Heat shock 70 kDa protein 1A (HSPA1A) | |||||
| LDTP03695 | Heat shock 70 kDa protein 4 (HSPA4) | |||||
| LDTP14545 | Heat shock 70 kDa protein 4L (HSPA4L) | |||||
| LDTP09811 | Heat shock protein 105 kDa (HSPH1) | |||||
| LDTP05697 | Heat shock protein 75 kDa, mitochondrial (TRAP1) | |||||
| LDTP02720 | Hematopoietic lineage cell-specific protein (HCLS1) | |||||
| LDTP00490 | Hepatocyte growth factor-regulated tyrosine kinase substrate (HGS) | |||||
| LDTP04495 | Heterogeneous nuclear ribonucleoprotein A3 (HNRNPA3) | |||||
| LDTP06032 | Heterogeneous nuclear ribonucleoprotein D0 (HNRNPD) | |||||
| LDTP04514 | Heterogeneous nuclear ribonucleoprotein F (HNRNPF) | |||||
| LDTP03615 | Heterogeneous nuclear ribonucleoprotein H (HNRNPH1) | |||||
| LDTP04714 | Heterogeneous nuclear ribonucleoprotein H2 (HNRNPH2) | |||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | |||||
| LDTP04952 | Heterogeneous nuclear ribonucleoprotein K (HNRNPK) | |||||
| LDTP02750 | Heterogeneous nuclear ribonucleoprotein L (HNRNPL) | |||||
| LDTP00991 | Heterogeneous nuclear ribonucleoprotein Q (SYNCRIP) | |||||
| LDTP00756 | Heterogeneous nuclear ribonucleoprotein R (HNRNPR) | |||||
| LDTP05259 | Heterogeneous nuclear ribonucleoprotein U (HNRNPU) | |||||
| LDTP17065 | Heterogeneous nuclear ribonucleoprotein U-like protein 2 (HNRNPUL2) | |||||
| LDTP03182 | Heterogeneous nuclear ribonucleoproteins A2/B1 (HNRNPA2B1) | |||||
| LDTP02227 | Heterogeneous nuclear ribonucleoproteins C1/C2 (HNRNPC) | |||||
| LDTP11315 | HIRA-interacting protein 3 (HIRIP3) | |||||
| LDTP02843 | Histone H1.5 (H1-5) | |||||
| LDTP01054 | Histone H2B type 1-K (H2BC12) | |||||
| LDTP06126 | Histone RNA hairpin-binding protein (SLBP) | |||||
| LDTP05590 | Histone-binding protein RBBP4 (RBBP4) | |||||
| LDTP04434 | Host cell factor 1 (HCFC1) | |||||
| LDTP04367 | Hsc70-interacting protein (ST13) | |||||
| LDTP12914 | Hsp70-binding protein 1 (HSPBP1) | |||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | |||||
| LDTP12904 | Insulin-like growth factor 2 mRNA-binding protein 1 (IGF2BP1) | |||||
| LDTP00272 | Insulin-like growth factor 2 mRNA-binding protein 3 (IGF2BP3) | |||||
| LDTP07333 | Integrator complex subunit 3 (INTS3) | |||||
| LDTP10402 | Integrator complex subunit 4 (INTS4) | |||||
| LDTP12678 | Integrator complex subunit 7 (INTS7) | |||||
| LDTP05158 | Interferon-induced 35 kDa protein (IFI35) | |||||
| LDTP05689 | Interleukin enhancer-binding factor 3 (ILF3) | |||||
| LDTP02674 | Keratin, type I cytoskeletal 10 (KRT10) | |||||
| LDTP01930 | Keratin, type I cytoskeletal 14 (KRT14) | |||||
| LDTP03755 | Keratin, type I cytoskeletal 9 (KRT9) | |||||
| LDTP02031 | Keratin, type II cytoskeletal 1 (KRT1) | |||||
| LDTP03792 | Keratin, type II cytoskeletal 2 epidermal (KRT2) | |||||
| LDTP02676 | Keratin, type II cytoskeletal 5 (KRT5) | |||||
| LDTP02030 | Keratin, type II cytoskeletal 6B (KRT6B) | |||||
| LDTP06259 | Keratin, type II cytoskeletal 72 (KRT72) | |||||
| LDTP05525 | KH domain-containing, RNA-binding, signal transduction-associated protein 1 (KHDRBS1) | |||||
| LDTP08238 | Kinectin (KTN1) | |||||
| LDTP00431 | Kinetochore protein NDC80 homolog (NDC80) | |||||
| LDTP06838 | La-related protein 7 (LARP7) | |||||
| LDTP03065 | Lamin-B1 (LMNB1) | |||||
| LDTP03967 | Lamina-associated polypeptide 2, isoform alpha (TMPO) | |||||
| LDTP05378 | Large ribosomal subunit protein eL6 (RPL6) | |||||
| LDTP04990 | Large ribosomal subunit protein eL8 (RPL7A) | |||||
| LDTP10232 | Large ribosomal subunit protein mL38 (MRPL38) | |||||
| LDTP16055 | Large ribosomal subunit protein mL65 (MRPS30) | |||||
| LDTP05024 | Large ribosomal subunit protein uL1 (RPL10A) | |||||
| LDTP02109 | Large ribosomal subunit protein uL10 (RPLP0) | |||||
| LDTP04106 | Large ribosomal subunit protein uL18 (RPL5) | |||||
| LDTP05027 | Large ribosomal subunit protein uL2 (RPL8) | |||||
| LDTP03865 | Large ribosomal subunit protein uL3 (RPL3) | |||||
| LDTP14589 | Large ribosomal subunit protein uL3m (MRPL3) | |||||
| LDTP03815 | Large ribosomal subunit protein uL4 (RPL4) | |||||
| LDTP09082 | LEM domain-containing protein 2 (LEMD2) | |||||
| LDTP03997 | Leucine-rich PPR motif-containing protein, mitochondrial (LRPPRC) | |||||
| LDTP19853 | Leucine-rich repeat-containing protein 58 (LRRC58) | |||||
| LDTP19702 | Leucine-rich repeat-containing protein 71 (LRRC71) | |||||
| LDTP04156 | LIM and senescent cell antigen-like-containing domain protein 1 (LIMS1) | |||||
| LDTP06220 | LIM and SH3 domain protein 1 (LASP1) | |||||
| LDTP14217 | Lipid droplet-regulating VLDL assembly factor AUP1 (AUP1) | |||||
| LDTP02116 | Lupus La protein (SSB) | |||||
| LDTP17622 | LysM and putative peptidoglycan-binding domain-containing protein 2 (LYSMD2) | |||||
| LDTP03877 | Macrophage-capping protein (CAPG) | |||||
| LDTP06276 | MAD2L1-binding protein (MAD2L1BP) | |||||
| LDTP11891 | Major facilitator superfamily domain-containing protein 1 (MFSD1) | |||||
| LDTP04027 | Matrin-3 (MATR3) | |||||
| LDTP14939 | Membralin (TMEM259) | |||||
| LDTP01731 | Methyl-CpG-binding domain protein 3 (MBD3) | |||||
| LDTP11066 | Methylosome protein WDR77 (WDR77) | |||||
| LDTP06444 | Microtubule-associated protein RP/EB family member 1 (MAPRE1) | |||||
| LDTP06413 | Microtubule-associated protein RP/EB family member 2 (MAPRE2) | |||||
| LDTP12619 | Midasin (MDN1) | |||||
| LDTP11197 | Mini-chromosome maintenance complex-binding protein (MCMBP) | |||||
| LDTP08058 | Mitochondrial antiviral-signaling protein (MAVS) | |||||
| LDTP12418 | Mitochondrial dynamics protein MIEF1 (MIEF1) | |||||
| LDTP15461 | Mitochondrial protein C2orf69 (C2orf69) | |||||
| LDTP10843 | MMS19 nucleotide excision repair protein homolog (MMS19) | |||||
| LDTP03346 | Moesin (MSN) | |||||
| LDTP08100 | Mucin-19 (MUC19) | |||||
| LDTP11079 | Myb-binding protein 1A (MYBBP1A) | |||||
| LDTP05815 | N-myc-interactor (NMI) | |||||
| LDTP12234 | N6-adenosine-methyltransferase non-catalytic subunit (METTL14) | |||||
| LDTP04678 | Nck-associated protein 1-like (NCKAP1L) | |||||
| LDTP14104 | NEDD8 ultimate buster 1 (NUB1) | |||||
| LDTP11876 | Negative elongation factor A (NELFA) | |||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | |||||
| LDTP05597 | Neuroblast differentiation-associated protein AHNAK (AHNAK) | |||||
| LDTP07438 | Nipped-B-like protein (NIPBL) | |||||
| LDTP10585 | Non-structural maintenance of chromosomes element 3 homolog (NSMCE3) | |||||
| LDTP12701 | Notchless protein homolog 1 (NLE1) | |||||
| LDTP04241 | Nuclear autoantigenic sperm protein (NASP) | |||||
| LDTP05711 | Nuclear inhibitor of protein phosphatase 1 (PPP1R8) | |||||
| LDTP13817 | Nuclear migration protein nudC (NUDC) | |||||
| LDTP14011 | Nucleolar complex protein 2 homolog (NOC2L) | |||||
| LDTP09545 | Nucleolar complex protein 3 homolog (NOC3L) | |||||
| LDTP06954 | Nucleolar MIF4G domain-containing protein 1 (NOM1) | |||||
| LDTP16017 | Nucleolar protein 11 (NOL11) | |||||
| LDTP02164 | Nucleophosmin (NPM1) | |||||
| LDTP08489 | NudC domain-containing protein 3 (NUDCD3) | |||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | |||||
| LDTP05858 | Origin recognition complex subunit 2 (ORC2) | |||||
| LDTP13104 | Origin recognition complex subunit 3 (ORC3) | |||||
| LDTP13167 | Peflin (PEF1) | |||||
| LDTP01021 | Perilipin-3 (PLIN3) | |||||
| LDTP11825 | Phosducin-like protein 3 (PDCL3) | |||||
| LDTP03408 | Phosphatidylinositol 3-kinase regulatory subunit alpha (PIK3R1) | |||||
| LDTP07844 | Phosphoinositide 3-kinase adapter protein 1 (PIK3AP1) | |||||
| LDTP12726 | PIH1 domain-containing protein 1 (PIH1D1) | |||||
| LDTP10129 | PIN2/TERF1-interacting telomerase inhibitor 1 (PINX1) | |||||
| LDTP02084 | Plasminogen activator inhibitor 2 (SERPINB2) | |||||
| LDTP02691 | Plastin-2 (LCP1) | |||||
| LDTP04015 | Platelet-activating factor acetylhydrolase IB subunit beta (PAFAH1B1) | |||||
| LDTP02280 | Pleckstrin (PLEK) | |||||
| LDTP10739 | PML-RARA-regulated adapter molecule 1 (PRAM1) | |||||
| LDTP06366 | Poly(rC)-binding protein 1 (PCBP1) | |||||
| LDTP06367 | Poly(rC)-binding protein 2 (PCBP2) | |||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | |||||
| LDTP02595 | Polyadenylate-binding protein 1 (PABPC1) | |||||
| LDTP01249 | Polycomb protein EED (EED) | |||||
| LDTP01057 | Polyglutamine-binding protein 1 (PQBP1) | |||||
| LDTP03364 | Polypyrimidine tract-binding protein 1 (PTBP1) | |||||
| LDTP07634 | POTE ankyrin domain family member E (POTEE) | |||||
| LDTP15284 | Pre-mRNA-processing factor 39 (PRPF39) | |||||
| LDTP01208 | Pre-mRNA-processing factor 40 homolog A (PRPF40A) | |||||
| LDTP01456 | Pre-mRNA-processing factor 6 (PRPF6) | |||||
| LDTP07526 | Pre-mRNA-processing-splicing factor 8 (PRPF8) | |||||
| LDTP12706 | Pre-mRNA-splicing factor RBM22 (RBM22) | |||||
| LDTP12269 | Pre-mRNA-splicing factor SYF1 (XAB2) | |||||
| LDTP06272 | Pre-mRNA-splicing regulator WTAP (WTAP) | |||||
| LDTP01392 | Probable cytosolic iron-sulfur protein assembly protein CIAO1 (CIAO1) | |||||
| LDTP09580 | Programmed cell death 6-interacting protein (PDCD6IP) | |||||
| LDTP02596 | Proliferating cell nuclear antigen (PCNA) | |||||
| LDTP15864 | Proteasomal ATPase-associated factor 1 (PAAF1) | |||||
| LDTP06514 | Proteasomal ubiquitin receptor ADRM1 (ADRM1) | |||||
| LDTP04917 | Proteasome activator complex subunit 3 (PSME3) | |||||
| LDTP01608 | Proteasome assembly chaperone 1 (PSMG1) | |||||
| LDTP11176 | Protein canopy homolog 3 (CNPY3) | |||||
| LDTP18547 | Protein CDV3 homolog (CDV3) | |||||
| LDTP06059 | Protein EFR3 homolog A (EFR3A) | |||||
| LDTP06879 | Protein FAM98B (FAM98B) | |||||
| LDTP18309 | Protein HGH1 homolog (HGH1) | |||||
| LDTP08301 | Protein Hook homolog 3 (HOOK3) | |||||
| LDTP19858 | Protein KTI12 homolog (KTI12) | |||||
| LDTP08224 | Protein LYRIC (MTDH) | |||||
| LDTP11559 | Protein Niban 1 (NIBAN1) | |||||
| LDTP19924 | Protein PBDC1 (PBDC1) | |||||
| LDTP13020 | Protein RCC2 (RCC2) | |||||
| LDTP07608 | Protein TMED8 (TMED8) | |||||
| LDTP04594 | Protein transport protein Sec24C (SEC24C) | |||||
| LDTP17041 | Protein tyrosine phosphatase receptor type C-associated protein (PTPRCAP) | |||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | |||||
| LDTP07888 | Protein unc-13 homolog D (UNC13D) | |||||
| LDTP11890 | Protein unc-45 homolog A (UNC45A) | |||||
| LDTP01296 | Protein XRP2 (RP2) | |||||
| LDTP12074 | Protein zwilch homolog (ZWILCH) | |||||
| LDTP17356 | Putative DENN domain-containing protein 10 B (DENND10P1) | |||||
| LDTP04355 | Rab GDP dissociation inhibitor beta (GDI2) | |||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | |||||
| LDTP07476 | RAD50-interacting protein 1 (RINT1) | |||||
| LDTP10105 | RAD51-associated protein 1 (RAD51AP1) | |||||
| LDTP04504 | Rap1 GTPase-GDP dissociation stimulator 1 (RAP1GDS1) | |||||
| LDTP04383 | Ras association domain-containing protein 2 (RASSF2) | |||||
| LDTP06166 | Ras GTPase-activating protein 3 (RASA3) | |||||
| LDTP13647 | Ras GTPase-activating protein-binding protein 2 (G3BP2) | |||||
| LDTP04117 | Ras GTPase-activating-like protein IQGAP1 (IQGAP1) | |||||
| LDTP10651 | Regulation of nuclear pre-mRNA domain-containing protein 1A (RPRD1A) | |||||
| LDTP12417 | Regulation of nuclear pre-mRNA domain-containing protein 1B (RPRD1B) | |||||
| LDTP02964 | Regulator of chromosome condensation (RCC1) | |||||
| LDTP02816 | Replication protein A 32 kDa subunit (RPA2) | |||||
| LDTP11434 | Replication termination factor 2 (RTF2) | |||||
| LDTP01522 | Reticulon-3 (RTN3) | |||||
| LDTP02146 | Retinoblastoma-associated protein (RB1) | |||||
| LDTP06351 | Retinoblastoma-binding protein 5 (RBBP5) | |||||
| LDTP05540 | Rho GTPase-activating protein 1 (ARHGAP1) | |||||
| LDTP08822 | Rho GTPase-activating protein 18 (ARHGAP18) | |||||
| LDTP09917 | Rho guanine nucleotide exchange factor 1 (ARHGEF1) | |||||
| LDTP06299 | Rho guanine nucleotide exchange factor 6 (ARHGEF6) | |||||
| LDTP13965 | Ribosomal RNA-processing protein 7 homolog A (RRP7A) | |||||
| LDTP15609 | Ribosome biogenesis protein BRX1 homolog (BRIX1) | |||||
| LDTP11625 | Ribosome biogenesis protein WDR12 (WDR12) | |||||
| LDTP12019 | Ribosome production factor 2 homolog (RPF2) | |||||
| LDTP16096 | RNA-binding protein 12 (RBM12) | |||||
| LDTP04294 | RNA-binding protein 25 (RBM25) | |||||
| LDTP13467 | RNA-binding protein Raly (RALY) | |||||
| LDTP02480 | RNA-binding protein RO60 (RO60) | |||||
| LDTP14980 | RRP12-like protein (RRP12) | |||||
| LDTP01373 | SAM and SH3 domain-containing protein 3 (SASH3) | |||||
| LDTP05179 | SAP domain-containing ribonucleoprotein (SARNP) | |||||
| LDTP11069 | Sclerostin (SOST) | |||||
| LDTP13991 | Serine-threonine kinase receptor-associated protein (STRAP) | |||||
| LDTP12800 | Serine/threonine-protein phosphatase 4 regulatory subunit 2 (PPP4R2) | |||||
| LDTP13701 | Serine/threonine-protein phosphatase 6 regulatory subunit 1 (PPP6R1) | |||||
| LDTP04198 | Serpin B10 (SERPINB10) | |||||
| LDTP13596 | Signal-transducing adaptor protein 1 (STAP1) | |||||
| LDTP06684 | Sister chromatid cohesion protein PDS5 homolog A (PDS5A) | |||||
| LDTP12605 | Sister chromatid cohesion protein PDS5 homolog B (PDS5B) | |||||
| LDTP16913 | SLIT-ROBO Rho GTPase-activating protein 2B (SRGAP2B) | |||||
| LDTP00862 | Small glutamine-rich tetratricopeptide repeat-containing protein alpha (SGTA) | |||||
| LDTP04913 | Small ribosomal subunit protein eS1 (RPS3A) | |||||
| LDTP04997 | Small ribosomal subunit protein eS4, X isoform (RPS4X) | |||||
| LDTP05002 | Small ribosomal subunit protein eS6 (RPS6) | |||||
| LDTP14788 | Small ribosomal subunit protein mS35 (MRPS35) | |||||
| LDTP13961 | Small ribosomal subunit protein uS2m (MRPS2) | |||||
| LDTP02809 | Small ribosomal subunit protein uS5 (RPS2) | |||||
| LDTP14789 | Small ribosomal subunit protein uS5m (MRPS5) | |||||
| LDTP14792 | Small ribosomal subunit protein uS9m (MRPS9) | |||||
| LDTP01294 | Small subunit processome component 20 homolog (UTP20) | |||||
| LDTP05048 | Small ubiquitin-related modifier 1 (SUMO1) | |||||
| LDTP08735 | Spartin (SPART) | |||||
| LDTP10815 | Spermatid perinuclear RNA-binding protein (STRBP) | |||||
| LDTP14208 | Spindlin-1 (SPIN1) | |||||
| LDTP12951 | Spliceosome-associated protein CWC15 homolog (CWC15) | |||||
| LDTP06429 | Splicing factor 1 (SF1) | |||||
| LDTP06393 | Splicing factor 3A subunit 1 (SF3A1) | |||||
| LDTP06387 | Splicing factor 3A subunit 2 (SF3A2) | |||||
| LDTP01251 | Splicing factor 3B subunit 1 (SF3B1) | |||||
| LDTP06376 | Splicing factor 3B subunit 3 (SF3B3) | |||||
| LDTP06386 | Splicing factor 3B subunit 4 (SF3B4) | |||||
| LDTP09562 | Splicing factor U2AF 26 kDa subunit (U2AF1L4) | |||||
| LDTP05272 | Splicing factor U2AF 35 kDa subunit (U2AF1) | |||||
| LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | |||||
| LDTP06280 | Squamous cell carcinoma antigen recognized by T-cells 3 (SART3) | |||||
| LDTP01499 | SR-related and CTD-associated factor 4 (SCAF4) | |||||
| LDTP09821 | Stalled ribosome sensor GCN1 (GCN1) | |||||
| LDTP12278 | Steroid receptor RNA activator 1 (SRA1) | |||||
| LDTP03860 | Stress-70 protein, mitochondrial (HSPA9) | |||||
| LDTP03619 | Stress-induced-phosphoprotein 1 (STIP1) | |||||
| LDTP00875 | Striatin (STRN) | |||||
| LDTP07207 | Striatin-interacting protein 1 (STRIP1) | |||||
| LDTP13760 | Structural maintenance of chromosomes protein 3 (SMC3) | |||||
| LDTP17420 | Suprabasin (SBSN) | |||||
| LDTP01362 | Survival of motor neuron-related-splicing factor 30 (SMNDC1) | |||||
| LDTP10062 | Synapse-associated protein 1 (SYAP1) | |||||
| LDTP00632 | Syntaxin-7 (STX7) | |||||
| LDTP02934 | T-complex protein 1 subunit alpha (TCP1) | |||||
| LDTP05113 | T-complex protein 1 subunit beta (CCT2) | |||||
| LDTP04201 | T-complex protein 1 subunit epsilon (CCT5) | |||||
| LDTP10990 | T-complex protein 1 subunit eta (CCT7) | |||||
| LDTP04249 | T-complex protein 1 subunit gamma (CCT3) | |||||
| LDTP04390 | T-complex protein 1 subunit theta (CCT8) | |||||
| LDTP03888 | T-complex protein 1 subunit zeta (CCT6A) | |||||
| LDTP08294 | Tax1-binding protein 1 (TAX1BP1) | |||||
| LDTP09363 | TBC1 domain family member 15 (TBC1D15) | |||||
| LDTP13227 | Testin (TES) | |||||
| LDTP16128 | Testis-expressed protein 10 (TEX10) | |||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | |||||
| LDTP19505 | Tetratricopeptide repeat protein 27 (TTC27) | |||||
| LDTP01678 | Tetratricopeptide repeat protein 4 (TTC4) | |||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | |||||
| LDTP10440 | THO complex subunit 3 (THOC3) | |||||
| LDTP12780 | THUMP domain-containing protein 1 (THUMPD1) | |||||
| LDTP06439 | Thyroid receptor-interacting protein 6 (TRIP6) | |||||
| LDTP19963 | TraB domain-containing protein (TRABD) | |||||
| LDTP03209 | Transcription elongation factor A protein 1 (TCEA1) | |||||
| LDTP00236 | Transcription elongation factor SPT5 (SUPT5H) | |||||
| LDTP07928 | Transcription elongation factor SPT6 (SUPT6H) | |||||
| LDTP05647 | Transducin beta-like protein 3 (TBL3) | |||||
| LDTP05036 | Transformer-2 protein homolog beta (TRA2B) | |||||
| LDTP04304 | Translation initiation factor eIF2B subunit beta (EIF2B2) | |||||
| LDTP11210 | Transmembrane protein 43 (TMEM43) | |||||
| LDTP13381 | tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6 (TRMT6) | |||||
| LDTP05068 | Tropomyosin alpha-4 chain (TPM4) | |||||
| LDTP02205 | Tubulin beta chain (TUBB) | |||||
| LDTP05076 | Tubulin beta-4B chain (TUBB4B) | |||||
| LDTP03213 | Tubulin gamma-1 chain (TUBG1) | |||||
| LDTP10860 | Tubulin-folding cofactor B (TBCB) | |||||
| LDTP06480 | Tubulin-specific chaperone C (TBCC) | |||||
| LDTP11212 | Tubulin-specific chaperone D (TBCD) | |||||
| LDTP00759 | Tumor protein D54 (TPD52L2) | |||||
| LDTP07084 | Tumor protein p63-regulated gene 1-like protein (TPRG1L) | |||||
| LDTP07404 | Twinfilin-2 (TWF2) | |||||
| LDTP02322 | U1 small nuclear ribonucleoprotein A (SNRPA) | |||||
| LDTP02365 | U2 small nuclear ribonucleoprotein A' (SNRPA1) | |||||
| LDTP07315 | U3 small nucleolar RNA-associated protein 25 homolog (UTP25) | |||||
| LDTP10047 | U3 small nucleolar RNA-associated protein 4 homolog (UTP4) | |||||
| LDTP00727 | U4/U6.U5 tri-snRNP-associated protein 1 (SART1) | |||||
| LDTP10217 | U5 small nuclear ribonucleoprotein 40 kDa protein (SNRNP40) | |||||
| LDTP01163 | Ubiquinone biosynthesis protein COQ9, mitochondrial (COQ9) | |||||
| LDTP09919 | Ubiquitin recognition factor in ER-associated degradation protein 1 (UFD1) | |||||
| LDTP07132 | Ubiquitin-associated protein 2 (UBAP2) | |||||
| LDTP18871 | Uncharacterized protein C15orf62, mitochondrial (C15orf62) | |||||
| LDTP14797 | Vacuolar fusion protein CCZ1 homolog (CCZ1) | |||||
| LDTP11800 | Vacuolar protein sorting-associated protein 16 homolog (VPS16) | |||||
| LDTP13019 | Vacuolar protein sorting-associated protein 18 homolog (VPS18) | |||||
| LDTP13338 | Vacuolar protein sorting-associated protein 51 homolog (VPS51) | |||||
| LDTP08766 | Vacuolar protein sorting-associated protein 52 homolog (VPS52) | |||||
| LDTP02946 | Vinculin (VCL) | |||||
| LDTP11735 | VIP36-like protein (LMAN2L) | |||||
| LDTP00057 | von Willebrand factor A domain-containing protein 8 (VWA8) | |||||
| LDTP01118 | WD repeat-containing protein 1 (WDR1) | |||||
| LDTP13681 | WD repeat-containing protein 3 (WDR3) | |||||
| LDTP04948 | WD repeat-containing protein 5 (WDR5) | |||||
| LDTP06726 | WD40 repeat-containing protein SMU1 (SMU1) | |||||
| LDTP11466 | YTH domain-containing family protein 1 (YTHDF1) | |||||
| LDTP13245 | Zinc finger CCCH domain-containing protein 7B (ZC3H7B) | |||||
| LDTP08018 | Zinc finger CCCH-type antiviral protein 1 (ZC3HAV1) | |||||
| LDTP09872 | Zinc finger protein ubi-d4 (DPF2) | |||||
| LDTP15762 | Zinc finger RNA-binding protein (ZFR) | |||||
