Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | FFF probe14 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:200uM; negative probe:200uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
SILAC
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11012 | 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha (AGPAT1) | 20.0 | ||||
| LDTP12639 | 1-acyl-sn-glycerol-3-phosphate acyltransferase epsilon (AGPAT5) | 20.0 | ||||
| LDTP02356 | 2',3'-cyclic-nucleotide 3'-phosphodiesterase (CNP) | 20.0 | ||||
| LDTP07447 | 2',5'-phosphodiesterase 12 (PDE12) | 20.0 | ||||
| LDTP00032 | 2-hydroxyacyl-CoA lyase 2 (ILVBL) | 20.0 | ||||
| LDTP06988 | 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial (COQ5) | 20.0 | ||||
| LDTP02627 | 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial (BCKDHA) | 20.0 | ||||
| LDTP00294 | 26S proteasome non-ATPase regulatory subunit 14 (PSMD14) | 20.0 | ||||
| LDTP04987 | 26S proteasome regulatory subunit 10B (PSMC6) | 20.0 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 20.0 | ||||
| LDTP18414 | 5'-nucleotidase domain-containing protein 2 (NT5DC2) | 20.0 | ||||
| LDTP15290 | 5'-nucleotidase domain-containing protein 3 (NT5DC3) | 20.0 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 20.0 | ||||
| LDTP09814 | Acyl-CoA:lysophosphatidylglycerol acyltransferase 1 (LPGAT1) | 20.0 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 20.0 | ||||
| LDTP12415 | Adenosine 5'-monophosphoramidase HINT3 (HINT3) | 20.0 | ||||
| LDTP03541 | Adenylosuccinate synthetase isozyme 2 (ADSS2) | 20.0 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 20.0 | ||||
| LDTP11318 | ADP-ribose pyrophosphatase, mitochondrial (NUDT9) | 20.0 | ||||
| LDTP03900 | ADP-ribosylation factor-like protein 1 (ARL1) | 20.0 | ||||
| LDTP14075 | AFG3-like protein 2 (AFG3L2) | 20.0 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 20.0 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 20.0 | ||||
| LDTP03770 | Alpha-adducin (ADD1) | 20.0 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 20.0 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 20.0 | ||||
| LDTP02264 | Asparagine synthetase [glutamine-hydrolyzing] (ASNS) | 20.0 | ||||
| LDTP05652 | Aspartyl/asparaginyl beta-hydroxylase (ASPH) | 20.0 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 20.0 | ||||
| LDTP07362 | Atlastin-3 (ATL3) | 20.0 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 20.0 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 20.0 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 20.0 | ||||
| LDTP07154 | ATPase family AAA domain-containing protein 3B (ATAD3B) | 20.0 | ||||
| LDTP19391 | ATPase family AAA domain-containing protein 3C (ATAD3C) | 20.0 | ||||
| LDTP00836 | ATPase GET3 (GET3) | 20.0 | ||||
| LDTP09285 | Atypical kinase COQ8A, mitochondrial (COQ8A) | 20.0 | ||||
| LDTP10201 | Atypical kinase COQ8B, mitochondrial (COQ8B) | 20.0 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 20.0 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 20.0 | ||||
| LDTP02706 | Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial (MTHFD2) | 20.0 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 20.0 | ||||
| LDTP05992 | Bleomycin hydrolase (BLMH) | 20.0 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 20.0 | ||||
| LDTP12163 | Calcyclin-binding protein (CACYBP) | 20.0 | ||||
| LDTP02911 | Calpain-2 catalytic subunit (CAPN2) | 20.0 | ||||
| LDTP04358 | Carnitine O-palmitoyltransferase 1, liver isoform (CPT1A) | 20.0 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 20.0 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 20.0 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 20.0 | ||||
| LDTP00416 | CDP-diacylglycerol--inositol 3-phosphatidyltransferase (CDIPT) | 20.0 | ||||
| LDTP04886 | Cell division control protein 42 homolog (CDC42) | 20.0 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 20.0 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 20.0 | ||||
| LDTP12048 | Complex I assembly factor ACAD9, mitochondrial (ACAD9) | 20.0 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 20.0 | ||||
| LDTP02622 | Creatine kinase U-type, mitochondrial (CKMT1A; CKMT1B) | 20.0 | ||||
| LDTP02149 | Cyclin-dependent kinase 1 (CDK1) | 20.0 | ||||
| LDTP03299 | Cyclin-dependent kinase 2 (CDK2) | 20.0 | ||||
| LDTP02589 | Cyclin-dependent kinase 4 (CDK4) | 20.0 | ||||
| LDTP04384 | Cyclin-dependent kinase 9 (CDK9) | 20.0 | ||||
| LDTP03753 | Cystathionine beta-synthase (CBS) | 20.0 | ||||
| LDTP03656 | Cystathionine gamma-lyase (CTH) | 20.0 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 20.0 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 20.0 | ||||
| LDTP01763 | Cytochrome b5 (CYB5A) | 20.0 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 20.0 | ||||
| LDTP01772 | Cytochrome c oxidase subunit 1 (MT-CO1) | 20.0 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 20.0 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 20.0 | ||||
| LDTP04327 | Cytosolic purine 5'-nucleotidase (NT5C2) | 20.0 | ||||
| LDTP00701 | D-3-phosphoglycerate dehydrogenase (PHGDH) | 20.0 | ||||
| LDTP12085 | Damage-control phosphatase ARMT1 (ARMT1) | 20.0 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 20.0 | ||||
| LDTP13959 | Dehydrogenase/reductase SDR family member 7 (DHRS7) | 20.0 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 20.0 | ||||
| LDTP11174 | Deubiquitinase DESI2 (DESI2) | 20.0 | ||||
| LDTP19892 | DGAT1/2-independent enzyme synthesizing storage lipids (TMEM68) | 20.0 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 20.0 | ||||
| LDTP00267 | DNA-directed RNA polymerase, mitochondrial (POLRMT) | 20.0 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 20.0 | ||||
| LDTP09388 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B (STT3B) | 20.0 | ||||
| LDTP03808 | Dual specificity mitogen-activated protein kinase kinase 2 (MAP2K2) | 20.0 | ||||
| LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 20.0 | ||||
| LDTP16021 | E3 ubiquitin ligase RNF121 (RNF121) | 20.0 | ||||
| LDTP06511 | Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial (ETFDH) | 20.0 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 20.0 | ||||
| LDTP02534 | Endoplasmic reticulum chaperone BiP (HSPA5) | 20.0 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 20.0 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 20.0 | ||||
| LDTP13314 | Enolase-phosphatase E1 (ENOPH1) | 20.0 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 20.0 | ||||
| LDTP10386 | ERO1-like protein alpha (ERO1A) | 20.0 | ||||
| LDTP09063 | Estradiol 17-beta-dehydrogenase 11 (HSD17B11) | 20.0 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 20.0 | ||||
| LDTP01634 | Fatty acid CoA ligase Acsl3 (ACSL3) | 20.0 | ||||
| LDTP02868 | Fumarylacetoacetase (FAH) | 20.0 | ||||
| LDTP09886 | Gamma-glutamyl hydrolase (GGH) | 20.0 | ||||
| LDTP02569 | Glucose-6-phosphate 1-dehydrogenase (G6PD) | 20.0 | ||||
| LDTP01374 | Glutaredoxin-3 (GLRX3) | 20.0 | ||||
| LDTP13367 | Glutathione hydrolase 7 (GGT7) | 20.0 | ||||
| LDTP01771 | Glutathione reductase, mitochondrial (GSR) | 20.0 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 20.0 | ||||
| LDTP04333 | GMP synthase [glutamine-hydrolyzing] (GMPS) | 20.0 | ||||
| LDTP09835 | GPI-anchor transamidase (PIGK) | 20.0 | ||||
| LDTP12470 | GTP-binding protein SAR1a (SAR1A) | 20.0 | ||||
| LDTP12233 | Helicase MOV-10 (MOV10) | 20.0 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 20.0 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 20.0 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 20.0 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 20.0 | ||||
| LDTP04531 | Hexokinase-2 (HK2) | 20.0 | ||||
| LDTP02602 | Histidine--tRNA ligase, cytoplasmic (HARS1) | 20.0 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 20.0 | ||||
| LDTP06645 | Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial (HADH) | 20.0 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 20.0 | ||||
| LDTP04519 | Kinesin-like protein KIF11 (KIF11) | 20.0 | ||||
| LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 20.0 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 20.0 | ||||
| LDTP04183 | Lanosterol synthase (LSS) | 20.0 | ||||
| LDTP06287 | Leucine--tRNA ligase, mitochondrial (LARS2) | 20.0 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 20.0 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 20.0 | ||||
| LDTP03817 | Lon protease homolog, mitochondrial (LONP1) | 20.0 | ||||
| LDTP03662 | Long-chain-fatty-acid--CoA ligase 1 (ACSL1) | 20.0 | ||||
| LDTP12552 | Lymphoid-specific helicase (HELLS) | 20.0 | ||||
| LDTP10500 | Lymphokine-activated killer T-cell-originated protein kinase (PBK) | 20.0 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 20.0 | ||||
| LDTP08799 | Lysophosphatidylserine lipase ABHD12 (ABHD12) | 20.0 | ||||
| LDTP07504 | Lysophospholipid acyltransferase 5 (LPCAT3) | 20.0 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 20.0 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 20.0 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 20.0 | ||||
| LDTP00338 | Lysosomal alpha-mannosidase (MAN2B1) | 20.0 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 20.0 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 20.0 | ||||
| LDTP05971 | Mannosyl-oligosaccharide glucosidase (MOGS) | 20.0 | ||||
| LDTP10930 | Membrane-associated tyrosine- and threonine-specific cdc2-inhibitory kinase (PKMYT1) | 20.0 | ||||
| LDTP10249 | Metalloendopeptidase OMA1, mitochondrial (OMA1) | 20.0 | ||||
| LDTP12227 | Methylcrotonoyl-CoA carboxylase beta chain, mitochondrial (MCCC2) | 20.0 | ||||
| LDTP05346 | Methylmalonate-semialdehyde/malonate-semialdehyde dehydrogenase [acylating], mitochondrial (ALDH6A1) | 20.0 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 20.0 | ||||
| LDTP06796 | Mitochondrial 10-formyltetrahydrofolate dehydrogenase (ALDH1L2) | 20.0 | ||||
| LDTP11683 | Mitochondrial disaggregase (CLPB) | 20.0 | ||||
| LDTP11090 | Mitochondrial genome maintenance exonuclease 1 (MGME1) | 20.0 | ||||
| LDTP06810 | Mitochondrial import inner membrane translocase subunit TIM50 (TIMM50) | 20.0 | ||||
| LDTP10981 | Mitochondrial intermediate peptidase (MIPEP) | 20.0 | ||||
| LDTP10038 | Mitochondrial ubiquitin ligase activator of NFKB 1 (MUL1) | 20.0 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 20.0 | ||||
| LDTP07651 | Monofunctional C1-tetrahydrofolate synthase, mitochondrial (MTHFD1L) | 20.0 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 20.0 | ||||
| LDTP03220 | NAD-dependent malic enzyme, mitochondrial (ME2) | 20.0 | ||||
| LDTP01561 | NADH dehydrogenase 1 alpha subcomplex subunit 10, mitochondrial (NDUFA10) | 20.0 | ||||
| LDTP04494 | NADH dehydrogenase 1 alpha subcomplex subunit 8 (NDUFA8) | 20.0 | ||||
| LDTP06631 | NADH dehydrogenase 1 alpha subcomplex subunit 9, mitochondrial (NDUFA9) | 20.0 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 20.0 | ||||
| LDTP01514 | NADH dehydrogenase 1 beta subcomplex subunit 4 (NDUFB4) | 20.0 | ||||
| LDTP01515 | NADH dehydrogenase 1 beta subcomplex subunit 8, mitochondrial (NDUFB8) | 20.0 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 20.0 | ||||
| LDTP01238 | NADH dehydrogenase iron-sulfur protein 3, mitochondrial (NDUFS3) | 20.0 | ||||
| LDTP01165 | NADH dehydrogenase iron-sulfur protein 7, mitochondrial (NDUFS7) | 20.0 | ||||
| LDTP00218 | NADH dehydrogenase iron-sulfur protein 8, mitochondrial (NDUFS8) | 20.0 | ||||
| LDTP13303 | NADH-cytochrome b5 reductase 1 (CYB5R1) | 20.0 | ||||
| LDTP03433 | NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial (NDUFS1) | 20.0 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 20.0 | ||||
| LDTP01983 | NADH-ubiquinone oxidoreductase chain 2 (MT-ND2) | 20.0 | ||||
| LDTP01985 | NADH-ubiquinone oxidoreductase chain 4 (MT-ND4) | 20.0 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 20.0 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 20.0 | ||||
| LDTP07367 | Nucleoredoxin (NXN) | 20.0 | ||||
| LDTP12657 | Nucleotide triphosphate diphosphatase NUDT15 (NUDT15) | 20.0 | ||||
| LDTP03813 | Oxygen-dependent coproporphyrinogen-III oxidase, mitochondrial (CPOX) | 20.0 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 20.0 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 20.0 | ||||
| LDTP10077 | Patatin-like phospholipase domain-containing protein 2 (PNPLA2) | 20.0 | ||||
| LDTP10101 | Peptidyl-prolyl cis-trans isomerase FKBP10 (FKBP10) | 20.0 | ||||
| LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 20.0 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 20.0 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 20.0 | ||||
| LDTP13831 | Phenylalanine--tRNA ligase alpha subunit (FARSA) | 20.0 | ||||
| LDTP01649 | Phosphatidate cytidylyltransferase 2 (CDS2) | 20.0 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 20.0 | ||||
| LDTP06638 | Phosphoenolpyruvate carboxykinase [GTP], mitochondrial (PCK2) | 20.0 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 20.0 | ||||
| LDTP03024 | Plasma membrane calcium-transporting ATPase 1 (ATP2B1) | 20.0 | ||||
| LDTP03249 | Plasma membrane calcium-transporting ATPase 4 (ATP2B4) | 20.0 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 20.0 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 20.0 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 20.0 | ||||
| LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 20.0 | ||||
| LDTP04303 | Presenilin-1 (PSEN1) | 20.0 | ||||
| LDTP04315 | Presenilin-2 (PSEN2) | 20.0 | ||||
| LDTP03348 | Probable ATP-dependent RNA helicase DDX6 (DDX6) | 20.0 | ||||
| LDTP09495 | Probable glutathione peroxidase 8 (GPX8) | 20.0 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 20.0 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 20.0 | ||||
| LDTP03413 | Proteasome subunit alpha type-5 (PSMA5) | 20.0 | ||||
| LDTP00449 | Proteasome subunit alpha type-7 (PSMA7) | 20.0 | ||||
| LDTP03060 | Proteasome subunit beta type-1 (PSMB1) | 20.0 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 20.0 | ||||
| LDTP03417 | Proteasome subunit beta type-4 (PSMB4) | 20.0 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 20.0 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 20.0 | ||||
| LDTP07868 | Protein O-mannosyl-transferase TMTC3 (TMTC3) | 20.0 | ||||
| LDTP00828 | Protein regulator of cytokinesis 1 (PRC1) | 20.0 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 20.0 | ||||
| LDTP00877 | Protein SCO2 homolog, mitochondrial (SCO2) | 20.0 | ||||
| LDTP03152 | Protein-L-isoaspartate(D-aspartate) O-methyltransferase (PCMT1) | 20.0 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 20.0 | ||||
| LDTP02549 | Pyruvate dehydrogenase E1 component subunit beta, mitochondrial (PDHB) | 20.0 | ||||
| LDTP03911 | Replication factor C subunit 3 (RFC3) | 20.0 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 20.0 | ||||
| LDTP03592 | Ribonucleoside-diphosphate reductase subunit M2 (RRM2) | 20.0 | ||||
| LDTP06384 | Ribosomal protein S6 kinase alpha-1 (RPS6KA1) | 20.0 | ||||
| LDTP04471 | Ribosomal protein S6 kinase alpha-3 (RPS6KA3) | 20.0 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 20.0 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 20.0 | ||||
| LDTP03688 | Serine hydroxymethyltransferase, cytosolic (SHMT1) | 20.0 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 20.0 | ||||
| LDTP06536 | Serine/threonine-protein kinase N2 (PKN2) | 20.0 | ||||
| LDTP05776 | Serine/threonine-protein kinase PAK 2 (PAK2) | 20.0 | ||||
| LDTP08226 | Serine/threonine-protein kinase tousled-like 2 (TLK2) | 20.0 | ||||
| LDTP10399 | Serine/threonine-protein phosphatase PGAM5, mitochondrial (PGAM5) | 20.0 | ||||
| LDTP13126 | Set1/Ash2 histone methyltransferase complex subunit ASH2 (ASH2L) | 20.0 | ||||
| LDTP04072 | Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial (ACADSB) | 20.0 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 20.0 | ||||
| LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | 20.0 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 20.0 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 20.0 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 20.0 | ||||
| LDTP10809 | SRSF protein kinase 1 (SRPK1) | 20.0 | ||||
| LDTP11819 | STE20-like serine/threonine-protein kinase (SLK) | 20.0 | ||||
| LDTP03769 | Sterol O-acyltransferase 1 (SOAT1) | 20.0 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 20.0 | ||||
| LDTP13156 | SUMO-activating enzyme subunit 2 (UBA2) | 20.0 | ||||
| LDTP04542 | Thimet oligopeptidase (THOP1) | 20.0 | ||||
| LDTP12056 | Thiol S-methyltransferase TMT1A (TMT1A) | 20.0 | ||||
| LDTP00758 | Thioredoxin-like protein 1 (TXNL1) | 20.0 | ||||
| LDTP11319 | Threonine--tRNA ligase, mitochondrial (TARS2) | 20.0 | ||||
| LDTP07227 | Threonylcarbamoyladenosine tRNA methylthiotransferase (CDKAL1) | 20.0 | ||||
| LDTP02006 | Tissue alpha-L-fucosidase (FUCA1) | 20.0 | ||||
| LDTP00399 | Torsin-1A (TOR1A) | 20.0 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 20.0 | ||||
| LDTP02935 | Tyrosine-protein phosphatase non-receptor type 1 (PTPN1) | 20.0 | ||||
| LDTP06903 | Ubiquitin carboxyl-terminal hydrolase 39 (USP39) | 20.0 | ||||
| LDTP10318 | Ubiquitin thioesterase OTUB1 (OTUB1) | 20.0 | ||||
| LDTP12851 | UDP-glucose:glycoprotein glucosyltransferase 1 (UGGT1) | 20.0 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 20.0 | ||||
| LDTP12773 | Very long chain fatty acid elongase 2 (ELOVL2) | 20.0 | ||||
| LDTP04289 | Very long-chain specific acyl-CoA dehydrogenase, mitochondrial (ACADVL) | 20.0 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 20.0 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 20.0 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 20.0 | ||||
| LDTP02198 | Cathepsin D (CTSD) | 19.8 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 19.7 | ||||
| LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 19.5 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 19.1 | ||||
| LDTP04992 | Ras-related protein Rab-11A (RAB11A) | 19.1 | ||||
| LDTP06501 | Ras-related protein Rab-11B (RAB11B) | 19.1 | ||||
| LDTP03689 | Serine hydroxymethyltransferase, mitochondrial (SHMT2) | 18.7 | ||||
| LDTP11701 | 5'-3' exoribonuclease 2 (XRN2) | 18.7 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 18.3 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 18.1 | ||||
| LDTP02283 | Cytochrome c1, heme protein, mitochondrial (CYC1) | 17.5 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 17.5 | ||||
| LDTP15879 | Haloacid dehalogenase-like hydrolase domain-containing protein 3 (HDHD3) | 17.3 | ||||
| LDTP06104 | Peptidyl-prolyl cis-trans isomerase FKBP8 (FKBP8) | 17.3 | ||||
| LDTP13112 | Phosphatidylinositol 4-kinase beta (PI4KB) | 17.3 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 17.2 | ||||
| LDTP05255 | Peptidyl-prolyl cis-trans isomerase FKBP3 (FKBP3) | 17.1 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 17.1 | ||||
| LDTP11284 | Phosphatidylserine synthase 2 (PTDSS2) | 17.1 | ||||
| LDTP01743 | NADH dehydrogenase 1 beta subcomplex subunit 10 (NDUFB10) | 17.0 | ||||
| LDTP13989 | Peptidyl-tRNA hydrolase 2, mitochondrial (PTRH2) | 16.9 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 16.9 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 16.8 | ||||
| LDTP04572 | Dipeptidyl peptidase 1 (CTSC) | 16.8 | ||||
| LDTP02216 | Beta-hexosaminidase subunit beta (HEXB) | 16.7 | ||||
| LDTP04163 | Prolyl endopeptidase (PREP) | 16.6 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 16.5 | ||||
| LDTP00714 | 26S proteasome non-ATPase regulatory subunit 3 (PSMD3) | 16.5 | ||||
| LDTP03765 | Myosin-10 (MYH10) | 16.5 | ||||
| LDTP04096 | Vesicle-fusing ATPase (NSF) | 16.3 | ||||
| LDTP03859 | V-type proton ATPase catalytic subunit A (ATP6V1A) | 16.3 | ||||
| LDTP03680 | DNA replication licensing factor MCM4 (MCM4) | 16.2 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 16.1 | ||||
| LDTP03785 | Myosin-11 (MYH11) | 16.1 | ||||
| LDTP00544 | Sphingolipid delta(4)-desaturase DES1 (DEGS1) | 16.0 | ||||
| LDTP03401 | Multifunctional protein CAD (CAD) | 15.8 | ||||
| LDTP03519 | UMP-CMP kinase (CMPK1) | 15.6 | ||||
| LDTP03819 | Serine/threonine-protein phosphatase PP1-gamma catalytic subunit (PPP1CC) | 15.4 | ||||
| LDTP04646 | Delta-1-pyrroline-5-carboxylate synthase (ALDH18A1) | 15.3 | ||||
| LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 15.3 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 15.2 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 15.1 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 15.1 | ||||
| LDTP12586 | Phenylalanine--tRNA ligase beta subunit (FARSB) | 15.0 | ||||
| LDTP02991 | Hexokinase-1 (HK1) | 14.8 | ||||
| LDTP04892 | Ras-related protein Rab-2A (RAB2A) | 14.7 | ||||
| LDTP05067 | Casein kinase II subunit beta (CSNK2B) | 14.6 | ||||
| LDTP03610 | Cytochrome b-c1 complex subunit 1, mitochondrial (UQCRC1) | 14.6 | ||||
| LDTP01986 | NADH-ubiquinone oxidoreductase chain 5 (MT-ND5) | 14.5 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 14.5 | ||||
| LDTP04209 | Casein kinase I isoform alpha (CSNK1A1) | 14.4 | ||||
| LDTP03522 | Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform (PPP2R1A) | 14.3 | ||||
| LDTP09070 | Outer mitochondrial transmembrane helix translocase (ATAD1) | 14.2 | ||||
| LDTP01063 | Eukaryotic translation initiation factor 5B (EIF5B) | 14.2 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 14.0 | ||||
| LDTP12757 | E3 ubiquitin-protein ligase MARCHF5 (MARCHF5) | 14.0 | ||||
| LDTP03222 | Tryptophan--tRNA ligase, cytoplasmic (WARS1) | 13.9 | ||||
| LDTP04196 | 26S proteasome non-ATPase regulatory subunit 8 (PSMD8) | 13.9 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 13.8 | ||||
| LDTP04243 | Fatty acid synthase (FASN) | 13.8 | ||||
| LDTP04203 | Phosphatidylserine synthase 1 (PTDSS1) | 13.8 | ||||
| LDTP04032 | Glycerol-3-phosphate dehydrogenase, mitochondrial (GPD2) | 13.7 | ||||
| LDTP05724 | Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial (ECH1) | 13.6 | ||||
| LDTP04374 | Dynamin-2 (DNM2) | 13.5 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 13.5 | ||||
| LDTP03330 | Proteasome subunit alpha type-1 (PSMA1) | 13.4 | ||||
| LDTP00273 | Dynamin-1-like protein (DNM1L) | 13.4 | ||||
| LDTP02188 | Protein disulfide-isomerase (P4HB) | 13.4 | ||||
| LDTP04144 | Cytochrome b-c1 complex subunit Rieske, mitochondrial (UQCRFS1) | 13.4 | ||||
| LDTP02150 | ATP synthase subunit beta, mitochondrial (ATP5F1B) | 13.3 | ||||
| LDTP10049 | FAST kinase domain-containing protein 4 (TBRG4) | 13.3 | ||||
| LDTP04246 | Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha (FNTA) | 13.2 | ||||
| LDTP04601 | Arginine--tRNA ligase, cytoplasmic (RARS1) | 13.2 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 13.2 | ||||
| LDTP03965 | Enoyl-CoA delta isomerase 1, mitochondrial (ECI1) | 13.1 | ||||
| LDTP10888 | Legumain (LGMN) | 13.1 | ||||
| LDTP03560 | Aldehyde dehydrogenase X, mitochondrial (ALDH1B1) | 13.1 | ||||
| LDTP10903 | Ribonucleases P/MRP protein subunit POP1 (POP1) | 13.1 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 13.0 | ||||
| LDTP03572 | Succinate dehydrogenase flavoprotein subunit, mitochondrial (SDHA) | 13.0 | ||||
| LDTP12588 | Isoleucine--tRNA ligase, mitochondrial (IARS2) | 13.0 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 13.0 | ||||
| LDTP03523 | Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform (PPP2R1B) | 13.0 | ||||
| LDTP09364 | Retinol dehydrogenase 11 (RDH11) | 12.9 | ||||
| LDTP06455 | Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating (NSDHL) | 12.9 | ||||
| LDTP00246 | Eukaryotic translation initiation factor 3 subunit F (EIF3F) | 12.9 | ||||
| LDTP10997 | Protein arginine N-methyltransferase 1 (PRMT1) | 12.8 | ||||
| LDTP03682 | DNA replication licensing factor MCM7 (MCM7) | 12.8 | ||||
| LDTP02362 | Dihydrolipoyl dehydrogenase, mitochondrial (DLD) | 12.8 | ||||
| LDTP02333 | Glutathione S-transferase P (GSTP1) | 12.8 | ||||
| LDTP05136 | DNA-dependent protein kinase catalytic subunit (PRKDC) | 12.7 | ||||
| LDTP13145 | Glyoxylate reductase/hydroxypyruvate reductase (GRHPR) | 12.6 | ||||
| LDTP08135 | E3 ubiquitin-protein ligase HUWE1 (HUWE1) | 12.6 | ||||
| LDTP12608 | Phosphatidylinositol-3-phosphatase SAC1 (SACM1L) | 12.6 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 12.6 | ||||
| LDTP01770 | NADH-cytochrome b5 reductase 3 (CYB5R3) | 12.6 | ||||
| LDTP02021 | Ornithine aminotransferase, mitochondrial (OAT) | 12.5 | ||||
| LDTP02552 | Glycogen phosphorylase, brain form (PYGB) | 12.5 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 12.5 | ||||
| LDTP03564 | DNA-directed RNA polymerase II subunit RPB2 (POLR2B) | 12.4 | ||||
| LDTP12835 | Large ribosomal subunit protein mL39 (MRPL39) | 12.4 | ||||
| LDTP02261 | ATP-dependent 6-phosphofructokinase, muscle type (PFKM) | 12.4 | ||||
| LDTP04962 | 26S proteasome regulatory subunit 4 (PSMC1) | 12.4 | ||||
| LDTP00931 | SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A member 5 (SMARCA5) | 12.4 | ||||
| LDTP00886 | Nardilysin (NRDC) | 12.4 | ||||
| LDTP05480 | Amidophosphoribosyltransferase (PPAT) | 12.4 | ||||
| LDTP04061 | 26S proteasome regulatory subunit 6B (PSMC4) | 12.3 | ||||
| LDTP10887 | Synaptic vesicle membrane protein VAT-1 homolog (VAT1) | 12.3 | ||||
| LDTP00479 | Histone acetyltransferase type B catalytic subunit (HAT1) | 12.3 | ||||
| LDTP04211 | Isocitrate dehydrogenase [NADP], mitochondrial (IDH2) | 12.3 | ||||
| LDTP04440 | Peroxisomal multifunctional enzyme type 2 (HSD17B4) | 12.3 | ||||
| LDTP03424 | ATP-binding cassette sub-family D member 3 (ABCD3) | 12.3 | ||||
| LDTP10159 | Pyrroline-5-carboxylate reductase 2 (PYCR2) | 12.2 | ||||
| LDTP04901 | Ras-related protein Rab-14 (RAB14) | 12.2 | ||||
| LDTP13787 | RuvB-like 2 (RUVBL2) | 12.2 | ||||
| LDTP08352 | Histone-arginine methyltransferase CARM1 (CARM1) | 12.1 | ||||
| LDTP03764 | Myosin-9 (MYH9) | 12.1 | ||||
| LDTP13285 | Probable ATP-dependent RNA helicase DDX20 (DDX20) | 12.1 | ||||
| LDTP05006 | Ras-related protein Rab-1A (RAB1A) | 12.1 | ||||
| LDTP11733 | Ras-related protein Rab-1B (RAB1B) | 12.1 | ||||
| LDTP13816 | RuvB-like 1 (RUVBL1) | 12.1 | ||||
| LDTP01220 | Mitochondrial-processing peptidase subunit beta (PMPCB) | 12.1 | ||||
| LDTP04284 | Proteasome subunit beta type-3 (PSMB3) | 12.1 | ||||
| LDTP04345 | Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial (IDH3A) | 12.1 | ||||
| LDTP09962 | Ubiquitin carboxyl-terminal hydrolase 7 (USP7) | 12.0 | ||||
| LDTP01584 | Phosphoacetylglucosamine mutase (PGM3) | 12.0 | ||||
| LDTP05369 | Dual specificity mitogen-activated protein kinase kinase 1 (MAP2K1) | 12.0 | ||||
| LDTP04895 | Ras-related protein Rab-10 (RAB10) | 11.9 | ||||
| LDTP08979 | Prostaglandin reductase 2 (PTGR2) | 11.5 | ||||
| LDTP11388 | N-alpha-acetyltransferase 15, NatA auxiliary subunit (NAA15) | 11.4 | ||||
| LDTP04963 | 26S proteasome regulatory subunit 8 (PSMC5) | 11.4 | ||||
| LDTP02909 | cAMP-dependent protein kinase catalytic subunit alpha (PRKACA) | 10.4 | ||||
| LDTP10862 | Proteasome subunit beta type-7 (PSMB7) | 10.1 | ||||
| LDTP04884 | Proteasome subunit alpha type-6 (PSMA6) | 10.0 | ||||
| LDTP05077 | Casein kinase II subunit alpha (CSNK2A1) | 9.7 | ||||
| LDTP09899 | Probable ATP-dependent RNA helicase DDX17 (DDX17) | 9.5 | ||||
| LDTP02933 | 26S proteasome regulatory subunit 6A (PSMC3) | 9.5 | ||||
| LDTP04200 | Glutathione synthetase (GSS) | 9.3 | ||||
| LDTP05812 | Ras GTPase-activating protein-binding protein 1 (G3BP1) | 8.7 | ||||
| LDTP15993 | Aminopeptidase B (RNPEP) | 8.0 | ||||
| LDTP13056 | Leucine--tRNA ligase, cytoplasmic (LARS1) | 8.0 | ||||
| LDTP04999 | Actin, aortic smooth muscle (ACTA2) | 8.0 | ||||
| LDTP03387 | Mitogen-activated protein kinase 3 (MAPK3) | 7.5 | ||||
| LDTP02223 | Cathepsin B (CTSB) | 7.3 | ||||
| LDTP02541 | Heat shock cognate 71 kDa protein (HSPA8) | 7.2 | ||||
| LDTP03333 | Proteasome subunit alpha type-4 (PSMA4) | 7.1 | ||||
| LDTP03510 | Peroxiredoxin-6 (PRDX6) | 6.9 | ||||
| LDTP15404 | Leucine-rich repeat-containing protein 47 (LRRC47) | 6.9 | ||||
| LDTP04960 | Serine/threonine-protein phosphatase PP1-beta catalytic subunit (PPP1CB) | 6.7 | ||||
| LDTP06427 | Translin (TSN) | 6.7 | ||||
| LDTP02204 | Calpain-1 catalytic subunit (CAPN1) | 6.5 | ||||
| LDTP02924 | Probable ATP-dependent RNA helicase DDX5 (DDX5) | 6.4 | ||||
| LDTP03445 | Mitogen-activated protein kinase 1 (MAPK1) | 6.3 | ||||
| LDTP10848 | ATP-dependent zinc metalloprotease YME1L1 (YME1L1) | 6.2 | ||||
| LDTP03975 | Exosome RNA helicase MTR4 (MTREX) | 6.1 | ||||
| LDTP04909 | ATP-binding cassette sub-family E member 1 (ABCE1) | 6.1 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 6.0 | ||||
| LDTP04399 | Ras-related protein Rab-7a (RAB7A) | 6.0 | ||||
| LDTP11529 | GTP-binding protein 4 (GTPBP4) | 5.9 | ||||
| LDTP04876 | Actin, cytoplasmic 1 (ACTB) | 5.9 | ||||
| LDTP04878 | Eukaryotic initiation factor 4A-I (EIF4A1) | 5.9 | ||||
| LDTP03166 | Ubiquitin-like modifier-activating enzyme 1 (UBA1) | 5.9 | ||||
| LDTP05434 | Lactoylglutathione lyase (GLO1) | 5.7 | ||||
| LDTP02161 | Glycogen phosphorylase, liver form (PYGL) | 5.4 | ||||
| LDTP06089 | Eukaryotic initiation factor 4A-II (EIF4A2) | 5.4 | ||||
| LDTP03626 | Peroxiredoxin-2 (PRDX2) | 5.3 | ||||
| LDTP05808 | Transcription intermediary factor 1-beta (TRIM28) | 5.2 | ||||
| LDTP01782 | Hypoxanthine-guanine phosphoribosyltransferase (HPRT1) | 5.2 | ||||
| LDTP04552 | Biliverdin reductase A (BLVRA) | 5.2 | ||||
| LDTP03858 | Lysosomal acid lipase/cholesteryl ester hydrolase (LIPA) | 5.1 | ||||
| LDTP04561 | ATP-citrate synthase (ACLY) | 5.0 | ||||
| LDTP03521 | Protein disulfide-isomerase A3 (PDIA3) | 5.0 | ||||
| LDTP02502 | Thioredoxin (TXN) | 5.0 | ||||
| LDTP12688 | ATP-dependent RNA helicase DDX18 (DDX18) | 5.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12510 | Aladin (AAAS) | 20.0 | ||||
| LDTP04393 | Annexin A11 (ANXA11) | 20.0 | ||||
| LDTP05528 | Apoptosis regulator BAX (BAX) | 20.0 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 20.0 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 20.0 | ||||
| LDTP04426 | B-cell receptor-associated protein 31 (BCAP31) | 20.0 | ||||
| LDTP10036 | BOS complex subunit NCLN (NCLN) | 20.0 | ||||
| LDTP06996 | BOS complex subunit NOMO2 (NOMO2) | 20.0 | ||||
| LDTP08673 | Calcium uptake protein 2, mitochondrial (MICU2) | 20.0 | ||||
| LDTP03405 | Calnexin (CANX) | 20.0 | ||||
| LDTP10804 | Chloride channel CLIC-like protein 1 (CLCC1) | 20.0 | ||||
| LDTP10989 | Copine-1 (CPNE1) | 20.0 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 20.0 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 20.0 | ||||
| LDTP02058 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 (RPN2) | 20.0 | ||||
| LDTP01301 | Electrogenic aspartate/glutamate antiporter SLC25A12, mitochondrial (SLC25A12) | 20.0 | ||||
| LDTP13393 | Electrogenic aspartate/glutamate antiporter SLC25A13, mitochondrial (SLC25A13) | 20.0 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 20.0 | ||||
| LDTP08960 | ER membrane protein complex subunit 1 (EMC1) | 20.0 | ||||
| LDTP01234 | Erlin-1 (ERLIN1) | 20.0 | ||||
| LDTP01455 | Erlin-2 (ERLIN2) | 20.0 | ||||
| LDTP00287 | Exocyst complex component 5 (EXOC5) | 20.0 | ||||
| LDTP00014 | Extended synaptotagmin-2 (ESYT2) | 20.0 | ||||
| LDTP06103 | Filamin-C (FLNC) | 20.0 | ||||
| LDTP01366 | Flotillin-1 (FLOT1) | 20.0 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 20.0 | ||||
| LDTP12281 | Golgi-associated PDZ and coiled-coil motif-containing protein (GOPC) | 20.0 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 20.0 | ||||
| LDTP05084 | Hemoglobin subunit alpha (HBA1; HBA2) | 20.0 | ||||
| LDTP00328 | Importin subunit alpha-3 (KPNA4) | 20.0 | ||||
| LDTP13322 | Importin-11 (IPO11) | 20.0 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 20.0 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 20.0 | ||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 20.0 | ||||
| LDTP11732 | Magnesium transporter protein 1 (MAGT1) | 20.0 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 20.0 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 20.0 | ||||
| LDTP01217 | Metaxin-2 (MTX2) | 20.0 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 20.0 | ||||
| LDTP06660 | MICOS complex subunit MIC60 (IMMT) | 20.0 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 20.0 | ||||
| LDTP13823 | Mitochondrial chaperone BCS1 (BCS1L) | 20.0 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 20.0 | ||||
| LDTP04956 | Mitochondrial import inner membrane translocase subunit Tim10 (TIMM10) | 20.0 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 20.0 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 20.0 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 20.0 | ||||
| LDTP00821 | Mitochondrial import inner membrane translocase subunit TIM44 (TIMM44) | 20.0 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 20.0 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 20.0 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 20.0 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 20.0 | ||||
| LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 20.0 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 20.0 | ||||
| LDTP09278 | Multiple coagulation factor deficiency protein 2 (MCFD2) | 20.0 | ||||
| LDTP04013 | Neutral amino acid transporter A (SLC1A4) | 20.0 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 20.0 | ||||
| LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 20.0 | ||||
| LDTP00361 | Nuclear envelope integral membrane protein 1 (NEMP1) | 20.0 | ||||
| LDTP04800 | Nuclear pore complex protein Nup107 (NUP107) | 20.0 | ||||
| LDTP09825 | Nuclear pore complex protein Nup205 (NUP205) | 20.0 | ||||
| LDTP03777 | Nuclear pore complex protein Nup214 (NUP214) | 20.0 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 20.0 | ||||
| LDTP09204 | Nucleoporin NUP35 (NUP35) | 20.0 | ||||
| LDTP09203 | Nucleoporin Nup37 (NUP37) | 20.0 | ||||
| LDTP02612 | Nucleoprotein TPR (TPR) | 20.0 | ||||
| LDTP11531 | Oxysterol-binding protein-related protein 8 (OSBPL8) | 20.0 | ||||
| LDTP06331 | Pericentriolar material 1 protein (PCM1) | 20.0 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 20.0 | ||||
| LDTP14181 | Peroxisomal membrane protein PEX16 (PEX16) | 20.0 | ||||
| LDTP04213 | Phosphatidylinositol transfer protein beta isoform (PITPNB) | 20.0 | ||||
| LDTP18053 | Probable mitochondrial glutathione transporter SLC25A40 (SLC25A40) | 20.0 | ||||
| LDTP12272 | Prolactin regulatory element-binding protein (PREB) | 20.0 | ||||
| LDTP02215 | Prosaposin (PSAP) | 20.0 | ||||
| LDTP04237 | Protein ERGIC-53 (LMAN1) | 20.0 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 20.0 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 20.0 | ||||
| LDTP03869 | Protein Mpv17 (MPV17) | 20.0 | ||||
| LDTP00590 | Protein RER1 (RER1) | 20.0 | ||||
| LDTP04707 | Protein SEC13 homolog (SEC13) | 20.0 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 20.0 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 20.0 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 20.0 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 20.0 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 20.0 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 20.0 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 20.0 | ||||
| LDTP12090 | Sideroflexin-1 (SFXN1) | 20.0 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 20.0 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 20.0 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 20.0 | ||||
| LDTP14636 | Solute carrier family 25 member 16 (SLC25A16) | 20.0 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 20.0 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 20.0 | ||||
| LDTP10533 | Sorting nexin-27 (SNX27) | 20.0 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 20.0 | ||||
| LDTP01454 | SUN domain-containing protein 1 (SUN1) | 20.0 | ||||
| LDTP05780 | Syntaxin-5 (STX5) | 20.0 | ||||
| LDTP00310 | Syntenin-1 (SDCBP) | 20.0 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 20.0 | ||||
| LDTP13243 | Translocation protein SEC63 homolog (SEC63) | 20.0 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 20.0 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 20.0 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 20.0 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 20.0 | ||||
| LDTP11291 | Transmembrane emp24 domain-containing protein 9 (TMED9) | 20.0 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 20.0 | ||||
| LDTP12979 | Transmembrane protein 14C (TMEM14C) | 20.0 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 20.0 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 20.0 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 20.0 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 20.0 | ||||
| LDTP09949 | Transportin-1 (TNPO1) | 20.0 | ||||
| LDTP14133 | Transportin-3 (TNPO3) | 20.0 | ||||
| LDTP12695 | Trimeric intracellular cation channel type B (TMEM38B) | 20.0 | ||||
| LDTP12533 | Ubiquilin-4 (UBQLN4) | 20.0 | ||||
| LDTP10343 | Vacuole membrane protein 1 (VMP1) | 20.0 | ||||
| LDTP01556 | Vesicle-associated membrane protein-associated protein B/C (VAPB) | 20.0 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 20.0 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 20.0 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 20.0 | ||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | 20.0 | ||||
| LDTP13953 | Endophilin-B1 (SH3GLB1) | 19.9 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 19.8 | ||||
| LDTP08769 | Nuclear pore complex protein Nup93 (NUP93) | 19.4 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 19.0 | ||||
| LDTP03717 | Prohibitin 1 (PHB1) | 18.9 | ||||
| LDTP10081 | Leucine-rich repeat-containing protein 59 (LRRC59) | 18.7 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 18.5 | ||||
| LDTP06549 | Hsp90 co-chaperone Cdc37 (CDC37) | 18.4 | ||||
| LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | 18.2 | ||||
| LDTP04932 | Protein transport protein Sec61 subunit alpha isoform 1 (SEC61A1) | 18.1 | ||||
| LDTP03104 | V-type proton ATPase subunit B, brain isoform (ATP6V1B2) | 18.1 | ||||
| LDTP12078 | Mitochondrial glutamate carrier 1 (SLC25A22) | 18.0 | ||||
| LDTP06242 | Importin subunit beta-1 (KPNB1) | 17.9 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 17.7 | ||||
| LDTP06462 | Neutral amino acid transporter B(0) (SLC1A5) | 17.7 | ||||
| LDTP11916 | Tubulin beta-1 chain (TUBB1) | 17.4 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 16.8 | ||||
| LDTP11103 | Thioredoxin domain-containing protein 17 (TXNDC17) | 16.8 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 16.7 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 16.7 | ||||
| LDTP11229 | Transmembrane protein 70, mitochondrial (TMEM70) | 16.7 | ||||
| LDTP01295 | Nuclear pore complex protein Nup155 (NUP155) | 16.6 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 16.6 | ||||
| LDTP13262 | Signal recognition particle subunit SRP68 (SRP68) | 16.2 | ||||
| LDTP09515 | Importin-4 (IPO4) | 15.9 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 15.4 | ||||
| LDTP02057 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 (RPN1) | 15.2 | ||||
| LDTP10663 | Importin-9 (IPO9) | 14.7 | ||||
| LDTP00434 | Transportin-2 (TNPO2) | 14.7 | ||||
| LDTP03064 | Cytochrome c oxidase subunit 5A, mitochondrial (COX5A) | 14.6 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 14.6 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 14.1 | ||||
| LDTP03839 | Nuclear pore glycoprotein p62 (NUP62) | 14.1 | ||||
| LDTP04501 | Importin subunit alpha-1 (KPNA2) | 14.0 | ||||
| LDTP01748 | Mitochondrial import receptor subunit TOM40 homolog (TOMM40) | 13.9 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 13.8 | ||||
| LDTP02087 | ADP/ATP translocase 2 (SLC25A5) | 13.8 | ||||
| LDTP03870 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit (DDOST) | 13.8 | ||||
| LDTP04787 | Transmembrane protein 33 (TMEM33) | 13.7 | ||||
| LDTP01969 | Transferrin receptor protein 1 (TFRC) | 13.6 | ||||
| LDTP11310 | Nuclear pore complex protein Nup85 (NUP85) | 13.6 | ||||
| LDTP04553 | Tricarboxylate transport protein, mitochondrial (SLC25A1) | 13.5 | ||||
| LDTP05642 | Nuclear pore complex protein Nup160 (NUP160) | 13.4 | ||||
| LDTP05690 | Vesicular integral-membrane protein VIP36 (LMAN2) | 13.2 | ||||
| LDTP05238 | Solute carrier family 25 member 3 (SLC25A3) | 13.1 | ||||
| LDTP05591 | Nuclear cap-binding protein subunit 1 (NCBP1) | 13.1 | ||||
| LDTP04953 | 14-3-3 protein gamma (YWHAG) | 13.0 | ||||
| LDTP11161 | Extended synaptotagmin-1 (ESYT1) | 12.9 | ||||
| LDTP13416 | Stomatin-like protein 2, mitochondrial (STOML2) | 12.8 | ||||
| LDTP13599 | Calcium load-activated calcium channel (TMCO1) | 12.8 | ||||
| LDTP00266 | Importin-5 (IPO5) | 12.6 | ||||
| LDTP01043 | Sorting nexin-2 (SNX2) | 12.6 | ||||
| LDTP01100 | Iron-sulfur clusters transporter ABCB7, mitochondrial (ABCB7) | 12.5 | ||||
| LDTP03327 | ATP synthase subunit alpha, mitochondrial (ATP5F1A) | 12.4 | ||||
| LDTP00451 | Secretory carrier-associated membrane protein 3 (SCAMP3) | 12.3 | ||||
| LDTP05510 | Complement component 1 Q subcomponent-binding protein, mitochondrial (C1QBP) | 12.2 | ||||
| LDTP04662 | Exportin-2 (CSE1L) | 12.2 | ||||
| LDTP01574 | Importin-7 (IPO7) | 12.2 | ||||
| LDTP05038 | AP-2 complex subunit beta (AP2B1) | 12.0 | ||||
| LDTP03810 | ATP synthase subunit gamma, mitochondrial (ATP5F1C) | 12.0 | ||||
| LDTP01037 | Catenin delta-1 (CTNND1) | 9.4 | ||||
| LDTP02307 | Annexin A5 (ANXA5) | 8.9 | ||||
| LDTP03385 | 14-3-3 protein theta (YWHAQ) | 8.2 | ||||
| LDTP05043 | 14-3-3 protein zeta/delta (YWHAZ) | 7.0 | ||||
| LDTP12142 | Exportin-5 (XPO5) | 6.9 | ||||
| LDTP04391 | T-complex protein 1 subunit delta (CCT4) | 6.1 | ||||
| LDTP02262 | Heat shock protein HSP 90-beta (HSP90AB1) | 5.4 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 20.0 | ||||
| LDTP05235 | Transcription factor A, mitochondrial (TFAM) | 20.0 | ||||
| LDTP09932 | SWI/SNF complex subunit SMARCC1 (SMARCC1) | 19.9 | ||||
| LDTP09694 | Paraspeckle component 1 (PSPC1) | 18.7 | ||||
| LDTP03212 | Splicing factor, proline- and glutamine-rich (SFPQ) | 12.6 | ||||
| LDTP06341 | Non-POU domain-containing octamer-binding protein (NONO) | 12.5 | ||||
| LDTP03363 | High mobility group protein B2 (HMGB2) | 9.1 | ||||
GPCR
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP14610 | Golgi pH regulator B (GPR89B) | 20.0 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | 20.0 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01323 | 26S proteasome non-ATPase regulatory subunit 10 (PSMD10) | 20.0 | ||||
| LDTP09837 | A-kinase anchor protein 1, mitochondrial (AKAP1) | 20.0 | ||||
| LDTP04679 | Afadin (AFDN) | 20.0 | ||||
| LDTP04904 | Alpha-centractin (ACTR1A) | 20.0 | ||||
| LDTP04647 | Alpha-soluble NSF attachment protein (NAPA) | 20.0 | ||||
| LDTP05687 | Aminoacyl tRNA synthase complex-interacting multifunctional protein 1 (AIMP1) | 20.0 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 20.0 | ||||
| LDTP08682 | Ankyrin repeat domain-containing protein 13A (ANKRD13A) | 20.0 | ||||
| LDTP03030 | Annexin A7 (ANXA7) | 20.0 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 20.0 | ||||
| LDTP12692 | Armadillo repeat-containing protein 1 (ARMC1) | 20.0 | ||||
| LDTP16196 | Armadillo repeat-containing X-linked protein 3 (ARMCX3) | 20.0 | ||||
| LDTP13091 | Ataxin-10 (ATXN10) | 20.0 | ||||
| LDTP10947 | Ataxin-2 (ATXN2) | 20.0 | ||||
| LDTP09655 | Ataxin-2-like protein (ATXN2L) | 20.0 | ||||
| LDTP01684 | BAG family molecular chaperone regulator 3 (BAG3) | 20.0 | ||||
| LDTP07598 | BRCA1-associated ATM activator 1 (BRAT1) | 20.0 | ||||
| LDTP08570 | Calcium homeostasis endoplasmic reticulum protein (CHERP) | 20.0 | ||||
| LDTP00493 | Calmegin (CLGN) | 20.0 | ||||
| LDTP00887 | Calumenin (CALU) | 20.0 | ||||
| LDTP02511 | cAMP-dependent protein kinase type I-alpha regulatory subunit (PRKAR1A) | 20.0 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 20.0 | ||||
| LDTP11611 | Centrosomal protein of 44 kDa (CEP44) | 20.0 | ||||
| LDTP03665 | Cleavage stimulation factor subunit 2 (CSTF2) | 20.0 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 20.0 | ||||
| LDTP04570 | Coatomer subunit beta (COPB1) | 20.0 | ||||
| LDTP00376 | Coatomer subunit epsilon (COPE) | 20.0 | ||||
| LDTP08842 | Cohesin subunit SA-2 (STAG2) | 20.0 | ||||
| LDTP12379 | Complex I assembly factor TIMMDC1, mitochondrial (TIMMDC1) | 20.0 | ||||
| LDTP04906 | COP9 signalosome complex subunit 2 (COPS2) | 20.0 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 20.0 | ||||
| LDTP06083 | Cytoplasmic dynein 1 heavy chain 1 (DYNC1H1) | 20.0 | ||||
| LDTP14250 | Cytoplasmic dynein 1 light intermediate chain 1 (DYNC1LI1) | 20.0 | ||||
| LDTP07958 | Cytoplasmic FMR1-interacting protein 1 (CYFIP1) | 20.0 | ||||
| LDTP10271 | DAZ-associated protein 1 (DAZAP1) | 20.0 | ||||
| LDTP10403 | DDRGK domain-containing protein 1 (DDRGK1) | 20.0 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 20.0 | ||||
| LDTP03606 | DnaJ homolog subfamily A member 1 (DNAJA1) | 20.0 | ||||
| LDTP06082 | Dynactin subunit 1 (DCTN1) | 20.0 | ||||
| LDTP05922 | Dynactin subunit 2 (DCTN2) | 20.0 | ||||
| LDTP08387 | Dynein axonemal assembly factor 5 (DNAAF5) | 20.0 | ||||
| LDTP17659 | ELMO domain-containing protein 2 (ELMOD2) | 20.0 | ||||
| LDTP04064 | Elongation factor Ts, mitochondrial (TSFM) | 20.0 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 20.0 | ||||
| LDTP13097 | Epidermal growth factor receptor substrate 15-like 1 (EPS15L1) | 20.0 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 20.0 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 20.0 | ||||
| LDTP00620 | Eukaryotic translation initiation factor 3 subunit H (EIF3H) | 20.0 | ||||
| LDTP05421 | Eukaryotic translation initiation factor 4 gamma 1 (EIF4G1) | 20.0 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 20.0 | ||||
| LDTP12434 | Exosome complex component RRP40 (EXOSC3) | 20.0 | ||||
| LDTP04127 | F-actin-capping protein subunit beta (CAPZB) | 20.0 | ||||
| LDTP00729 | Glycosylphosphatidylinositol anchor attachment 1 protein (GPAA1) | 20.0 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 20.0 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 20.0 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 20.0 | ||||
| LDTP07964 | Golgi to ER traffic protein 4 homolog (GET4) | 20.0 | ||||
| LDTP10015 | GPI transamidase component PIG-T (PIGT) | 20.0 | ||||
| LDTP10184 | HAUS augmin-like complex subunit 1 (HAUS1) | 20.0 | ||||
| LDTP12700 | HAUS augmin-like complex subunit 2 (HAUS2) | 20.0 | ||||
| LDTP07318 | HAUS augmin-like complex subunit 3 (HAUS3) | 20.0 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 20.0 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 20.0 | ||||
| LDTP02053 | Heat shock protein beta-1 (HSPB1) | 20.0 | ||||
| LDTP13797 | HIG1 domain family member 1A, mitochondrial (HIGD1A) | 20.0 | ||||
| LDTP03841 | Hippocalcin-like protein 1 (HPCAL1) | 20.0 | ||||
| LDTP01259 | Interferon-inducible double-stranded RNA-dependent protein kinase activator A (PRKRA) | 20.0 | ||||
| LDTP10700 | KH domain-containing RNA-binding protein QKI (QKI) | 20.0 | ||||
| LDTP10263 | KIF-binding protein (KIFBP) | 20.0 | ||||
| LDTP08238 | Kinectin (KTN1) | 20.0 | ||||
| LDTP12192 | Kinetochore protein Spc25 (SPC25) | 20.0 | ||||
| LDTP03065 | Lamin-B1 (LMNB1) | 20.0 | ||||
| LDTP03967 | Lamina-associated polypeptide 2, isoform alpha (TMPO) | 20.0 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 20.0 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 20.0 | ||||
| LDTP05741 | Large ribosomal subunit protein bL28m (MRPL28) | 20.0 | ||||
| LDTP15922 | Large ribosomal subunit protein mL37 (MRPL37) | 20.0 | ||||
| LDTP12395 | Large ribosomal subunit protein mL40 (MRPL40) | 20.0 | ||||
| LDTP15863 | Large ribosomal subunit protein mL45 (MRPL45) | 20.0 | ||||
| LDTP15976 | Large ribosomal subunit protein mL46 (MRPL46) | 20.0 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 20.0 | ||||
| LDTP15887 | Lipase maturation factor 2 (LMF2) | 20.0 | ||||
| LDTP14217 | Lipid droplet-regulating VLDL assembly factor AUP1 (AUP1) | 20.0 | ||||
| LDTP14165 | Melanoma-associated antigen D1 (MAGED1) | 20.0 | ||||
| LDTP13657 | Melanoma-associated antigen D2 (MAGED2) | 20.0 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 20.0 | ||||
| LDTP03404 | Microtubule-associated protein 4 (MAP4) | 20.0 | ||||
| LDTP06413 | Microtubule-associated protein RP/EB family member 2 (MAPRE2) | 20.0 | ||||
| LDTP08058 | Mitochondrial antiviral-signaling protein (MAVS) | 20.0 | ||||
| LDTP11670 | Mitochondrial fission factor (MFF) | 20.0 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 20.0 | ||||
| LDTP15874 | Mitochondrial import inner membrane translocase subunit Tim29 (TIMM29) | 20.0 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 20.0 | ||||
| LDTP10275 | Mitochondrial potassium channel (CCDC51) | 20.0 | ||||
| LDTP00487 | Myosin regulatory light chain 12B (MYL12B) | 20.0 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 20.0 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 20.0 | ||||
| LDTP13093 | Neurochondrin (NCDN) | 20.0 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 20.0 | ||||
| LDTP04951 | Nuclear transport factor 2 (NUTF2) | 20.0 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 20.0 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 20.0 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 20.0 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 20.0 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 20.0 | ||||
| LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 20.0 | ||||
| LDTP10889 | Perilipin-2 (PLIN2) | 20.0 | ||||
| LDTP01021 | Perilipin-3 (PLIN3) | 20.0 | ||||
| LDTP05895 | Phosphatidylinositol-binding clathrin assembly protein (PICALM) | 20.0 | ||||
| LDTP13309 | Prefoldin subunit 2 (PFDN2) | 20.0 | ||||
| LDTP04935 | Prefoldin subunit 3 (VBP1) | 20.0 | ||||
| LDTP10873 | Prefoldin subunit 5 (PFDN5) | 20.0 | ||||
| LDTP05484 | Proteasome activator complex subunit 1 (PSME1) | 20.0 | ||||
| LDTP07255 | Proteasome adapter and scaffold protein ECM29 (ECPAS) | 20.0 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 20.0 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 20.0 | ||||
| LDTP09773 | Protein FAM3C (FAM3C) | 20.0 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 20.0 | ||||
| LDTP01174 | Protein NipSnap homolog 2 (NIPSNAP2) | 20.0 | ||||
| LDTP13430 | Protein TASOR (TASOR) | 20.0 | ||||
| LDTP09851 | Protein TFG (TFG) | 20.0 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 20.0 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 20.0 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 20.0 | ||||
| LDTP11833 | Rab3 GTPase-activating protein non-catalytic subunit (RAB3GAP2) | 20.0 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 20.0 | ||||
| LDTP07476 | RAD50-interacting protein 1 (RINT1) | 20.0 | ||||
| LDTP07401 | Ragulator complex protein LAMTOR1 (LAMTOR1) | 20.0 | ||||
| LDTP13647 | Ras GTPase-activating protein-binding protein 2 (G3BP2) | 20.0 | ||||
| LDTP06352 | Reticulocalbin-1 (RCN1) | 20.0 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 20.0 | ||||
| LDTP06182 | Ribosomal RNA processing protein 1 homolog B (RRP1B) | 20.0 | ||||
| LDTP05224 | RNA-binding protein 10 (RBM10) | 20.0 | ||||
| LDTP05318 | RNA-binding protein EWS (EWSR1) | 20.0 | ||||
| LDTP14453 | RNA-binding protein Musashi homolog 1 (MSI1) | 20.0 | ||||
| LDTP10357 | RUS family member 1 (RUSF1) | 20.0 | ||||
| LDTP09615 | Sec1 family domain-containing protein 1 (SCFD1) | 20.0 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 20.0 | ||||
| LDTP00862 | Small glutamine-rich tetratricopeptide repeat-containing protein alpha (SGTA) | 20.0 | ||||
| LDTP14788 | Small ribosomal subunit protein mS35 (MRPS35) | 20.0 | ||||
| LDTP10285 | Small ribosomal subunit protein mS39 (PTCD3) | 20.0 | ||||
| LDTP14215 | Small ribosomal subunit protein mS40 (MRPS18B) | 20.0 | ||||
| LDTP14792 | Small ribosomal subunit protein uS9m (MRPS9) | 20.0 | ||||
| LDTP14172 | Sorting nexin-9 (SNX9) | 20.0 | ||||
| LDTP05985 | Spectrin alpha chain, non-erythrocytic 1 (SPTAN1) | 20.0 | ||||
| LDTP06280 | Squamous cell carcinoma antigen recognized by T-cells 3 (SART3) | 20.0 | ||||
| LDTP06094 | Src substrate cortactin (CTTN) | 20.0 | ||||
| LDTP06181 | Structural maintenance of chromosomes protein 1A (SMC1A) | 20.0 | ||||
| LDTP12606 | Structural maintenance of chromosomes protein 4 (SMC4) | 20.0 | ||||
| LDTP10062 | Synapse-associated protein 1 (SYAP1) | 20.0 | ||||
| LDTP08389 | Syntaxin-12 (STX12) | 20.0 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 20.0 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 20.0 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 20.0 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 20.0 | ||||
| LDTP07012 | Torsin-1A-interacting protein 1 (TOR1AIP1) | 20.0 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 20.0 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 20.0 | ||||
| LDTP13967 | Transmembrane emp24 domain-containing protein 5 (TMED5) | 20.0 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 20.0 | ||||
| LDTP18494 | Tropomodulin-3 (TMOD3) | 20.0 | ||||
| LDTP10860 | Tubulin-folding cofactor B (TBCB) | 20.0 | ||||
| LDTP06479 | Tubulin-specific chaperone E (TBCE) | 20.0 | ||||
| LDTP13922 | Tudor and KH domain-containing protein (TDRKH) | 20.0 | ||||
| LDTP00759 | Tumor protein D54 (TPD52L2) | 20.0 | ||||
| LDTP10217 | U5 small nuclear ribonucleoprotein 40 kDa protein (SNRNP40) | 20.0 | ||||
| LDTP13626 | Ubiquilin-1 (UBQLN1) | 20.0 | ||||
| LDTP13273 | Ubiquilin-2 (UBQLN2) | 20.0 | ||||
| LDTP12666 | Ubiquinol-cytochrome c reductase complex assembly factor 1 (UQCC1) | 20.0 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 20.0 | ||||
| LDTP06060 | Ubiquitin-associated protein 2-like (UBAP2L) | 20.0 | ||||
| LDTP17652 | Uncharacterized protein KIAA2013 (KIAA2013) | 20.0 | ||||
| LDTP10097 | Vacuolar protein sorting-associated protein 33A (VPS33A) | 20.0 | ||||
| LDTP02946 | Vinculin (VCL) | 20.0 | ||||
| LDTP01118 | WD repeat-containing protein 1 (WDR1) | 20.0 | ||||
| LDTP08094 | Wings apart-like protein homolog (WAPL) | 20.0 | ||||
| LDTP01171 | Zinc finger protein ZPR1 (ZPR1) | 20.0 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 18.5 | ||||
| LDTP01750 | Peroxisomal membrane protein 11B (PEX11B) | 18.3 | ||||
| LDTP09913 | CUGBP Elav-like family member 1 (CELF1) | 18.1 | ||||
| LDTP12762 | Transmembrane protein 161A (TMEM161A) | 18.0 | ||||
| LDTP02297 | Vimentin (VIM) | 18.0 | ||||
| LDTP12677 | DnaJ homolog subfamily C member 11 (DNAJC11) | 17.5 | ||||
| LDTP02322 | U1 small nuclear ribonucleoprotein A (SNRPA) | 17.4 | ||||
| LDTP01358 | Pre-mRNA-splicing factor SPF27 (BCAS2) | 17.4 | ||||
| LDTP05400 | Lamin-B2 (LMNB2) | 17.2 | ||||
| LDTP06587 | Survival motor neuron protein (SMN1; SMN2) | 17.0 | ||||
| LDTP06121 | Caprin-1 (CAPRIN1) | 16.8 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 16.8 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 16.8 | ||||
| LDTP04028 | DNA mismatch repair protein Msh2 (MSH2) | 16.7 | ||||
| LDTP01932 | Prelamin-A/C (LMNA) | 16.6 | ||||
| LDTP05533 | Kinesin light chain 1 (KLC1) | 16.5 | ||||
| LDTP10924 | Prohibitin-2 (PHB2) | 16.4 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 16.3 | ||||
| LDTP04241 | Nuclear autoantigenic sperm protein (NASP) | 16.2 | ||||
| LDTP07718 | MICOS complex subunit MIC27 (APOOL) | 16.1 | ||||
| LDTP02816 | Replication protein A 32 kDa subunit (RPA2) | 15.9 | ||||
| LDTP04395 | RNA-binding protein FXR1 (FXR1) | 15.9 | ||||
| LDTP15253 | HEAT repeat-containing protein 3 (HEATR3) | 15.2 | ||||
| LDTP09878 | Symplekin (SYMPK) | 15.2 | ||||
| LDTP10185 | FAS-associated factor 2 (FAF2) | 15.1 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 14.8 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 14.7 | ||||
| LDTP05525 | KH domain-containing, RNA-binding, signal transduction-associated protein 1 (KHDRBS1) | 14.6 | ||||
| LDTP13813 | Eukaryotic translation initiation factor 3 subunit L (EIF3L) | 14.1 | ||||
| LDTP06948 | Protein YIF1B (YIF1B) | 14.0 | ||||
| LDTP13338 | Vacuolar protein sorting-associated protein 51 homolog (VPS51) | 13.9 | ||||
| LDTP14277 | Cytochrome c oxidase assembly protein COX11, mitochondrial (COX11) | 13.8 | ||||
| LDTP12476 | Translation initiation factor eIF2B subunit gamma (EIF2B3) | 13.8 | ||||
| LDTP10078 | Far upstream element-binding protein 1 (FUBP1) | 13.7 | ||||
| LDTP02734 | Endoplasmin (HSP90B1) | 13.7 | ||||
| LDTP04947 | DDB1- and CUL4-associated factor 7 (DCAF7) | 13.5 | ||||
| LDTP04201 | T-complex protein 1 subunit epsilon (CCT5) | 13.4 | ||||
| LDTP13630 | Neudesin (NENF) | 13.4 | ||||
| LDTP00417 | Programmed cell death protein 5 (PDCD5) | 13.4 | ||||
| LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | 13.3 | ||||
| LDTP00843 | Alpha-actinin-4 (ACTN4) | 13.3 | ||||
| LDTP05257 | Receptor expression-enhancing protein 5 (REEP5) | 13.3 | ||||
| LDTP09580 | Programmed cell death 6-interacting protein (PDCD6IP) | 13.2 | ||||
| LDTP04356 | Emerin (EMD) | 13.1 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 13.1 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 13.0 | ||||
| LDTP06305 | WD repeat-containing protein 43 (WDR43) | 13.0 | ||||
| LDTP01432 | Mitochondrial import receptor subunit TOM70 (TOMM70) | 13.0 | ||||
| LDTP06268 | Condensin complex subunit 2 (NCAPH) | 13.0 | ||||
| LDTP17065 | Heterogeneous nuclear ribonucleoprotein U-like protein 2 (HNRNPUL2) | 12.9 | ||||
| LDTP09938 | Far upstream element-binding protein 2 (KHSRP) | 12.8 | ||||
| LDTP04917 | Proteasome activator complex subunit 3 (PSME3) | 12.8 | ||||
| LDTP03711 | Catenin alpha-1 (CTNNA1) | 12.8 | ||||
| LDTP14272 | Insulin-like growth factor 2 mRNA-binding protein 2 (IGF2BP2) | 12.8 | ||||
| LDTP06444 | Microtubule-associated protein RP/EB family member 1 (MAPRE1) | 12.8 | ||||
| LDTP04199 | Protein PRRC2A (PRRC2A) | 12.7 | ||||
| LDTP06393 | Splicing factor 3A subunit 1 (SF3A1) | 12.7 | ||||
| LDTP13906 | Polymerase delta-interacting protein 2 (POLDIP2) | 12.7 | ||||
| LDTP11144 | Endoplasmic reticulum resident protein 44 (ERP44) | 12.7 | ||||
| LDTP05277 | Protein SET (SET) | 12.7 | ||||
| LDTP03509 | Endoplasmic reticulum resident protein 29 (ERP29) | 12.7 | ||||
| LDTP11197 | Mini-chromosome maintenance complex-binding protein (MCMBP) | 12.7 | ||||
| LDTP03712 | Catenin beta-1 (CTNNB1) | 12.7 | ||||
| LDTP04500 | Heterogeneous nuclear ribonucleoprotein M (HNRNPM) | 12.7 | ||||
| LDTP04249 | T-complex protein 1 subunit gamma (CCT3) | 12.7 | ||||
| LDTP03612 | Bifunctional purine biosynthesis protein ATIC (ATIC) | 12.7 | ||||
| LDTP02631 | Alpha-actinin-1 (ACTN1) | 12.6 | ||||
| LDTP13908 | AP-3 complex subunit mu-1 (AP3M1) | 12.6 | ||||
| LDTP03619 | Stress-induced-phosphoprotein 1 (STIP1) | 12.6 | ||||
| LDTP10684 | RNA-binding protein 14 (RBM14) | 12.5 | ||||
| LDTP04714 | Heterogeneous nuclear ribonucleoprotein H2 (HNRNPH2) | 12.5 | ||||
| LDTP00398 | Insulin receptor substrate 4 (IRS4) | 12.5 | ||||
| LDTP13817 | Nuclear migration protein nudC (NUDC) | 12.5 | ||||
| LDTP05113 | T-complex protein 1 subunit beta (CCT2) | 12.5 | ||||
| LDTP03997 | Leucine-rich PPR motif-containing protein, mitochondrial (LRPPRC) | 12.4 | ||||
| LDTP00306 | Pescadillo homolog (PES1) | 12.4 | ||||
| LDTP05442 | 14-3-3 protein eta (YWHAH) | 12.4 | ||||
| LDTP02165 | Tropomyosin alpha-3 chain (TPM3) | 12.4 | ||||
| LDTP05068 | Tropomyosin alpha-4 chain (TPM4) | 12.4 | ||||
| LDTP04853 | Eukaryotic translation initiation factor 3 subunit E (EIF3E) | 12.3 | ||||
| LDTP04117 | Ras GTPase-activating-like protein IQGAP1 (IQGAP1) | 12.3 | ||||
| LDTP04627 | UV excision repair protein RAD23 homolog B (RAD23B) | 12.3 | ||||
| LDTP03615 | Heterogeneous nuclear ribonucleoprotein H (HNRNPH1) | 12.3 | ||||
| LDTP11238 | Heterogeneous nuclear ribonucleoprotein U-like protein 1 (HNRNPUL1) | 12.2 | ||||
| LDTP04514 | Heterogeneous nuclear ribonucleoprotein F (HNRNPF) | 12.2 | ||||
| LDTP08760 | Cell cycle and apoptosis regulator protein 2 (CCAR2) | 12.2 | ||||
| LDTP19912 | Protein NipSnap homolog 1 (NIPSNAP1) | 12.2 | ||||
| LDTP00991 | Heterogeneous nuclear ribonucleoprotein Q (SYNCRIP) | 12.2 | ||||
| LDTP11210 | Transmembrane protein 43 (TMEM43) | 12.2 | ||||
| LDTP06543 | DNA damage-binding protein 1 (DDB1) | 12.1 | ||||
| LDTP13519 | Proteasome activator complex subunit 2 (PSME2) | 12.1 | ||||
| LDTP13760 | Structural maintenance of chromosomes protein 3 (SMC3) | 12.1 | ||||
| LDTP10408 | Far upstream element-binding protein 3 (FUBP3) | 12.1 | ||||
| LDTP13162 | Mortality factor 4-like protein 1 (MORF4L1) | 12.1 | ||||
| LDTP00756 | Heterogeneous nuclear ribonucleoprotein R (HNRNPR) | 12.1 | ||||
| LDTP06879 | Protein FAM98B (FAM98B) | 12.1 | ||||
| LDTP05677 | Splicing factor 3A subunit 3 (SF3A3) | 12.1 | ||||
| LDTP09821 | Stalled ribosome sensor GCN1 (GCN1) | 12.0 | ||||
| LDTP13030 | BRCA2 and CDKN1A-interacting protein (BCCIP) | 12.0 | ||||
| LDTP13532 | Malignant T-cell-amplified sequence 1 (MCTS1) | 11.8 | ||||
| LDTP03850 | RNA-binding motif protein, X chromosome (RBMX) | 11.7 | ||||
| LDTP10914 | Translin-associated protein X (TSNAX) | 11.4 | ||||
| LDTP14105 | YTH domain-containing family protein 2 (YTHDF2) | 11.2 | ||||
| LDTP03182 | Heterogeneous nuclear ribonucleoproteins A2/B1 (HNRNPA2B1) | 11.0 | ||||
| LDTP05768 | Heterogeneous nuclear ribonucleoprotein A0 (HNRNPA0) | 10.9 | ||||
| LDTP14216 | Coatomer subunit gamma-1 (COPG1) | 10.6 | ||||
| LDTP04952 | Heterogeneous nuclear ribonucleoprotein K (HNRNPK) | 9.7 | ||||
| LDTP04290 | YLP motif-containing protein 1 (YLPM1) | 9.2 | ||||
| LDTP02595 | Polyadenylate-binding protein 1 (PABPC1) | 9.0 | ||||
| LDTP05034 | Ubiquitin-ribosomal protein eL40 fusion protein (UBA52) | 8.9 | ||||
| LDTP04495 | Heterogeneous nuclear ribonucleoprotein A3 (HNRNPA3) | 8.9 | ||||
| LDTP04412 | Small ribosomal subunit protein mS29 (DAP3) | 8.7 | ||||
| LDTP02692 | Plastin-3 (PLS3) | 8.3 | ||||
| LDTP03721 | Radixin (RDX) | 8.0 | ||||
| LDTP03520 | Phosphatidylethanolamine-binding protein 1 (PEBP1) | 7.9 | ||||
| LDTP04887 | Destrin (DSTN) | 7.8 | ||||
| LDTP02596 | Proliferating cell nuclear antigen (PCNA) | 7.8 | ||||
| LDTP05719 | Cleavage stimulation factor subunit 3 (CSTF3) | 7.6 | ||||
| LDTP08707 | Proline-, glutamic acid- and leucine-rich protein 1 (PELP1) | 7.5 | ||||
| LDTP05821 | Polyadenylate-binding protein 4 (PABPC4) | 7.3 | ||||
| LDTP14951 | Beta-actin-like protein 2 (ACTBL2) | 7.1 | ||||
| LDTP13779 | 60S ribosome subunit biogenesis protein NIP7 homolog (NIP7) | 7.0 | ||||
| LDTP04367 | Hsc70-interacting protein (ST13) | 6.9 | ||||
| LDTP04355 | Rab GDP dissociation inhibitor beta (GDI2) | 6.9 | ||||
| LDTP11324 | RNA-binding protein 4 (RBM4) | 6.8 | ||||
| LDTP05024 | Large ribosomal subunit protein uL1 (RPL10A) | 6.6 | ||||
| LDTP06032 | Heterogeneous nuclear ribonucleoprotein D0 (HNRNPD) | 6.5 | ||||
| LDTP02750 | Heterogeneous nuclear ribonucleoprotein L (HNRNPL) | 6.4 | ||||
| LDTP11575 | Apoptosis inhibitor 5 (API5) | 6.3 | ||||
| LDTP10920 | DnaJ homolog subfamily C member 7 (DNAJC7) | 6.3 | ||||
| LDTP03888 | T-complex protein 1 subunit zeta (CCT6A) | 6.2 | ||||
| LDTP07947 | Eukaryotic translation initiation factor 3 subunit M (EIF3M) | 6.0 | ||||
| LDTP00239 | DNA fragmentation factor subunit alpha (DFFA) | 5.9 | ||||
| LDTP02108 | Large ribosomal subunit protein P2 (RPLP2) | 5.5 | ||||
| LDTP02884 | Heat shock 70 kDa protein 6 (HSPA6) | 5.5 | ||||
| LDTP06273 | 26S proteasome non-ATPase regulatory subunit 6 (PSMD6) | 5.4 | ||||
| LDTP12296 | tRNA (34-2'-O)-methyltransferase regulator WDR6 (WDR6) | 5.3 | ||||
| LDTP03364 | Polypyrimidine tract-binding protein 1 (PTBP1) | 5.3 | ||||
| LDTP02156 | Eukaryotic translation initiation factor 4E (EIF4E) | 5.3 | ||||
| LDTP05590 | Histone-binding protein RBBP4 (RBBP4) | 5.3 | ||||
| LDTP00078 | CCR4-NOT transcription complex subunit 1 (CNOT1) | 5.2 | ||||
| LDTP02364 | Heterogeneous nuclear ribonucleoprotein A1 (HNRNPA1) | 5.2 | ||||
| LDTP17097 | Heterogeneous nuclear ribonucleoprotein A1-like 2 (HNRNPA1L2) | 5.2 | ||||
| LDTP04049 | Ran-specific GTPase-activating protein (RANBP1) | 5.2 | ||||
| LDTP04708 | NHP2-like protein 1 (SNU13) | 5.1 | ||||
