Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C106 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 99.7 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 99.7 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 99.7 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 86.8 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 84.4 | ||||
| LDTP00575 | Glutathione S-transferase A4 (GSTA4) | 81.0 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 78.2 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 76.6 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 67.2 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 67.2 | ||||
| LDTP12790 | Glutaminyl-peptide cyclotransferase-like protein (QPCTL) | 66.3 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 64.4 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 63.6 | ||||
| LDTP04114 | E3 ubiquitin-protein ligase NEDD4 (NEDD4) | 59.3 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 58.9 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 58.1 | ||||
| LDTP12960 | [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial (PDP1) | 53.8 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 52.3 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 52.0 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 50.6 | ||||
| LDTP06511 | Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial (ETFDH) | 49.5 | ||||
| LDTP07868 | Protein O-mannosyl-transferase TMTC3 (TMTC3) | 49.2 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 47.8 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 46.9 | ||||
| LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 45.9 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 45.6 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 44.9 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 44.6 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 43.4 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 43.1 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 42.8 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 42.8 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 42.2 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 41.6 | ||||
| LDTP03374 | Peptidyl-prolyl cis-trans isomerase FKBP2 (FKBP2) | 41.4 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 38.6 | ||||
| LDTP10780 | Trimethylguanosine synthase (TGS1) | 38.6 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 38.3 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 37.8 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 37.3 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 37.3 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 35.5 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 34.8 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 34.8 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 34.3 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 33.8 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 33.6 | ||||
| LDTP03671 | Multidrug resistance-associated protein 1 (ABCC1) | 33.1 | ||||
| LDTP00032 | 2-hydroxyacyl-CoA lyase 2 (ILVBL) | 32.0 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 31.6 | ||||
| LDTP03676 | ATP-binding cassette sub-family D member 1 (ABCD1) | 31.3 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 31.1 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 30.9 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 30.5 | ||||
| LDTP11199 | DCN1-like protein 5 (DCUN1D5) | 30.3 | ||||
| LDTP06657 | 2-hydroxyacylsphingosine 1-beta-galactosyltransferase (UGT8) | 30.1 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 30.1 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 29.7 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 29.7 | ||||
| LDTP12197 | Ethanolamine kinase 1 (ETNK1) | 29.2 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 28.8 | ||||
| LDTP10249 | Metalloendopeptidase OMA1, mitochondrial (OMA1) | 28.8 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 28.6 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 28.2 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 28.1 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 28.1 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 27.9 | ||||
| LDTP13367 | Glutathione hydrolase 7 (GGT7) | 27.5 | ||||
| LDTP03523 | Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform (PPP2R1B) | 27.5 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 26.7 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 26.7 | ||||
| LDTP06384 | Ribosomal protein S6 kinase alpha-1 (RPS6KA1) | 26.7 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 26.4 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 26.2 | ||||
| LDTP04471 | Ribosomal protein S6 kinase alpha-3 (RPS6KA3) | 26.0 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 25.6 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 25.5 | ||||
| LDTP12763 | Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase (BPNT2) | 25.5 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 25.3 | ||||
| LDTP10699 | E3 ubiquitin-protein ligase NEDD4-like (NEDD4L) | 25.3 | ||||
| LDTP10201 | Atypical kinase COQ8B, mitochondrial (COQ8B) | 25.1 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 25.1 | ||||
| LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 25.1 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 25.1 | ||||
| LDTP00975 | Mannosyl-oligosaccharide 1,2-alpha-mannosidase IB (MAN1A2) | 25.1 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 24.9 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 24.9 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 24.9 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 24.9 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 24.8 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 24.8 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 24.3 | ||||
| LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 24.3 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 24.1 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 24.1 | ||||
| LDTP00316 | Ribonuclease T2 (RNASET2) | 24.1 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 23.6 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 23.3 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 22.5 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 22.3 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 22.2 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 22.0 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 21.9 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 21.9 | ||||
| LDTP12886 | Glycerophosphodiester phosphodiesterase 1 (GDE1) | 21.7 | ||||
| LDTP07762 | Hydroxysteroid dehydrogenase-like protein 2 (HSDL2) | 21.7 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 21.6 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 21.4 | ||||
| LDTP01502 | NADH dehydrogenase 1 beta subcomplex subunit 6 (NDUFB6) | 21.4 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 21.4 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 21.1 | ||||
| LDTP11518 | Histone-lysine N-methyltransferase NSD3 (NSD3) | 21.0 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 20.7 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 20.5 | ||||
| LDTP06320 | [Pyruvate dehydrogenase (acetyl-transferring)] kinase isozyme 1, mitochondrial (PDK1) | 20.5 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 20.3 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 20.3 | ||||
| LDTP08203 | E3 ubiquitin-protein ligase synoviolin (SYVN1) | 20.1 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 19.8 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 19.7 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 19.7 | ||||
| LDTP03522 | Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform (PPP2R1A) | 19.7 | ||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 19.3 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 19.3 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 19.2 | ||||
| LDTP11852 | Presenilin-associated rhomboid-like protein, mitochondrial (PARL) | 19.2 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 18.9 | ||||
| LDTP01743 | NADH dehydrogenase 1 beta subcomplex subunit 10 (NDUFB10) | 18.9 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 18.8 | ||||
| LDTP06988 | 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial (COQ5) | 18.5 | ||||
| LDTP06977 | GPI ethanolamine phosphate transferase 2 (PIGG) | 18.5 | ||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 18.5 | ||||
| LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 18.4 | ||||
| LDTP10101 | Peptidyl-prolyl cis-trans isomerase FKBP10 (FKBP10) | 18.3 | ||||
| LDTP01759 | Histone-lysine N-methyltransferase NSD2 (NSD2) | 18.1 | ||||
| LDTP04080 | Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform (PHKA1) | 18.1 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 18.1 | ||||
| LDTP07417 | Serine/threonine-protein phosphatase 4 regulatory subunit 3A (PPP4R3A) | 18.1 | ||||
| LDTP13154 | E3 ubiquitin-protein ligase RNF14 (RNF14) | 18.0 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 17.8 | ||||
| LDTP07989 | Ribonucleoside-diphosphate reductase subunit M2 B (RRM2B) | 17.8 | ||||
| LDTP05372 | Peptidyl-prolyl cis-trans isomerase FKBP4 (FKBP4) | 17.6 | ||||
| LDTP08891 | Ceramide synthase 5 (CERS5) | 17.5 | ||||
| LDTP07154 | ATPase family AAA domain-containing protein 3B (ATAD3B) | 17.4 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 17.4 | ||||
| LDTP03249 | Plasma membrane calcium-transporting ATPase 4 (ATP2B4) | 17.3 | ||||
| LDTP12109 | Ribitol 5-phosphate transferase FKRP (FKRP) | 17.3 | ||||
| LDTP02188 | Protein disulfide-isomerase (P4HB) | 17.1 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 17.1 | ||||
| LDTP02640 | X-ray repair cross-complementing protein 6 (XRCC6) | 17.1 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 17.0 | ||||
| LDTP13675 | COP9 signalosome complex subunit 3 (COPS3) | 17.0 | ||||
| LDTP14427 | Cytochrome c oxidase subunit 7A-related protein, mitochondrial (COX7A2L) | 17.0 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 16.9 | ||||
| LDTP03024 | Plasma membrane calcium-transporting ATPase 1 (ATP2B1) | 16.9 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 16.8 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 16.8 | ||||
| LDTP02150 | ATP synthase subunit beta, mitochondrial (ATP5F1B) | 16.7 | ||||
| LDTP15154 | Dehydrogenase/reductase SDR family member 13 (DHRS13) | 16.7 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 16.7 | ||||
| LDTP11318 | ADP-ribose pyrophosphatase, mitochondrial (NUDT9) | 16.6 | ||||
| LDTP06645 | Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial (HADH) | 16.6 | ||||
| LDTP01329 | Lathosterol oxidase (SC5D) | 16.6 | ||||
| LDTP00338 | Lysosomal alpha-mannosidase (MAN2B1) | 16.6 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 16.6 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 16.6 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 16.4 | ||||
| LDTP02000 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase (HMGCR) | 16.3 | ||||
| LDTP12470 | GTP-binding protein SAR1a (SAR1A) | 16.3 | ||||
| LDTP11209 | Phosphatidylinositol 4-kinase type 2-alpha (PI4K2A) | 16.3 | ||||
| LDTP08530 | Mitofusin-1 (MFN1) | 16.2 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 16.2 | ||||
| LDTP12318 | Calcium-independent phospholipase A2-gamma (PNPLA8) | 16.1 | ||||
| LDTP08017 | Endoplasmic reticulum metallopeptidase 1 (ERMP1) | 16.1 | ||||
| LDTP03980 | Serine/threonine-protein kinase mTOR (MTOR) | 16.1 | ||||
| LDTP02260 | Beta-glucuronidase (GUSB) | 16.0 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 16.0 | ||||
| LDTP09355 | Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma (PIP4K2C) | 16.0 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 16.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15648 | BRI3-binding protein (BRI3BP) | 99.7 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 99.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 99.7 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 99.7 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 79.3 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 73.0 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 66.7 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 65.3 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 63.6 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 62.7 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 56.5 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 56.5 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 55.7 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 52.3 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 50.6 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 49.2 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 47.8 | ||||
| LDTP02215 | Prosaposin (PSAP) | 47.5 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 44.9 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 43.7 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 43.1 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 42.5 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 39.9 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 39.7 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 39.4 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 38.6 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 38.3 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 38.3 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 38.3 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 36.5 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 36.5 | ||||
| LDTP05871 | Protein OS-9 (OS9) | 35.5 | ||||
| LDTP00857 | Syntaxin-6 (STX6) | 35.5 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 35.3 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 35.0 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 33.8 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 33.6 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 33.4 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 31.8 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 31.8 | ||||
| LDTP15979 | Transmembrane protein 245 (TMEM245) | 31.8 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 31.6 | ||||
| LDTP11826 | Sodium-dependent neutral amino acid transporter B(0)AT2 (SLC6A15) | 31.1 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 30.7 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 30.3 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 30.3 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 30.3 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 30.1 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 30.1 | ||||
| LDTP09294 | Proton-coupled zinc antiporter SLC30A5 (SLC30A5) | 29.2 | ||||
| LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 29.0 | ||||
| LDTP04501 | Importin subunit alpha-1 (KPNA2) | 28.6 | ||||
| LDTP11812 | Protein ARV1 (ARV1) | 28.6 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 28.4 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 28.4 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 28.2 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 28.2 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 27.9 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 27.5 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 27.5 | ||||
| LDTP03380 | Stomatin (STOM) | 27.5 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 26.9 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 26.9 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 26.7 | ||||
| LDTP01301 | Electrogenic aspartate/glutamate antiporter SLC25A12, mitochondrial (SLC25A12) | 25.3 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 25.3 | ||||
| LDTP17682 | Zinc transporter ZIP11 (SLC39A11) | 25.3 | ||||
| LDTP00405 | Etoposide-induced protein 2.4 homolog (EI24) | 25.1 | ||||
| LDTP10769 | Intermembrane lipid transfer protein VPS13A (VPS13A) | 25.1 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 24.9 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 24.6 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 24.6 | ||||
| LDTP11634 | Derlin-2 (DERL2) | 24.3 | ||||
| LDTP05934 | Stromal interaction molecule 1 (STIM1) | 24.1 | ||||
| LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 23.9 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 23.9 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 23.6 | ||||
| LDTP06499 | V-type proton ATPase subunit S1 (ATP6AP1) | 23.4 | ||||
| LDTP09949 | Transportin-1 (TNPO1) | 23.3 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 23.1 | ||||
| LDTP04462 | H(+)/Cl(-) exchange transporter 6 (CLCN6) | 22.9 | ||||
| LDTP09144 | Metal transporter CNNM3 (CNNM3) | 22.9 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 22.9 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 22.5 | ||||
| LDTP06660 | MICOS complex subunit MIC60 (IMMT) | 22.2 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 22.0 | ||||
| LDTP14275 | Sodium bicarbonate cotransporter 3 (SLC4A7) | 21.9 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 21.7 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 21.7 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 21.6 | ||||
| LDTP08981 | Cytochrome c oxidase assembly protein COX18, mitochondrial (COX18) | 21.6 | ||||
| LDTP00630 | Importin-8 (IPO8) | 21.6 | ||||
| LDTP01380 | Wolframin (WFS1) | 21.6 | ||||
| LDTP08327 | Osteopetrosis-associated transmembrane protein 1 (OSTM1) | 21.4 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 21.3 | ||||
| LDTP08673 | Calcium uptake protein 2, mitochondrial (MICU2) | 21.0 | ||||
| LDTP13716 | Exocyst complex component 7 (EXOC7) | 21.0 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 20.5 | ||||
| LDTP00821 | Mitochondrial import inner membrane translocase subunit TIM44 (TIMM44) | 19.8 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 19.8 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 19.8 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 19.7 | ||||
| LDTP12704 | Anoctamin-10 (ANO10) | 19.4 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 19.4 | ||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 19.2 | ||||
| LDTP11229 | Transmembrane protein 70, mitochondrial (TMEM70) | 19.2 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 19.0 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 18.9 | ||||
| LDTP07537 | Metal transporter CNNM4 (CNNM4) | 18.8 | ||||
| LDTP06581 | Occludin (OCLN) | 18.8 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 18.6 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 18.6 | ||||
| LDTP03546 | Translocator protein (TSPO) | 18.5 | ||||
| LDTP12665 | Cell cycle control protein 50A (TMEM30A) | 18.4 | ||||
| LDTP10533 | Sorting nexin-27 (SNX27) | 18.4 | ||||
| LDTP09028 | Mitoguardin 1 (MIGA1) | 18.1 | ||||
| LDTP10073 | Protein RFT1 homolog (RFT1) | 18.1 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 18.0 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 18.0 | ||||
| LDTP13262 | Signal recognition particle subunit SRP68 (SRP68) | 18.0 | ||||
| LDTP13256 | SUN domain-containing protein 2 (SUN2) | 17.9 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 17.9 | ||||
| LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | 17.8 | ||||
| LDTP13973 | WASH complex subunit 3 (WASHC3) | 17.8 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 17.6 | ||||
| LDTP11041 | Calcium uptake protein 1, mitochondrial (MICU1) | 17.3 | ||||
| LDTP10317 | THO complex subunit 1 (THOC1) | 17.3 | ||||
| LDTP14717 | ATP synthase subunit e, mitochondrial (ATP5ME) | 17.1 | ||||
| LDTP08029 | Nucleoporin p54 (NUP54) | 17.1 | ||||
| LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 16.9 | ||||
| LDTP06293 | Metal cation symporter ZIP14 (SLC39A14) | 16.9 | ||||
| LDTP07477 | Transmembrane protein 214 (TMEM214) | 16.8 | ||||
| LDTP02087 | ADP/ATP translocase 2 (SLC25A5) | 16.7 | ||||
| LDTP01574 | Importin-7 (IPO7) | 16.7 | ||||
| LDTP10754 | Pannexin-1 (PANX1) | 16.7 | ||||
| LDTP08016 | Proton-coupled amino acid transporter 1 (SLC36A1) | 16.7 | ||||
| LDTP13953 | Endophilin-B1 (SH3GLB1) | 16.6 | ||||
| LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 16.4 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 16.4 | ||||
| LDTP06549 | Hsp90 co-chaperone Cdc37 (CDC37) | 16.1 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 16.1 | ||||
| LDTP13320 | Prenylated Rab acceptor protein 1 (RABAC1) | 16.1 | ||||
| LDTP12981 | Proton-transporting V-type ATPase complex assembly regulator TMEM9 (TMEM9) | 16.1 | ||||
| LDTP05780 | Syntaxin-5 (STX5) | 16.1 | ||||
| LDTP12725 | Calcium uniporter regulatory subunit MCUb, mitochondrial (MCUB) | 16.0 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 16.0 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP08006 | PHD finger-like domain-containing protein 5A (PHF5A) | 26.9 | ||||
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 23.4 | ||||
| LDTP02879 | Zinc finger protein 24 (ZNF24) | 16.6 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04720 | IgG receptor FcRn large subunit p51 (FCGRT) | 52.0 | ||||
| LDTP03772 | Basigin (BSG) | 32.2 | ||||
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 24.6 | ||||
| LDTP02040 | HLA class I histocompatibility antigen, A alpha chain (HLA-A) | 17.6 | ||||
| LDTP09907 | Neogenin (NEO1) | 17.3 | ||||
| LDTP02491 | HLA class I histocompatibility antigen, C alpha chain (HLA-C) | 16.8 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11076 | Apolipoprotein L2 (APOL2) | 99.7 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 99.7 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 99.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 95.7 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 89.3 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 84.4 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 81.6 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 76.1 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 72.5 | ||||
| LDTP11143 | Centromere protein K (CENPK) | 70.0 | ||||
| LDTP14939 | Membralin (TMEM259) | 64.4 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 62.7 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 62.7 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 59.7 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 57.3 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 56.9 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 56.5 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 50.9 | ||||
| LDTP12287 | Ran guanine nucleotide release factor (RANGRF) | 50.6 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 50.2 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 48.2 | ||||
| LDTP06892 | Protein Hikeshi (HIKESHI) | 46.5 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 45.3 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 43.4 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 43.1 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 42.5 | ||||
| LDTP08606 | Nurim (NRM) | 40.5 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 38.9 | ||||
| LDTP00779 | Trans-Golgi network integral membrane protein 2 (TGOLN2) | 37.3 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 37.0 | ||||
| LDTP00417 | Programmed cell death protein 5 (PDCD5) | 36.8 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 36.0 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 36.0 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 35.5 | ||||
| LDTP11825 | Phosducin-like protein 3 (PDCL3) | 35.5 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 35.3 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 35.3 | ||||
| LDTP15634 | Ubiquinol-cytochrome c reductase complex assembly factor 5 (UQCC5) | 34.3 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 32.9 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 32.2 | ||||
| LDTP10027 | Cytoplasmic 60S subunit biogenesis factor ZNF622 (ZNF622) | 31.3 | ||||
| LDTP09069 | Kinetochore protein Spc24 (SPC24) | 30.9 | ||||
| LDTP05734 | Protein flightless-1 homolog (FLII) | 30.7 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 30.1 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 29.2 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 29.0 | ||||
| LDTP11326 | FUN14 domain-containing protein 2 (FUNDC2) | 28.4 | ||||
| LDTP10113 | Mitochondrial import receptor subunit TOM6 homolog (TOMM6) | 28.4 | ||||
| LDTP05277 | Protein SET (SET) | 28.4 | ||||
| LDTP19859 | Small integral membrane protein 12 (SMIM12) | 28.4 | ||||
| LDTP15095 | Receptor expression-enhancing protein 3 (REEP3) | 28.2 | ||||
| LDTP16322 | Mitochondrial import inner membrane translocase subunit Tim8 B (TIMM8B) | 27.7 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 27.7 | ||||
| LDTP08796 | Protein SYS1 homolog (SYS1) | 27.1 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 25.5 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 25.3 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 25.1 | ||||
| LDTP10442 | Thioredoxin domain-containing protein 15 (TXNDC15) | 24.9 | ||||
| LDTP05530 | Induced myeloid leukemia cell differentiation protein Mcl-1 (MCL1) | 24.8 | ||||
| LDTP00913 | Mitochondrial import inner membrane translocase subunit Tim8 A (TIMM8A) | 24.8 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 24.8 | ||||
| LDTP02297 | Vimentin (VIM) | 24.8 | ||||
| LDTP10403 | DDRGK domain-containing protein 1 (DDRGK1) | 24.1 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 24.1 | ||||
| LDTP02181 | Neurofilament medium polypeptide (NEFM) | 23.8 | ||||
| LDTP10908 | Protein S100-A13 (S100A13) | 23.8 | ||||
| LDTP15599 | UPF0729 protein C18orf32 (C18orf32) | 23.4 | ||||
| LDTP13125 | Protein UXT (UXT) | 22.9 | ||||
| LDTP17721 | Refilin-B (RFLNB) | 22.9 | ||||
| LDTP00887 | Calumenin (CALU) | 22.8 | ||||
| LDTP05719 | Cleavage stimulation factor subunit 3 (CSTF3) | 22.3 | ||||
| LDTP04527 | RNA-binding protein 5 (RBM5) | 22.3 | ||||
| LDTP06373 | Mitochondrial import receptor subunit TOM20 homolog (TOMM20) | 22.2 | ||||
| LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 22.2 | ||||
| LDTP08766 | Vacuolar protein sorting-associated protein 52 homolog (VPS52) | 22.2 | ||||
| LDTP07031 | Collectin-12 (COLEC12) | 22.0 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 22.0 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 22.0 | ||||
| LDTP13402 | Dynactin subunit 4 (DCTN4) | 21.9 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 21.7 | ||||
| LDTP13807 | PRELI domain-containing protein 1, mitochondrial (PRELID1) | 21.7 | ||||
| LDTP15253 | HEAT repeat-containing protein 3 (HEATR3) | 21.4 | ||||
| LDTP14125 | Mitochondrial import inner membrane translocase subunit Tim10 B (TIMM10B) | 21.4 | ||||
| LDTP02180 | Neurofilament light polypeptide (NEFL) | 21.4 | ||||
| LDTP04207 | Heat shock 70 kDa protein 13 (HSPA13) | 21.3 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 21.3 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 21.0 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 20.8 | ||||
| LDTP11113 | Receptor expression-enhancing protein 2 (REEP2) | 20.8 | ||||
| LDTP07718 | MICOS complex subunit MIC27 (APOOL) | 20.4 | ||||
| LDTP00729 | Glycosylphosphatidylinositol anchor attachment 1 protein (GPAA1) | 20.3 | ||||
| LDTP15240 | LysM and putative peptidoglycan-binding domain-containing protein 3 (LYSMD3) | 20.3 | ||||
| LDTP12379 | Complex I assembly factor TIMMDC1, mitochondrial (TIMMDC1) | 20.1 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 20.0 | ||||
| LDTP09850 | Proline-rich protein PRCC (PRCC) | 20.0 | ||||
| LDTP08908 | Ephexin-1 (NGEF) | 19.7 | ||||
| LDTP00513 | Plexin-B2 (PLXNB2) | 19.7 | ||||
| LDTP04395 | RNA-binding protein FXR1 (FXR1) | 19.7 | ||||
| LDTP13338 | Vacuolar protein sorting-associated protein 51 homolog (VPS51) | 19.7 | ||||
| LDTP01171 | Zinc finger protein ZPR1 (ZPR1) | 19.7 | ||||
| LDTP04356 | Emerin (EMD) | 19.6 | ||||
| LDTP04714 | Heterogeneous nuclear ribonucleoprotein H2 (HNRNPH2) | 19.6 | ||||
| LDTP12764 | MICOS complex subunit MIC19 (CHCHD3) | 19.6 | ||||
| LDTP04425 | Translocon-associated protein subunit delta (SSR4) | 19.6 | ||||
| LDTP01163 | Ubiquinone biosynthesis protein COQ9, mitochondrial (COQ9) | 19.6 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 19.4 | ||||
| LDTP04241 | Nuclear autoantigenic sperm protein (NASP) | 19.4 | ||||
| LDTP05715 | Vesicle transport protein SEC20 (BNIP1) | 19.4 | ||||
| LDTP08081 | Hepatoma-derived growth factor-related protein 2 (HDGFL2) | 19.3 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 19.2 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 19.2 | ||||
| LDTP05224 | RNA-binding protein 10 (RBM10) | 19.2 | ||||
| LDTP08000 | Dymeclin (DYM) | 19.0 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 19.0 | ||||
| LDTP14716 | ATP synthase subunit ATP5MJ, mitochondrial (ATP5MJ) | 18.9 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 18.9 | ||||
| LDTP17652 | Uncharacterized protein KIAA2013 (KIAA2013) | 18.9 | ||||
| LDTP13982 | Mitochondrial fission 1 protein (FIS1) | 18.8 | ||||
| LDTP08793 | Armadillo repeat-containing protein 10 (ARMC10) | 18.6 | ||||
| LDTP10927 | COP9 signalosome complex subunit 8 (COPS8) | 18.5 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 18.5 | ||||
| LDTP11167 | Protein YIPF4 (YIPF4) | 18.5 | ||||
| LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | 18.5 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 18.4 | ||||
| LDTP10255 | Protein Hook homolog 2 (HOOK2) | 18.3 | ||||
| LDTP11981 | Receptor expression-enhancing protein 4 (REEP4) | 18.3 | ||||
| LDTP01510 | Zinc finger protein-like 1 (ZFPL1) | 18.3 | ||||
| LDTP05558 | Galectin-3-binding protein (LGALS3BP) | 18.0 | ||||
| LDTP13162 | Mortality factor 4-like protein 1 (MORF4L1) | 18.0 | ||||
| LDTP09410 | Protein bicaudal D homolog 2 (BICD2) | 17.9 | ||||
| LDTP06022 | Cold-inducible RNA-binding protein (CIRBP) | 17.8 | ||||
| LDTP00397 | Golgi SNAP receptor complex member 2 (GOSR2) | 17.8 | ||||
| LDTP10184 | HAUS augmin-like complex subunit 1 (HAUS1) | 17.8 | ||||
| LDTP09615 | Sec1 family domain-containing protein 1 (SCFD1) | 17.8 | ||||
| LDTP13964 | MOB-like protein phocein (MOB4) | 17.5 | ||||
| LDTP01661 | Synaptosomal-associated protein 29 (SNAP29) | 17.3 | ||||
| LDTP13159 | Alpha-catulin (CTNNAL1) | 17.1 | ||||
| LDTP13230 | Gamma-tubulin complex component 4 (TUBGCP4) | 17.1 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 17.1 | ||||
| LDTP19924 | Protein PBDC1 (PBDC1) | 17.1 | ||||
| LDTP09183 | Periphilin-1 (PPHLN1) | 17.0 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 17.0 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 16.9 | ||||
| LDTP14136 | Mitochondrial import inner membrane translocase subunit Tim13 (TIMM13) | 16.8 | ||||
| LDTP05501 | Fragile X messenger ribonucleoprotein 1 (FMR1) | 16.7 | ||||
| LDTP05741 | Large ribosomal subunit protein bL28m (MRPL28) | 16.7 | ||||
| LDTP05318 | RNA-binding protein EWS (EWSR1) | 16.7 | ||||
| LDTP08682 | Ankyrin repeat domain-containing protein 13A (ANKRD13A) | 16.6 | ||||
| LDTP04557 | Arfaptin-2 (ARFIP2) | 16.6 | ||||
| LDTP15741 | Cytochrome c oxidase assembly protein COX14 (COX14) | 16.4 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 16.4 | ||||
| LDTP06431 | Thyroid receptor-interacting protein 11 (TRIP11) | 16.4 | ||||
| LDTP13689 | Conserved oligomeric Golgi complex subunit 5 (COG5) | 16.2 | ||||
| LDTP01361 | DnaJ homolog subfamily C member 8 (DNAJC8) | 16.2 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 16.2 | ||||
| LDTP04917 | Proteasome activator complex subunit 3 (PSME3) | 16.2 | ||||
| LDTP12729 | Required for meiotic nuclear division protein 1 homolog (RMND1) | 16.1 | ||||
| LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | 16.0 | ||||
| LDTP05400 | Lamin-B2 (LMNB2) | 16.0 | ||||
