Details of the Probe-central Interaction Altas
General Information of Experiment
Probe Name | C350 | Probe Info | ||||
---|---|---|---|---|---|---|
Probe concentration | Probe:50uM; negative probe:50uM | |||||
Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
Quantitative Method |
TMT
|
|||||
In Vivo Experiment Model | Model Type |
|
Living cell | |||
Derived Tissue |
|
Peripheral blood | ||||
Disease Model | Normal | |||||
Model Name | Human normal cells (HEK-293T) | |||||
Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 |
Interaction Altas of This Experiment [1]
Enzyme
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 99.7 | ||||
LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 99.7 | ||||
LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 99.7 | ||||
LDTP00697 | Cytochrome b5 type B (CYB5B) | 99.7 | ||||
LDTP02359 | Heme oxygenase 1 (HMOX1) | 99.7 | ||||
LDTP03540 | Heme oxygenase 2 (HMOX2) | 99.7 | ||||
LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 99.7 | ||||
LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 99.7 | ||||
LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 99.7 | ||||
LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 99.7 | ||||
LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 99.7 | ||||
LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 99.7 | ||||
LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 99.7 | ||||
LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 98.4 | ||||
LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 96.3 | ||||
LDTP01743 | NADH dehydrogenase 1 beta subcomplex subunit 10 (NDUFB10) | 86.2 | ||||
LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 82.1 | ||||
LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 82.1 | ||||
LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 81.0 | ||||
LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 74.0 | ||||
LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 73.0 | ||||
LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 72.5 | ||||
LDTP05905 | Acid ceramidase (ASAH1) | 69.1 | ||||
LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 68.6 | ||||
LDTP05409 | Antigen peptide transporter 2 (TAP2) | 67.6 | ||||
LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 67.6 | ||||
LDTP06142 | Squalene monooxygenase (SQLE) | 66.3 | ||||
LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 65.8 | ||||
LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 65.8 | ||||
LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 65.8 | ||||
LDTP07868 | Protein O-mannosyl-transferase TMTC3 (TMTC3) | 65.3 | ||||
LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 62.7 | ||||
LDTP10329 | Ceramide synthase 2 (CERS2) | 61.8 | ||||
LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 61.4 | ||||
LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 61.0 | ||||
LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 60.1 | ||||
LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 58.9 | ||||
LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 57.7 | ||||
LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 56.9 | ||||
LDTP02000 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase (HMGCR) | 56.5 | ||||
LDTP04358 | Carnitine O-palmitoyltransferase 1, liver isoform (CPT1A) | 56.5 | ||||
LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 56.5 | ||||
LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 55.7 | ||||
LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 54.6 | ||||
LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 53.4 | ||||
LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 52.7 | ||||
LDTP13409 | Anaphase-promoting complex subunit 7 (ANAPC7) | 50.9 | ||||
LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 50.9 | ||||
LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 49.5 | ||||
LDTP00032 | 2-hydroxyacyl-CoA lyase 2 (ILVBL) | 48.8 | ||||
LDTP06977 | GPI ethanolamine phosphate transferase 2 (PIGG) | 48.5 | ||||
LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 48.5 | ||||
LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 46.9 | ||||
LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 45.6 | ||||
LDTP11852 | Presenilin-associated rhomboid-like protein, mitochondrial (PARL) | 45.6 | ||||
LDTP03842 | Squalene synthase (FDFT1) | 45.3 | ||||
LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 43.7 | ||||
LDTP11319 | Threonine--tRNA ligase, mitochondrial (TARS2) | 43.4 | ||||
LDTP04114 | E3 ubiquitin-protein ligase NEDD4 (NEDD4) | 43.1 | ||||
LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 42.8 | ||||
LDTP09251 | Atlastin-2 (ATL2) | 42.2 | ||||
LDTP07931 | Heme A synthase COX15 (COX15) | 41.9 | ||||
LDTP03145 | Catechol O-methyltransferase (COMT) | 41.6 | ||||
LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 41.6 | ||||
LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 41.4 | ||||
LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 41.4 | ||||
LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 41.1 | ||||
LDTP12639 | 1-acyl-sn-glycerol-3-phosphate acyltransferase epsilon (AGPAT5) | 40.5 | ||||
LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 40.5 | ||||
LDTP08378 | Serine/threonine-protein kinase VRK2 (VRK2) | 40.2 | ||||
LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 40.2 | ||||
LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 39.7 | ||||
LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 39.7 | ||||
LDTP01329 | Lathosterol oxidase (SC5D) | 39.4 | ||||
LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 38.1 | ||||
LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 37.8 | ||||
LDTP08203 | E3 ubiquitin-protein ligase synoviolin (SYVN1) | 37.5 | ||||
LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 37.3 | ||||
LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 37.3 | ||||
LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 37.0 | ||||
LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 36.8 | ||||
LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 36.5 | ||||
LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 36.3 | ||||
LDTP06370 | Ephrin type-A receptor 7 (EPHA7) | 36.3 | ||||
LDTP12420 | Xaa-Pro aminopeptidase 3 (XPNPEP3) | 36.3 | ||||
LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 36.0 | ||||
LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 36.0 | ||||
LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 35.8 | ||||
LDTP02505 | Lysosomal protective protein (CTSA) | 35.8 | ||||
LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 35.8 | ||||
LDTP03680 | DNA replication licensing factor MCM4 (MCM4) | 35.3 | ||||
LDTP01300 | Cartilage-associated protein (CRTAP) | 34.8 | ||||
LDTP04581 | Holocytochrome c-type synthase (HCCS) | 34.5 | ||||
LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 34.1 | ||||
LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 33.4 | ||||
LDTP19838 | Immunity-related GTPase family Q protein (IRGQ) | 33.1 | ||||
LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 33.1 | ||||
LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 32.9 | ||||
LDTP02141 | Alpha-galactosidase A (GLA) | 32.7 | ||||
LDTP02837 | Beta-galactosidase (GLB1) | 32.7 | ||||
LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 32.4 | ||||
LDTP08799 | Lysophosphatidylserine lipase ABHD12 (ABHD12) | 31.8 | ||||
LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 31.3 | ||||
LDTP00988 | Protein O-GlcNAcase (OGA) | 31.3 | ||||
LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 31.1 | ||||
LDTP09814 | Acyl-CoA:lysophosphatidylglycerol acyltransferase 1 (LPGAT1) | 30.7 | ||||
LDTP11199 | DCN1-like protein 5 (DCUN1D5) | 30.7 | ||||
LDTP02539 | Lysosomal acid phosphatase (ACP2) | 30.7 | ||||
LDTP10020 | Ras-related protein Rab-24 (RAB24) | 30.5 | ||||
LDTP09061 | Retinol dehydrogenase 13 (RDH13) | 30.3 | ||||
LDTP04440 | Peroxisomal multifunctional enzyme type 2 (HSD17B4) | 30.1 | ||||
LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 30.1 | ||||
LDTP10249 | Metalloendopeptidase OMA1, mitochondrial (OMA1) | 29.4 | ||||
LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 29.4 | ||||
LDTP14427 | Cytochrome c oxidase subunit 7A-related protein, mitochondrial (COX7A2L) | 29.2 | ||||
LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 29.2 | ||||
LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 29.2 | ||||
LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 29.2 | ||||
LDTP04569 | Geranylgeranyl transferase type-2 subunit beta (RABGGTB) | 28.8 | ||||
LDTP10966 | Microsomal glutathione S-transferase 2 (MGST2) | 28.6 | ||||
LDTP05850 | Probable methyltransferase TARBP1 (TARBP1) | 28.4 | ||||
LDTP10137 | Cytochrome c oxidase assembly factor 7 (COA7) | 28.1 | ||||
LDTP12227 | Methylcrotonoyl-CoA carboxylase beta chain, mitochondrial (MCCC2) | 28.1 | ||||
LDTP04531 | Hexokinase-2 (HK2) | 27.9 | ||||
LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | 27.9 | ||||
LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 27.7 | ||||
LDTP07154 | ATPase family AAA domain-containing protein 3B (ATAD3B) | 27.5 | ||||
LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 27.1 | ||||
LDTP13408 | Cell division cycle protein 23 homolog (CDC23) | 26.9 | ||||
LDTP02721 | Farnesyl pyrophosphate synthase (FDPS) | 26.9 | ||||
LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 26.9 | ||||
LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 26.9 | ||||
LDTP04925 | Pterin-4-alpha-carbinolamine dehydratase (PCBD1) | 26.7 | ||||
LDTP10699 | E3 ubiquitin-protein ligase NEDD4-like (NEDD4L) | 26.5 | ||||
LDTP10930 | Membrane-associated tyrosine- and threonine-specific cdc2-inhibitory kinase (PKMYT1) | 26.5 | ||||
LDTP11437 | Peroxisomal trans-2-enoyl-CoA reductase (PECR) | 26.5 | ||||
LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 26.5 | ||||
LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 26.4 | ||||
LDTP04962 | 26S proteasome regulatory subunit 4 (PSMC1) | 26.2 | ||||
LDTP01065 | E3 ubiquitin-protein ligase TRIM13 (TRIM13) | 26.2 | ||||
LDTP03769 | Sterol O-acyltransferase 1 (SOAT1) | 26.2 | ||||
LDTP12752 | NADH dehydrogenase 1 beta subcomplex subunit 11, mitochondrial (NDUFB11) | 26.0 | ||||
LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 26.0 | ||||
LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 25.8 | ||||
LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 25.8 | ||||
LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 25.5 | ||||
LDTP00836 | ATPase GET3 (GET3) | 25.5 | ||||
LDTP04203 | Phosphatidylserine synthase 1 (PTDSS1) | 25.5 | ||||
LDTP03249 | Plasma membrane calcium-transporting ATPase 4 (ATP2B4) | 25.5 | ||||
LDTP01704 | Phosphatidylserine lipase ABHD16A (ABHD16A) | 25.1 | ||||
LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 24.8 | ||||
LDTP03060 | Proteasome subunit beta type-1 (PSMB1) | 24.8 | ||||
LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 24.6 | ||||
LDTP09063 | Estradiol 17-beta-dehydrogenase 11 (HSD17B11) | 24.4 | ||||
LDTP06315 | Platelet-activating factor acetylhydrolase IB subunit alpha1 (PAFAH1B3) | 24.4 | ||||
LDTP01047 | Dolichol-phosphate mannosyltransferase subunit 1 (DPM1) | 23.9 | ||||
LDTP09835 | GPI-anchor transamidase (PIGK) | 23.9 | ||||
LDTP00344 | Stearoyl-CoA desaturase (SCD) | 23.9 | ||||
LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 23.8 | ||||
LDTP15097 | All-trans-retinol 13,14-reductase (RETSAT) | 23.8 | ||||
LDTP03779 | Copper-transporting ATPase 2 (ATP7B) | 23.8 | ||||
LDTP04895 | Ras-related protein Rab-10 (RAB10) | 23.8 | ||||
LDTP07227 | Threonylcarbamoyladenosine tRNA methylthiotransferase (CDKAL1) | 23.8 | ||||
LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 23.6 | ||||
LDTP09388 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B (STT3B) | 23.6 | ||||
LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 23.1 | ||||
LDTP03394 | Ceramide synthase 1 (CERS1) | 22.9 | ||||
LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 22.8 | ||||
LDTP00877 | Protein SCO2 homolog, mitochondrial (SCO2) | 22.8 | ||||
LDTP11035 | Dihydropyrimidinase-related protein 5 (DPYSL5) | 22.6 | ||||
LDTP12608 | Phosphatidylinositol-3-phosphatase SAC1 (SACM1L) | 22.6 | ||||
LDTP09495 | Probable glutathione peroxidase 8 (GPX8) | 22.6 | ||||
LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 22.6 | ||||
LDTP05733 | Serine/threonine-protein kinase 4 (STK4) | 22.5 | ||||
LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 22.3 | ||||
LDTP13814 | Phospholipase A-2-activating protein (PLAA) | 22.3 | ||||
LDTP12470 | GTP-binding protein SAR1a (SAR1A) | 22.2 | ||||
LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 22.2 | ||||
LDTP04247 | Protein farnesyltransferase subunit beta (FNTB) | 22.2 | ||||
LDTP01699 | Acyl-CoA 6-desaturase (FADS2) | 22.0 | ||||
LDTP00536 | Mitochondrial ribonuclease P catalytic subunit (PRORP) | 22.0 |
Transporter and channel
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP01804 | ATP synthase subunit a (MT-ATP6) | 99.7 | ||||
LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 99.7 | ||||
LDTP11245 | Derlin-1 (DERL1) | 99.7 | ||||
LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 99.7 | ||||
LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 99.7 | ||||
LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 99.7 | ||||
LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 99.7 | ||||
LDTP11615 | Protein tweety homolog 3 (TTYH3) | 99.7 | ||||
LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 99.7 | ||||
LDTP06633 | Reticulon-1 (RTN1) | 99.7 | ||||
LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 99.7 | ||||
LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 99.7 | ||||
LDTP16813 | Tetraspanin-3 (TSPAN3) | 99.7 | ||||
LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 99.7 | ||||
LDTP15948 | Transmembrane protein 126A (TMEM126A) | 99.7 | ||||
LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 99.7 | ||||
LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 99.7 | ||||
LDTP11250 | MICOS complex subunit MIC26 (APOO) | 96.3 | ||||
LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 96.3 | ||||
LDTP00857 | Syntaxin-6 (STX6) | 95.0 | ||||
LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 93.7 | ||||
LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 91.1 | ||||
LDTP15481 | Transmembrane protein 87A (TMEM87A) | 89.9 | ||||
LDTP10065 | Transmembrane protein 230 (TMEM230) | 85.0 | ||||
LDTP07531 | Sideroflexin-4 (SFXN4) | 83.3 | ||||
LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 77.7 | ||||
LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 77.2 | ||||
LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 74.5 | ||||
LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 74.0 | ||||
LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 73.5 | ||||
LDTP08469 | Complex I assembly factor TMEM126B, mitochondrial (TMEM126B) | 67.6 | ||||
LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 67.2 | ||||
LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 66.7 | ||||
LDTP08881 | Transmembrane protein 199 (TMEM199) | 66.7 | ||||
LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 65.3 | ||||
LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 64.0 | ||||
LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 62.7 | ||||
LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 61.4 | ||||
LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 60.1 | ||||
LDTP04227 | Guided entry of tail-anchored proteins factor CAMLG (CAMLG) | 59.3 | ||||
LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 59.3 | ||||
LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 57.3 | ||||
LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 56.9 | ||||
LDTP02215 | Prosaposin (PSAP) | 56.1 | ||||
LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 55.7 | ||||
LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 52.3 | ||||
LDTP09294 | Proton-coupled zinc antiporter SLC30A5 (SLC30A5) | 49.5 | ||||
LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 48.2 | ||||
LDTP07236 | Protein GPR107 (GPR107) | 48.2 | ||||
LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 47.2 | ||||
LDTP06499 | V-type proton ATPase subunit S1 (ATP6AP1) | 46.9 | ||||
LDTP05900 | Metaxin-1 (MTX1) | 45.9 | ||||
LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 45.9 | ||||
LDTP12451 | Integral membrane protein 2C (ITM2C) | 45.3 | ||||
LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 44.9 | ||||
LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 44.3 | ||||
LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 43.7 | ||||
LDTP12704 | Anoctamin-10 (ANO10) | 42.8 | ||||
LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 42.5 | ||||
LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 41.9 | ||||
LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 41.4 | ||||
LDTP13262 | Signal recognition particle subunit SRP68 (SRP68) | 41.1 | ||||
LDTP10343 | Vacuole membrane protein 1 (VMP1) | 40.5 | ||||
LDTP01060 | PRA1 family protein 2 (PRAF2) | 40.2 | ||||
LDTP10731 | Sodium-coupled neutral amino acid symporter 2 (SLC38A2) | 39.7 | ||||
LDTP14717 | ATP synthase subunit e, mitochondrial (ATP5ME) | 38.6 | ||||
LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 38.6 | ||||
LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 38.6 | ||||
LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 38.6 | ||||
LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 38.1 | ||||
LDTP02087 | ADP/ATP translocase 2 (SLC25A5) | 37.5 | ||||
LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 37.5 | ||||
LDTP10073 | Protein RFT1 homolog (RFT1) | 37.5 | ||||
LDTP15979 | Transmembrane protein 245 (TMEM245) | 37.5 | ||||
LDTP01217 | Metaxin-2 (MTX2) | 37.3 | ||||
LDTP12809 | Solute carrier family 2, facilitated glucose transporter member 8 (SLC2A8) | 36.8 | ||||
LDTP12661 | Exocyst complex component 1 (EXOC1) | 36.3 | ||||
LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 36.3 | ||||
LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 35.5 | ||||
LDTP03380 | Stomatin (STOM) | 35.3 | ||||
LDTP10663 | Importin-9 (IPO9) | 35.0 | ||||
LDTP11281 | Voltage-gated monoatomic cation channel TMEM109 (TMEM109) | 35.0 | ||||
LDTP07477 | Transmembrane protein 214 (TMEM214) | 34.8 | ||||
LDTP10533 | Sorting nexin-27 (SNX27) | 34.3 | ||||
LDTP06660 | MICOS complex subunit MIC60 (IMMT) | 34.1 | ||||
LDTP04787 | Transmembrane protein 33 (TMEM33) | 34.1 | ||||
LDTP10081 | Leucine-rich repeat-containing protein 59 (LRRC59) | 33.8 | ||||
LDTP01454 | SUN domain-containing protein 1 (SUN1) | 33.6 | ||||
LDTP03546 | Translocator protein (TSPO) | 33.1 | ||||
LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 32.9 | ||||
LDTP07064 | Nucleoporin NUP188 (NUP188) | 32.4 | ||||
LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 31.8 | ||||
LDTP00590 | Protein RER1 (RER1) | 31.6 | ||||
LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 31.1 | ||||
LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 30.9 | ||||
LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 30.7 | ||||
LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 30.1 | ||||
LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 30.1 | ||||
LDTP10804 | Chloride channel CLIC-like protein 1 (CLCC1) | 29.9 | ||||
LDTP11291 | Transmembrane emp24 domain-containing protein 9 (TMED9) | 29.9 | ||||
LDTP00405 | Etoposide-induced protein 2.4 homolog (EI24) | 29.7 | ||||
LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 29.7 | ||||
LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 29.7 | ||||
LDTP03405 | Calnexin (CANX) | 29.4 | ||||
LDTP07462 | MFS-type transporter SLC18B1 (SLC18B1) | 29.4 | ||||
LDTP13943 | Thioredoxin-related transmembrane protein 2 (TMX2) | 29.2 | ||||
LDTP09288 | Vang-like protein 1 (VANGL1) | 28.6 | ||||
LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 28.2 | ||||
LDTP11213 | Nucleoporin NDC1 (NDC1) | 27.9 | ||||
LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 27.7 | ||||
LDTP07058 | Transmembrane protein 201 (TMEM201) | 27.5 | ||||
LDTP01601 | Activator of 90 kDa heat shock protein ATPase homolog 1 (AHSA1) | 26.4 | ||||
LDTP00970 | Gasdermin-E (GSDME) | 26.2 | ||||
LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 26.0 | ||||
LDTP04501 | Importin subunit alpha-1 (KPNA2) | 26.0 | ||||
LDTP04237 | Protein ERGIC-53 (LMAN1) | 26.0 | ||||
LDTP04426 | B-cell receptor-associated protein 31 (BCAP31) | 25.8 | ||||
LDTP07537 | Metal transporter CNNM4 (CNNM4) | 25.8 | ||||
LDTP05780 | Syntaxin-5 (STX5) | 25.8 | ||||
LDTP13320 | Prenylated Rab acceptor protein 1 (RABAC1) | 25.6 | ||||
LDTP07583 | Transmembrane protein 65 (TMEM65) | 25.5 | ||||
LDTP11229 | Transmembrane protein 70, mitochondrial (TMEM70) | 25.3 | ||||
LDTP06293 | Metal cation symporter ZIP14 (SLC39A14) | 24.9 | ||||
LDTP09987 | Secretory carrier-associated membrane protein 4 (SCAMP4) | 24.6 | ||||
LDTP00821 | Mitochondrial import inner membrane translocase subunit TIM44 (TIMM44) | 24.4 | ||||
LDTP07152 | Acyl-CoA-binding domain-containing protein 5 (ACBD5) | 24.3 | ||||
LDTP06855 | Anoctamin-6 (ANO6) | 24.3 | ||||
LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 24.3 | ||||
LDTP10621 | Sideroflexin-2 (SFXN2) | 24.3 | ||||
LDTP01301 | Electrogenic aspartate/glutamate antiporter SLC25A12, mitochondrial (SLC25A12) | 24.1 | ||||
LDTP09028 | Mitoguardin 1 (MIGA1) | 23.9 | ||||
LDTP12090 | Sideroflexin-1 (SFXN1) | 23.9 | ||||
LDTP02068 | Sodium/potassium-transporting ATPase subunit beta-1 (ATP1B1) | 23.6 | ||||
LDTP15838 | Translocation protein SEC62 (SEC62) | 23.6 | ||||
LDTP01100 | Iron-sulfur clusters transporter ABCB7, mitochondrial (ABCB7) | 23.4 | ||||
LDTP01352 | PRA1 family protein 3 (ARL6IP5) | 23.4 | ||||
LDTP07667 | Transmembrane protein 205 (TMEM205) | 23.4 | ||||
LDTP09144 | Metal transporter CNNM3 (CNNM3) | 23.3 | ||||
LDTP06271 | ER membrane protein complex subunit 2 (EMC2) | 22.9 | ||||
LDTP09515 | Importin-4 (IPO4) | 22.8 | ||||
LDTP08769 | Nuclear pore complex protein Nup93 (NUP93) | 22.8 | ||||
LDTP13599 | Calcium load-activated calcium channel (TMCO1) | 22.6 | ||||
LDTP12078 | Mitochondrial glutamate carrier 1 (SLC25A22) | 22.6 | ||||
LDTP10885 | Sortilin (SORT1) | 22.6 | ||||
LDTP13953 | Endophilin-B1 (SH3GLB1) | 22.5 | ||||
LDTP06549 | Hsp90 co-chaperone Cdc37 (CDC37) | 22.2 | ||||
LDTP04956 | Mitochondrial import inner membrane translocase subunit Tim10 (TIMM10) | 22.0 | ||||
LDTP01380 | Wolframin (WFS1) | 22.0 |
Transcription factor
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 47.2 | ||||
LDTP09694 | Paraspeckle component 1 (PSPC1) | 41.4 |
Immunoglobulin
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP03772 | Basigin (BSG) | 57.3 | ||||
LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 52.3 | ||||
LDTP04720 | IgG receptor FcRn large subunit p51 (FCGRT) | 44.9 | ||||
LDTP02040 | HLA class I histocompatibility antigen, A alpha chain (HLA-A) | 25.8 |
Other
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP11076 | Apolipoprotein L2 (APOL2) | 99.7 | ||||
LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 99.7 | ||||
LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 99.7 | ||||
LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 99.7 | ||||
LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 99.7 | ||||
LDTP00871 | Microtubule nucleation factor SSNA1 (SSNA1) | 99.7 | ||||
LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 99.7 | ||||
LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 99.7 | ||||
LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 99.7 | ||||
LDTP05160 | Nucleobindin-2 (NUCB2) | 99.7 | ||||
LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 99.7 | ||||
LDTP10056 | Protein FAM162A (FAM162A) | 99.7 | ||||
LDTP12287 | Ran guanine nucleotide release factor (RANGRF) | 99.7 | ||||
LDTP01167 | Reticulon-2 (RTN2) | 99.7 | ||||
LDTP12412 | Reticulon-4 (RTN4) | 99.7 | ||||
LDTP00986 | Syntaxin-10 (STX10) | 99.7 | ||||
LDTP14458 | Tetraspanin-6 (TSPAN6) | 99.7 | ||||
LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 99.7 | ||||
LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 94.4 | ||||
LDTP13086 | Syntaxin-18 (STX18) | 89.9 | ||||
LDTP01522 | Reticulon-3 (RTN3) | 88.0 | ||||
LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 84.4 | ||||
LDTP08606 | Nurim (NRM) | 80.4 | ||||
LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 77.2 | ||||
LDTP01163 | Ubiquinone biosynthesis protein COQ9, mitochondrial (COQ9) | 77.2 | ||||
LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 70.5 | ||||
LDTP06097 | Reticulocalbin-2 (RCN2) | 70.5 | ||||
LDTP02927 | Ganglioside GM2 activator (GM2A) | 70.0 | ||||
LDTP19963 | TraB domain-containing protein (TRABD) | 69.1 | ||||
LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 67.6 | ||||
LDTP18272 | Transmembrane protein 209 (TMEM209) | 66.7 | ||||
LDTP09773 | Protein FAM3C (FAM3C) | 66.3 | ||||
LDTP08224 | Protein LYRIC (MTDH) | 65.8 | ||||
LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 57.7 | ||||
LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 56.9 | ||||
LDTP15398 | Protein FAM177A1 (FAM177A1) | 55.7 | ||||
LDTP01494 | Protein YIF1A (YIF1A) | 53.8 | ||||
LDTP14126 | Mitochondrial import inner membrane translocase subunit Tim9 (TIMM9) | 51.6 | ||||
LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 50.6 | ||||
LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 49.2 | ||||
LDTP03729 | General transcription factor IIF subunit 1 (GTF2F1) | 48.5 | ||||
LDTP16080 | Protein FAM114A2 (FAM114A2) | 48.5 | ||||
LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 48.2 | ||||
LDTP12025 | UPF0488 protein C8orf33 (C8orf33) | 47.8 | ||||
LDTP00859 | Synaptogyrin-2 (SYNGR2) | 46.9 | ||||
LDTP18132 | Protein FAM136A (FAM136A) | 45.9 | ||||
LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 45.6 | ||||
LDTP11167 | Protein YIPF4 (YIPF4) | 45.3 | ||||
LDTP16322 | Mitochondrial import inner membrane translocase subunit Tim8 B (TIMM8B) | 44.9 | ||||
LDTP05375 | Nucleobindin-1 (NUCB1) | 44.0 | ||||
LDTP00632 | Syntaxin-7 (STX7) | 44.0 | ||||
LDTP15793 | Protein FAM210A (FAM210A) | 42.5 | ||||
LDTP08594 | Negative elongation factor C/D (NELFCD) | 42.2 | ||||
LDTP00417 | Programmed cell death protein 5 (PDCD5) | 41.6 | ||||
LDTP12729 | Required for meiotic nuclear division protein 1 homolog (RMND1) | 41.6 | ||||
LDTP17003 | Matrix-remodeling-associated protein 7 (MXRA7) | 41.4 | ||||
LDTP11906 | Phosphatidylinositol glycan anchor biosynthesis class U protein (PIGU) | 41.1 | ||||
LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 41.1 | ||||
LDTP06892 | Protein Hikeshi (HIKESHI) | 39.9 | ||||
LDTP15253 | HEAT repeat-containing protein 3 (HEATR3) | 39.1 | ||||
LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 39.1 | ||||
LDTP01171 | Zinc finger protein ZPR1 (ZPR1) | 38.3 | ||||
LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 38.1 | ||||
LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 37.5 | ||||
LDTP00913 | Mitochondrial import inner membrane translocase subunit Tim8 A (TIMM8A) | 37.5 | ||||
LDTP04356 | Emerin (EMD) | 37.3 | ||||
LDTP10914 | Translin-associated protein X (TSNAX) | 37.3 | ||||
LDTP01359 | Dynactin subunit 3 (DCTN3) | 37.0 | ||||
LDTP09787 | Nicastrin (NCSTN) | 37.0 | ||||
LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 35.3 | ||||
LDTP10908 | Protein S100-A13 (S100A13) | 35.3 | ||||
LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 35.0 | ||||
LDTP13125 | Protein UXT (UXT) | 34.5 | ||||
LDTP12379 | Complex I assembly factor TIMMDC1, mitochondrial (TIMMDC1) | 34.3 | ||||
LDTP07192 | Intermembrane lipid transfer protein VPS13D (VPS13D) | 34.3 | ||||
LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 33.6 | ||||
LDTP15887 | Lipase maturation factor 2 (LMF2) | 32.9 | ||||
LDTP05715 | Vesicle transport protein SEC20 (BNIP1) | 32.7 | ||||
LDTP05257 | Receptor expression-enhancing protein 5 (REEP5) | 32.4 | ||||
LDTP02345 | Retinol-binding protein 1 (RBP1) | 32.4 | ||||
LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 32.4 | ||||
LDTP07718 | MICOS complex subunit MIC27 (APOOL) | 31.6 | ||||
LDTP11044 | Polyadenylate-binding protein-interacting protein 2 (PAIP2) | 31.6 | ||||
LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 31.3 | ||||
LDTP01075 | Protein CutA (CUTA) | 31.1 | ||||
LDTP05868 | Protein unc-119 homolog A (UNC119) | 30.7 | ||||
LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 30.5 | ||||
LDTP01225 | Mediator of RNA polymerase II transcription subunit 24 (MED24) | 30.5 | ||||
LDTP10924 | Prohibitin-2 (PHB2) | 30.5 | ||||
LDTP03775 | RNA-binding protein FUS (FUS) | 30.5 | ||||
LDTP09215 | Torsin-1A-interacting protein 2 (TOR1AIP2) | 30.1 | ||||
LDTP04425 | Translocon-associated protein subunit delta (SSR4) | 30.1 | ||||
LDTP16193 | Craniofacial development protein 1 (CFDP1) | 29.9 | ||||
LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 29.9 | ||||
LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 29.7 | ||||
LDTP06305 | WD repeat-containing protein 43 (WDR43) | 29.7 | ||||
LDTP19924 | Protein PBDC1 (PBDC1) | 29.4 | ||||
LDTP16285 | Transducin beta-like protein 2 (TBL2) | 29.4 | ||||
LDTP11981 | Receptor expression-enhancing protein 4 (REEP4) | 29.2 | ||||
LDTP00887 | Calumenin (CALU) | 29.0 | ||||
LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 29.0 | ||||
LDTP01652 | Centrosomal protein 43 (CEP43) | 28.8 | ||||
LDTP10209 | Regulator of microtubule dynamics protein 1 (RMDN1) | 28.6 | ||||
LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | 28.4 | ||||
LDTP00046 | NBAS subunit of NRZ tethering complex (NBAS) | 27.9 | ||||
LDTP09069 | Kinetochore protein Spc24 (SPC24) | 27.7 | ||||
LDTP09151 | Calcium uniporter protein, mitochondrial (MCU) | 27.3 | ||||
LDTP02297 | Vimentin (VIM) | 27.1 | ||||
LDTP07031 | Collectin-12 (COLEC12) | 26.9 | ||||
LDTP05386 | Dystonin (DST) | 26.9 | ||||
LDTP05226 | RNA-binding protein 3 (RBM3) | 26.7 | ||||
LDTP00729 | Glycosylphosphatidylinositol anchor attachment 1 protein (GPAA1) | 26.4 | ||||
LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 26.2 | ||||
LDTP06210 | Golgin subfamily B member 1 (GOLGB1) | 25.8 | ||||
LDTP06058 | Rho guanine nucleotide exchange factor 7 (ARHGEF7) | 25.8 | ||||
LDTP12956 | Coiled-coil domain-containing protein 167 (CCDC167) | 25.5 | ||||
LDTP13630 | Neudesin (NENF) | 25.1 | ||||
LDTP12395 | Large ribosomal subunit protein mL40 (MRPL40) | 24.9 | ||||
LDTP13162 | Mortality factor 4-like protein 1 (MORF4L1) | 24.9 | ||||
LDTP04917 | Proteasome activator complex subunit 3 (PSME3) | 24.9 | ||||
LDTP11645 | SRA stem-loop-interacting RNA-binding protein, mitochondrial (SLIRP) | 24.9 | ||||
LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 24.6 | ||||
LDTP08793 | Armadillo repeat-containing protein 10 (ARMC10) | 24.6 | ||||
LDTP12591 | Kinesin light chain 4 (KLC4) | 24.6 | ||||
LDTP10849 | Regulator of microtubule dynamics protein 3 (RMDN3) | 24.4 | ||||
LDTP05960 | Trophoblast glycoprotein (TPBG) | 24.4 | ||||
LDTP10185 | FAS-associated factor 2 (FAF2) | 24.3 | ||||
LDTP15976 | Large ribosomal subunit protein mL46 (MRPL46) | 24.3 | ||||
LDTP14136 | Mitochondrial import inner membrane translocase subunit Tim13 (TIMM13) | 24.3 | ||||
LDTP00573 | Prefoldin subunit 6 (PFDN6) | 24.3 | ||||
LDTP04207 | Heat shock 70 kDa protein 13 (HSPA13) | 24.1 | ||||
LDTP01206 | Vesicle-trafficking protein SEC22b (SEC22B) | 24.1 | ||||
LDTP10847 | Protein Niban 2 (NIBAN2) | 23.9 | ||||
LDTP06022 | Cold-inducible RNA-binding protein (CIRBP) | 23.8 | ||||
LDTP10403 | DDRGK domain-containing protein 1 (DDRGK1) | 23.8 | ||||
LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 23.8 | ||||
LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 23.6 | ||||
LDTP01050 | Small ribosomal subunit protein uS14m (MRPS14) | 22.9 | ||||
LDTP04703 | Tumor protein D52 (TPD52) | 22.9 | ||||
LDTP15863 | Large ribosomal subunit protein mL45 (MRPL45) | 22.8 | ||||
LDTP02736 | Myosin light chain 6B (MYL6B) | 22.8 | ||||
LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | 22.6 | ||||
LDTP09410 | Protein bicaudal D homolog 2 (BICD2) | 22.6 | ||||
LDTP12677 | DnaJ homolog subfamily C member 11 (DNAJC11) | 22.5 | ||||
LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 22.5 | ||||
LDTP13967 | Transmembrane emp24 domain-containing protein 5 (TMED5) | 22.5 | ||||
LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 22.3 | ||||
LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 22.2 | ||||
LDTP03967 | Lamina-associated polypeptide 2, isoform alpha (TMPO) | 22.2 | ||||
LDTP05318 | RNA-binding protein EWS (EWSR1) | 22.2 | ||||
LDTP11800 | Vacuolar protein sorting-associated protein 16 homolog (VPS16) | 22.2 |