Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C040 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 66.7 | ||||
| LDTP01743 | NADH dehydrogenase 1 beta subcomplex subunit 10 (NDUFB10) | 54.6 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 54.2 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 51.3 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 48.5 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 45.6 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 41.6 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 41.4 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 41.4 | ||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 38.1 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 36.0 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 33.4 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 32.7 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 31.1 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 30.9 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 30.7 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 29.2 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 29.0 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 27.1 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 26.9 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 26.2 | ||||
| LDTP04506 | Diacylglycerol kinase epsilon (DGKE) | 23.6 | ||||
| LDTP11259 | Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase (ALG12) | 23.3 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 22.8 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 22.0 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 21.9 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 21.1 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 20.8 | ||||
| LDTP09620 | Soluble calcium-activated nucleotidase 1 (CANT1) | 20.4 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 20.0 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 19.6 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 19.4 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 19.2 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 19.2 | ||||
| LDTP10930 | Membrane-associated tyrosine- and threonine-specific cdc2-inhibitory kinase (PKMYT1) | 19.0 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 18.5 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 18.3 | ||||
| LDTP11494 | Neurolysin, mitochondrial (NLN) | 17.8 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 17.5 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 17.1 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 16.8 | ||||
| LDTP10038 | Mitochondrial ubiquitin ligase activator of NFKB 1 (MUL1) | 16.7 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 16.7 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 16.6 | ||||
| LDTP05588 | RNA cytosine C(5)-methyltransferase NSUN2 (NSUN2) | 16.6 | ||||
| LDTP08979 | Prostaglandin reductase 2 (PTGR2) | 16.3 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 15.9 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 15.6 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 15.5 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 15.5 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 15.5 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 15.1 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 15.1 | ||||
| LDTP12415 | Adenosine 5'-monophosphoramidase HINT3 (HINT3) | 15.0 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 14.9 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 14.5 | ||||
| LDTP00344 | Stearoyl-CoA desaturase (SCD) | 14.2 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 14.1 | ||||
| LDTP07831 | Transmembrane protein with metallophosphoesterase domain (TMPPE) | 14.1 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 14.0 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 13.9 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 13.9 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 13.7 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 13.6 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 13.6 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 13.5 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 13.5 | ||||
| LDTP06501 | Ras-related protein Rab-11B (RAB11B) | 13.5 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 13.5 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 13.5 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 13.4 | ||||
| LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 13.3 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 13.1 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 12.7 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 12.5 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 12.2 | ||||
| LDTP14231 | GTP-binding protein SAR1b (SAR1B) | 12.1 | ||||
| LDTP06986 | Rab-like protein 3 (RABL3) | 12.0 | ||||
| LDTP09061 | Retinol dehydrogenase 13 (RDH13) | 12.0 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 11.9 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 11.8 | ||||
| LDTP12470 | GTP-binding protein SAR1a (SAR1A) | 11.8 | ||||
| LDTP04203 | Phosphatidylserine synthase 1 (PTDSS1) | 11.8 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 11.5 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 11.5 | ||||
| LDTP07529 | SCY1-like protein 2 (SCYL2) | 11.2 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 11.2 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 11.1 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 11.1 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 11.0 | ||||
| LDTP01329 | Lathosterol oxidase (SC5D) | 10.9 | ||||
| LDTP13466 | Endoplasmic reticulum mannosyl-oligosaccharide 1,2-alpha-mannosidase (MAN1B1) | 10.9 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 10.7 | ||||
| LDTP13204 | Gamma-adducin (ADD3) | 10.4 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 10.3 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 10.3 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 10.2 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 10.2 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 10.2 | ||||
| LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 10.1 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 10.1 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 10.1 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 10.0 | ||||
| LDTP11852 | Presenilin-associated rhomboid-like protein, mitochondrial (PARL) | 10.0 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 9.9 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 9.9 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 9.8 | ||||
| LDTP09814 | Acyl-CoA:lysophosphatidylglycerol acyltransferase 1 (LPGAT1) | 9.8 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 9.8 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 9.8 | ||||
| LDTP10432 | ATP synthase membrane subunit K, mitochondrial (ATP5MK) | 9.7 | ||||
| LDTP07154 | ATPase family AAA domain-containing protein 3B (ATAD3B) | 9.7 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 9.5 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 9.4 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 9.3 | ||||
| LDTP12757 | E3 ubiquitin-protein ligase MARCHF5 (MARCHF5) | 9.3 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 9.2 | ||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 9.2 | ||||
| LDTP01515 | NADH dehydrogenase 1 beta subcomplex subunit 8, mitochondrial (NDUFB8) | 9.1 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 9.0 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 8.8 | ||||
| LDTP11284 | Phosphatidylserine synthase 2 (PTDSS2) | 8.8 | ||||
| LDTP10785 | Ubiquitin carboxyl-terminal hydrolase 28 (USP28) | 8.8 | ||||
| LDTP06227 | Prostaglandin reductase 1 (PTGR1) | 8.8 | ||||
| LDTP04471 | Ribosomal protein S6 kinase alpha-3 (RPS6KA3) | 8.8 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 8.7 | ||||
| LDTP11733 | Ras-related protein Rab-1B (RAB1B) | 8.7 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 8.7 | ||||
| LDTP13986 | Vesicle transport protein GOT1B (GOLT1B) | 8.6 | ||||
| LDTP07966 | COP9 signalosome complex subunit 6 (COPS6) | 8.6 | ||||
| LDTP07402 | Dehydrogenase/reductase SDR family member 7B (DHRS7B) | 8.5 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 8.5 | ||||
| LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | 8.5 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 8.5 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 8.3 | ||||
| LDTP15154 | Dehydrogenase/reductase SDR family member 13 (DHRS13) | 8.3 | ||||
| LDTP15370 | Pseudouridylate synthase RPUSD2 (RPUSD2) | 8.3 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 8.3 | ||||
| LDTP01649 | Phosphatidate cytidylyltransferase 2 (CDS2) | 8.2 | ||||
| LDTP08378 | Serine/threonine-protein kinase VRK2 (VRK2) | 8.2 | ||||
| LDTP12639 | 1-acyl-sn-glycerol-3-phosphate acyltransferase epsilon (AGPAT5) | 8.1 | ||||
| LDTP05228 | Calcium-transporting ATPase type 2C member 1 (ATP2C1) | 8.1 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 8.1 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 8.1 | ||||
| LDTP12608 | Phosphatidylinositol-3-phosphatase SAC1 (SACM1L) | 8.1 | ||||
| LDTP04358 | Carnitine O-palmitoyltransferase 1, liver isoform (CPT1A) | 8.0 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 8.0 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 7.8 | ||||
| LDTP08598 | NAD-dependent protein deacetylase sirtuin-2 (SIRT2) | 7.8 | ||||
| LDTP07227 | Threonylcarbamoyladenosine tRNA methylthiotransferase (CDKAL1) | 7.8 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 7.7 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 7.7 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 7.7 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 7.7 | ||||
| LDTP11209 | Phosphatidylinositol 4-kinase type 2-alpha (PI4K2A) | 7.6 | ||||
| LDTP07813 | Sulfhydryl oxidase 2 (QSOX2) | 7.6 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 7.6 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 7.6 | ||||
| LDTP04892 | Ras-related protein Rab-2A (RAB2A) | 7.5 | ||||
| LDTP06455 | Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating (NSDHL) | 7.5 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 7.4 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 7.4 | ||||
| LDTP02150 | ATP synthase subunit beta, mitochondrial (ATP5F1B) | 7.3 | ||||
| LDTP04531 | Hexokinase-2 (HK2) | 7.3 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 7.2 | ||||
| LDTP06384 | Ribosomal protein S6 kinase alpha-1 (RPS6KA1) | 7.2 | ||||
| LDTP08530 | Mitofusin-1 (MFN1) | 7.1 | ||||
| LDTP03769 | Sterol O-acyltransferase 1 (SOAT1) | 7.1 | ||||
| LDTP04247 | Protein farnesyltransferase subunit beta (FNTB) | 7.0 | ||||
| LDTP00416 | CDP-diacylglycerol--inositol 3-phosphatidyltransferase (CDIPT) | 7.0 | ||||
| LDTP00032 | 2-hydroxyacyl-CoA lyase 2 (ILVBL) | 6.8 | ||||
| LDTP09063 | Estradiol 17-beta-dehydrogenase 11 (HSD17B11) | 6.8 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 6.8 | ||||
| LDTP16025 | Ketosamine-3-kinase (FN3KRP) | 6.8 | ||||
| LDTP00877 | Protein SCO2 homolog, mitochondrial (SCO2) | 6.8 | ||||
| LDTP06721 | GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase (ALG11) | 6.7 | ||||
| LDTP01699 | Acyl-CoA 6-desaturase (FADS2) | 6.7 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 6.7 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 6.6 | ||||
| LDTP09835 | GPI-anchor transamidase (PIGK) | 6.5 | ||||
| LDTP00890 | S-adenosylhomocysteine hydrolase-like protein 1 (AHCYL1) | 6.5 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 6.5 | ||||
| LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 6.5 | ||||
| LDTP04895 | Ras-related protein Rab-10 (RAB10) | 6.5 | ||||
| LDTP05949 | Cullin-4A (CUL4A) | 6.5 | ||||
| LDTP07679 | Lysocardiolipin acyltransferase 1 (LCLAT1) | 6.5 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 6.5 | ||||
| LDTP03858 | Lysosomal acid lipase/cholesteryl ester hydrolase (LIPA) | 6.4 | ||||
| LDTP01770 | NADH-cytochrome b5 reductase 3 (CYB5R3) | 6.4 | ||||
| LDTP02640 | X-ray repair cross-complementing protein 6 (XRCC6) | 6.4 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 99.7 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 99.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 63.1 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 61.4 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 54.9 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 39.9 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 38.6 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 38.6 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 38.3 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 37.8 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 35.0 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 32.2 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 30.1 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 29.0 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 28.4 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 28.4 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 26.9 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 26.7 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 26.0 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 25.8 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 24.8 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 24.6 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 24.4 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 24.1 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 23.8 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 23.4 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 22.8 | ||||
| LDTP12704 | Anoctamin-10 (ANO10) | 21.9 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 20.8 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 20.8 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 20.8 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 20.7 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 20.5 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 20.1 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 19.6 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 18.5 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 18.4 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 17.9 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 17.6 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 17.4 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 17.3 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 17.1 | ||||
| LDTP01180 | Programmed cell death protein 6 (PDCD6) | 17.1 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 16.6 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 16.3 | ||||
| LDTP01060 | PRA1 family protein 2 (PRAF2) | 16.0 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 15.8 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 15.2 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 15.1 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 15.0 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 14.8 | ||||
| LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 14.7 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 14.6 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 14.4 | ||||
| LDTP14717 | ATP synthase subunit e, mitochondrial (ATP5ME) | 14.1 | ||||
| LDTP15733 | Solute carrier family 25 member 44 (SLC25A44) | 13.6 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 13.3 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 13.3 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 13.3 | ||||
| LDTP06855 | Anoctamin-6 (ANO6) | 13.0 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 12.9 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 12.5 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 12.4 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 12.3 | ||||
| LDTP08469 | Complex I assembly factor TMEM126B, mitochondrial (TMEM126B) | 12.2 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 12.0 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 11.8 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 11.8 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 11.7 | ||||
| LDTP03546 | Translocator protein (TSPO) | 11.6 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 11.6 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 11.5 | ||||
| LDTP11281 | Voltage-gated monoatomic cation channel TMEM109 (TMEM109) | 11.4 | ||||
| LDTP12979 | Transmembrane protein 14C (TMEM14C) | 10.9 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 10.9 | ||||
| LDTP04501 | Importin subunit alpha-1 (KPNA2) | 10.7 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 10.7 | ||||
| LDTP01380 | Wolframin (WFS1) | 10.6 | ||||
| LDTP04227 | Guided entry of tail-anchored proteins factor CAMLG (CAMLG) | 10.6 | ||||
| LDTP06633 | Reticulon-1 (RTN1) | 10.4 | ||||
| LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 10.3 | ||||
| LDTP15838 | Translocation protein SEC62 (SEC62) | 10.3 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 10.2 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 10.1 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 9.9 | ||||
| LDTP01631 | Mitochondrial pyruvate carrier 2 (MPC2) | 9.8 | ||||
| LDTP11826 | Sodium-dependent neutral amino acid transporter B(0)AT2 (SLC6A15) | 9.8 | ||||
| LDTP11732 | Magnesium transporter protein 1 (MAGT1) | 9.7 | ||||
| LDTP00590 | Protein RER1 (RER1) | 9.6 | ||||
| LDTP00405 | Etoposide-induced protein 2.4 homolog (EI24) | 9.6 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 9.5 | ||||
| LDTP03811 | V-type proton ATPase subunit E 1 (ATP6V1E1) | 9.5 | ||||
| LDTP12661 | Exocyst complex component 1 (EXOC1) | 9.4 | ||||
| LDTP10081 | Leucine-rich repeat-containing protein 59 (LRRC59) | 9.4 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 9.4 | ||||
| LDTP07439 | Mitochondrial adenyl nucleotide antiporter SLC25A25 (SLC25A25) | 9.3 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 9.3 | ||||
| LDTP00882 | Glucose-6-phosphate exchanger SLC37A4 (SLC37A4) | 9.3 | ||||
| LDTP04787 | Transmembrane protein 33 (TMEM33) | 9.2 | ||||
| LDTP13953 | Endophilin-B1 (SH3GLB1) | 9.1 | ||||
| LDTP06499 | V-type proton ATPase subunit S1 (ATP6AP1) | 9.1 | ||||
| LDTP04426 | B-cell receptor-associated protein 31 (BCAP31) | 9.1 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 9.0 | ||||
| LDTP01454 | SUN domain-containing protein 1 (SUN1) | 9.0 | ||||
| LDTP13599 | Calcium load-activated calcium channel (TMCO1) | 8.9 | ||||
| LDTP05780 | Syntaxin-5 (STX5) | 8.9 | ||||
| LDTP15744 | Transmembrane protein 101 (TMEM101) | 8.9 | ||||
| LDTP13943 | Thioredoxin-related transmembrane protein 2 (TMX2) | 8.8 | ||||
| LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 8.8 | ||||
| LDTP07467 | Rhomboid domain-containing protein 2 (RHBDD2) | 8.8 | ||||
| LDTP07058 | Transmembrane protein 201 (TMEM201) | 8.5 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 8.4 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 8.3 | ||||
| LDTP10621 | Sideroflexin-2 (SFXN2) | 8.3 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 8.1 | ||||
| LDTP09515 | Importin-4 (IPO4) | 8.0 | ||||
| LDTP01366 | Flotillin-1 (FLOT1) | 7.9 | ||||
| LDTP00872 | Peroxisomal membrane protein PMP34 (SLC25A17) | 7.9 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 7.8 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 7.8 | ||||
| LDTP02087 | ADP/ATP translocase 2 (SLC25A5) | 7.7 | ||||
| LDTP04932 | Protein transport protein Sec61 subunit alpha isoform 1 (SEC61A1) | 7.6 | ||||
| LDTP06660 | MICOS complex subunit MIC60 (IMMT) | 7.5 | ||||
| LDTP13256 | SUN domain-containing protein 2 (SUN2) | 7.5 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 7.5 | ||||
| LDTP03810 | ATP synthase subunit gamma, mitochondrial (ATP5F1C) | 7.3 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 7.3 | ||||
| LDTP06581 | Occludin (OCLN) | 7.2 | ||||
| LDTP03405 | Calnexin (CANX) | 7.2 | ||||
| LDTP03952 | Reduced folate transporter (SLC19A1) | 7.2 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 7.1 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 6.9 | ||||
| LDTP07477 | Transmembrane protein 214 (TMEM214) | 6.9 | ||||
| LDTP07537 | Metal transporter CNNM4 (CNNM4) | 6.7 | ||||
| LDTP14275 | Sodium bicarbonate cotransporter 3 (SLC4A7) | 6.6 | ||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 6.5 | ||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 6.4 | ||||
| LDTP01352 | PRA1 family protein 3 (ARL6IP5) | 6.4 | ||||
| LDTP00821 | Mitochondrial import inner membrane translocase subunit TIM44 (TIMM44) | 6.4 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 6.4 | ||||
| LDTP13416 | Stomatin-like protein 2, mitochondrial (STOML2) | 6.4 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 19.0 | ||||
| LDTP05065 | Y-box-binding protein 1 (YBX1) | 8.8 | ||||
| LDTP13305 | SAP30-binding protein (SAP30BP) | 6.9 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | 9.7 | ||||
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 7.2 | ||||
| LDTP14205 | Neuroplastin (NPTN) | 6.6 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 99.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 93.1 | ||||
| LDTP19859 | Small integral membrane protein 12 (SMIM12) | 82.7 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 53.4 | ||||
| LDTP13797 | HIG1 domain family member 1A, mitochondrial (HIGD1A) | 52.0 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 44.3 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 43.7 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 41.9 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 41.6 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 41.4 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 39.1 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 39.1 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 38.3 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 35.8 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 34.8 | ||||
| LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 34.1 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 34.1 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 32.0 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 29.2 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 26.9 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 26.2 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 26.0 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 24.8 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 22.6 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 22.5 | ||||
| LDTP15240 | LysM and putative peptidoglycan-binding domain-containing protein 3 (LYSMD3) | 20.3 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 19.8 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 19.6 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 19.4 | ||||
| LDTP09773 | Protein FAM3C (FAM3C) | 19.3 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 19.3 | ||||
| LDTP09679 | Negative elongation factor B (NELFB) | 18.9 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 18.6 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 18.5 | ||||
| LDTP11981 | Receptor expression-enhancing protein 4 (REEP4) | 18.1 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 18.0 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 18.0 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 17.6 | ||||
| LDTP13630 | Neudesin (NENF) | 17.4 | ||||
| LDTP06121 | Caprin-1 (CAPRIN1) | 16.2 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 15.8 | ||||
| LDTP10924 | Prohibitin-2 (PHB2) | 15.8 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 15.1 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 14.9 | ||||
| LDTP04356 | Emerin (EMD) | 14.8 | ||||
| LDTP06892 | Protein Hikeshi (HIKESHI) | 14.3 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 13.8 | ||||
| LDTP14939 | Membralin (TMEM259) | 13.7 | ||||
| LDTP07964 | Golgi to ER traffic protein 4 homolog (GET4) | 13.6 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 13.6 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 13.5 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 13.4 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 13.2 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 12.6 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 12.6 | ||||
| LDTP00729 | Glycosylphosphatidylinositol anchor attachment 1 protein (GPAA1) | 12.5 | ||||
| LDTP10357 | RUS family member 1 (RUSF1) | 12.4 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 12.1 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 12.0 | ||||
| LDTP04207 | Heat shock 70 kDa protein 13 (HSPA13) | 12.0 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 11.6 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 11.6 | ||||
| LDTP06373 | Mitochondrial import receptor subunit TOM20 homolog (TOMM20) | 11.5 | ||||
| LDTP12379 | Complex I assembly factor TIMMDC1, mitochondrial (TIMMDC1) | 11.0 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 11.0 | ||||
| LDTP11906 | Phosphatidylinositol glycan anchor biosynthesis class U protein (PIGU) | 10.6 | ||||
| LDTP13802 | DNA replication complex GINS protein PSF2 (GINS2) | 10.6 | ||||
| LDTP04241 | Nuclear autoantigenic sperm protein (NASP) | 10.6 | ||||
| LDTP13967 | Transmembrane emp24 domain-containing protein 5 (TMED5) | 10.6 | ||||
| LDTP05257 | Receptor expression-enhancing protein 5 (REEP5) | 10.2 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 10.2 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 10.1 | ||||
| LDTP05715 | Vesicle transport protein SEC20 (BNIP1) | 10.1 | ||||
| LDTP09644 | m-AAA protease-interacting protein 1, mitochondrial (MAIP1) | 10.0 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 9.7 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 9.6 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 9.5 | ||||
| LDTP02297 | Vimentin (VIM) | 9.4 | ||||
| LDTP12571 | LanC-like protein 2 (LANCL2) | 9.4 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 9.3 | ||||
| LDTP08793 | Armadillo repeat-containing protein 10 (ARMC10) | 9.2 | ||||
| LDTP02443 | Calmodulin-3 (CALM3) | 9.2 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 9.1 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 8.9 | ||||
| LDTP05530 | Induced myeloid leukemia cell differentiation protein Mcl-1 (MCL1) | 8.9 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 8.8 | ||||
| LDTP17659 | ELMO domain-containing protein 2 (ELMOD2) | 8.7 | ||||
| LDTP15283 | Nucleolar protein 9 (NOP9) | 8.7 | ||||
| LDTP11140 | Peroxiredoxin-like 2A (PRXL2A) | 8.7 | ||||
| LDTP00887 | Calumenin (CALU) | 8.6 | ||||
| LDTP07718 | MICOS complex subunit MIC27 (APOOL) | 8.6 | ||||
| LDTP11670 | Mitochondrial fission factor (MFF) | 8.5 | ||||
| LDTP10469 | Engulfment and cell motility protein 2 (ELMO2) | 8.4 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 8.3 | ||||
| LDTP07632 | Type-1 angiotensin II receptor-associated protein (AGTRAP) | 8.2 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 8.1 | ||||
| LDTP09850 | Proline-rich protein PRCC (PRCC) | 8.1 | ||||
| LDTP04941 | Coatomer subunit zeta-1 (COPZ1) | 7.9 | ||||
| LDTP15887 | Lipase maturation factor 2 (LMF2) | 7.8 | ||||
| LDTP00632 | Syntaxin-7 (STX7) | 7.8 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 7.8 | ||||
| LDTP11134 | DNA replication complex GINS protein SLD5 (GINS4) | 7.7 | ||||
| LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 7.7 | ||||
| LDTP10849 | Regulator of microtubule dynamics protein 3 (RMDN3) | 7.7 | ||||
| LDTP05484 | Proteasome activator complex subunit 1 (PSME1) | 7.6 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 7.5 | ||||
| LDTP10403 | DDRGK domain-containing protein 1 (DDRGK1) | 7.4 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 7.3 | ||||
| LDTP12762 | Transmembrane protein 161A (TMEM161A) | 7.3 | ||||
| LDTP11210 | Transmembrane protein 43 (TMEM43) | 7.3 | ||||
| LDTP09069 | Kinetochore protein Spc24 (SPC24) | 7.2 | ||||
| LDTP01213 | Cell division control protein 45 homolog (CDC45) | 7.1 | ||||
| LDTP06022 | Cold-inducible RNA-binding protein (CIRBP) | 7.1 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 7.1 | ||||
| LDTP17157 | OCIA domain-containing protein 2 (OCIAD2) | 7.0 | ||||
| LDTP19625 | Integral membrane protein GPR180 (GPR180) | 6.9 | ||||
| LDTP08153 | Transmembrane emp24 domain-containing protein 4 (TMED4) | 6.9 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 6.9 | ||||
| LDTP11326 | FUN14 domain-containing protein 2 (FUNDC2) | 6.9 | ||||
| LDTP05685 | Transmembrane protein 115 (TMEM115) | 6.7 | ||||
| LDTP05318 | RNA-binding protein EWS (EWSR1) | 6.6 | ||||
| LDTP10062 | Synapse-associated protein 1 (SYAP1) | 6.6 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 6.6 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 6.6 | ||||
| LDTP03850 | RNA-binding motif protein, X chromosome (RBMX) | 6.6 | ||||
| LDTP04425 | Translocon-associated protein subunit delta (SSR4) | 6.5 | ||||
| LDTP13604 | Hippocalcin-like protein 4 (HPCAL4) | 6.4 | ||||
