Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | JN0003 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:200uM; negative probe:200uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
SILAC
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP06612 | 2,4-dienoyl-CoA reductase [(3E)-enoyl-CoA-producing], mitochondrial (DECR1) | 20.0 | ||||
| LDTP00032 | 2-hydroxyacyl-CoA lyase 2 (ILVBL) | 20.0 | ||||
| LDTP04963 | 26S proteasome regulatory subunit 8 (PSMC5) | 20.0 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 20.0 | ||||
| LDTP11701 | 5'-3' exoribonuclease 2 (XRN2) | 20.0 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 20.0 | ||||
| LDTP03291 | Acetyl-CoA acetyltransferase, mitochondrial (ACAT1) | 20.0 | ||||
| LDTP10982 | Aconitate hydratase, mitochondrial (ACO2) | 20.0 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 20.0 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 20.0 | ||||
| LDTP05192 | ADP-ribosylation factor 1 (ARF1) | 20.0 | ||||
| LDTP04907 | ADP-ribosylation factor 3 (ARF3) | 20.0 | ||||
| LDTP02942 | ADP-ribosylation factor 4 (ARF4) | 20.0 | ||||
| LDTP05193 | ADP-ribosylation factor 5 (ARF5) | 20.0 | ||||
| LDTP03900 | ADP-ribosylation factor-like protein 1 (ARL1) | 20.0 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 20.0 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 20.0 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 20.0 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 20.0 | ||||
| LDTP07362 | Atlastin-3 (ATL3) | 20.0 | ||||
| LDTP12688 | ATP-dependent RNA helicase DDX18 (DDX18) | 20.0 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 20.0 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 20.0 | ||||
| LDTP02706 | Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial (MTHFD2) | 20.0 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 20.0 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 20.0 | ||||
| LDTP02911 | Calpain-2 catalytic subunit (CAPN2) | 20.0 | ||||
| LDTP04358 | Carnitine O-palmitoyltransferase 1, liver isoform (CPT1A) | 20.0 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 20.0 | ||||
| LDTP04209 | Casein kinase I isoform alpha (CSNK1A1) | 20.0 | ||||
| LDTP02198 | Cathepsin D (CTSD) | 20.0 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 20.0 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 20.0 | ||||
| LDTP01772 | Cytochrome c oxidase subunit 1 (MT-CO1) | 20.0 | ||||
| LDTP02283 | Cytochrome c1, heme protein, mitochondrial (CYC1) | 20.0 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 20.0 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 20.0 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 20.0 | ||||
| LDTP04572 | Dipeptidyl peptidase 1 (CTSC) | 20.0 | ||||
| LDTP11259 | Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase (ALG12) | 20.0 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 20.0 | ||||
| LDTP12757 | E3 ubiquitin-protein ligase MARCHF5 (MARCHF5) | 20.0 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 20.0 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 20.0 | ||||
| LDTP13314 | Enolase-phosphatase E1 (ENOPH1) | 20.0 | ||||
| LDTP03965 | Enoyl-CoA delta isomerase 1, mitochondrial (ECI1) | 20.0 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 20.0 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 20.0 | ||||
| LDTP02235 | Fumarate hydratase, mitochondrial (FH) | 20.0 | ||||
| LDTP09886 | Gamma-glutamyl hydrolase (GGH) | 20.0 | ||||
| LDTP02651 | Gamma-interferon-inducible lysosomal thiol reductase (IFI30) | 20.0 | ||||
| LDTP01768 | Glutamate dehydrogenase 1, mitochondrial (GLUD1) | 20.0 | ||||
| LDTP00464 | Glutathione S-transferase 3, mitochondrial (MGST3) | 20.0 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 20.0 | ||||
| LDTP04032 | Glycerol-3-phosphate dehydrogenase, mitochondrial (GPD2) | 20.0 | ||||
| LDTP12470 | GTP-binding protein SAR1a (SAR1A) | 20.0 | ||||
| LDTP12233 | Helicase MOV-10 (MOV10) | 20.0 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 20.0 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 20.0 | ||||
| LDTP04531 | Hexokinase-2 (HK2) | 20.0 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 20.0 | ||||
| LDTP08082 | L-xylulose reductase (DCXR) | 20.0 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 20.0 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 20.0 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 20.0 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 20.0 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 20.0 | ||||
| LDTP08799 | Lysophosphatidylserine lipase ABHD12 (ABHD12) | 20.0 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 20.0 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 20.0 | ||||
| LDTP00338 | Lysosomal alpha-mannosidase (MAN2B1) | 20.0 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 20.0 | ||||
| LDTP12227 | Methylcrotonoyl-CoA carboxylase beta chain, mitochondrial (MCCC2) | 20.0 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 20.0 | ||||
| LDTP06796 | Mitochondrial 10-formyltetrahydrofolate dehydrogenase (ALDH1L2) | 20.0 | ||||
| LDTP10981 | Mitochondrial intermediate peptidase (MIPEP) | 20.0 | ||||
| LDTP01220 | Mitochondrial-processing peptidase subunit beta (PMPCB) | 20.0 | ||||
| LDTP03445 | Mitogen-activated protein kinase 1 (MAPK1) | 20.0 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 20.0 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 20.0 | ||||
| LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 20.0 | ||||
| LDTP01238 | NADH dehydrogenase iron-sulfur protein 3, mitochondrial (NDUFS3) | 20.0 | ||||
| LDTP01165 | NADH dehydrogenase iron-sulfur protein 7, mitochondrial (NDUFS7) | 20.0 | ||||
| LDTP01770 | NADH-cytochrome b5 reductase 3 (CYB5R3) | 20.0 | ||||
| LDTP01986 | NADH-ubiquinone oxidoreductase chain 5 (MT-ND5) | 20.0 | ||||
| LDTP00886 | Nardilysin (NRDC) | 20.0 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 20.0 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 20.0 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 20.0 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 20.0 | ||||
| LDTP06104 | Peptidyl-prolyl cis-trans isomerase FKBP8 (FKBP8) | 20.0 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 20.0 | ||||
| LDTP13831 | Phenylalanine--tRNA ligase alpha subunit (FARSA) | 20.0 | ||||
| LDTP12608 | Phosphatidylinositol-3-phosphatase SAC1 (SACM1L) | 20.0 | ||||
| LDTP06638 | Phosphoenolpyruvate carboxykinase [GTP], mitochondrial (PCK2) | 20.0 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 20.0 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 20.0 | ||||
| LDTP05785 | Probable ATP-dependent RNA helicase DDX10 (DDX10) | 20.0 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 20.0 | ||||
| LDTP08979 | Prostaglandin reductase 2 (PTGR2) | 20.0 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 20.0 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 20.0 | ||||
| LDTP03417 | Proteasome subunit beta type-4 (PSMB4) | 20.0 | ||||
| LDTP04246 | Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha (FNTA) | 20.0 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 20.0 | ||||
| LDTP04892 | Ras-related protein Rab-2A (RAB2A) | 20.0 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 20.0 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 20.0 | ||||
| LDTP04471 | Ribosomal protein S6 kinase alpha-3 (RPS6KA3) | 20.0 | ||||
| LDTP05588 | RNA cytosine C(5)-methyltransferase NSUN2 (NSUN2) | 20.0 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 20.0 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 20.0 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 20.0 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 20.0 | ||||
| LDTP00544 | Sphingolipid delta(4)-desaturase DES1 (DEGS1) | 20.0 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 20.0 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 20.0 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 20.0 | ||||
| LDTP01707 | Thioredoxin domain-containing protein 12 (TXNDC12) | 20.0 | ||||
| LDTP06658 | Thioredoxin reductase 1, cytoplasmic (TXNRD1) | 20.0 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 20.0 | ||||
| LDTP02006 | Tissue alpha-L-fucosidase (FUCA1) | 20.0 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 20.0 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 20.0 | ||||
| LDTP07937 | tRNA methyltransferase 10 homolog C (TRMT10C) | 20.0 | ||||
| LDTP06067 | Tubulin--tyrosine ligase-like protein 12 (TTLL12) | 20.0 | ||||
| LDTP02935 | Tyrosine-protein phosphatase non-receptor type 1 (PTPN1) | 20.0 | ||||
| LDTP03519 | UMP-CMP kinase (CMPK1) | 20.0 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 20.0 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 20.0 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 20.0 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 20.0 | ||||
| LDTP02640 | X-ray repair cross-complementing protein 6 (XRCC6) | 20.0 | ||||
| LDTP12960 | [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial (PDP1) | 20.0 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 20.0 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 19.9 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 19.9 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 19.7 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 19.6 | ||||
| LDTP02602 | Histidine--tRNA ligase, cytoplasmic (HARS1) | 19.6 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 19.6 | ||||
| LDTP07868 | Protein O-mannosyl-transferase TMTC3 (TMTC3) | 19.5 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 19.4 | ||||
| LDTP02743 | Insulin-degrading enzyme (IDE) | 19.3 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 18.5 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 18.1 | ||||
| LDTP09063 | Estradiol 17-beta-dehydrogenase 11 (HSD17B11) | 18.0 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 17.8 | ||||
| LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | 17.8 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 17.6 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 17.1 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 17.0 | ||||
| LDTP14074 | Ribosomal biogenesis protein LAS1L (LAS1L) | 17.0 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 17.0 | ||||
| LDTP03688 | Serine hydroxymethyltransferase, cytosolic (SHMT1) | 16.7 | ||||
| LDTP04251 | Elongation factor Tu, mitochondrial (TUFM) | 16.6 | ||||
| LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 16.5 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 16.5 | ||||
| LDTP04289 | Very long-chain specific acyl-CoA dehydrogenase, mitochondrial (ACADVL) | 16.4 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 16.3 | ||||
| LDTP13787 | RuvB-like 2 (RUVBL2) | 16.3 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 16.1 | ||||
| LDTP03333 | Proteasome subunit alpha type-4 (PSMA4) | 15.6 | ||||
| LDTP02150 | ATP synthase subunit beta, mitochondrial (ATP5F1B) | 15.6 | ||||
| LDTP12048 | Complex I assembly factor ACAD9, mitochondrial (ACAD9) | 15.4 | ||||
| LDTP12610 | Obg-like ATPase 1 (OLA1) | 15.3 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 15.2 | ||||
| LDTP06384 | Ribosomal protein S6 kinase alpha-1 (RPS6KA1) | 14.9 | ||||
| LDTP03413 | Proteasome subunit alpha type-5 (PSMA5) | 14.9 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 14.8 | ||||
| LDTP03769 | Sterol O-acyltransferase 1 (SOAT1) | 14.8 | ||||
| LDTP04601 | Arginine--tRNA ligase, cytoplasmic (RARS1) | 14.7 | ||||
| LDTP12163 | Calcyclin-binding protein (CACYBP) | 14.7 | ||||
| LDTP04211 | Isocitrate dehydrogenase [NADP], mitochondrial (IDH2) | 14.7 | ||||
| LDTP02216 | Beta-hexosaminidase subunit beta (HEXB) | 14.5 | ||||
| LDTP07154 | ATPase family AAA domain-containing protein 3B (ATAD3B) | 14.4 | ||||
| LDTP02362 | Dihydrolipoyl dehydrogenase, mitochondrial (DLD) | 14.2 | ||||
| LDTP04646 | Delta-1-pyrroline-5-carboxylate synthase (ALDH18A1) | 14.2 | ||||
| LDTP04243 | Fatty acid synthase (FASN) | 13.9 | ||||
| LDTP06631 | NADH dehydrogenase 1 alpha subcomplex subunit 9, mitochondrial (NDUFA9) | 13.7 | ||||
| LDTP06849 | Prolyl endopeptidase-like (PREPL) | 13.7 | ||||
| LDTP02188 | Protein disulfide-isomerase (P4HB) | 13.6 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 13.6 | ||||
| LDTP03817 | Lon protease homolog, mitochondrial (LONP1) | 13.4 | ||||
| LDTP03689 | Serine hydroxymethyltransferase, mitochondrial (SHMT2) | 13.4 | ||||
| LDTP02642 | X-ray repair cross-complementing protein 5 (XRCC5) | 13.4 | ||||
| LDTP11388 | N-alpha-acetyltransferase 15, NatA auxiliary subunit (NAA15) | 13.3 | ||||
| LDTP07762 | Hydroxysteroid dehydrogenase-like protein 2 (HSDL2) | 13.2 | ||||
| LDTP04542 | Thimet oligopeptidase (THOP1) | 13.2 | ||||
| LDTP03610 | Cytochrome b-c1 complex subunit 1, mitochondrial (UQCRC1) | 13.1 | ||||
| LDTP05724 | Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial (ECH1) | 13.1 | ||||
| LDTP03572 | Succinate dehydrogenase flavoprotein subunit, mitochondrial (SDHA) | 13.1 | ||||
| LDTP03424 | ATP-binding cassette sub-family D member 3 (ABCD3) | 13.0 | ||||
| LDTP02534 | Endoplasmic reticulum chaperone BiP (HSPA5) | 12.9 | ||||
| LDTP02991 | Hexokinase-1 (HK1) | 12.8 | ||||
| LDTP12588 | Isoleucine--tRNA ligase, mitochondrial (IARS2) | 12.8 | ||||
| LDTP00701 | D-3-phosphoglycerate dehydrogenase (PHGDH) | 12.8 | ||||
| LDTP03387 | Mitogen-activated protein kinase 3 (MAPK3) | 12.6 | ||||
| LDTP03433 | NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial (NDUFS1) | 12.6 | ||||
| LDTP03858 | Lysosomal acid lipase/cholesteryl ester hydrolase (LIPA) | 12.6 | ||||
| LDTP03682 | DNA replication licensing factor MCM7 (MCM7) | 12.5 | ||||
| LDTP02568 | DNA topoisomerase 2-alpha (TOP2A) | 12.5 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 12.5 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 12.5 | ||||
| LDTP04074 | Ubiquitin carboxyl-terminal hydrolase 5 (USP5) | 12.4 | ||||
| LDTP04096 | Vesicle-fusing ATPase (NSF) | 12.4 | ||||
| LDTP04253 | Alpha-aminoadipic semialdehyde dehydrogenase (ALDH7A1) | 12.3 | ||||
| LDTP10887 | Synaptic vesicle membrane protein VAT-1 homolog (VAT1) | 12.3 | ||||
| LDTP02223 | Cathepsin B (CTSB) | 12.2 | ||||
| LDTP00273 | Dynamin-1-like protein (DNM1L) | 12.2 | ||||
| LDTP02569 | Glucose-6-phosphate 1-dehydrogenase (G6PD) | 12.2 | ||||
| LDTP04374 | Dynamin-2 (DNM2) | 12.2 | ||||
| LDTP03060 | Proteasome subunit beta type-1 (PSMB1) | 12.2 | ||||
| LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 12.2 | ||||
| LDTP10954 | 3-hydroxyacyl-CoA dehydrogenase type-2 (HSD17B10) | 12.1 | ||||
| LDTP04333 | GMP synthase [glutamine-hydrolyzing] (GMPS) | 12.1 | ||||
| LDTP03259 | Ribonucleoside-diphosphate reductase large subunit (RRM1) | 12.1 | ||||
| LDTP02333 | Glutathione S-transferase P (GSTP1) | 12.1 | ||||
| LDTP07581 | Aspartate--tRNA ligase, mitochondrial (DARS2) | 12.1 | ||||
| LDTP05136 | DNA-dependent protein kinase catalytic subunit (PRKDC) | 12.1 | ||||
| LDTP05992 | Bleomycin hydrolase (BLMH) | 12.0 | ||||
| LDTP04263 | Cysteine--tRNA ligase, cytoplasmic (CARS1) | 12.0 | ||||
| LDTP12586 | Phenylalanine--tRNA ligase beta subunit (FARSB) | 12.0 | ||||
| LDTP06455 | Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating (NSDHL) | 11.6 | ||||
| LDTP01333 | Isocitrate dehydrogenase [NADP] cytoplasmic (IDH1) | 10.5 | ||||
| LDTP10386 | ERO1-like protein alpha (ERO1A) | 10.0 | ||||
| LDTP11733 | Ras-related protein Rab-1B (RAB1B) | 9.7 | ||||
| LDTP00479 | Histone acetyltransferase type B catalytic subunit (HAT1) | 8.9 | ||||
| LDTP05379 | DNA topoisomerase 2-beta (TOP2B) | 8.6 | ||||
| LDTP04999 | Actin, aortic smooth muscle (ACTA2) | 8.0 | ||||
| LDTP12469 | Nucleolar RNA helicase 2 (DDX21) | 7.8 | ||||
| LDTP09899 | Probable ATP-dependent RNA helicase DDX17 (DDX17) | 7.7 | ||||
| LDTP00418 | Protein arginine N-methyltransferase 5 (PRMT5) | 7.7 | ||||
| LDTP00267 | DNA-directed RNA polymerase, mitochondrial (POLRMT) | 7.6 | ||||
| LDTP18414 | 5'-nucleotidase domain-containing protein 2 (NT5DC2) | 7.4 | ||||
| LDTP03223 | Small ribosomal subunit protein uS3 (RPS3) | 6.9 | ||||
| LDTP06314 | Protein disulfide-isomerase A6 (PDIA6) | 6.9 | ||||
| LDTP04878 | Eukaryotic initiation factor 4A-I (EIF4A1) | 6.5 | ||||
| LDTP05550 | ATP-dependent RNA helicase A (DHX9) | 6.4 | ||||
| LDTP04636 | Adenylate kinase 2, mitochondrial (AK2) | 6.0 | ||||
| LDTP01634 | Fatty acid CoA ligase Acsl3 (ACSL3) | 5.8 | ||||
| LDTP05071 | Elongation factor 1-alpha 1 (EEF1A1) | 5.8 | ||||
| LDTP04561 | ATP-citrate synthase (ACLY) | 5.5 | ||||
| LDTP01783 | Aspartate aminotransferase, mitochondrial (GOT2) | 5.5 | ||||
| LDTP13816 | RuvB-like 1 (RUVBL1) | 5.4 | ||||
| LDTP13750 | Proliferation-associated protein 2G4 (PA2G4) | 5.4 | ||||
| LDTP02522 | 60 kDa heat shock protein, mitochondrial (HSPD1) | 5.4 | ||||
| LDTP04876 | Actin, cytoplasmic 1 (ACTB) | 5.4 | ||||
| LDTP02933 | 26S proteasome regulatory subunit 6A (PSMC3) | 5.3 | ||||
| LDTP06089 | Eukaryotic initiation factor 4A-II (EIF4A2) | 5.2 | ||||
| LDTP07946 | ATP-dependent RNA helicase DHX30 (DHX30) | 5.2 | ||||
| LDTP05073 | Actin, alpha skeletal muscle (ACTA1) | 5.1 | ||||
| LDTP03242 | Adenosylhomocysteinase (AHCY) | 5.1 | ||||
| LDTP01205 | Citrate synthase, mitochondrial (CS) | 5.1 | ||||
| LDTP01766 | L-lactate dehydrogenase A chain (LDHA) | 5.0 | ||||
| LDTP04665 | Transitional endoplasmic reticulum ATPase (VCP) | 5.0 | ||||
| LDTP09390 | Polyribonucleotide nucleotidyltransferase 1, mitochondrial (PNPT1) | 5.0 | ||||
| LDTP04398 | Ras-related protein Rab-5C (RAB5C) | 5.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 20.0 | ||||
| LDTP05528 | Apoptosis regulator BAX (BAX) | 20.0 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 20.0 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 20.0 | ||||
| LDTP03810 | ATP synthase subunit gamma, mitochondrial (ATP5F1C) | 20.0 | ||||
| LDTP10036 | BOS complex subunit NCLN (NCLN) | 20.0 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 20.0 | ||||
| LDTP03405 | Calnexin (CANX) | 20.0 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 20.0 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 20.0 | ||||
| LDTP02057 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 (RPN1) | 20.0 | ||||
| LDTP02058 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 (RPN2) | 20.0 | ||||
| LDTP01301 | Electrogenic aspartate/glutamate antiporter SLC25A12, mitochondrial (SLC25A12) | 20.0 | ||||
| LDTP13393 | Electrogenic aspartate/glutamate antiporter SLC25A13, mitochondrial (SLC25A13) | 20.0 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 20.0 | ||||
| LDTP01455 | Erlin-2 (ERLIN2) | 20.0 | ||||
| LDTP06103 | Filamin-C (FLNC) | 20.0 | ||||
| LDTP01366 | Flotillin-1 (FLOT1) | 20.0 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 20.0 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 20.0 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 20.0 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 20.0 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 20.0 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 20.0 | ||||
| LDTP06660 | MICOS complex subunit MIC60 (IMMT) | 20.0 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 20.0 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 20.0 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 20.0 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 20.0 | ||||
| LDTP04956 | Mitochondrial import inner membrane translocase subunit Tim10 (TIMM10) | 20.0 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 20.0 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 20.0 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 20.0 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 20.0 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 20.0 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 20.0 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 20.0 | ||||
| LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 20.0 | ||||
| LDTP09825 | Nuclear pore complex protein Nup205 (NUP205) | 20.0 | ||||
| LDTP08769 | Nuclear pore complex protein Nup93 (NUP93) | 20.0 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 20.0 | ||||
| LDTP04213 | Phosphatidylinositol transfer protein beta isoform (PITPNB) | 20.0 | ||||
| LDTP02215 | Prosaposin (PSAP) | 20.0 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 20.0 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 20.0 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 20.0 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 20.0 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 20.0 | ||||
| LDTP00451 | Secretory carrier-associated membrane protein 3 (SCAMP3) | 20.0 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 20.0 | ||||
| LDTP13262 | Signal recognition particle subunit SRP68 (SRP68) | 20.0 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 20.0 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 20.0 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 20.0 | ||||
| LDTP00310 | Syntenin-1 (SDCBP) | 20.0 | ||||
| LDTP10317 | THO complex subunit 1 (THOC1) | 20.0 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 20.0 | ||||
| LDTP13243 | Translocation protein SEC63 homolog (SEC63) | 20.0 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 20.0 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 20.0 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 20.0 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 20.0 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 20.0 | ||||
| LDTP07583 | Transmembrane protein 65 (TMEM65) | 20.0 | ||||
| LDTP14133 | Transportin-3 (TNPO3) | 20.0 | ||||
| LDTP04553 | Tricarboxylate transport protein, mitochondrial (SLC25A1) | 20.0 | ||||
| LDTP12533 | Ubiquilin-4 (UBQLN4) | 20.0 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 20.0 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 20.0 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 20.0 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 20.0 | ||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | 20.0 | ||||
| LDTP04787 | Transmembrane protein 33 (TMEM33) | 19.2 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 17.9 | ||||
| LDTP05690 | Vesicular integral-membrane protein VIP36 (LMAN2) | 17.8 | ||||
| LDTP04501 | Importin subunit alpha-1 (KPNA2) | 17.6 | ||||
| LDTP03717 | Prohibitin 1 (PHB1) | 17.3 | ||||
| LDTP13953 | Endophilin-B1 (SH3GLB1) | 17.2 | ||||
| LDTP08673 | Calcium uptake protein 2, mitochondrial (MICU2) | 17.1 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 17.1 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 17.0 | ||||
| LDTP01100 | Iron-sulfur clusters transporter ABCB7, mitochondrial (ABCB7) | 17.0 | ||||
| LDTP14509 | ATP synthase subunit d, mitochondrial (ATP5PD) | 16.7 | ||||
| LDTP12090 | Sideroflexin-1 (SFXN1) | 16.6 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 16.3 | ||||
| LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | 16.2 | ||||
| LDTP01748 | Mitochondrial import receptor subunit TOM40 homolog (TOMM40) | 16.2 | ||||
| LDTP13416 | Stomatin-like protein 2, mitochondrial (STOML2) | 16.0 | ||||
| LDTP05238 | Solute carrier family 25 member 3 (SLC25A3) | 16.0 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 15.3 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 15.3 | ||||
| LDTP00821 | Mitochondrial import inner membrane translocase subunit TIM44 (TIMM44) | 15.2 | ||||
| LDTP02087 | ADP/ATP translocase 2 (SLC25A5) | 15.0 | ||||
| LDTP10663 | Importin-9 (IPO9) | 15.0 | ||||
| LDTP01601 | Activator of 90 kDa heat shock protein ATPase homolog 1 (AHSA1) | 14.4 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 14.3 | ||||
| LDTP10081 | Leucine-rich repeat-containing protein 59 (LRRC59) | 14.2 | ||||
| LDTP01043 | Sorting nexin-2 (SNX2) | 14.2 | ||||
| LDTP00434 | Transportin-2 (TNPO2) | 13.6 | ||||
| LDTP14066 | Hypoxia up-regulated protein 1 (HYOU1) | 13.5 | ||||
| LDTP09949 | Transportin-1 (TNPO1) | 13.3 | ||||
| LDTP02612 | Nucleoprotein TPR (TPR) | 12.9 | ||||
| LDTP01574 | Importin-7 (IPO7) | 12.5 | ||||
| LDTP04393 | Annexin A11 (ANXA11) | 12.4 | ||||
| LDTP12142 | Exportin-5 (XPO5) | 12.4 | ||||
| LDTP03664 | Kinesin-1 heavy chain (KIF5B) | 12.2 | ||||
| LDTP00266 | Importin-5 (IPO5) | 12.1 | ||||
| LDTP05273 | Spectrin beta chain, non-erythrocytic 1 (SPTBN1) | 12.0 | ||||
| LDTP06462 | Neutral amino acid transporter B(0) (SLC1A5) | 11.6 | ||||
| LDTP03327 | ATP synthase subunit alpha, mitochondrial (ATP5F1A) | 10.3 | ||||
| LDTP03870 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit (DDOST) | 10.1 | ||||
| LDTP06549 | Hsp90 co-chaperone Cdc37 (CDC37) | 10.1 | ||||
| LDTP11934 | EH domain-containing protein 1 (EHD1) | 8.5 | ||||
| LDTP05384 | Mitochondrial 2-oxoglutarate/malate carrier protein (SLC25A11) | 8.2 | ||||
| LDTP06242 | Importin subunit beta-1 (KPNB1) | 7.9 | ||||
| LDTP01295 | Nuclear pore complex protein Nup155 (NUP155) | 6.7 | ||||
| LDTP01969 | Transferrin receptor protein 1 (TFRC) | 6.3 | ||||
| LDTP13322 | Importin-11 (IPO11) | 6.2 | ||||
| LDTP00501 | Exportin-1 (XPO1) | 6.0 | ||||
| LDTP09515 | Importin-4 (IPO4) | 5.8 | ||||
| LDTP09579 | Nuclear pore complex protein Nup133 (NUP133) | 5.6 | ||||
| LDTP01133 | Copine-3 (CPNE3) | 5.3 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05065 | Y-box-binding protein 1 (YBX1) | 20.0 | ||||
| LDTP06341 | Non-POU domain-containing octamer-binding protein (NONO) | 15.2 | ||||
| LDTP03212 | Splicing factor, proline- and glutamine-rich (SFPQ) | 14.0 | ||||
| LDTP09694 | Paraspeckle component 1 (PSPC1) | 13.8 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | 17.5 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01814 | Alpha-2-macroglobulin (A2M) | 20.0 | ||||
| LDTP03030 | Annexin A7 (ANXA7) | 20.0 | ||||
| LDTP13908 | AP-3 complex subunit mu-1 (AP3M1) | 20.0 | ||||
| LDTP09655 | Ataxin-2-like protein (ATXN2L) | 20.0 | ||||
| LDTP00887 | Calumenin (CALU) | 20.0 | ||||
| LDTP02697 | cAMP-dependent protein kinase type II-alpha regulatory subunit (PRKAR2A) | 20.0 | ||||
| LDTP03711 | Catenin alpha-1 (CTNNA1) | 20.0 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 20.0 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 20.0 | ||||
| LDTP04092 | Crk-like protein (CRKL) | 20.0 | ||||
| LDTP01361 | DnaJ homolog subfamily C member 8 (DNAJC8) | 20.0 | ||||
| LDTP06082 | Dynactin subunit 1 (DCTN1) | 20.0 | ||||
| LDTP05922 | Dynactin subunit 2 (DCTN2) | 20.0 | ||||
| LDTP13402 | Dynactin subunit 4 (DCTN4) | 20.0 | ||||
| LDTP04356 | Emerin (EMD) | 20.0 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 20.0 | ||||
| LDTP00620 | Eukaryotic translation initiation factor 3 subunit H (EIF3H) | 20.0 | ||||
| LDTP10749 | Exportin-6 (XPO6) | 20.0 | ||||
| LDTP10185 | FAS-associated factor 2 (FAF2) | 20.0 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 20.0 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 20.0 | ||||
| LDTP02053 | Heat shock protein beta-1 (HSPB1) | 20.0 | ||||
| LDTP17065 | Heterogeneous nuclear ribonucleoprotein U-like protein 2 (HNRNPUL2) | 20.0 | ||||
| LDTP08425 | Hornerin (HRNR) | 20.0 | ||||
| LDTP08238 | Kinectin (KTN1) | 20.0 | ||||
| LDTP04382 | Kinetochore-associated protein 1 (KNTC1) | 20.0 | ||||
| LDTP03065 | Lamin-B1 (LMNB1) | 20.0 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 20.0 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 20.0 | ||||
| LDTP15922 | Large ribosomal subunit protein mL37 (MRPL37) | 20.0 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 20.0 | ||||
| LDTP06068 | MAGUK p55 subfamily member 2 (MPP2) | 20.0 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 20.0 | ||||
| LDTP14939 | Membralin (TMEM259) | 20.0 | ||||
| LDTP03404 | Microtubule-associated protein 4 (MAP4) | 20.0 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 20.0 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 20.0 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 20.0 | ||||
| LDTP04241 | Nuclear autoantigenic sperm protein (NASP) | 20.0 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 20.0 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 20.0 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 20.0 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 20.0 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 20.0 | ||||
| LDTP04935 | Prefoldin subunit 3 (VBP1) | 20.0 | ||||
| LDTP01932 | Prelamin-A/C (LMNA) | 20.0 | ||||
| LDTP10924 | Prohibitin-2 (PHB2) | 20.0 | ||||
| LDTP04078 | Proliferation marker protein Ki-67 (MKI67) | 20.0 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 20.0 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 20.0 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 20.0 | ||||
| LDTP19912 | Protein NipSnap homolog 1 (NIPSNAP1) | 20.0 | ||||
| LDTP05277 | Protein SET (SET) | 20.0 | ||||
| LDTP13430 | Protein TASOR (TASOR) | 20.0 | ||||
| LDTP09851 | Protein TFG (TFG) | 20.0 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 20.0 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 20.0 | ||||
| LDTP03495 | RNA-binding motif, single-stranded-interacting protein 1 (RBMS1) | 20.0 | ||||
| LDTP05224 | RNA-binding protein 10 (RBM10) | 20.0 | ||||
| LDTP10684 | RNA-binding protein 14 (RBM14) | 20.0 | ||||
| LDTP05318 | RNA-binding protein EWS (EWSR1) | 20.0 | ||||
| LDTP10216 | RNA-binding protein Musashi homolog 2 (MSI2) | 20.0 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 20.0 | ||||
| LDTP14215 | Small ribosomal subunit protein mS40 (MRPS18B) | 20.0 | ||||
| LDTP06094 | Src substrate cortactin (CTTN) | 20.0 | ||||
| LDTP03860 | Stress-70 protein, mitochondrial (HSPA9) | 20.0 | ||||
| LDTP07574 | Superkiller complex protein 3 (SKIC3) | 20.0 | ||||
| LDTP08389 | Syntaxin-12 (STX12) | 20.0 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 20.0 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 20.0 | ||||
| LDTP05036 | Transformer-2 protein homolog beta (TRA2B) | 20.0 | ||||
| LDTP04425 | Translocon-associated protein subunit delta (SSR4) | 20.0 | ||||
| LDTP11210 | Transmembrane protein 43 (TMEM43) | 20.0 | ||||
| LDTP05867 | Treacle protein (TCOF1) | 20.0 | ||||
| LDTP13626 | Ubiquilin-1 (UBQLN1) | 20.0 | ||||
| LDTP06060 | Ubiquitin-associated protein 2-like (UBAP2L) | 20.0 | ||||
| LDTP02297 | Vimentin (VIM) | 20.0 | ||||
| LDTP08094 | Wings apart-like protein homolog (WAPL) | 20.0 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 18.8 | ||||
| LDTP10078 | Far upstream element-binding protein 1 (FUBP1) | 17.6 | ||||
| LDTP11682 | Polyadenylate-binding protein-interacting protein 1 (PAIP1) | 17.4 | ||||
| LDTP08058 | Mitochondrial antiviral-signaling protein (MAVS) | 17.2 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 17.0 | ||||
| LDTP09615 | Sec1 family domain-containing protein 1 (SCFD1) | 16.6 | ||||
| LDTP09938 | Far upstream element-binding protein 2 (KHSRP) | 16.5 | ||||
| LDTP01259 | Interferon-inducible double-stranded RNA-dependent protein kinase activator A (PRKRA) | 16.4 | ||||
| LDTP04793 | Poly(rC)-binding protein 3 (PCBP3) | 16.2 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 16.0 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 16.0 | ||||
| LDTP15705 | BTB/POZ domain-containing protein KCTD12 (KCTD12) | 15.5 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 15.0 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 14.9 | ||||
| LDTP05400 | Lamin-B2 (LMNB2) | 14.6 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 14.6 | ||||
| LDTP16156 | Protein PALS2 (PALS2) | 14.4 | ||||
| LDTP06543 | DNA damage-binding protein 1 (DDB1) | 14.2 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 14.2 | ||||
| LDTP16128 | Testis-expressed protein 10 (TEX10) | 14.2 | ||||
| LDTP02734 | Endoplasmin (HSP90B1) | 14.1 | ||||
| LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | 13.8 | ||||
| LDTP13630 | Neudesin (NENF) | 13.8 | ||||
| LDTP04917 | Proteasome activator complex subunit 3 (PSME3) | 13.8 | ||||
| LDTP07526 | Pre-mRNA-processing-splicing factor 8 (PRPF8) | 13.7 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 13.7 | ||||
| LDTP03182 | Heterogeneous nuclear ribonucleoproteins A2/B1 (HNRNPA2B1) | 13.7 | ||||
| LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | 13.4 | ||||
| LDTP13813 | Eukaryotic translation initiation factor 3 subunit L (EIF3L) | 13.4 | ||||
| LDTP01432 | Mitochondrial import receptor subunit TOM70 (TOMM70) | 13.4 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 13.4 | ||||
| LDTP05437 | Single-stranded DNA-binding protein, mitochondrial (SSBP1) | 13.4 | ||||
| LDTP06182 | Ribosomal RNA processing protein 1 homolog B (RRP1B) | 13.3 | ||||
| LDTP11140 | Peroxiredoxin-like 2A (PRXL2A) | 13.3 | ||||
| LDTP00991 | Heterogeneous nuclear ribonucleoprotein Q (SYNCRIP) | 13.3 | ||||
| LDTP04853 | Eukaryotic translation initiation factor 3 subunit E (EIF3E) | 13.3 | ||||
| LDTP04714 | Heterogeneous nuclear ribonucleoprotein H2 (HNRNPH2) | 13.2 | ||||
| LDTP04181 | Coatomer subunit delta (ARCN1) | 13.2 | ||||
| LDTP00756 | Heterogeneous nuclear ribonucleoprotein R (HNRNPR) | 13.2 | ||||
| LDTP04049 | Ran-specific GTPase-activating protein (RANBP1) | 13.0 | ||||
| LDTP05668 | G-rich sequence factor 1 (GRSF1) | 12.9 | ||||
| LDTP11238 | Heterogeneous nuclear ribonucleoprotein U-like protein 1 (HNRNPUL1) | 12.9 | ||||
| LDTP15253 | HEAT repeat-containing protein 3 (HEATR3) | 12.8 | ||||
| LDTP03615 | Heterogeneous nuclear ribonucleoprotein H (HNRNPH1) | 12.8 | ||||
| LDTP13104 | Origin recognition complex subunit 3 (ORC3) | 12.7 | ||||
| LDTP06305 | WD repeat-containing protein 43 (WDR43) | 12.7 | ||||
| LDTP06181 | Structural maintenance of chromosomes protein 1A (SMC1A) | 12.7 | ||||
| LDTP04514 | Heterogeneous nuclear ribonucleoprotein F (HNRNPF) | 12.7 | ||||
| LDTP00376 | Coatomer subunit epsilon (COPE) | 12.6 | ||||
| LDTP06391 | Protein transport protein Sec23B (SEC23B) | 12.5 | ||||
| LDTP05821 | Polyadenylate-binding protein 4 (PABPC4) | 12.5 | ||||
| LDTP05525 | KH domain-containing, RNA-binding, signal transduction-associated protein 1 (KHDRBS1) | 12.4 | ||||
| LDTP09580 | Programmed cell death 6-interacting protein (PDCD6IP) | 12.4 | ||||
| LDTP10962 | Heterogeneous nuclear ribonucleoprotein A/B (HNRNPAB) | 12.4 | ||||
| LDTP09793 | Small ribosomal subunit protein mS27 (MRPS27) | 12.3 | ||||
| LDTP04201 | T-complex protein 1 subunit epsilon (CCT5) | 12.3 | ||||
| LDTP05027 | Large ribosomal subunit protein uL2 (RPL8) | 12.1 | ||||
| LDTP03767 | Coatomer subunit beta' (COPB2) | 12.1 | ||||
| LDTP03967 | Lamina-associated polypeptide 2, isoform alpha (TMPO) | 12.1 | ||||
| LDTP01319 | Eukaryotic translation initiation factor 3 subunit G (EIF3G) | 12.0 | ||||
| LDTP01251 | Splicing factor 3B subunit 1 (SF3B1) | 12.0 | ||||
| LDTP11398 | Serrate RNA effector molecule homolog (SRRT) | 12.0 | ||||
| LDTP02227 | Heterogeneous nuclear ribonucleoproteins C1/C2 (HNRNPC) | 11.7 | ||||
| LDTP03850 | RNA-binding motif protein, X chromosome (RBMX) | 11.7 | ||||
| LDTP04952 | Heterogeneous nuclear ribonucleoprotein K (HNRNPK) | 11.4 | ||||
| LDTP02205 | Tubulin beta chain (TUBB) | 10.2 | ||||
| LDTP04902 | Actin-related protein 3 (ACTR3) | 9.8 | ||||
| LDTP10015 | GPI transamidase component PIG-T (PIGT) | 9.8 | ||||
| LDTP03247 | Eukaryotic translation initiation factor 4B (EIF4B) | 9.7 | ||||
| LDTP11277 | Tubulin beta-2B chain (TUBB2B) | 9.7 | ||||
| LDTP06032 | Heterogeneous nuclear ribonucleoprotein D0 (HNRNPD) | 9.7 | ||||
| LDTP04367 | Hsc70-interacting protein (ST13) | 9.5 | ||||
| LDTP00843 | Alpha-actinin-4 (ACTN4) | 9.5 | ||||
| LDTP11079 | Myb-binding protein 1A (MYBBP1A) | 9.3 | ||||
| LDTP03598 | Cytotoxic granule associated RNA binding protein TIA1 (TIA1) | 9.1 | ||||
| LDTP03509 | Endoplasmic reticulum resident protein 29 (ERP29) | 9.1 | ||||
| LDTP04495 | Heterogeneous nuclear ribonucleoprotein A3 (HNRNPA3) | 8.9 | ||||
| LDTP04027 | Matrin-3 (MATR3) | 8.6 | ||||
| LDTP13760 | Structural maintenance of chromosomes protein 3 (SMC3) | 8.4 | ||||
| LDTP03520 | Phosphatidylethanolamine-binding protein 1 (PEBP1) | 8.3 | ||||
| LDTP04500 | Heterogeneous nuclear ribonucleoprotein M (HNRNPM) | 8.2 | ||||
| LDTP05076 | Tubulin beta-4B chain (TUBB4B) | 8.2 | ||||
| LDTP00078 | CCR4-NOT transcription complex subunit 1 (CNOT1) | 8.0 | ||||
| LDTP01195 | Core histone macro-H2A.1 (MACROH2A1) | 7.9 | ||||
| LDTP14951 | Beta-actin-like protein 2 (ACTBL2) | 7.3 | ||||
| LDTP02595 | Polyadenylate-binding protein 1 (PABPC1) | 7.1 | ||||
| LDTP05647 | Transducin beta-like protein 3 (TBL3) | 6.8 | ||||
| LDTP13925 | Nucleolar protein 58 (NOP58) | 6.7 | ||||
| LDTP02845 | Histone H1.2 (H1-2) | 6.6 | ||||
| LDTP10990 | T-complex protein 1 subunit eta (CCT7) | 6.5 | ||||
| LDTP03346 | Moesin (MSN) | 6.4 | ||||
| LDTP12904 | Insulin-like growth factor 2 mRNA-binding protein 1 (IGF2BP1) | 6.3 | ||||
| LDTP04390 | T-complex protein 1 subunit theta (CCT8) | 6.3 | ||||
| LDTP03619 | Stress-induced-phosphoprotein 1 (STIP1) | 6.1 | ||||
| LDTP02364 | Heterogeneous nuclear ribonucleoprotein A1 (HNRNPA1) | 6.1 | ||||
| LDTP02631 | Alpha-actinin-1 (ACTN1) | 6.1 | ||||
| LDTP02218 | Profilin-1 (PFN1) | 6.1 | ||||
| LDTP02779 | Ezrin (EZR) | 6.0 | ||||
| LDTP04972 | Small ribosomal subunit protein uS13 (RPS18) | 5.9 | ||||
| LDTP06562 | Histone-binding protein RBBP7 (RBBP7) | 5.9 | ||||
| LDTP13167 | Peflin (PEF1) | 5.9 | ||||
| LDTP05688 | Interleukin enhancer-binding factor 2 (ILF2) | 5.8 | ||||
| LDTP00487 | Myosin regulatory light chain 12B (MYL12B) | 5.7 | ||||
| LDTP06345 | Periodic tryptophan protein 2 homolog (PWP2) | 5.6 | ||||
| LDTP03606 | DnaJ homolog subfamily A member 1 (DNAJA1) | 5.6 | ||||
| LDTP10285 | Small ribosomal subunit protein mS39 (PTCD3) | 5.6 | ||||
| LDTP04249 | T-complex protein 1 subunit gamma (CCT3) | 5.5 | ||||
| LDTP10843 | MMS19 nucleotide excision repair protein homolog (MMS19) | 5.3 | ||||
| LDTP05442 | 14-3-3 protein eta (YWHAH) | 5.1 | ||||
| LDTP03888 | T-complex protein 1 subunit zeta (CCT6A) | 5.0 | ||||
