Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C161 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 99.7 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 67.6 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 64.4 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 59.3 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 58.1 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 56.5 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 53.8 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 53.1 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 52.7 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 41.9 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 37.8 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 37.5 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 37.5 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 36.3 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 35.5 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 34.3 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 32.9 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 32.4 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 31.3 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 31.3 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 30.7 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 30.5 | ||||
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 30.3 | ||||
| LDTP12639 | 1-acyl-sn-glycerol-3-phosphate acyltransferase epsilon (AGPAT5) | 30.1 | ||||
| LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 28.2 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 28.1 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 27.9 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 27.7 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 27.3 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 26.7 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 26.7 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 26.5 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 26.0 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 26.0 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 25.6 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 25.6 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 25.5 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 25.3 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 25.3 | ||||
| LDTP00032 | 2-hydroxyacyl-CoA lyase 2 (ILVBL) | 24.9 | ||||
| LDTP15097 | All-trans-retinol 13,14-reductase (RETSAT) | 24.6 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 24.6 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 24.6 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 24.6 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 24.3 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 24.3 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 24.1 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 23.8 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 23.8 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 23.6 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 23.6 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 23.3 | ||||
| LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 22.8 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 22.5 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 22.2 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 21.9 | ||||
| LDTP04246 | Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha (FNTA) | 21.9 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 21.7 | ||||
| LDTP09391 | Ceramide kinase (CERK) | 21.6 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 21.1 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 21.0 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 20.8 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 20.7 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 20.3 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 20.3 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 20.1 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 20.0 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 20.0 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 19.8 | ||||
| LDTP00804 | E3 ubiquitin-protein ligase RNF13 (RNF13) | 19.8 | ||||
| LDTP13408 | Cell division cycle protein 23 homolog (CDC23) | 19.6 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 19.6 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 19.6 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 18.8 | ||||
| LDTP10249 | Metalloendopeptidase OMA1, mitochondrial (OMA1) | 18.5 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 18.1 | ||||
| LDTP16025 | Ketosamine-3-kinase (FN3KRP) | 18.0 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 17.9 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 17.3 | ||||
| LDTP03417 | Proteasome subunit beta type-4 (PSMB4) | 17.1 | ||||
| LDTP00544 | Sphingolipid delta(4)-desaturase DES1 (DEGS1) | 17.1 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 17.0 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 17.0 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 16.9 | ||||
| LDTP11081 | NAD-capped RNA hydrolase NUDT12 (NUDT12) | 16.9 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 16.6 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 16.4 | ||||
| LDTP13986 | Vesicle transport protein GOT1B (GOLT1B) | 16.3 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 16.2 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 16.2 | ||||
| LDTP04114 | E3 ubiquitin-protein ligase NEDD4 (NEDD4) | 16.1 | ||||
| LDTP07831 | Transmembrane protein with metallophosphoesterase domain (TMPPE) | 16.1 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 16.0 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 15.8 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 15.6 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 15.6 | ||||
| LDTP05409 | Antigen peptide transporter 2 (TAP2) | 15.3 | ||||
| LDTP14278 | Sulfide:quinone oxidoreductase, mitochondrial (SQOR) | 15.3 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 15.1 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 15.1 | ||||
| LDTP10699 | E3 ubiquitin-protein ligase NEDD4-like (NEDD4L) | 15.0 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 14.9 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 14.8 | ||||
| LDTP04471 | Ribosomal protein S6 kinase alpha-3 (RPS6KA3) | 14.5 | ||||
| LDTP01743 | NADH dehydrogenase 1 beta subcomplex subunit 10 (NDUFB10) | 14.3 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 14.2 | ||||
| LDTP14264 | Choline/ethanolaminephosphotransferase 1 (CEPT1) | 14.2 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 14.2 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 14.1 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 14.0 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 14.0 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 14.0 | ||||
| LDTP06849 | Prolyl endopeptidase-like (PREPL) | 13.8 | ||||
| LDTP10930 | Membrane-associated tyrosine- and threonine-specific cdc2-inhibitory kinase (PKMYT1) | 13.7 | ||||
| LDTP00462 | Branched-chain alpha-ketoacid dehydrogenase kinase (BCKDK) | 13.6 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 13.6 | ||||
| LDTP08017 | Endoplasmic reticulum metallopeptidase 1 (ERMP1) | 13.5 | ||||
| LDTP07756 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2 (HACD2) | 13.5 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 13.5 | ||||
| LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 13.4 | ||||
| LDTP11437 | Peroxisomal trans-2-enoyl-CoA reductase (PECR) | 13.3 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 13.2 | ||||
| LDTP16040 | Glyoxalase domain-containing protein 4 (GLOD4) | 13.1 | ||||
| LDTP03779 | Copper-transporting ATPase 2 (ATP7B) | 12.9 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 12.9 | ||||
| LDTP07868 | Protein O-mannosyl-transferase TMTC3 (TMTC3) | 12.9 | ||||
| LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | 12.9 | ||||
| LDTP06986 | Rab-like protein 3 (RABL3) | 12.8 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 12.7 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 12.6 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 12.6 | ||||
| LDTP00877 | Protein SCO2 homolog, mitochondrial (SCO2) | 12.6 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 12.4 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 12.3 | ||||
| LDTP00836 | ATPase GET3 (GET3) | 12.2 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 12.1 | ||||
| LDTP12444 | Xaa-Pro aminopeptidase 1 (XPNPEP1) | 12.1 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 12.0 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 12.0 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 12.0 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 12.0 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 12.0 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 11.9 | ||||
| LDTP02150 | ATP synthase subunit beta, mitochondrial (ATP5F1B) | 11.9 | ||||
| LDTP07503 | Endoplasmic reticulum aminopeptidase 2 (ERAP2) | 11.8 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 11.8 | ||||
| LDTP11319 | Threonine--tRNA ligase, mitochondrial (TARS2) | 11.7 | ||||
| LDTP04247 | Protein farnesyltransferase subunit beta (FNTB) | 11.6 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 11.6 | ||||
| LDTP01759 | Histone-lysine N-methyltransferase NSD2 (NSD2) | 11.6 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 11.6 | ||||
| LDTP15132 | 2-oxoglutarate and iron-dependent oxygenase domain-containing protein 3 (OGFOD3) | 11.5 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 11.5 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 11.5 | ||||
| LDTP10163 | m7GpppX diphosphatase (DCPS) | 11.3 | ||||
| LDTP09061 | Retinol dehydrogenase 13 (RDH13) | 11.3 | ||||
| LDTP15155 | Thiol S-methyltransferase TMT1B (TMT1B) | 11.3 | ||||
| LDTP17247 | 5'-nucleotidase domain-containing protein 1 (NT5DC1) | 11.2 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 11.2 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 11.0 | ||||
| LDTP13131 | 7-dehydrocholesterol reductase (DHCR7) | 10.9 | ||||
| LDTP03822 | Activin receptor type-1B (ACVR1B) | 10.9 | ||||
| LDTP08378 | Serine/threonine-protein kinase VRK2 (VRK2) | 10.9 | ||||
| LDTP07873 | Acyl-CoA dehydrogenase family member 11 (ACAD11) | 10.8 | ||||
| LDTP13352 | GTP:AMP phosphotransferase AK3, mitochondrial (AK3) | 10.8 | ||||
| LDTP10530 | Beta-1,3-galactosyltransferase 6 (B3GALT6) | 10.7 | ||||
| LDTP07057 | Protein phosphatase 1L (PPM1L) | 10.7 | ||||
| LDTP00975 | Mannosyl-oligosaccharide 1,2-alpha-mannosidase IB (MAN1A2) | 10.6 | ||||
| LDTP00886 | Nardilysin (NRDC) | 10.6 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 10.6 | ||||
| LDTP01699 | Acyl-CoA 6-desaturase (FADS2) | 10.5 | ||||
| LDTP01329 | Lathosterol oxidase (SC5D) | 10.5 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 10.5 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 10.4 | ||||
| LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 10.4 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 10.4 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 10.3 | ||||
| LDTP03608 | RAC-beta serine/threonine-protein kinase (AKT2) | 10.3 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 10.2 | ||||
| LDTP07961 | Protein arginine methyltransferase NDUFAF7, mitochondrial (NDUFAF7) | 10.2 | ||||
| LDTP06779 | Triokinase/FMN cyclase (TKFC) | 10.2 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 10.1 | ||||
| LDTP04263 | Cysteine--tRNA ligase, cytoplasmic (CARS1) | 10.1 | ||||
| LDTP02721 | Farnesyl pyrophosphate synthase (FDPS) | 10.1 | ||||
| LDTP10101 | Peptidyl-prolyl cis-trans isomerase FKBP10 (FKBP10) | 10.1 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 10.1 | ||||
| LDTP10676 | Inositol polyphosphate-4-phosphatase type I A (INPP4A) | 10.0 | ||||
| LDTP01649 | Phosphatidate cytidylyltransferase 2 (CDS2) | 10.0 | ||||
| LDTP11199 | DCN1-like protein 5 (DCUN1D5) | 9.9 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 9.8 | ||||
| LDTP12470 | GTP-binding protein SAR1a (SAR1A) | 9.8 | ||||
| LDTP00518 | Histone-lysine N-methyltransferase SETD1A (SETD1A) | 9.8 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 9.8 | ||||
| LDTP06511 | Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial (ETFDH) | 9.8 | ||||
| LDTP04080 | Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform (PHKA1) | 9.8 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 99.7 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 99.7 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 69.1 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 67.2 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 64.4 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 64.0 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 62.2 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 57.3 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 56.5 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 55.7 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 55.3 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 52.0 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 50.6 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 49.5 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 47.2 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 44.3 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 43.4 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 42.5 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 39.4 | ||||
| LDTP16163 | Cytochrome c oxidase assembly protein COX16 homolog, mitochondrial (COX16) | 39.4 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 38.6 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 35.0 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 35.0 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 34.3 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 31.1 | ||||
| LDTP01217 | Metaxin-2 (MTX2) | 30.7 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 29.7 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 29.0 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 27.9 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 26.9 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 26.2 | ||||
| LDTP02215 | Prosaposin (PSAP) | 25.1 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 24.9 | ||||
| LDTP17106 | Solute carrier family 25 member 35 (SLC25A35) | 24.6 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 24.4 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 24.3 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 24.1 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 23.9 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 23.8 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 23.4 | ||||
| LDTP08016 | Proton-coupled amino acid transporter 1 (SLC36A1) | 23.1 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 21.1 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 21.0 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 20.8 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 20.8 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 19.4 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 19.4 | ||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 19.3 | ||||
| LDTP11136 | Sugar transporter SWEET1 (SLC50A1) | 19.0 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 18.9 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 18.4 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 18.4 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 18.3 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 18.1 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 18.1 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 18.1 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 18.0 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 17.9 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 17.8 | ||||
| LDTP04463 | H(+)/Cl(-) exchange transporter 7 (CLCN7) | 17.8 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 17.6 | ||||
| LDTP14181 | Peroxisomal membrane protein PEX16 (PEX16) | 17.5 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 17.4 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 17.1 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 16.9 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 16.8 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 16.8 | ||||
| LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | 16.3 | ||||
| LDTP09294 | Proton-coupled zinc antiporter SLC30A5 (SLC30A5) | 16.3 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 16.0 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 15.7 | ||||
| LDTP14275 | Sodium bicarbonate cotransporter 3 (SLC4A7) | 15.3 | ||||
| LDTP02544 | Solute carrier family 2, facilitated glucose transporter member 1 (SLC2A1) | 15.1 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 15.0 | ||||
| LDTP09028 | Mitoguardin 1 (MIGA1) | 15.0 | ||||
| LDTP12704 | Anoctamin-10 (ANO10) | 14.9 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 14.5 | ||||
| LDTP07058 | Transmembrane protein 201 (TMEM201) | 14.5 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 14.3 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 14.1 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 13.8 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 13.8 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 13.4 | ||||
| LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 13.2 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 13.2 | ||||
| LDTP04787 | Transmembrane protein 33 (TMEM33) | 13.2 | ||||
| LDTP04501 | Importin subunit alpha-1 (KPNA2) | 12.9 | ||||
| LDTP13393 | Electrogenic aspartate/glutamate antiporter SLC25A13, mitochondrial (SLC25A13) | 12.8 | ||||
| LDTP15979 | Transmembrane protein 245 (TMEM245) | 12.8 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 12.7 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 12.6 | ||||
| LDTP06293 | Metal cation symporter ZIP14 (SLC39A14) | 12.5 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 12.4 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 11.9 | ||||
| LDTP06198 | Major facilitator superfamily domain-containing protein 10 (MFSD10) | 11.9 | ||||
| LDTP07610 | Proton-coupled zinc antiporter SLC30A9, mitochondrial (SLC30A9) | 11.9 | ||||
| LDTP03546 | Translocator protein (TSPO) | 11.8 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 11.7 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 11.7 | ||||
| LDTP05811 | Syntaxin-3 (STX3) | 11.7 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 11.6 | ||||
| LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 11.6 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 11.5 | ||||
| LDTP00872 | Peroxisomal membrane protein PMP34 (SLC25A17) | 11.4 | ||||
| LDTP11634 | Derlin-2 (DERL2) | 11.2 | ||||
| LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 11.2 | ||||
| LDTP03952 | Reduced folate transporter (SLC19A1) | 11.0 | ||||
| LDTP09949 | Transportin-1 (TNPO1) | 11.0 | ||||
| LDTP02087 | ADP/ATP translocase 2 (SLC25A5) | 10.9 | ||||
| LDTP01100 | Iron-sulfur clusters transporter ABCB7, mitochondrial (ABCB7) | 10.9 | ||||
| LDTP01748 | Mitochondrial import receptor subunit TOM40 homolog (TOMM40) | 10.9 | ||||
| LDTP00590 | Protein RER1 (RER1) | 10.6 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 10.6 | ||||
| LDTP07467 | Rhomboid domain-containing protein 2 (RHBDD2) | 10.6 | ||||
| LDTP14212 | Solute carrier family 12 member 7 (SLC12A7) | 10.6 | ||||
| LDTP15733 | Solute carrier family 25 member 44 (SLC25A44) | 10.6 | ||||
| LDTP06855 | Anoctamin-6 (ANO6) | 10.5 | ||||
| LDTP09144 | Metal transporter CNNM3 (CNNM3) | 10.3 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 10.3 | ||||
| LDTP01309 | Renin receptor (ATP6AP2) | 10.3 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 10.1 | ||||
| LDTP10754 | Pannexin-1 (PANX1) | 10.0 | ||||
| LDTP07649 | Sodium-driven chloride bicarbonate exchanger (SLC4A10) | 10.0 | ||||
| LDTP01380 | Wolframin (WFS1) | 10.0 | ||||
| LDTP08673 | Calcium uptake protein 2, mitochondrial (MICU2) | 9.9 | ||||
| LDTP15838 | Translocation protein SEC62 (SEC62) | 9.8 | ||||
| LDTP11229 | Transmembrane protein 70, mitochondrial (TMEM70) | 9.8 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 9.8 | ||||
| LDTP07537 | Metal transporter CNNM4 (CNNM4) | 9.7 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 14.4 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05085 | Coxsackievirus and adenovirus receptor (CXADR) | 13.6 | ||||
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 12.8 | ||||
| LDTP03772 | Basigin (BSG) | 10.1 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 99.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 99.7 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 61.0 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 58.5 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 54.9 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 52.0 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 45.9 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 42.8 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 42.2 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 41.1 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 39.4 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 38.6 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 37.3 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 36.8 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 34.8 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 33.6 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 31.8 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 27.1 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 26.2 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 25.5 | ||||
| LDTP14259 | Testis-expressed protein 264 (TEX264) | 24.9 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 23.9 | ||||
| LDTP01225 | Mediator of RNA polymerase II transcription subunit 24 (MED24) | 23.9 | ||||
| LDTP14126 | Mitochondrial import inner membrane translocase subunit Tim9 (TIMM9) | 22.9 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 22.3 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 22.2 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 21.6 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 21.6 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 21.4 | ||||
| LDTP03729 | General transcription factor IIF subunit 1 (GTF2F1) | 20.7 | ||||
| LDTP15701 | EF-hand domain-containing protein D2 (EFHD2) | 19.8 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 19.7 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 19.6 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 19.6 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 18.9 | ||||
| LDTP00779 | Trans-Golgi network integral membrane protein 2 (TGOLN2) | 18.9 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 18.8 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 18.1 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 17.8 | ||||
| LDTP13125 | Protein UXT (UXT) | 17.4 | ||||
| LDTP13802 | DNA replication complex GINS protein PSF2 (GINS2) | 16.9 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 16.9 | ||||
| LDTP09069 | Kinetochore protein Spc24 (SPC24) | 16.8 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 16.6 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 16.6 | ||||
| LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 15.7 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 15.6 | ||||
| LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | 15.6 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 15.3 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 15.3 | ||||
| LDTP05277 | Protein SET (SET) | 15.2 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 15.2 | ||||
| LDTP15095 | Receptor expression-enhancing protein 3 (REEP3) | 14.8 | ||||
| LDTP08387 | Dynein axonemal assembly factor 5 (DNAAF5) | 14.5 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 14.3 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 14.2 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 13.8 | ||||
| LDTP02181 | Neurofilament medium polypeptide (NEFM) | 13.7 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 13.7 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 13.2 | ||||
| LDTP04356 | Emerin (EMD) | 12.9 | ||||
| LDTP12623 | Zinc finger CCHC domain-containing protein 3 (ZCCHC3) | 12.8 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 12.7 | ||||
| LDTP16322 | Mitochondrial import inner membrane translocase subunit Tim8 B (TIMM8B) | 12.7 | ||||
| LDTP10487 | Protein SERAC1 (SERAC1) | 12.6 | ||||
| LDTP05711 | Nuclear inhibitor of protein phosphatase 1 (PPP1R8) | 12.5 | ||||
| LDTP04207 | Heat shock 70 kDa protein 13 (HSPA13) | 12.3 | ||||
| LDTP11143 | Centromere protein K (CENPK) | 12.2 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 12.2 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 12.2 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 12.1 | ||||
| LDTP09773 | Protein FAM3C (FAM3C) | 12.1 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 12.1 | ||||
| LDTP17713 | Tetratricopeptide repeat protein 39C (TTC39C) | 12.0 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 11.9 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 11.9 | ||||
| LDTP12379 | Complex I assembly factor TIMMDC1, mitochondrial (TIMMDC1) | 11.7 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 11.7 | ||||
| LDTP09143 | Divergent protein kinase domain 2A (DIPK2A) | 11.5 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 11.5 | ||||
| LDTP07718 | MICOS complex subunit MIC27 (APOOL) | 11.4 | ||||
| LDTP10924 | Prohibitin-2 (PHB2) | 11.4 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 11.3 | ||||
| LDTP12545 | Protein kish-B (TMEM167B) | 11.2 | ||||
| LDTP13863 | DnaJ homolog subfamily C member 16 (DNAJC16) | 11.1 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 11.1 | ||||
| LDTP12925 | CCR4-NOT transcription complex subunit 2 (CNOT2) | 11.0 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 11.0 | ||||
| LDTP12780 | THUMP domain-containing protein 1 (THUMPD1) | 11.0 | ||||
| LDTP04425 | Translocon-associated protein subunit delta (SSR4) | 11.0 | ||||
| LDTP01259 | Interferon-inducible double-stranded RNA-dependent protein kinase activator A (PRKRA) | 10.9 | ||||
| LDTP17652 | Uncharacterized protein KIAA2013 (KIAA2013) | 10.9 | ||||
| LDTP11906 | Phosphatidylinositol glycan anchor biosynthesis class U protein (PIGU) | 10.8 | ||||
| LDTP11159 | Gamma-tubulin complex component 2 (TUBGCP2) | 10.6 | ||||
| LDTP00871 | Microtubule nucleation factor SSNA1 (SSNA1) | 10.6 | ||||
| LDTP14125 | Mitochondrial import inner membrane translocase subunit Tim10 B (TIMM10B) | 10.6 | ||||
| LDTP02180 | Neurofilament light polypeptide (NEFL) | 10.6 | ||||
| LDTP06808 | Vacuolar ATPase assembly integral membrane protein VMA21 (VMA21) | 10.6 | ||||
| LDTP11981 | Receptor expression-enhancing protein 4 (REEP4) | 10.6 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 10.5 | ||||
| LDTP03615 | Heterogeneous nuclear ribonucleoprotein H (HNRNPH1) | 10.5 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 10.5 | ||||
| LDTP00887 | Calumenin (CALU) | 10.4 | ||||
| LDTP05922 | Dynactin subunit 2 (DCTN2) | 10.4 | ||||
| LDTP11326 | FUN14 domain-containing protein 2 (FUNDC2) | 10.4 | ||||
| LDTP05558 | Galectin-3-binding protein (LGALS3BP) | 10.4 | ||||
| LDTP02297 | Vimentin (VIM) | 10.3 | ||||
| LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 10.3 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 10.3 | ||||
| LDTP05715 | Vesicle transport protein SEC20 (BNIP1) | 10.3 | ||||
| LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 10.1 | ||||
| LDTP09297 | Large ribosomal subunit protein mL64 (GADD45GIP1) | 10.1 | ||||
| LDTP04853 | Eukaryotic translation initiation factor 3 subunit E (EIF3E) | 10.0 | ||||
| LDTP14217 | Lipid droplet-regulating VLDL assembly factor AUP1 (AUP1) | 10.0 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 10.0 | ||||
| LDTP07031 | Collectin-12 (COLEC12) | 9.9 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 9.9 | ||||
| LDTP10213 | Anaphase-promoting complex subunit 16 (ANAPC16) | 9.8 | ||||
| LDTP07598 | BRCA1-associated ATM activator 1 (BRAT1) | 9.8 | ||||
| LDTP10603 | Conserved oligomeric Golgi complex subunit 8 (COG8) | 9.8 | ||||
| LDTP00991 | Heterogeneous nuclear ribonucleoprotein Q (SYNCRIP) | 9.8 | ||||
| LDTP00632 | Syntaxin-7 (STX7) | 9.8 | ||||
| LDTP12476 | Translation initiation factor eIF2B subunit gamma (EIF2B3) | 9.8 | ||||
| LDTP12651 | TBC1 domain family member 23 (TBC1D23) | 9.7 | ||||
