Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C218 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 99.7 | ||||
| LDTP07831 | Transmembrane protein with metallophosphoesterase domain (TMPPE) | 74.0 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 54.9 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 47.8 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 46.2 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 45.6 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 44.9 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 43.7 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 41.6 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 38.9 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 38.3 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 37.8 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 37.5 | ||||
| LDTP01571 | Phenylalanine--tRNA ligase, mitochondrial (FARS2) | 36.5 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 36.0 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 36.0 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 36.0 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 34.3 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 33.1 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 31.8 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 31.3 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 30.3 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 30.1 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 29.2 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 28.2 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 27.9 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 27.9 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 27.1 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 26.9 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 26.7 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 26.0 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 26.0 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 24.9 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 24.4 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 23.9 | ||||
| LDTP11225 | Deoxyhypusine hydroxylase (DOHH) | 23.6 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 23.6 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 23.4 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 23.1 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 22.9 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 22.9 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 22.8 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 22.6 | ||||
| LDTP06384 | Ribosomal protein S6 kinase alpha-1 (RPS6KA1) | 22.6 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 22.3 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 22.3 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 22.3 | ||||
| LDTP03671 | Multidrug resistance-associated protein 1 (ABCC1) | 22.0 | ||||
| LDTP09556 | E3 ubiquitin-protein ligase RNF139 (RNF139) | 21.9 | ||||
| LDTP01219 | NADH dehydrogenase 1 beta subcomplex subunit 1 (NDUFB1) | 21.9 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 21.7 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 21.6 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 21.4 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 21.4 | ||||
| LDTP04286 | DNA replication licensing factor MCM2 (MCM2) | 21.1 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 21.1 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 21.0 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 20.7 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 20.5 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 20.0 | ||||
| LDTP07259 | N-alpha-acetyltransferase 35, NatC auxiliary subunit (NAA35) | 20.0 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 19.8 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 19.8 | ||||
| LDTP01649 | Phosphatidate cytidylyltransferase 2 (CDS2) | 19.7 | ||||
| LDTP11867 | UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase (DPAGT1) | 19.7 | ||||
| LDTP12586 | Phenylalanine--tRNA ligase beta subunit (FARSB) | 19.6 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 19.0 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 18.9 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 18.9 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 18.8 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 18.6 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 18.4 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 18.3 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 18.1 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 17.6 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 17.6 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 17.5 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 17.3 | ||||
| LDTP06546 | Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform (PPP2R5E) | 17.1 | ||||
| LDTP01743 | NADH dehydrogenase 1 beta subcomplex subunit 10 (NDUFB10) | 17.0 | ||||
| LDTP09061 | Retinol dehydrogenase 13 (RDH13) | 17.0 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 16.9 | ||||
| LDTP04438 | Succinate-semialdehyde dehydrogenase, mitochondrial (ALDH5A1) | 16.9 | ||||
| LDTP01983 | NADH-ubiquinone oxidoreductase chain 2 (MT-ND2) | 16.8 | ||||
| LDTP05480 | Amidophosphoribosyltransferase (PPAT) | 16.6 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 16.6 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 16.6 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 16.4 | ||||
| LDTP04471 | Ribosomal protein S6 kinase alpha-3 (RPS6KA3) | 16.3 | ||||
| LDTP12763 | Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase (BPNT2) | 16.2 | ||||
| LDTP08455 | Palmitoyltransferase ZDHHC13 (ZDHHC13) | 16.2 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 16.1 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 16.0 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 16.0 | ||||
| LDTP01284 | Mitochondrial tRNA-specific 2-thiouridylase 1 (TRMU) | 15.6 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 15.5 | ||||
| LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | 15.2 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 14.9 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 14.9 | ||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 14.9 | ||||
| LDTP00400 | Torsin-1B (TOR1B) | 14.9 | ||||
| LDTP12415 | Adenosine 5'-monophosphoramidase HINT3 (HINT3) | 14.6 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 14.6 | ||||
| LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 14.6 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 14.5 | ||||
| LDTP12639 | 1-acyl-sn-glycerol-3-phosphate acyltransferase epsilon (AGPAT5) | 14.4 | ||||
| LDTP06721 | GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase (ALG11) | 14.4 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 14.4 | ||||
| LDTP03608 | RAC-beta serine/threonine-protein kinase (AKT2) | 14.4 | ||||
| LDTP00344 | Stearoyl-CoA desaturase (SCD) | 14.4 | ||||
| LDTP04531 | Hexokinase-2 (HK2) | 14.3 | ||||
| LDTP15962 | Protein-L-histidine N-pros-methyltransferase (METTL9) | 14.2 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 14.1 | ||||
| LDTP05920 | Calcium/calmodulin-dependent protein kinase type II subunit gamma (CAMK2G) | 14.1 | ||||
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 14.1 | ||||
| LDTP02123 | Protein kinase C beta type (PRKCB) | 13.8 | ||||
| LDTP11259 | Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase (ALG12) | 13.6 | ||||
| LDTP00877 | Protein SCO2 homolog, mitochondrial (SCO2) | 13.5 | ||||
| LDTP00544 | Sphingolipid delta(4)-desaturase DES1 (DEGS1) | 13.5 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 13.5 | ||||
| LDTP03518 | Enoyl-CoA hydratase, mitochondrial (ECHS1) | 13.5 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 13.4 | ||||
| LDTP08617 | Patatin-like phospholipase domain-containing protein 6 (PNPLA6) | 13.4 | ||||
| LDTP07154 | ATPase family AAA domain-containing protein 3B (ATAD3B) | 13.2 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 13.2 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 13.2 | ||||
| LDTP02150 | ATP synthase subunit beta, mitochondrial (ATP5F1B) | 12.9 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 12.9 | ||||
| LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 12.7 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 12.7 | ||||
| LDTP01300 | Cartilage-associated protein (CRTAP) | 12.6 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 12.6 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 12.6 | ||||
| LDTP10966 | Microsomal glutathione S-transferase 2 (MGST2) | 12.6 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 12.5 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 12.5 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 12.5 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 12.4 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 12.4 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 12.3 | ||||
| LDTP15097 | All-trans-retinol 13,14-reductase (RETSAT) | 12.1 | ||||
| LDTP04646 | Delta-1-pyrroline-5-carboxylate synthase (ALDH18A1) | 12.1 | ||||
| LDTP09110 | NAD(P)H-hydrate epimerase (NAXE) | 12.1 | ||||
| LDTP10862 | Proteasome subunit beta type-7 (PSMB7) | 12.1 | ||||
| LDTP07227 | Threonylcarbamoyladenosine tRNA methylthiotransferase (CDKAL1) | 12.1 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 12.0 | ||||
| LDTP12608 | Phosphatidylinositol-3-phosphatase SAC1 (SACM1L) | 12.0 | ||||
| LDTP02721 | Farnesyl pyrophosphate synthase (FDPS) | 11.9 | ||||
| LDTP13957 | Ubiquitin-conjugating enzyme E2 J1 (UBE2J1) | 11.9 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 11.8 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 11.8 | ||||
| LDTP01502 | NADH dehydrogenase 1 beta subcomplex subunit 6 (NDUFB6) | 11.8 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 11.7 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 11.7 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 11.7 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 11.6 | ||||
| LDTP07756 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2 (HACD2) | 11.6 | ||||
| LDTP03813 | Oxygen-dependent coproporphyrinogen-III oxidase, mitochondrial (CPOX) | 11.4 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 11.4 | ||||
| LDTP06810 | Mitochondrial import inner membrane translocase subunit TIM50 (TIMM50) | 11.3 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 11.3 | ||||
| LDTP00831 | NADH dehydrogenase 1 beta subcomplex subunit 5, mitochondrial (NDUFB5) | 11.2 | ||||
| LDTP03592 | Ribonucleoside-diphosphate reductase subunit M2 (RRM2) | 11.2 | ||||
| LDTP00464 | Glutathione S-transferase 3, mitochondrial (MGST3) | 11.2 | ||||
| LDTP05588 | RNA cytosine C(5)-methyltransferase NSUN2 (NSUN2) | 11.2 | ||||
| LDTP09835 | GPI-anchor transamidase (PIGK) | 11.0 | ||||
| LDTP10930 | Membrane-associated tyrosine- and threonine-specific cdc2-inhibitory kinase (PKMYT1) | 11.0 | ||||
| LDTP00890 | S-adenosylhomocysteine hydrolase-like protein 1 (AHCYL1) | 11.0 | ||||
| LDTP04032 | Glycerol-3-phosphate dehydrogenase, mitochondrial (GPD2) | 10.9 | ||||
| LDTP12470 | GTP-binding protein SAR1a (SAR1A) | 10.9 | ||||
| LDTP14141 | Mannose-1-phosphate guanyltransferase beta (GMPPB) | 10.9 | ||||
| LDTP08530 | Mitofusin-1 (MFN1) | 10.9 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 10.9 | ||||
| LDTP06283 | Exosome complex component RRP42 (EXOSC7) | 10.9 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 10.8 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 10.8 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 10.7 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15648 | BRI3-binding protein (BRI3BP) | 99.7 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 99.7 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 78.2 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 71.0 | ||||
| LDTP08981 | Cytochrome c oxidase assembly protein COX18, mitochondrial (COX18) | 58.5 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 54.2 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 49.9 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 48.5 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 46.2 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 45.6 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 41.9 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 40.5 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 38.9 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 38.3 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 35.8 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 35.5 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 34.1 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 32.9 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 32.0 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 31.6 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 30.9 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 30.7 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 30.3 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 30.3 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 30.1 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 30.1 | ||||
| LDTP07467 | Rhomboid domain-containing protein 2 (RHBDD2) | 30.1 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 29.9 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 28.2 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 28.1 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 27.9 | ||||
| LDTP08469 | Complex I assembly factor TMEM126B, mitochondrial (TMEM126B) | 27.7 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 27.7 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 27.3 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 27.1 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 26.9 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 26.4 | ||||
| LDTP11626 | Protein YIPF3 (YIPF3) | 25.6 | ||||
| LDTP07490 | Zinc transporter 6 (SLC30A6) | 25.3 | ||||
| LDTP03546 | Translocator protein (TSPO) | 24.8 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 24.1 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 23.6 | ||||
| LDTP06855 | Anoctamin-6 (ANO6) | 23.4 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 23.3 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 22.8 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 22.8 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 22.6 | ||||
| LDTP11136 | Sugar transporter SWEET1 (SLC50A1) | 21.0 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 20.4 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 20.1 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 20.1 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 19.8 | ||||
| LDTP11826 | Sodium-dependent neutral amino acid transporter B(0)AT2 (SLC6A15) | 19.7 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 19.6 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 19.6 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 19.3 | ||||
| LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 18.9 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 18.9 | ||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 18.5 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 18.3 | ||||
| LDTP05780 | Syntaxin-5 (STX5) | 18.3 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 17.9 | ||||
| LDTP01380 | Wolframin (WFS1) | 17.8 | ||||
| LDTP10081 | Leucine-rich repeat-containing protein 59 (LRRC59) | 17.6 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 17.6 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 17.5 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 17.4 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 17.4 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 17.0 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 17.0 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 16.9 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 16.4 | ||||
| LDTP10804 | Chloride channel CLIC-like protein 1 (CLCC1) | 16.1 | ||||
| LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 16.0 | ||||
| LDTP02215 | Prosaposin (PSAP) | 15.9 | ||||
| LDTP03327 | ATP synthase subunit alpha, mitochondrial (ATP5F1A) | 15.8 | ||||
| LDTP07058 | Transmembrane protein 201 (TMEM201) | 15.8 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 15.3 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 14.9 | ||||
| LDTP00590 | Protein RER1 (RER1) | 14.8 | ||||
| LDTP03405 | Calnexin (CANX) | 14.6 | ||||
| LDTP00821 | Mitochondrial import inner membrane translocase subunit TIM44 (TIMM44) | 14.6 | ||||
| LDTP09294 | Proton-coupled zinc antiporter SLC30A5 (SLC30A5) | 14.5 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 14.2 | ||||
| LDTP03810 | ATP synthase subunit gamma, mitochondrial (ATP5F1C) | 14.2 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 14.0 | ||||
| LDTP06293 | Metal cation symporter ZIP14 (SLC39A14) | 13.9 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 13.9 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 13.8 | ||||
| LDTP13943 | Thioredoxin-related transmembrane protein 2 (TMX2) | 13.8 | ||||
| LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 13.5 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 13.4 | ||||
| LDTP08279 | Mitochondrial coenzyme A transporter SLC25A42 (SLC25A42) | 13.1 | ||||
| LDTP15838 | Translocation protein SEC62 (SEC62) | 13.1 | ||||
| LDTP08673 | Calcium uptake protein 2, mitochondrial (MICU2) | 12.9 | ||||
| LDTP03869 | Protein Mpv17 (MPV17) | 12.9 | ||||
| LDTP05116 | CMP-sialic acid transporter (SLC35A1) | 12.7 | ||||
| LDTP14174 | Sorting nexin-5 (SNX5) | 12.7 | ||||
| LDTP07477 | Transmembrane protein 214 (TMEM214) | 12.6 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 12.6 | ||||
| LDTP01217 | Metaxin-2 (MTX2) | 12.3 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 12.3 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 12.3 | ||||
| LDTP10621 | Sideroflexin-2 (SFXN2) | 12.2 | ||||
| LDTP11732 | Magnesium transporter protein 1 (MAGT1) | 12.1 | ||||
| LDTP02057 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 (RPN1) | 12.0 | ||||
| LDTP13393 | Electrogenic aspartate/glutamate antiporter SLC25A13, mitochondrial (SLC25A13) | 12.0 | ||||
| LDTP09144 | Metal transporter CNNM3 (CNNM3) | 12.0 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 11.9 | ||||
| LDTP08769 | Nuclear pore complex protein Nup93 (NUP93) | 11.7 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 11.5 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 11.5 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 11.5 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 11.5 | ||||
| LDTP11281 | Voltage-gated monoatomic cation channel TMEM109 (TMEM109) | 11.5 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 11.4 | ||||
| LDTP14181 | Peroxisomal membrane protein PEX16 (PEX16) | 11.4 | ||||
| LDTP12704 | Anoctamin-10 (ANO10) | 11.3 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 11.3 | ||||
| LDTP06994 | ER membrane protein complex subunit 4 (EMC4) | 11.3 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 11.2 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 11.2 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 11.2 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 11.1 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 10.9 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 10.9 | ||||
| LDTP05510 | Complement component 1 Q subcomponent-binding protein, mitochondrial (C1QBP) | 10.9 | ||||
| LDTP04787 | Transmembrane protein 33 (TMEM33) | 10.9 | ||||
| LDTP04426 | B-cell receptor-associated protein 31 (BCAP31) | 10.7 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 13.2 | ||||
| LDTP10507 | Zinc finger protein 512B (ZNF512B) | 10.9 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 15.3 | ||||
| LDTP03772 | Basigin (BSG) | 14.5 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11674 | Extracellular glycoprotein lacritin (LACRT) | 99.7 | ||||
| LDTP03571 | Lipocalin-1 (LCN1) | 99.7 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 99.7 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 86.8 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 82.7 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 77.2 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 60.5 | ||||
| LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 60.1 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 53.4 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 52.3 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 50.9 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 50.2 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 47.2 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 46.9 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 45.6 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 44.0 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 39.9 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 35.3 | ||||
| LDTP18467 | LYR motif-containing protein 2 (LYRM2) | 34.5 | ||||
| LDTP11009 | Opiorphin prepropeptide (OPRPN) | 34.5 | ||||
| LDTP08919 | COMM domain-containing protein 1 (COMMD1) | 34.3 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 34.1 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 32.7 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 32.4 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 32.0 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 31.6 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 31.6 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 30.1 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 29.9 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 29.9 | ||||
| LDTP12395 | Large ribosomal subunit protein mL40 (MRPL40) | 29.0 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 28.2 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 27.7 | ||||
| LDTP10357 | RUS family member 1 (RUSF1) | 27.7 | ||||
| LDTP13425 | U6 snRNA-associated Sm-like protein LSm7 (LSM7) | 27.7 | ||||
| LDTP14939 | Membralin (TMEM259) | 27.3 | ||||
| LDTP15240 | LysM and putative peptidoglycan-binding domain-containing protein 3 (LYSMD3) | 26.5 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 25.6 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 25.6 | ||||
| LDTP08248 | NLR family member X1 (NLRX1) | 24.3 | ||||
| LDTP08796 | Protein SYS1 homolog (SYS1) | 23.1 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 22.9 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 22.6 | ||||
| LDTP15712 | RING finger and SPRY domain-containing protein 1 (RSPRY1) | 22.3 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 20.8 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 19.7 | ||||
| LDTP12982 | Mitochondrial import receptor subunit TOM7 homolog (TOMM7) | 19.4 | ||||
| LDTP10093 | Mitochondrial calcium uniporter regulator 1 (MCUR1) | 19.3 | ||||
| LDTP11906 | Phosphatidylinositol glycan anchor biosynthesis class U protein (PIGU) | 18.6 | ||||
| LDTP09069 | Kinetochore protein Spc24 (SPC24) | 18.5 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 18.5 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 18.3 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 18.1 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 18.0 | ||||
| LDTP15253 | HEAT repeat-containing protein 3 (HEATR3) | 17.4 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 17.3 | ||||
| LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 17.1 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 17.1 | ||||
| LDTP07598 | BRCA1-associated ATM activator 1 (BRAT1) | 17.1 | ||||
| LDTP15434 | ADP-ribosylation factor-like protein 6-interacting protein 6 (ARL6IP6) | 16.9 | ||||
| LDTP04015 | Platelet-activating factor acetylhydrolase IB subunit beta (PAFAH1B1) | 16.7 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 16.2 | ||||
| LDTP00887 | Calumenin (CALU) | 16.1 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 16.1 | ||||
| LDTP04356 | Emerin (EMD) | 16.0 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 16.0 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 16.0 | ||||
| LDTP14126 | Mitochondrial import inner membrane translocase subunit Tim9 (TIMM9) | 15.9 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 15.5 | ||||
| LDTP05715 | Vesicle transport protein SEC20 (BNIP1) | 15.5 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 15.0 | ||||
| LDTP11981 | Receptor expression-enhancing protein 4 (REEP4) | 14.9 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 14.5 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 14.3 | ||||
| LDTP16116 | BSD domain-containing protein 1 (BSDC1) | 14.2 | ||||
| LDTP11421 | Fanconi anemia group D2 protein (FANCD2) | 14.2 | ||||
| LDTP13908 | AP-3 complex subunit mu-1 (AP3M1) | 13.9 | ||||
| LDTP02297 | Vimentin (VIM) | 13.9 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 13.8 | ||||
| LDTP09325 | Iron-sulfur cluster transfer protein NUBPL (NUBPL) | 13.6 | ||||
| LDTP10469 | Engulfment and cell motility protein 2 (ELMO2) | 13.5 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 13.5 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 13.4 | ||||
| LDTP11277 | Tubulin beta-2B chain (TUBB2B) | 13.4 | ||||
| LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 13.2 | ||||
| LDTP05076 | Tubulin beta-4B chain (TUBB4B) | 13.2 | ||||
| LDTP08420 | BLOC-2 complex member HPS6 (HPS6) | 13.1 | ||||
| LDTP13622 | NFU1 iron-sulfur cluster scaffold homolog, mitochondrial (NFU1) | 13.1 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 13.0 | ||||
| LDTP17659 | ELMO domain-containing protein 2 (ELMOD2) | 13.0 | ||||
| LDTP16577 | DENN domain-containing protein 11 (DENND11) | 12.9 | ||||
| LDTP04514 | Heterogeneous nuclear ribonucleoprotein F (HNRNPF) | 12.8 | ||||
| LDTP04714 | Heterogeneous nuclear ribonucleoprotein H2 (HNRNPH2) | 12.7 | ||||
| LDTP16322 | Mitochondrial import inner membrane translocase subunit Tim8 B (TIMM8B) | 12.7 | ||||
| LDTP00991 | Heterogeneous nuclear ribonucleoprotein Q (SYNCRIP) | 12.6 | ||||
| LDTP06587 | Survival motor neuron protein (SMN1; SMN2) | 12.6 | ||||
| LDTP09644 | m-AAA protease-interacting protein 1, mitochondrial (MAIP1) | 12.4 | ||||
| LDTP02205 | Tubulin beta chain (TUBB) | 12.4 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 12.3 | ||||
| LDTP13922 | Tudor and KH domain-containing protein (TDRKH) | 12.1 | ||||
| LDTP05257 | Receptor expression-enhancing protein 5 (REEP5) | 12.0 | ||||
| LDTP11159 | Gamma-tubulin complex component 2 (TUBGCP2) | 12.0 | ||||
| LDTP00729 | Glycosylphosphatidylinositol anchor attachment 1 protein (GPAA1) | 12.0 | ||||
| LDTP11167 | Protein YIPF4 (YIPF4) | 12.0 | ||||
| LDTP05647 | Transducin beta-like protein 3 (TBL3) | 12.0 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 11.9 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 11.9 | ||||
| LDTP15887 | Lipase maturation factor 2 (LMF2) | 11.9 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 11.9 | ||||
| LDTP03182 | Heterogeneous nuclear ribonucleoproteins A2/B1 (HNRNPA2B1) | 11.8 | ||||
| LDTP05530 | Induced myeloid leukemia cell differentiation protein Mcl-1 (MCL1) | 11.8 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 11.8 | ||||
| LDTP11373 | Chromatin remodeling regulator CECR2 (CECR2) | 11.7 | ||||
| LDTP04369 | Peroxisomal targeting signal 1 receptor (PEX5) | 11.7 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 11.6 | ||||
| LDTP11326 | FUN14 domain-containing protein 2 (FUNDC2) | 11.6 | ||||
| LDTP05998 | Tubulin beta-2A chain (TUBB2A) | 11.6 | ||||
| LDTP03615 | Heterogeneous nuclear ribonucleoprotein H (HNRNPH1) | 11.5 | ||||
| LDTP14125 | Mitochondrial import inner membrane translocase subunit Tim10 B (TIMM10B) | 11.5 | ||||
| LDTP08300 | Reticulophagy regulator 3 (RETREG3) | 11.5 | ||||
| LDTP14136 | Mitochondrial import inner membrane translocase subunit Tim13 (TIMM13) | 11.4 | ||||
| LDTP10033 | WW domain-binding protein 2 (WBP2) | 11.2 | ||||
| LDTP00756 | Heterogeneous nuclear ribonucleoprotein R (HNRNPR) | 11.2 | ||||
| LDTP04902 | Actin-related protein 3 (ACTR3) | 11.1 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 11.1 | ||||
| LDTP11044 | Polyadenylate-binding protein-interacting protein 2 (PAIP2) | 11.1 | ||||
| LDTP08000 | Dymeclin (DYM) | 11.0 | ||||
| LDTP05277 | Protein SET (SET) | 11.0 | ||||
| LDTP13721 | TBC1 domain family member 2B (TBC1D2B) | 10.9 | ||||
| LDTP10408 | Far upstream element-binding protein 3 (FUBP3) | 10.9 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 10.7 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 10.7 | ||||
| LDTP15793 | Protein FAM210A (FAM210A) | 10.7 | ||||
