Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C094 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 99.7 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 99.7 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 99.7 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 95.0 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 93.7 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 91.1 | ||||
| LDTP01065 | E3 ubiquitin-protein ligase TRIM13 (TRIM13) | 90.5 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 89.9 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 80.4 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 79.9 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 79.9 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 79.3 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 78.8 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 74.5 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 69.6 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 66.7 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 64.0 | ||||
| LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 62.7 | ||||
| LDTP10038 | Mitochondrial ubiquitin ligase activator of NFKB 1 (MUL1) | 62.2 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 62.2 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 61.4 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 60.5 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 59.3 | ||||
| LDTP00836 | ATPase GET3 (GET3) | 58.9 | ||||
| LDTP06977 | GPI ethanolamine phosphate transferase 2 (PIGG) | 57.3 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 56.9 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 56.5 | ||||
| LDTP11957 | Protein O-mannose kinase (POMK) | 55.7 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 52.7 | ||||
| LDTP12763 | Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase (BPNT2) | 52.7 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 52.3 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 52.3 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 48.8 | ||||
| LDTP01649 | Phosphatidate cytidylyltransferase 2 (CDS2) | 48.2 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 47.5 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 47.2 | ||||
| LDTP13352 | GTP:AMP phosphotransferase AK3, mitochondrial (AK3) | 46.9 | ||||
| LDTP01329 | Lathosterol oxidase (SC5D) | 46.2 | ||||
| LDTP12293 | Adipocyte plasma membrane-associated protein (APMAP) | 45.6 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 45.6 | ||||
| LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 45.6 | ||||
| LDTP15962 | Protein-L-histidine N-pros-methyltransferase (METTL9) | 44.6 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 44.3 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 43.4 | ||||
| LDTP16070 | Epimerase family protein SDR39U1 (SDR39U1) | 43.1 | ||||
| LDTP10966 | Microsomal glutathione S-transferase 2 (MGST2) | 43.1 | ||||
| LDTP01986 | NADH-ubiquinone oxidoreductase chain 5 (MT-ND5) | 43.1 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 42.5 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 41.9 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 41.9 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 41.6 | ||||
| LDTP11284 | Phosphatidylserine synthase 2 (PTDSS2) | 41.6 | ||||
| LDTP09060 | Ubiquitin-associated domain-containing protein 2 (UBAC2) | 41.6 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 41.6 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 41.1 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 40.8 | ||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 40.8 | ||||
| LDTP04289 | Very long-chain specific acyl-CoA dehydrogenase, mitochondrial (ACADVL) | 40.8 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 39.9 | ||||
| LDTP11852 | Presenilin-associated rhomboid-like protein, mitochondrial (PARL) | 39.7 | ||||
| LDTP00758 | Thioredoxin-like protein 1 (TXNL1) | 39.1 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 38.6 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 38.3 | ||||
| LDTP02000 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase (HMGCR) | 37.8 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 37.8 | ||||
| LDTP13986 | Vesicle transport protein GOT1B (GOLT1B) | 37.8 | ||||
| LDTP06657 | 2-hydroxyacylsphingosine 1-beta-galactosyltransferase (UGT8) | 37.0 | ||||
| LDTP13959 | Dehydrogenase/reductase SDR family member 7 (DHRS7) | 37.0 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 36.8 | ||||
| LDTP04531 | Hexokinase-2 (HK2) | 36.8 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 36.5 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 34.8 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 34.8 | ||||
| LDTP11199 | DCN1-like protein 5 (DCUN1D5) | 34.5 | ||||
| LDTP07591 | Neutral cholesterol ester hydrolase 1 (NCEH1) | 34.1 | ||||
| LDTP03163 | Sterol carrier protein 2 (SCP2) | 33.8 | ||||
| LDTP14278 | Sulfide:quinone oxidoreductase, mitochondrial (SQOR) | 33.8 | ||||
| LDTP08232 | Glycerol-3-phosphate acyltransferase 4 (GPAT4) | 33.4 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 32.9 | ||||
| LDTP05337 | Dihydroorotate dehydrogenase (quinone), mitochondrial (DHODH) | 32.7 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 32.7 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 32.2 | ||||
| LDTP09388 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B (STT3B) | 32.0 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 32.0 | ||||
| LDTP05006 | Ras-related protein Rab-1A (RAB1A) | 32.0 | ||||
| LDTP07227 | Threonylcarbamoyladenosine tRNA methylthiotransferase (CDKAL1) | 31.8 | ||||
| LDTP13675 | COP9 signalosome complex subunit 3 (COPS3) | 31.1 | ||||
| LDTP12608 | Phosphatidylinositol-3-phosphatase SAC1 (SACM1L) | 31.1 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 31.1 | ||||
| LDTP01560 | NADH dehydrogenase 1 subunit C2 (NDUFC2) | 30.9 | ||||
| LDTP09061 | Retinol dehydrogenase 13 (RDH13) | 30.9 | ||||
| LDTP12470 | GTP-binding protein SAR1a (SAR1A) | 30.7 | ||||
| LDTP03662 | Long-chain-fatty-acid--CoA ligase 1 (ACSL1) | 30.3 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 30.3 | ||||
| LDTP07756 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2 (HACD2) | 30.3 | ||||
| LDTP05622 | Alpha-1,6-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase (MGAT2) | 29.9 | ||||
| LDTP04353 | Protoporphyrinogen oxidase (PPOX) | 29.7 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 29.4 | ||||
| LDTP11259 | Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase (ALG12) | 29.4 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 29.4 | ||||
| LDTP10432 | ATP synthase membrane subunit K, mitochondrial (ATP5MK) | 29.2 | ||||
| LDTP00416 | CDP-diacylglycerol--inositol 3-phosphatidyltransferase (CDIPT) | 29.2 | ||||
| LDTP08532 | Inositol 1,4,5-trisphosphate receptor-interacting protein (ITPRIP) | 29.2 | ||||
| LDTP00982 | Long-chain-fatty-acid--CoA ligase 4 (ACSL4) | 29.2 | ||||
| LDTP00492 | Ras-related protein Rab-7L1 (RAB29) | 29.2 | ||||
| LDTP10887 | Synaptic vesicle membrane protein VAT-1 homolog (VAT1) | 29.2 | ||||
| LDTP02367 | Cytochrome c oxidase subunit 6C (COX6C) | 28.8 | ||||
| LDTP00464 | Glutathione S-transferase 3, mitochondrial (MGST3) | 28.8 | ||||
| LDTP06371 | GTP-binding protein Rheb (RHEB) | 28.6 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 28.6 | ||||
| LDTP08799 | Lysophosphatidylserine lipase ABHD12 (ABHD12) | 28.6 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 28.4 | ||||
| LDTP01634 | Fatty acid CoA ligase Acsl3 (ACSL3) | 28.4 | ||||
| LDTP00496 | Long-chain fatty acid transport protein 2 (SLC27A2) | 28.4 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 28.4 | ||||
| LDTP13131 | 7-dehydrocholesterol reductase (DHCR7) | 28.2 | ||||
| LDTP09814 | Acyl-CoA:lysophosphatidylglycerol acyltransferase 1 (LPGAT1) | 28.2 | ||||
| LDTP15155 | Thiol S-methyltransferase TMT1B (TMT1B) | 28.2 | ||||
| LDTP11867 | UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase (DPAGT1) | 28.2 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 28.1 | ||||
| LDTP09495 | Probable glutathione peroxidase 8 (GPX8) | 28.1 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 27.9 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 27.7 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 27.7 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 27.5 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 27.3 | ||||
| LDTP11723 | Cytosolic 5'-nucleotidase 3A (NT5C3A) | 26.9 | ||||
| LDTP06511 | Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial (ETFDH) | 26.9 | ||||
| LDTP14427 | Cytochrome c oxidase subunit 7A-related protein, mitochondrial (COX7A2L) | 26.7 | ||||
| LDTP09063 | Estradiol 17-beta-dehydrogenase 11 (HSD17B11) | 26.5 | ||||
| LDTP03769 | Sterol O-acyltransferase 1 (SOAT1) | 26.4 | ||||
| LDTP03150 | Methylmalonyl-CoA mutase, mitochondrial (MMUT) | 26.2 | ||||
| LDTP09285 | Atypical kinase COQ8A, mitochondrial (COQ8A) | 25.8 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 25.8 | ||||
| LDTP04646 | Delta-1-pyrroline-5-carboxylate synthase (ALDH18A1) | 25.8 | ||||
| LDTP00344 | Stearoyl-CoA desaturase (SCD) | 25.8 | ||||
| LDTP11012 | 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha (AGPAT1) | 25.5 | ||||
| LDTP05638 | CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 4 (ST3GAL4) | 25.5 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 25.5 | ||||
| LDTP14264 | Choline/ethanolaminephosphotransferase 1 (CEPT1) | 25.1 | ||||
| LDTP01743 | NADH dehydrogenase 1 beta subcomplex subunit 10 (NDUFB10) | 25.1 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 25.1 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 24.9 | ||||
| LDTP02757 | Cytochrome b-c1 complex subunit 7 (UQCRB) | 24.9 | ||||
| LDTP00577 | Dihydroxyacetone phosphate acyltransferase (GNPAT) | 24.8 | ||||
| LDTP08598 | NAD-dependent protein deacetylase sirtuin-2 (SIRT2) | 24.8 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 24.6 | ||||
| LDTP06721 | GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase (ALG11) | 24.6 | ||||
| LDTP00400 | Torsin-1B (TOR1B) | 24.6 | ||||
| LDTP01699 | Acyl-CoA 6-desaturase (FADS2) | 24.4 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 24.4 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 24.4 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 24.3 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 24.1 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 23.8 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 23.6 | ||||
| LDTP11733 | Ras-related protein Rab-1B (RAB1B) | 23.6 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 23.4 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 23.4 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 23.4 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 23.3 | ||||
| LDTP12180 | Retinol dehydrogenase 14 (RDH14) | 23.1 | ||||
| LDTP06455 | Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating (NSDHL) | 23.1 | ||||
| LDTP13317 | NADH dehydrogenase 1 alpha subcomplex subunit 12 (NDUFA12) | 22.9 | ||||
| LDTP04889 | Signal peptidase complex subunit 3 (SPCS3) | 22.9 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 22.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
| LDTP01180 | Programmed cell death protein 6 (PDCD6) | 99.7 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 99.7 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 99.7 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 95.0 | ||||
| LDTP12979 | Transmembrane protein 14C (TMEM14C) | 93.7 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 90.5 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 88.0 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 88.0 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 85.0 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 83.9 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 76.1 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 74.0 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 72.0 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 69.1 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 68.6 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 67.6 | ||||
| LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 64.9 | ||||
| LDTP08981 | Cytochrome c oxidase assembly protein COX18, mitochondrial (COX18) | 64.4 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 64.0 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 57.3 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 57.3 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 56.1 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 55.7 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 54.9 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 54.9 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 53.1 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 52.0 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 50.6 | ||||
| LDTP08279 | Mitochondrial coenzyme A transporter SLC25A42 (SLC25A42) | 48.8 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 48.8 | ||||
| LDTP12738 | Ceroid-lipofuscinosis neuronal protein 6 (CLN6) | 48.2 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 48.2 | ||||
| LDTP11634 | Derlin-2 (DERL2) | 47.2 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 47.2 | ||||
| LDTP10731 | Sodium-coupled neutral amino acid symporter 2 (SLC38A2) | 47.2 | ||||
| LDTP07058 | Transmembrane protein 201 (TMEM201) | 46.9 | ||||
| LDTP12958 | ER membrane protein complex subunit 3 (EMC3) | 46.2 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 46.2 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 46.2 | ||||
| LDTP07467 | Rhomboid domain-containing protein 2 (RHBDD2) | 45.3 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 44.9 | ||||
| LDTP01454 | SUN domain-containing protein 1 (SUN1) | 44.0 | ||||
| LDTP00590 | Protein RER1 (RER1) | 43.4 | ||||
| LDTP04663 | Bax inhibitor 1 (TMBIM6) | 42.2 | ||||
| LDTP00451 | Secretory carrier-associated membrane protein 3 (SCAMP3) | 42.2 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 41.9 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 41.4 | ||||
| LDTP09788 | Sorting nexin-19 (SNX19) | 41.1 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 40.8 | ||||
| LDTP00872 | Peroxisomal membrane protein PMP34 (SLC25A17) | 40.8 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 39.1 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 38.9 | ||||
| LDTP04426 | B-cell receptor-associated protein 31 (BCAP31) | 37.8 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 37.5 | ||||
| LDTP06633 | Reticulon-1 (RTN1) | 37.5 | ||||
| LDTP13943 | Thioredoxin-related transmembrane protein 2 (TMX2) | 36.3 | ||||
| LDTP09294 | Proton-coupled zinc antiporter SLC30A5 (SLC30A5) | 35.3 | ||||
| LDTP03869 | Protein Mpv17 (MPV17) | 35.0 | ||||
| LDTP13599 | Calcium load-activated calcium channel (TMCO1) | 34.3 | ||||
| LDTP11291 | Transmembrane emp24 domain-containing protein 9 (TMED9) | 33.8 | ||||
| LDTP11732 | Magnesium transporter protein 1 (MAGT1) | 33.6 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 33.1 | ||||
| LDTP06855 | Anoctamin-6 (ANO6) | 32.7 | ||||
| LDTP11281 | Voltage-gated monoatomic cation channel TMEM109 (TMEM109) | 32.7 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 32.4 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 32.0 | ||||
| LDTP01748 | Mitochondrial import receptor subunit TOM40 homolog (TOMM40) | 32.0 | ||||
| LDTP04787 | Transmembrane protein 33 (TMEM33) | 32.0 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 31.8 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 31.6 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 31.3 | ||||
| LDTP11229 | Transmembrane protein 70, mitochondrial (TMEM70) | 31.1 | ||||
| LDTP00405 | Etoposide-induced protein 2.4 homolog (EI24) | 30.5 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 30.5 | ||||
| LDTP09204 | Nucleoporin NUP35 (NUP35) | 30.3 | ||||
| LDTP01352 | PRA1 family protein 3 (ARL6IP5) | 30.3 | ||||
| LDTP10081 | Leucine-rich repeat-containing protein 59 (LRRC59) | 29.9 | ||||
| LDTP10398 | Receptor expression-enhancing protein 6 (REEP6) | 29.9 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 29.7 | ||||
| LDTP12090 | Sideroflexin-1 (SFXN1) | 29.7 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 29.4 | ||||
| LDTP06994 | ER membrane protein complex subunit 4 (EMC4) | 29.0 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 28.6 | ||||
| LDTP12078 | Mitochondrial glutamate carrier 1 (SLC25A22) | 28.2 | ||||
| LDTP14717 | ATP synthase subunit e, mitochondrial (ATP5ME) | 27.7 | ||||
| LDTP01631 | Mitochondrial pyruvate carrier 2 (MPC2) | 27.7 | ||||
| LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 27.7 | ||||
| LDTP13256 | SUN domain-containing protein 2 (SUN2) | 27.7 | ||||
| LDTP09789 | Transmembrane 9 superfamily member 4 (TM9SF4) | 27.7 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 27.3 | ||||
| LDTP09028 | Mitoguardin 1 (MIGA1) | 27.3 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 26.9 | ||||
| LDTP02087 | ADP/ATP translocase 2 (SLC25A5) | 26.5 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 26.5 | ||||
| LDTP05384 | Mitochondrial 2-oxoglutarate/malate carrier protein (SLC25A11) | 26.5 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 26.5 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 26.5 | ||||
| LDTP13320 | Prenylated Rab acceptor protein 1 (RABAC1) | 26.4 | ||||
| LDTP10073 | Protein RFT1 homolog (RFT1) | 26.0 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 25.8 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 25.6 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 25.6 | ||||
| LDTP10754 | Pannexin-1 (PANX1) | 25.6 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 25.6 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 25.5 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 25.5 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 25.3 | ||||
| LDTP11609 | Endoplasmic reticulum junction formation protein lunapark (LNPK) | 25.3 | ||||
| LDTP01060 | PRA1 family protein 2 (PRAF2) | 25.3 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 25.3 | ||||
| LDTP10621 | Sideroflexin-2 (SFXN2) | 25.1 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 24.9 | ||||
| LDTP10148 | Store-operated calcium entry-associated regulatory factor (SARAF) | 24.9 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 24.8 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 24.6 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 24.4 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 24.3 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 24.3 | ||||
| LDTP04932 | Protein transport protein Sec61 subunit alpha isoform 1 (SEC61A1) | 24.1 | ||||
| LDTP03952 | Reduced folate transporter (SLC19A1) | 23.6 | ||||
| LDTP04723 | ATP synthase subunit f, mitochondrial (ATP5MF) | 23.4 | ||||
| LDTP00657 | Nucleoporin NUP42 (NUP42) | 23.3 | ||||
| LDTP03717 | Prohibitin 1 (PHB1) | 23.3 | ||||
| LDTP04237 | Protein ERGIC-53 (LMAN1) | 23.3 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 23.3 | ||||
| LDTP10804 | Chloride channel CLIC-like protein 1 (CLCC1) | 23.1 | ||||
| LDTP11826 | Sodium-dependent neutral amino acid transporter B(0)AT2 (SLC6A15) | 23.1 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 23.1 | ||||
| LDTP06198 | Major facilitator superfamily domain-containing protein 10 (MFSD10) | 22.9 | ||||
| LDTP03405 | Calnexin (CANX) | 22.8 | ||||
| LDTP09515 | Importin-4 (IPO4) | 22.8 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 31.1 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | 31.1 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 99.7 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 99.7 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 99.7 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 99.7 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 99.7 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 99.7 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 90.5 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 86.8 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 86.8 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 85.6 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 81.6 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 74.5 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 69.1 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 67.6 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 65.3 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 64.9 | ||||
| LDTP16980 | Small integral membrane protein 11 (SMIM11) | 62.7 | ||||
| LDTP00397 | Golgi SNAP receptor complex member 2 (GOSR2) | 61.4 | ||||
| LDTP04557 | Arfaptin-2 (ARFIP2) | 61.0 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 61.0 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 60.5 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 59.3 | ||||
| LDTP15095 | Receptor expression-enhancing protein 3 (REEP3) | 58.9 | ||||
| LDTP14939 | Membralin (TMEM259) | 58.5 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 54.9 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 54.9 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 53.1 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 52.3 | ||||
| LDTP11113 | Receptor expression-enhancing protein 2 (REEP2) | 52.3 | ||||
| LDTP08793 | Armadillo repeat-containing protein 10 (ARMC10) | 52.0 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 52.0 | ||||
| LDTP09773 | Protein FAM3C (FAM3C) | 51.3 | ||||
| LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 50.9 | ||||
| LDTP10442 | Thioredoxin domain-containing protein 15 (TXNDC15) | 50.9 | ||||
| LDTP13797 | HIG1 domain family member 1A, mitochondrial (HIGD1A) | 48.5 | ||||
| LDTP11326 | FUN14 domain-containing protein 2 (FUNDC2) | 47.8 | ||||
| LDTP04558 | Arfaptin-1 (ARFIP1) | 46.5 | ||||
| LDTP18569 | PRELI domain containing protein 3B (PRELID3B) | 45.9 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 45.6 | ||||
| LDTP11906 | Phosphatidylinositol glycan anchor biosynthesis class U protein (PIGU) | 42.2 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 41.6 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 41.6 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 41.4 | ||||
| LDTP13626 | Ubiquilin-1 (UBQLN1) | 41.1 | ||||
| LDTP11981 | Receptor expression-enhancing protein 4 (REEP4) | 40.5 | ||||
| LDTP16078 | Heme-binding protein 1 (HEBP1) | 39.9 | ||||
| LDTP17003 | Matrix-remodeling-associated protein 7 (MXRA7) | 39.1 | ||||
| LDTP01163 | Ubiquinone biosynthesis protein COQ9, mitochondrial (COQ9) | 38.6 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 37.3 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 37.0 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 36.8 | ||||
| LDTP15887 | Lipase maturation factor 2 (LMF2) | 36.0 | ||||
| LDTP14716 | ATP synthase subunit ATP5MJ, mitochondrial (ATP5MJ) | 35.8 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 35.0 | ||||
| LDTP05257 | Receptor expression-enhancing protein 5 (REEP5) | 34.8 | ||||
| LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 34.8 | ||||
| LDTP12025 | UPF0488 protein C8orf33 (C8orf33) | 34.8 | ||||
| LDTP05054 | Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-5 (GNG5) | 34.3 | ||||
| LDTP19472 | Protein NCBP2AS2 (NCBP2AS2) | 33.8 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 33.4 | ||||
| LDTP10046 | Endoplasmic reticulum-Golgi intermediate compartment protein 1 (ERGIC1) | 33.4 | ||||
| LDTP10924 | Prohibitin-2 (PHB2) | 33.4 | ||||
| LDTP00729 | Glycosylphosphatidylinositol anchor attachment 1 protein (GPAA1) | 33.1 | ||||
| LDTP15240 | LysM and putative peptidoglycan-binding domain-containing protein 3 (LYSMD3) | 33.1 | ||||
| LDTP09644 | m-AAA protease-interacting protein 1, mitochondrial (MAIP1) | 32.2 | ||||
| LDTP13779 | 60S ribosome subunit biogenesis protein NIP7 homolog (NIP7) | 31.8 | ||||
| LDTP04356 | Emerin (EMD) | 31.6 | ||||
| LDTP05715 | Vesicle transport protein SEC20 (BNIP1) | 31.6 | ||||
| LDTP06430 | Cdc42-interacting protein 4 (TRIP10) | 30.7 | ||||
| LDTP14164 | Immediate early response 3-interacting protein 1 (IER3IP1) | 30.3 | ||||
| LDTP01075 | Protein CutA (CUTA) | 30.1 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 30.1 | ||||
| LDTP18132 | Protein FAM136A (FAM136A) | 29.9 | ||||
| LDTP05530 | Induced myeloid leukemia cell differentiation protein Mcl-1 (MCL1) | 29.2 | ||||
| LDTP08300 | Reticulophagy regulator 3 (RETREG3) | 28.8 | ||||
| LDTP12379 | Complex I assembly factor TIMMDC1, mitochondrial (TIMMDC1) | 28.1 | ||||
| LDTP03466 | Transcription initiation factor IIE subunit beta (GTF2E2) | 28.1 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 27.9 | ||||
| LDTP08796 | Protein SYS1 homolog (SYS1) | 27.9 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 27.7 | ||||
| LDTP06808 | Vacuolar ATPase assembly integral membrane protein VMA21 (VMA21) | 27.7 | ||||
| LDTP09108 | Mitoregulin (MTLN) | 27.3 | ||||
| LDTP08761 | NADH dehydrogenase 1 alpha subcomplex assembly factor 2 (NDUFAF2) | 27.3 | ||||
| LDTP07718 | MICOS complex subunit MIC27 (APOOL) | 27.1 | ||||
| LDTP11210 | Transmembrane protein 43 (TMEM43) | 26.9 | ||||
| LDTP13954 | Complex I intermediate-associated protein 30, mitochondrial (NDUFAF1) | 26.5 | ||||
| LDTP09324 | Ganglioside-induced differentiation-associated protein 1 (GDAP1) | 26.5 | ||||
| LDTP04425 | Translocon-associated protein subunit delta (SSR4) | 26.2 | ||||
| LDTP19010 | Tumor protein p53-inducible protein 11 (TP53I11) | 26.2 | ||||
| LDTP08606 | Nurim (NRM) | 26.0 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 25.6 | ||||
| LDTP11774 | Oxysterol-binding protein-related protein 2 (OSBPL2) | 25.1 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 24.9 | ||||
| LDTP14491 | Mannose-P-dolichol utilization defect 1 protein (MPDU1) | 24.3 | ||||
| LDTP10207 | Mitochondrial import inner membrane translocase subunit TIM14 (DNAJC19) | 24.1 | ||||
| LDTP07668 | Ubiquinol-cytochrome-c reductase complex assembly factor 3 (UQCC3) | 24.1 | ||||
| LDTP12746 | Gem-associated protein 8 (GEMIN8) | 23.9 | ||||
| LDTP01206 | Vesicle-trafficking protein SEC22b (SEC22B) | 23.9 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 23.8 | ||||
| LDTP17652 | Uncharacterized protein KIAA2013 (KIAA2013) | 23.8 | ||||
| LDTP13967 | Transmembrane emp24 domain-containing protein 5 (TMED5) | 23.4 | ||||
| LDTP20361 | Coiled-coil domain-containing protein 127 (CCDC127) | 23.3 | ||||
| LDTP13863 | DnaJ homolog subfamily C member 16 (DNAJC16) | 23.3 | ||||
| LDTP17659 | ELMO domain-containing protein 2 (ELMOD2) | 23.3 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 23.1 | ||||
| LDTP12982 | Mitochondrial import receptor subunit TOM7 homolog (TOMM7) | 23.1 | ||||
| LDTP11140 | Peroxiredoxin-like 2A (PRXL2A) | 23.1 | ||||
| LDTP11143 | Centromere protein K (CENPK) | 22.8 | ||||