Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C235 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05917 | Receptor-interacting serine/threonine-protein kinase 1 (RIPK1) | 99.7 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 99.7 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 92.4 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 87.4 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 81.6 | ||||
| LDTP07831 | Transmembrane protein with metallophosphoesterase domain (TMPPE) | 79.3 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 78.8 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 77.2 | ||||
| LDTP09285 | Atypical kinase COQ8A, mitochondrial (COQ8A) | 75.6 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 74.0 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 71.5 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 64.4 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 63.1 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 62.2 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 61.0 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 55.3 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 53.8 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 49.5 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 49.2 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 47.2 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 45.9 | ||||
| LDTP00325 | Pirin (PIR) | 45.3 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 44.0 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 43.7 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 43.4 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 42.5 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 41.4 | ||||
| LDTP08598 | NAD-dependent protein deacetylase sirtuin-2 (SIRT2) | 41.1 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 40.8 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 40.2 | ||||
| LDTP12293 | Adipocyte plasma membrane-associated protein (APMAP) | 39.7 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 39.7 | ||||
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 39.7 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 38.3 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 37.0 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 36.8 | ||||
| LDTP09495 | Probable glutathione peroxidase 8 (GPX8) | 36.8 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 36.5 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 36.5 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 36.0 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 36.0 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 35.5 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 35.0 | ||||
| LDTP00836 | ATPase GET3 (GET3) | 34.8 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 34.5 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 34.3 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 34.1 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 33.8 | ||||
| LDTP06501 | Ras-related protein Rab-11B (RAB11B) | 33.1 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 32.0 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 32.0 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 32.0 | ||||
| LDTP05006 | Ras-related protein Rab-1A (RAB1A) | 31.6 | ||||
| LDTP10201 | Atypical kinase COQ8B, mitochondrial (COQ8B) | 31.1 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 31.1 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 31.1 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 30.9 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 30.9 | ||||
| LDTP07227 | Threonylcarbamoyladenosine tRNA methylthiotransferase (CDKAL1) | 30.7 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 30.3 | ||||
| LDTP00877 | Protein SCO2 homolog, mitochondrial (SCO2) | 29.9 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 29.7 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 29.2 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 29.2 | ||||
| LDTP01219 | NADH dehydrogenase 1 beta subcomplex subunit 1 (NDUFB1) | 28.8 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 28.2 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 28.2 | ||||
| LDTP04892 | Ras-related protein Rab-2A (RAB2A) | 28.2 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 27.7 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 27.5 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 27.5 | ||||
| LDTP00544 | Sphingolipid delta(4)-desaturase DES1 (DEGS1) | 27.3 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 26.5 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 26.5 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 26.4 | ||||
| LDTP12470 | GTP-binding protein SAR1a (SAR1A) | 26.4 | ||||
| LDTP00344 | Stearoyl-CoA desaturase (SCD) | 25.5 | ||||
| LDTP14427 | Cytochrome c oxidase subunit 7A-related protein, mitochondrial (COX7A2L) | 25.1 | ||||
| LDTP13959 | Dehydrogenase/reductase SDR family member 7 (DHRS7) | 25.1 | ||||
| LDTP11733 | Ras-related protein Rab-1B (RAB1B) | 24.9 | ||||
| LDTP07483 | 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial (HIBCH) | 24.8 | ||||
| LDTP03051 | Ras-related protein Rab-6A (RAB6A) | 24.6 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 24.4 | ||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 24.4 | ||||
| LDTP11723 | Cytosolic 5'-nucleotidase 3A (NT5C3A) | 24.3 | ||||
| LDTP04211 | Isocitrate dehydrogenase [NADP], mitochondrial (IDH2) | 24.3 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 23.9 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 23.8 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 23.6 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 23.6 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 23.4 | ||||
| LDTP04895 | Ras-related protein Rab-10 (RAB10) | 23.1 | ||||
| LDTP09061 | Retinol dehydrogenase 13 (RDH13) | 22.8 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 22.6 | ||||
| LDTP06371 | GTP-binding protein Rheb (RHEB) | 22.6 | ||||
| LDTP08455 | Palmitoyltransferase ZDHHC13 (ZDHHC13) | 22.6 | ||||
| LDTP12415 | Adenosine 5'-monophosphoramidase HINT3 (HINT3) | 22.3 | ||||
| LDTP06839 | NAD kinase 2, mitochondrial (NADK2) | 22.3 | ||||
| LDTP08530 | Mitofusin-1 (MFN1) | 21.6 | ||||
| LDTP05588 | RNA cytosine C(5)-methyltransferase NSUN2 (NSUN2) | 21.6 | ||||
| LDTP13986 | Vesicle transport protein GOT1B (GOLT1B) | 21.4 | ||||
| LDTP06657 | 2-hydroxyacylsphingosine 1-beta-galactosyltransferase (UGT8) | 21.0 | ||||
| LDTP01389 | Delta(14)-sterol reductase TM7SF2 (TM7SF2) | 20.8 | ||||
| LDTP10362 | Alpha/beta hydrolase domain-containing protein 17A (ABHD17A) | 20.5 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 20.5 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 20.5 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 20.4 | ||||
| LDTP16040 | Glyoxalase domain-containing protein 4 (GLOD4) | 20.4 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 20.4 | ||||
| LDTP02757 | Cytochrome b-c1 complex subunit 7 (UQCRB) | 20.3 | ||||
| LDTP12752 | NADH dehydrogenase 1 beta subcomplex subunit 11, mitochondrial (NDUFB11) | 20.3 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 20.3 | ||||
| LDTP12312 | Ras-related protein Rab-18 (RAB18) | 20.3 | ||||
| LDTP09814 | Acyl-CoA:lysophosphatidylglycerol acyltransferase 1 (LPGAT1) | 20.0 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 20.0 | ||||
| LDTP11842 | Inorganic pyrophosphatase 2, mitochondrial (PPA2) | 19.7 | ||||
| LDTP06322 | [Pyruvate dehydrogenase (acetyl-transferring)] kinase isozyme 3, mitochondrial (PDK3) | 19.7 | ||||
| LDTP10432 | ATP synthase membrane subunit K, mitochondrial (ATP5MK) | 19.6 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 19.6 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 19.6 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 19.4 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 19.4 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 19.3 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 19.3 | ||||
| LDTP06810 | Mitochondrial import inner membrane translocase subunit TIM50 (TIMM50) | 19.3 | ||||
| LDTP03163 | Sterol carrier protein 2 (SCP2) | 19.2 | ||||
| LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 19.0 | ||||
| LDTP12608 | Phosphatidylinositol-3-phosphatase SAC1 (SACM1L) | 19.0 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 18.9 | ||||
| LDTP02283 | Cytochrome c1, heme protein, mitochondrial (CYC1) | 18.9 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 18.8 | ||||
| LDTP00464 | Glutathione S-transferase 3, mitochondrial (MGST3) | 18.6 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 18.5 | ||||
| LDTP06320 | [Pyruvate dehydrogenase (acetyl-transferring)] kinase isozyme 1, mitochondrial (PDK1) | 18.5 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 18.4 | ||||
| LDTP07525 | Protein arginine N-methyltransferase 9 (PRMT9) | 18.3 | ||||
| LDTP07154 | ATPase family AAA domain-containing protein 3B (ATAD3B) | 18.1 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 18.1 | ||||
| LDTP02713 | Macrophage migration inhibitory factor (MIF) | 18.1 | ||||
| LDTP01659 | Ras-related protein Rab-3D (RAB3D) | 18.0 | ||||
| LDTP08799 | Lysophosphatidylserine lipase ABHD12 (ABHD12) | 17.9 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 17.8 | ||||
| LDTP06384 | Ribosomal protein S6 kinase alpha-1 (RPS6KA1) | 17.8 | ||||
| LDTP00400 | Torsin-1B (TOR1B) | 17.8 | ||||
| LDTP11535 | Ras-related protein Rab-34 (RAB34) | 17.6 | ||||
| LDTP01573 | Acyl-protein thioesterase 2 (LYPLA2) | 17.5 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 17.5 | ||||
| LDTP03662 | Long-chain-fatty-acid--CoA ligase 1 (ACSL1) | 17.5 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 17.5 | ||||
| LDTP09578 | Phosphatidylglycerophosphatase and protein-tyrosine phosphatase 1 (PTPMT1) | 17.5 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 17.4 | ||||
| LDTP12180 | Retinol dehydrogenase 14 (RDH14) | 17.4 | ||||
| LDTP04471 | Ribosomal protein S6 kinase alpha-3 (RPS6KA3) | 17.4 | ||||
| LDTP00293 | Cytochrome c oxidase subunit NDUFA4 (NDUFA4) | 17.3 | ||||
| LDTP03050 | Ras-related protein Rab-5A (RAB5A) | 17.3 | ||||
| LDTP01743 | NADH dehydrogenase 1 beta subcomplex subunit 10 (NDUFB10) | 17.1 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 17.1 | ||||
| LDTP01699 | Acyl-CoA 6-desaturase (FADS2) | 17.0 | ||||
| LDTP04183 | Lanosterol synthase (LSS) | 16.9 | ||||
| LDTP16070 | Epimerase family protein SDR39U1 (SDR39U1) | 16.8 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 16.8 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15648 | BRI3-binding protein (BRI3BP) | 99.7 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 99.7 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 99.7 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 99.7 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 96.3 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 81.0 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 77.2 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 77.2 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 76.6 | ||||
| LDTP11927 | Essential MCU regulator, mitochondrial (SMDT1) | 73.5 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 71.5 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 71.5 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 70.0 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 66.3 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 65.8 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 64.9 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 63.1 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 62.2 | ||||
| LDTP08469 | Complex I assembly factor TMEM126B, mitochondrial (TMEM126B) | 61.0 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 59.7 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 58.1 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 53.8 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 52.7 | ||||
| LDTP14181 | Peroxisomal membrane protein PEX16 (PEX16) | 52.7 | ||||
| LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 52.3 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 51.3 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 50.2 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 50.2 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 47.8 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 47.5 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 46.5 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 43.4 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 42.2 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 40.8 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 40.8 | ||||
| LDTP04956 | Mitochondrial import inner membrane translocase subunit Tim10 (TIMM10) | 39.9 | ||||
| LDTP11281 | Voltage-gated monoatomic cation channel TMEM109 (TMEM109) | 39.7 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 39.4 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 39.1 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 39.1 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 39.1 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 39.1 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 38.6 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 35.5 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 35.0 | ||||
| LDTP15000 | Solute carrier family 35 member F1 (SLC35F1) | 34.5 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 33.4 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 33.4 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 33.1 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 32.9 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 32.9 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 32.4 | ||||
| LDTP07058 | Transmembrane protein 201 (TMEM201) | 32.4 | ||||
| LDTP00590 | Protein RER1 (RER1) | 32.2 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 31.8 | ||||
| LDTP12191 | Vezatin (VEZT) | 31.6 | ||||
| LDTP01060 | PRA1 family protein 2 (PRAF2) | 30.9 | ||||
| LDTP04787 | Transmembrane protein 33 (TMEM33) | 30.9 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 30.7 | ||||
| LDTP02215 | Prosaposin (PSAP) | 30.7 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 30.5 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 30.3 | ||||
| LDTP07467 | Rhomboid domain-containing protein 2 (RHBDD2) | 30.3 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 29.9 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 29.9 | ||||
| LDTP09261 | Major facilitator superfamily domain-containing protein 8 (MFSD8) | 29.7 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 29.4 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 29.4 | ||||
| LDTP10731 | Sodium-coupled neutral amino acid symporter 2 (SLC38A2) | 29.2 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 29.0 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 28.1 | ||||
| LDTP02266 | Synaptophysin (SYP) | 27.3 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 27.1 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 27.1 | ||||
| LDTP01454 | SUN domain-containing protein 1 (SUN1) | 26.9 | ||||
| LDTP11732 | Magnesium transporter protein 1 (MAGT1) | 26.7 | ||||
| LDTP01352 | PRA1 family protein 3 (ARL6IP5) | 26.7 | ||||
| LDTP10343 | Vacuole membrane protein 1 (VMP1) | 26.4 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 25.8 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 25.6 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 25.6 | ||||
| LDTP05780 | Syntaxin-5 (STX5) | 25.5 | ||||
| LDTP03546 | Translocator protein (TSPO) | 25.5 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 25.5 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 25.3 | ||||
| LDTP00872 | Peroxisomal membrane protein PMP34 (SLC25A17) | 25.1 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 24.8 | ||||
| LDTP04426 | B-cell receptor-associated protein 31 (BCAP31) | 24.4 | ||||
| LDTP06994 | ER membrane protein complex subunit 4 (EMC4) | 24.4 | ||||
| LDTP12958 | ER membrane protein complex subunit 3 (EMC3) | 24.1 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 23.9 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 23.9 | ||||
| LDTP10081 | Leucine-rich repeat-containing protein 59 (LRRC59) | 23.8 | ||||
| LDTP14717 | ATP synthase subunit e, mitochondrial (ATP5ME) | 22.9 | ||||
| LDTP03064 | Cytochrome c oxidase subunit 5A, mitochondrial (COX5A) | 22.9 | ||||
| LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 22.5 | ||||
| LDTP12533 | Ubiquilin-4 (UBQLN4) | 22.5 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 22.5 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 22.3 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 22.3 | ||||
| LDTP01380 | Wolframin (WFS1) | 22.3 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 22.0 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 22.0 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 21.7 | ||||
| LDTP01631 | Mitochondrial pyruvate carrier 2 (MPC2) | 21.4 | ||||
| LDTP13943 | Thioredoxin-related transmembrane protein 2 (TMX2) | 21.4 | ||||
| LDTP07152 | Acyl-CoA-binding domain-containing protein 5 (ACBD5) | 21.1 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 21.0 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 21.0 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 21.0 | ||||
| LDTP07462 | MFS-type transporter SLC18B1 (SLC18B1) | 20.8 | ||||
| LDTP05667 | Syntaxin-4 (STX4) | 20.8 | ||||
| LDTP13599 | Calcium load-activated calcium channel (TMCO1) | 20.7 | ||||
| LDTP04749 | Peroxisomal biogenesis factor 3 (PEX3) | 20.1 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 20.0 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 19.8 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 19.7 | ||||
| LDTP00546 | Secretory carrier-associated membrane protein 1 (SCAMP1) | 19.6 | ||||
| LDTP10148 | Store-operated calcium entry-associated regulatory factor (SARAF) | 19.4 | ||||
| LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 19.3 | ||||
| LDTP03405 | Calnexin (CANX) | 19.2 | ||||
| LDTP12979 | Transmembrane protein 14C (TMEM14C) | 19.2 | ||||
| LDTP11812 | Protein ARV1 (ARV1) | 18.6 | ||||
| LDTP01748 | Mitochondrial import receptor subunit TOM40 homolog (TOMM40) | 18.5 | ||||
| LDTP00821 | Mitochondrial import inner membrane translocase subunit TIM44 (TIMM44) | 18.0 | ||||
| LDTP01217 | Metaxin-2 (MTX2) | 17.9 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 17.6 | ||||
| LDTP10370 | Solute carrier family 41 member 3 (SLC41A3) | 17.4 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 17.4 | ||||
| LDTP01100 | Iron-sulfur clusters transporter ABCB7, mitochondrial (ABCB7) | 16.9 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 16.9 | ||||
| LDTP11041 | Calcium uptake protein 1, mitochondrial (MICU1) | 16.8 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 19.6 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 24.3 | ||||
| LDTP03772 | Basigin (BSG) | 16.9 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11076 | Apolipoprotein L2 (APOL2) | 99.7 | ||||
| LDTP16078 | Heme-binding protein 1 (HEBP1) | 99.7 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 99.7 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 99.7 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 99.7 | ||||
| LDTP10203 | RalBP1-associated Eps domain-containing protein 1 (REPS1) | 89.9 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 88.6 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 86.2 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 74.5 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 73.5 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 72.5 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 70.5 | ||||
| LDTP12982 | Mitochondrial import receptor subunit TOM7 homolog (TOMM7) | 69.6 | ||||
| LDTP03520 | Phosphatidylethanolamine-binding protein 1 (PEBP1) | 69.1 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 65.8 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 64.0 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 63.1 | ||||
| LDTP14939 | Membralin (TMEM259) | 57.7 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 53.4 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 50.9 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 44.0 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 43.4 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 42.8 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 41.4 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 40.8 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 39.4 | ||||
| LDTP11326 | FUN14 domain-containing protein 2 (FUNDC2) | 38.3 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 36.5 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 35.8 | ||||
| LDTP05257 | Receptor expression-enhancing protein 5 (REEP5) | 35.3 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 34.5 | ||||
| LDTP08248 | NLR family member X1 (NLRX1) | 33.4 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 33.4 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 33.1 | ||||
| LDTP10357 | RUS family member 1 (RUSF1) | 32.4 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 31.3 | ||||
| LDTP05715 | Vesicle transport protein SEC20 (BNIP1) | 31.3 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 30.9 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 30.3 | ||||
| LDTP10442 | Thioredoxin domain-containing protein 15 (TXNDC15) | 30.1 | ||||
| LDTP14716 | ATP synthase subunit ATP5MJ, mitochondrial (ATP5MJ) | 29.7 | ||||
| LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | 28.6 | ||||
| LDTP19472 | Protein NCBP2AS2 (NCBP2AS2) | 28.1 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 28.1 | ||||
| LDTP00729 | Glycosylphosphatidylinositol anchor attachment 1 protein (GPAA1) | 27.7 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 26.9 | ||||
| LDTP04558 | Arfaptin-1 (ARFIP1) | 26.5 | ||||
| LDTP17003 | Matrix-remodeling-associated protein 7 (MXRA7) | 26.0 | ||||
| LDTP13982 | Mitochondrial fission 1 protein (FIS1) | 26.0 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 25.3 | ||||
| LDTP08058 | Mitochondrial antiviral-signaling protein (MAVS) | 25.3 | ||||
| LDTP11906 | Phosphatidylinositol glycan anchor biosynthesis class U protein (PIGU) | 25.3 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 24.1 | ||||
| LDTP08300 | Reticulophagy regulator 3 (RETREG3) | 24.1 | ||||
| LDTP18132 | Protein FAM136A (FAM136A) | 23.9 | ||||
| LDTP11044 | Polyadenylate-binding protein-interacting protein 2 (PAIP2) | 23.8 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 23.6 | ||||
| LDTP05054 | Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-5 (GNG5) | 23.4 | ||||
| LDTP04425 | Translocon-associated protein subunit delta (SSR4) | 23.3 | ||||
| LDTP06373 | Mitochondrial import receptor subunit TOM20 homolog (TOMM20) | 22.8 | ||||
| LDTP10924 | Prohibitin-2 (PHB2) | 22.6 | ||||
| LDTP12606 | Structural maintenance of chromosomes protein 4 (SMC4) | 22.6 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 22.3 | ||||
| LDTP00887 | Calumenin (CALU) | 22.2 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 22.0 | ||||
| LDTP07655 | Pre-mRNA 3'-end-processing factor FIP1 (FIP1L1) | 22.0 | ||||
| LDTP13622 | NFU1 iron-sulfur cluster scaffold homolog, mitochondrial (NFU1) | 21.9 | ||||
| LDTP00875 | Striatin (STRN) | 21.9 | ||||
| LDTP04356 | Emerin (EMD) | 21.7 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 21.7 | ||||
| LDTP15778 | Protein PRRC1 (PRRC1) | 21.1 | ||||
| LDTP05530 | Induced myeloid leukemia cell differentiation protein Mcl-1 (MCL1) | 20.7 | ||||
| LDTP07718 | MICOS complex subunit MIC27 (APOOL) | 20.7 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 20.4 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 20.3 | ||||
| LDTP11140 | Peroxiredoxin-like 2A (PRXL2A) | 20.3 | ||||
| LDTP05041 | Guanine nucleotide-binding protein G(i) subunit alpha-1 (GNAI1) | 20.1 | ||||
| LDTP10207 | Mitochondrial import inner membrane translocase subunit TIM14 (DNAJC19) | 20.0 | ||||
| LDTP18435 | Plasminogen receptor (KT) (PLGRKT) | 19.8 | ||||
| LDTP12677 | DnaJ homolog subfamily C member 11 (DNAJC11) | 19.4 | ||||
| LDTP06527 | Alpha-internexin (INA) | 19.3 | ||||
| LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 19.3 | ||||
| LDTP13967 | Transmembrane emp24 domain-containing protein 5 (TMED5) | 18.9 | ||||
| LDTP13664 | Syntaxin-8 (STX8) | 18.6 | ||||
| LDTP11910 | Golgi phosphoprotein 3-like (GOLPH3L) | 18.5 | ||||
| LDTP12692 | Armadillo repeat-containing protein 1 (ARMC1) | 18.4 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 18.3 | ||||
| LDTP10113 | Mitochondrial import receptor subunit TOM6 homolog (TOMM6) | 18.1 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 18.1 | ||||
| LDTP10469 | Engulfment and cell motility protein 2 (ELMO2) | 18.0 | ||||
| LDTP05226 | RNA-binding protein 3 (RBM3) | 17.6 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 17.6 | ||||
| LDTP11239 | Protein misato homolog 1 (MSTO1) | 17.4 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 17.3 | ||||
| LDTP01711 | Protein ecdysoneless homolog (ECD) | 17.3 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 17.3 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 17.1 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 17.1 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 17.0 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 17.0 | ||||
| LDTP06404 | Surfeit locus protein 1 (SURF1) | 17.0 | ||||
| LDTP12379 | Complex I assembly factor TIMMDC1, mitochondrial (TIMMDC1) | 16.8 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 16.8 | ||||
| LDTP03615 | Heterogeneous nuclear ribonucleoprotein H (HNRNPH1) | 16.8 | ||||
| LDTP11981 | Receptor expression-enhancing protein 4 (REEP4) | 16.7 | ||||
