Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C201 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP08933 | Chondroitin sulfate N-acetylgalactosaminyltransferase 2 (CSGALNACT2) | 99.7 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 99.7 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 99.7 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 99.7 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 99.7 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 99.7 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 99.7 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 99.7 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 99.7 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 99.7 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 99.7 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 99.7 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 99.7 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 99.7 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 99.7 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 94.4 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 90.5 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 89.9 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 86.8 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 86.8 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 86.2 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 86.2 | ||||
| LDTP03779 | Copper-transporting ATPase 2 (ATP7B) | 81.0 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 79.3 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 77.7 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 66.3 | ||||
| LDTP06067 | Tubulin--tyrosine ligase-like protein 12 (TTLL12) | 63.6 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 60.5 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 57.7 | ||||
| LDTP01065 | E3 ubiquitin-protein ligase TRIM13 (TRIM13) | 57.3 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 55.7 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 54.9 | ||||
| LDTP12757 | E3 ubiquitin-protein ligase MARCHF5 (MARCHF5) | 52.3 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 52.0 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 50.2 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 50.2 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 49.9 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 48.5 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 48.5 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 48.2 | ||||
| LDTP06977 | GPI ethanolamine phosphate transferase 2 (PIGG) | 47.8 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 47.5 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 46.9 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 46.5 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 46.2 | ||||
| LDTP04334 | DNA ligase 3 (LIG3) | 45.3 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 44.9 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 44.6 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 44.3 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 44.3 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 44.0 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 44.0 | ||||
| LDTP12763 | Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase (BPNT2) | 44.0 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 43.7 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 43.4 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 42.8 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 42.8 | ||||
| LDTP13352 | GTP:AMP phosphotransferase AK3, mitochondrial (AK3) | 42.5 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 42.2 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 42.2 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 41.1 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 39.9 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 39.7 | ||||
| LDTP10699 | E3 ubiquitin-protein ligase NEDD4-like (NEDD4L) | 39.7 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 39.7 | ||||
| LDTP00701 | D-3-phosphoglycerate dehydrogenase (PHGDH) | 39.1 | ||||
| LDTP14427 | Cytochrome c oxidase subunit 7A-related protein, mitochondrial (COX7A2L) | 38.9 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 38.3 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 38.3 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 38.1 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 38.1 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 37.8 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 37.5 | ||||
| LDTP13367 | Glutathione hydrolase 7 (GGT7) | 37.3 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 36.8 | ||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 36.0 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 36.0 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 36.0 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 35.8 | ||||
| LDTP04246 | Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha (FNTA) | 35.0 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 34.8 | ||||
| LDTP06657 | 2-hydroxyacylsphingosine 1-beta-galactosyltransferase (UGT8) | 34.5 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 34.5 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 34.3 | ||||
| LDTP10038 | Mitochondrial ubiquitin ligase activator of NFKB 1 (MUL1) | 34.3 | ||||
| LDTP13986 | Vesicle transport protein GOT1B (GOLT1B) | 34.3 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 34.1 | ||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 33.8 | ||||
| LDTP07966 | COP9 signalosome complex subunit 6 (COPS6) | 33.8 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 33.4 | ||||
| LDTP08596 | Mitochondrial Rho GTPase 2 (RHOT2) | 33.1 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 32.9 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 32.9 | ||||
| LDTP08530 | Mitofusin-1 (MFN1) | 32.7 | ||||
| LDTP04542 | Thimet oligopeptidase (THOP1) | 32.7 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 32.2 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 32.2 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 32.0 | ||||
| LDTP07227 | Threonylcarbamoyladenosine tRNA methylthiotransferase (CDKAL1) | 32.0 | ||||
| LDTP02000 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase (HMGCR) | 31.8 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 31.8 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 31.8 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 31.8 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 31.8 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 31.6 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 31.6 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 31.3 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 31.1 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 30.9 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 30.9 | ||||
| LDTP14311 | SEC23-interacting protein (SEC23IP) | 30.9 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 30.7 | ||||
| LDTP00836 | ATPase GET3 (GET3) | 30.7 | ||||
| LDTP07503 | Endoplasmic reticulum aminopeptidase 2 (ERAP2) | 30.7 | ||||
| LDTP04531 | Hexokinase-2 (HK2) | 30.7 | ||||
| LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 30.7 | ||||
| LDTP10930 | Membrane-associated tyrosine- and threonine-specific cdc2-inhibitory kinase (PKMYT1) | 30.5 | ||||
| LDTP07831 | Transmembrane protein with metallophosphoesterase domain (TMPPE) | 30.5 | ||||
| LDTP06986 | Rab-like protein 3 (RABL3) | 30.1 | ||||
| LDTP10981 | Mitochondrial intermediate peptidase (MIPEP) | 29.9 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 29.9 | ||||
| LDTP09845 | Geranylgeranyl transferase type-2 subunit alpha (RABGGTA) | 29.7 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 29.7 | ||||
| LDTP00877 | Protein SCO2 homolog, mitochondrial (SCO2) | 29.7 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 29.4 | ||||
| LDTP16070 | Epimerase family protein SDR39U1 (SDR39U1) | 29.4 | ||||
| LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | 29.4 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 29.4 | ||||
| LDTP06645 | Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial (HADH) | 29.2 | ||||
| LDTP01649 | Phosphatidate cytidylyltransferase 2 (CDS2) | 29.2 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 29.2 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 29.0 | ||||
| LDTP05228 | Calcium-transporting ATPase type 2C member 1 (ATP2C1) | 29.0 | ||||
| LDTP11199 | DCN1-like protein 5 (DCUN1D5) | 29.0 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 29.0 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 28.6 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 28.6 | ||||
| LDTP01759 | Histone-lysine N-methyltransferase NSD2 (NSD2) | 28.4 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 28.4 | ||||
| LDTP00325 | Pirin (PIR) | 28.2 | ||||
| LDTP11284 | Phosphatidylserine synthase 2 (PTDSS2) | 27.9 | ||||
| LDTP05422 | Copper-transporting ATPase 1 (ATP7A) | 27.7 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 27.5 | ||||
| LDTP04164 | NADP-dependent malic enzyme (ME1) | 27.5 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 27.5 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 27.5 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 27.1 | ||||
| LDTP01514 | NADH dehydrogenase 1 beta subcomplex subunit 4 (NDUFB4) | 26.9 | ||||
| LDTP13720 | Ubiquitin carboxyl-terminal hydrolase 24 (USP24) | 26.9 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 26.9 | ||||
| LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 26.7 | ||||
| LDTP06432 | Pachytene checkpoint protein 2 homolog (TRIP13) | 26.5 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 26.4 | ||||
| LDTP10267 | Trans-3-hydroxy-L-proline dehydratase (L3HYPDH) | 26.4 | ||||
| LDTP10966 | Microsomal glutathione S-transferase 2 (MGST2) | 26.2 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 26.2 | ||||
| LDTP09061 | Retinol dehydrogenase 13 (RDH13) | 26.0 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 25.8 | ||||
| LDTP12303 | ATP-binding cassette sub-family B member 6 (ABCB6) | 25.8 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 25.8 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 25.8 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 25.8 | ||||
| LDTP12679 | Trimethyllysine dioxygenase, mitochondrial (TMLHE) | 25.8 | ||||
| LDTP00717 | Bifunctional 3'-phosphoadenosine 5'-phosphosulfate synthase 1 (PAPSS1) | 25.6 | ||||
| LDTP15155 | Thiol S-methyltransferase TMT1B (TMT1B) | 25.5 | ||||
| LDTP01368 | Triple functional domain protein (TRIO) | 25.3 | ||||
| LDTP02150 | ATP synthase subunit beta, mitochondrial (ATP5F1B) | 25.1 | ||||
| LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 25.1 | ||||
| LDTP02362 | Dihydrolipoyl dehydrogenase, mitochondrial (DLD) | 24.4 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 24.4 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 24.3 | ||||
| LDTP07672 | E3 ubiquitin-protein ligase LRSAM1 (LRSAM1) | 24.1 | ||||
| LDTP09814 | Acyl-CoA:lysophosphatidylglycerol acyltransferase 1 (LPGAT1) | 23.9 | ||||
| LDTP01502 | NADH dehydrogenase 1 beta subcomplex subunit 6 (NDUFB6) | 23.9 | ||||
| LDTP09835 | GPI-anchor transamidase (PIGK) | 23.8 | ||||
| LDTP05409 | Antigen peptide transporter 2 (TAP2) | 23.6 | ||||
| LDTP13959 | Dehydrogenase/reductase SDR family member 7 (DHRS7) | 23.6 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 23.6 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 99.7 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 99.7 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 99.7 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 99.7 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 99.7 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 99.7 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 99.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 99.7 | ||||
| LDTP02215 | Prosaposin (PSAP) | 99.7 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 99.7 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 99.7 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 99.7 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 99.7 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 99.7 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 99.7 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 99.7 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 99.7 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 98.4 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 95.0 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 94.4 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 88.6 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 83.3 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 81.0 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 80.4 | ||||
| LDTP08981 | Cytochrome c oxidase assembly protein COX18, mitochondrial (COX18) | 73.5 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 72.5 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 70.5 | ||||
| LDTP13953 | Endophilin-B1 (SH3GLB1) | 70.5 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 70.5 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 70.0 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 68.1 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 66.3 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 63.6 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 62.2 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 58.1 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 57.7 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 53.4 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 52.7 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 51.6 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 49.5 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 49.2 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 48.8 | ||||
| LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | 48.2 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 48.2 | ||||
| LDTP14636 | Solute carrier family 25 member 16 (SLC25A16) | 48.2 | ||||
| LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 44.9 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 44.9 | ||||
| LDTP09028 | Mitoguardin 1 (MIGA1) | 43.4 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 41.6 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 41.1 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 41.1 | ||||
| LDTP11634 | Derlin-2 (DERL2) | 40.2 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 39.9 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 37.8 | ||||
| LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 37.0 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 36.8 | ||||
| LDTP03380 | Stomatin (STOM) | 36.8 | ||||
| LDTP04463 | H(+)/Cl(-) exchange transporter 7 (CLCN7) | 36.5 | ||||
| LDTP07439 | Mitochondrial adenyl nucleotide antiporter SLC25A25 (SLC25A25) | 36.3 | ||||
| LDTP07058 | Transmembrane protein 201 (TMEM201) | 36.3 | ||||
| LDTP01380 | Wolframin (WFS1) | 36.0 | ||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 35.5 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 35.3 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 35.3 | ||||
| LDTP09515 | Importin-4 (IPO4) | 35.0 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 35.0 | ||||
| LDTP06293 | Metal cation symporter ZIP14 (SLC39A14) | 34.8 | ||||
| LDTP09788 | Sorting nexin-19 (SNX19) | 33.6 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 33.4 | ||||
| LDTP01060 | PRA1 family protein 2 (PRAF2) | 32.9 | ||||
| LDTP13393 | Electrogenic aspartate/glutamate antiporter SLC25A13, mitochondrial (SLC25A13) | 32.4 | ||||
| LDTP04426 | B-cell receptor-associated protein 31 (BCAP31) | 32.2 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 31.8 | ||||
| LDTP10804 | Chloride channel CLIC-like protein 1 (CLCC1) | 31.6 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 31.3 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 31.1 | ||||
| LDTP04787 | Transmembrane protein 33 (TMEM33) | 30.5 | ||||
| LDTP10073 | Protein RFT1 homolog (RFT1) | 30.3 | ||||
| LDTP12704 | Anoctamin-10 (ANO10) | 29.9 | ||||
| LDTP10769 | Intermembrane lipid transfer protein VPS13A (VPS13A) | 29.2 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 29.0 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 29.0 | ||||
| LDTP15733 | Solute carrier family 25 member 44 (SLC25A44) | 29.0 | ||||
| LDTP06660 | MICOS complex subunit MIC60 (IMMT) | 28.6 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 28.6 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 28.4 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 28.4 | ||||
| LDTP03869 | Protein Mpv17 (MPV17) | 28.4 | ||||
| LDTP12979 | Transmembrane protein 14C (TMEM14C) | 28.4 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 28.2 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 28.2 | ||||
| LDTP01043 | Sorting nexin-2 (SNX2) | 27.7 | ||||
| LDTP07002 | Transport and Golgi organization protein 1 homolog (MIA3) | 27.5 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 27.3 | ||||
| LDTP01601 | Activator of 90 kDa heat shock protein ATPase homolog 1 (AHSA1) | 27.1 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 27.1 | ||||
| LDTP03405 | Calnexin (CANX) | 26.7 | ||||
| LDTP07537 | Metal transporter CNNM4 (CNNM4) | 26.7 | ||||
| LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 26.7 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 26.7 | ||||
| LDTP08030 | Autophagy-related protein 9A (ATG9A) | 26.5 | ||||
| LDTP00405 | Etoposide-induced protein 2.4 homolog (EI24) | 26.5 | ||||
| LDTP01217 | Metaxin-2 (MTX2) | 26.4 | ||||
| LDTP10533 | Sorting nexin-27 (SNX27) | 26.4 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 26.2 | ||||
| LDTP06928 | Coiled-coil domain-containing protein 93 (CCDC93) | 26.2 | ||||
| LDTP11291 | Transmembrane emp24 domain-containing protein 9 (TMED9) | 26.2 | ||||
| LDTP02048 | Cellular tumor antigen p53 (TP53) | 26.0 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 26.0 | ||||
| LDTP12644 | Mitochondrial potassium channel ATP-binding subunit (ABCB8) | 25.8 | ||||
| LDTP06499 | V-type proton ATPase subunit S1 (ATP6AP1) | 25.8 | ||||
| LDTP01366 | Flotillin-1 (FLOT1) | 25.6 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 25.5 | ||||
| LDTP00590 | Protein RER1 (RER1) | 25.5 | ||||
| LDTP07467 | Rhomboid domain-containing protein 2 (RHBDD2) | 25.3 | ||||
| LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 25.1 | ||||
| LDTP13256 | SUN domain-containing protein 2 (SUN2) | 24.9 | ||||
| LDTP08633 | Transmembrane protein 192 (TMEM192) | 24.9 | ||||
| LDTP14717 | ATP synthase subunit e, mitochondrial (ATP5ME) | 24.8 | ||||
| LDTP06198 | Major facilitator superfamily domain-containing protein 10 (MFSD10) | 24.8 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 24.8 | ||||
| LDTP06271 | ER membrane protein complex subunit 2 (EMC2) | 24.4 | ||||
| LDTP00821 | Mitochondrial import inner membrane translocase subunit TIM44 (TIMM44) | 24.4 | ||||
| LDTP01309 | Renin receptor (ATP6AP2) | 24.4 | ||||
| LDTP03546 | Translocator protein (TSPO) | 24.4 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 24.1 | ||||
| LDTP04553 | Tricarboxylate transport protein, mitochondrial (SLC25A1) | 24.1 | ||||
| LDTP14174 | Sorting nexin-5 (SNX5) | 23.9 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP09694 | Paraspeckle component 1 (PSPC1) | 28.6 | ||||
GPCR
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15303 | Membrane progestin receptor alpha (PAQR7) | 27.9 | ||||
| LDTP14610 | Golgi pH regulator B (GPR89B) | 27.3 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | 31.3 | ||||
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 31.3 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 99.7 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 99.7 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 99.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 99.7 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 99.7 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 99.7 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 99.7 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 99.7 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 99.7 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 99.7 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 99.7 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 99.7 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 99.7 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 99.7 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 97.7 | ||||
| LDTP10255 | Protein Hook homolog 2 (HOOK2) | 97.7 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 97.0 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 93.7 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 78.2 | ||||
| LDTP01932 | Prelamin-A/C (LMNA) | 78.2 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 77.7 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 76.6 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 74.5 | ||||
| LDTP14939 | Membralin (TMEM259) | 74.5 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 74.0 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 73.0 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 70.0 | ||||
| LDTP01163 | Ubiquinone biosynthesis protein COQ9, mitochondrial (COQ9) | 59.7 | ||||
| LDTP04425 | Translocon-associated protein subunit delta (SSR4) | 58.1 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 57.3 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 57.3 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 56.5 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 56.1 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 53.4 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 53.4 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 51.6 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 48.8 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 48.5 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 47.8 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 45.9 | ||||
| LDTP07419 | Centromere protein P (CENPP) | 45.3 | ||||
| LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 44.9 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 44.6 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 44.0 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 43.4 | ||||
| LDTP08796 | Protein SYS1 homolog (SYS1) | 42.8 | ||||
| LDTP11981 | Receptor expression-enhancing protein 4 (REEP4) | 41.4 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 39.7 | ||||
| LDTP00887 | Calumenin (CALU) | 39.4 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 39.4 | ||||
| LDTP16322 | Mitochondrial import inner membrane translocase subunit Tim8 B (TIMM8B) | 38.3 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 37.5 | ||||
| LDTP07031 | Collectin-12 (COLEC12) | 37.3 | ||||
| LDTP07718 | MICOS complex subunit MIC27 (APOOL) | 37.3 | ||||
| LDTP20008 | Costars family protein ABRACL (ABRACL) | 37.0 | ||||
| LDTP05641 | WASH complex subunit 5 (WASHC5) | 37.0 | ||||
| LDTP05922 | Dynactin subunit 2 (DCTN2) | 36.8 | ||||
| LDTP14125 | Mitochondrial import inner membrane translocase subunit Tim10 B (TIMM10B) | 36.5 | ||||
| LDTP00417 | Programmed cell death protein 5 (PDCD5) | 36.5 | ||||
| LDTP00779 | Trans-Golgi network integral membrane protein 2 (TGOLN2) | 36.5 | ||||
| LDTP10924 | Prohibitin-2 (PHB2) | 35.5 | ||||
| LDTP05277 | Protein SET (SET) | 35.5 | ||||
| LDTP10442 | Thioredoxin domain-containing protein 15 (TXNDC15) | 35.5 | ||||
| LDTP09324 | Ganglioside-induced differentiation-associated protein 1 (GDAP1) | 35.3 | ||||
| LDTP04703 | Tumor protein D52 (TPD52) | 34.5 | ||||
| LDTP11326 | FUN14 domain-containing protein 2 (FUNDC2) | 34.1 | ||||
| LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 33.8 | ||||
| LDTP02297 | Vimentin (VIM) | 33.8 | ||||
| LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | 33.1 | ||||
| LDTP13802 | DNA replication complex GINS protein PSF2 (GINS2) | 32.4 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 32.2 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 31.8 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 31.8 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 30.7 | ||||
| LDTP15253 | HEAT repeat-containing protein 3 (HEATR3) | 30.7 | ||||
| LDTP04917 | Proteasome activator complex subunit 3 (PSME3) | 30.5 | ||||
| LDTP19924 | Protein PBDC1 (PBDC1) | 30.3 | ||||
| LDTP01236 | Transcription initiation protein SPT3 homolog (SUPT3H) | 30.1 | ||||
| LDTP05530 | Induced myeloid leukemia cell differentiation protein Mcl-1 (MCL1) | 29.9 | ||||
| LDTP02181 | Neurofilament medium polypeptide (NEFM) | 29.2 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 28.8 | ||||
| LDTP04356 | Emerin (EMD) | 28.8 | ||||
| LDTP06068 | MAGUK p55 subfamily member 2 (MPP2) | 28.8 | ||||
| LDTP08248 | NLR family member X1 (NLRX1) | 28.4 | ||||
| LDTP05715 | Vesicle transport protein SEC20 (BNIP1) | 27.9 | ||||
| LDTP12629 | T-complex protein 11-like protein 1 (TCP11L1) | 27.7 | ||||
| LDTP03065 | Lamin-B1 (LMNB1) | 27.3 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 27.3 | ||||
| LDTP00632 | Syntaxin-7 (STX7) | 27.1 | ||||
| LDTP14259 | Testis-expressed protein 264 (TEX264) | 27.1 | ||||
| LDTP13863 | DnaJ homolog subfamily C member 16 (DNAJC16) | 26.7 | ||||
| LDTP12764 | MICOS complex subunit MIC19 (CHCHD3) | 26.5 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 26.5 | ||||
| LDTP13091 | Ataxin-10 (ATXN10) | 26.2 | ||||
| LDTP05257 | Receptor expression-enhancing protein 5 (REEP5) | 26.2 | ||||
| LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | 26.2 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 26.2 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 25.8 | ||||
| LDTP05418 | UBX domain-containing protein 1 (UBXN1) | 25.6 | ||||
| LDTP04626 | UV excision repair protein RAD23 homolog A (RAD23A) | 25.6 | ||||
| LDTP00212 | AP-3 complex subunit beta-1 (AP3B1) | 25.3 | ||||
| LDTP10093 | Mitochondrial calcium uniporter regulator 1 (MCUR1) | 25.3 | ||||
| LDTP05068 | Tropomyosin alpha-4 chain (TPM4) | 25.3 | ||||
| LDTP04207 | Heat shock 70 kDa protein 13 (HSPA13) | 25.1 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 24.9 | ||||
| LDTP02180 | Neurofilament light polypeptide (NEFL) | 24.9 | ||||
| LDTP12762 | Transmembrane protein 161A (TMEM161A) | 24.8 | ||||
| LDTP11525 | Kinetochore protein Nuf2 (NUF2) | 24.6 | ||||
| LDTP13837 | Trafficking protein particle complex subunit 4 (TRAPPC4) | 24.4 | ||||
| LDTP06527 | Alpha-internexin (INA) | 24.3 | ||||
| LDTP01177 | Hyaluronan mediated motility receptor (HMMR) | 24.1 | ||||
| LDTP10184 | HAUS augmin-like complex subunit 1 (HAUS1) | 23.9 | ||||
| LDTP18132 | Protein FAM136A (FAM136A) | 23.9 | ||||
| LDTP15887 | Lipase maturation factor 2 (LMF2) | 23.8 | ||||
| LDTP02511 | cAMP-dependent protein kinase type I-alpha regulatory subunit (PRKAR1A) | 23.6 | ||||
