Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C092 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 99.7 | ||||
| LDTP01743 | NADH dehydrogenase 1 beta subcomplex subunit 10 (NDUFB10) | 99.7 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 99.7 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 93.1 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 83.3 | ||||
| LDTP01065 | E3 ubiquitin-protein ligase TRIM13 (TRIM13) | 83.3 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 83.3 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 81.0 | ||||
| LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 71.5 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 70.5 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 67.6 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 67.2 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 61.4 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 61.0 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 60.1 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 59.7 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 57.7 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 57.3 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 56.9 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 56.5 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 56.1 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 55.3 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 55.3 | ||||
| LDTP00758 | Thioredoxin-like protein 1 (TXNL1) | 54.9 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 53.4 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 49.9 | ||||
| LDTP01649 | Phosphatidate cytidylyltransferase 2 (CDS2) | 49.5 | ||||
| LDTP11957 | Protein O-mannose kinase (POMK) | 49.2 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 45.6 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 43.4 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 43.1 | ||||
| LDTP10038 | Mitochondrial ubiquitin ligase activator of NFKB 1 (MUL1) | 42.8 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 42.5 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 42.2 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 40.2 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 39.9 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 39.7 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 39.4 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 38.9 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 38.3 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 37.8 | ||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 37.8 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 37.3 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 37.0 | ||||
| LDTP12763 | Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase (BPNT2) | 36.3 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 36.0 | ||||
| LDTP15962 | Protein-L-histidine N-pros-methyltransferase (METTL9) | 35.0 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 34.1 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 33.8 | ||||
| LDTP13986 | Vesicle transport protein GOT1B (GOLT1B) | 33.8 | ||||
| LDTP11867 | UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase (DPAGT1) | 33.6 | ||||
| LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 33.1 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 32.9 | ||||
| LDTP00344 | Stearoyl-CoA desaturase (SCD) | 32.9 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 32.4 | ||||
| LDTP01560 | NADH dehydrogenase 1 subunit C2 (NDUFC2) | 32.4 | ||||
| LDTP11177 | Mitochondrial ribosome-associated GTPase 1 (MTG1) | 32.0 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 31.3 | ||||
| LDTP05638 | CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 4 (ST3GAL4) | 31.1 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 31.1 | ||||
| LDTP14264 | Choline/ethanolaminephosphotransferase 1 (CEPT1) | 30.7 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 30.3 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 30.3 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 30.1 | ||||
| LDTP06977 | GPI ethanolamine phosphate transferase 2 (PIGG) | 30.1 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 29.9 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 29.9 | ||||
| LDTP07227 | Threonylcarbamoyladenosine tRNA methylthiotransferase (CDKAL1) | 29.9 | ||||
| LDTP04247 | Protein farnesyltransferase subunit beta (FNTB) | 29.0 | ||||
| LDTP09061 | Retinol dehydrogenase 13 (RDH13) | 29.0 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 28.8 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 28.6 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 27.9 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 27.9 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 27.5 | ||||
| LDTP11284 | Phosphatidylserine synthase 2 (PTDSS2) | 27.1 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 26.9 | ||||
| LDTP11852 | Presenilin-associated rhomboid-like protein, mitochondrial (PARL) | 26.9 | ||||
| LDTP16070 | Epimerase family protein SDR39U1 (SDR39U1) | 26.7 | ||||
| LDTP08532 | Inositol 1,4,5-trisphosphate receptor-interacting protein (ITPRIP) | 26.2 | ||||
| LDTP01329 | Lathosterol oxidase (SC5D) | 26.0 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 26.0 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 26.0 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 25.8 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 25.3 | ||||
| LDTP01986 | NADH-ubiquinone oxidoreductase chain 5 (MT-ND5) | 25.3 | ||||
| LDTP10699 | E3 ubiquitin-protein ligase NEDD4-like (NEDD4L) | 25.1 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 25.1 | ||||
| LDTP04531 | Hexokinase-2 (HK2) | 24.9 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 24.9 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 24.4 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 24.4 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 24.1 | ||||
| LDTP00400 | Torsin-1B (TOR1B) | 23.9 | ||||
| LDTP09056 | Inactive C-alpha-formylglycine-generating enzyme 2 (SUMF2) | 23.8 | ||||
| LDTP10966 | Microsomal glutathione S-transferase 2 (MGST2) | 23.8 | ||||
| LDTP12470 | GTP-binding protein SAR1a (SAR1A) | 23.6 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 23.4 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 23.3 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 23.1 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 22.8 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 22.8 | ||||
| LDTP02000 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase (HMGCR) | 22.6 | ||||
| LDTP04327 | Cytosolic purine 5'-nucleotidase (NT5C2) | 22.5 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 22.5 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 22.5 | ||||
| LDTP13675 | COP9 signalosome complex subunit 3 (COPS3) | 22.0 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 21.9 | ||||
| LDTP14278 | Sulfide:quinone oxidoreductase, mitochondrial (SQOR) | 21.9 | ||||
| LDTP09060 | Ubiquitin-associated domain-containing protein 2 (UBAC2) | 21.9 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 21.7 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 21.6 | ||||
| LDTP11259 | Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase (ALG12) | 21.6 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 21.4 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 21.3 | ||||
| LDTP00577 | Dihydroxyacetone phosphate acyltransferase (GNPAT) | 21.1 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 21.1 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 20.8 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 20.8 | ||||
| LDTP10432 | ATP synthase membrane subunit K, mitochondrial (ATP5MK) | 20.4 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 20.4 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 20.0 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 20.0 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 19.8 | ||||
| LDTP00416 | CDP-diacylglycerol--inositol 3-phosphatidyltransferase (CDIPT) | 19.7 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 19.6 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 19.4 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 19.4 | ||||
| LDTP05228 | Calcium-transporting ATPase type 2C member 1 (ATP2C1) | 19.2 | ||||
| LDTP09388 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B (STT3B) | 19.2 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 19.2 | ||||
| LDTP06645 | Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial (HADH) | 19.2 | ||||
| LDTP00492 | Ras-related protein Rab-7L1 (RAB29) | 19.0 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 18.8 | ||||
| LDTP17587 | Catechol O-methyltransferase domain-containing protein 1 (COMTD1) | 18.6 | ||||
| LDTP07966 | COP9 signalosome complex subunit 6 (COPS6) | 18.6 | ||||
| LDTP05006 | Ras-related protein Rab-1A (RAB1A) | 18.5 | ||||
| LDTP05409 | Antigen peptide transporter 2 (TAP2) | 18.4 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 18.4 | ||||
| LDTP00836 | ATPase GET3 (GET3) | 18.3 | ||||
| LDTP07756 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2 (HACD2) | 18.3 | ||||
| LDTP07873 | Acyl-CoA dehydrogenase family member 11 (ACAD11) | 18.1 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 18.0 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 18.0 | ||||
| LDTP08598 | NAD-dependent protein deacetylase sirtuin-2 (SIRT2) | 18.0 | ||||
| LDTP09814 | Acyl-CoA:lysophosphatidylglycerol acyltransferase 1 (LPGAT1) | 17.9 | ||||
| LDTP13959 | Dehydrogenase/reductase SDR family member 7 (DHRS7) | 17.9 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 17.9 | ||||
| LDTP15155 | Thiol S-methyltransferase TMT1B (TMT1B) | 17.9 | ||||
| LDTP04895 | Ras-related protein Rab-10 (RAB10) | 17.8 | ||||
| LDTP12420 | Xaa-Pro aminopeptidase 3 (XPNPEP3) | 17.8 | ||||
| LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 17.6 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 17.4 | ||||
| LDTP08232 | Glycerol-3-phosphate acyltransferase 4 (GPAT4) | 17.3 | ||||
| LDTP06657 | 2-hydroxyacylsphingosine 1-beta-galactosyltransferase (UGT8) | 17.1 | ||||
| LDTP04420 | DNA replication ATP-dependent helicase/nuclease DNA2 (DNA2) | 17.1 | ||||
| LDTP09495 | Probable glutathione peroxidase 8 (GPX8) | 17.1 | ||||
| LDTP08530 | Mitofusin-1 (MFN1) | 17.0 | ||||
| LDTP12752 | NADH dehydrogenase 1 beta subcomplex subunit 11, mitochondrial (NDUFB11) | 17.0 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 17.0 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 16.8 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 16.8 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 16.7 | ||||
| LDTP07154 | ATPase family AAA domain-containing protein 3B (ATAD3B) | 16.4 | ||||
| LDTP12608 | Phosphatidylinositol-3-phosphatase SAC1 (SACM1L) | 16.4 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 16.4 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 99.7 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 99.7 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 91.1 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 77.7 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 70.5 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 68.6 | ||||
| LDTP08029 | Nucleoporin p54 (NUP54) | 68.1 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 61.0 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 60.1 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 58.9 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 55.3 | ||||
| LDTP08981 | Cytochrome c oxidase assembly protein COX18, mitochondrial (COX18) | 54.9 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 54.6 | ||||
| LDTP08279 | Mitochondrial coenzyme A transporter SLC25A42 (SLC25A42) | 53.1 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 50.9 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 50.6 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 46.2 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 45.3 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 44.9 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 44.3 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 44.0 | ||||
| LDTP09788 | Sorting nexin-19 (SNX19) | 43.4 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 42.8 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 41.9 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 40.8 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 40.8 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 40.8 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 40.8 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 40.2 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 40.2 | ||||
| LDTP09294 | Proton-coupled zinc antiporter SLC30A5 (SLC30A5) | 40.2 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 39.9 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 39.7 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 39.4 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 38.1 | ||||
| LDTP02215 | Prosaposin (PSAP) | 36.8 | ||||
| LDTP03810 | ATP synthase subunit gamma, mitochondrial (ATP5F1C) | 36.5 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 35.0 | ||||
| LDTP07467 | Rhomboid domain-containing protein 2 (RHBDD2) | 34.5 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 34.3 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 32.9 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 32.2 | ||||
| LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 31.8 | ||||
| LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 30.7 | ||||
| LDTP10073 | Protein RFT1 homolog (RFT1) | 29.9 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 29.7 | ||||
| LDTP03869 | Protein Mpv17 (MPV17) | 29.2 | ||||
| LDTP13953 | Endophilin-B1 (SH3GLB1) | 28.8 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 28.6 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 28.4 | ||||
| LDTP04956 | Mitochondrial import inner membrane translocase subunit Tim10 (TIMM10) | 27.9 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 27.9 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 27.7 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 27.5 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 27.3 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 27.3 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 26.7 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 26.0 | ||||
| LDTP06633 | Reticulon-1 (RTN1) | 25.8 | ||||
| LDTP10804 | Chloride channel CLIC-like protein 1 (CLCC1) | 25.6 | ||||
| LDTP00451 | Secretory carrier-associated membrane protein 3 (SCAMP3) | 25.1 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 25.1 | ||||
| LDTP00590 | Protein RER1 (RER1) | 24.9 | ||||
| LDTP10731 | Sodium-coupled neutral amino acid symporter 2 (SLC38A2) | 24.4 | ||||
| LDTP01454 | SUN domain-containing protein 1 (SUN1) | 24.4 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 23.8 | ||||
| LDTP10148 | Store-operated calcium entry-associated regulatory factor (SARAF) | 23.6 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 23.4 | ||||
| LDTP04663 | Bax inhibitor 1 (TMBIM6) | 23.4 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 23.4 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 22.9 | ||||
| LDTP13943 | Thioredoxin-related transmembrane protein 2 (TMX2) | 22.9 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 22.8 | ||||
| LDTP12738 | Ceroid-lipofuscinosis neuronal protein 6 (CLN6) | 22.5 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 22.5 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 22.5 | ||||
| LDTP09789 | Transmembrane 9 superfamily member 4 (TM9SF4) | 22.2 | ||||
| LDTP12979 | Transmembrane protein 14C (TMEM14C) | 22.2 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 21.4 | ||||
| LDTP11291 | Transmembrane emp24 domain-containing protein 9 (TMED9) | 21.3 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 21.0 | ||||
| LDTP06855 | Anoctamin-6 (ANO6) | 20.7 | ||||
| LDTP10081 | Leucine-rich repeat-containing protein 59 (LRRC59) | 20.5 | ||||
| LDTP03952 | Reduced folate transporter (SLC19A1) | 20.4 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 20.3 | ||||
| LDTP07058 | Transmembrane protein 201 (TMEM201) | 20.0 | ||||
| LDTP04426 | B-cell receptor-associated protein 31 (BCAP31) | 19.8 | ||||
| LDTP10754 | Pannexin-1 (PANX1) | 19.8 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 19.6 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 19.6 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 19.6 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 19.4 | ||||
| LDTP01180 | Programmed cell death protein 6 (PDCD6) | 19.4 | ||||
| LDTP07152 | Acyl-CoA-binding domain-containing protein 5 (ACBD5) | 19.3 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 19.3 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 19.2 | ||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 19.2 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 18.9 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 18.9 | ||||
| LDTP11826 | Sodium-dependent neutral amino acid transporter B(0)AT2 (SLC6A15) | 18.8 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 18.6 | ||||
| LDTP14717 | ATP synthase subunit e, mitochondrial (ATP5ME) | 18.5 | ||||
| LDTP11634 | Derlin-2 (DERL2) | 18.5 | ||||
| LDTP06293 | Metal cation symporter ZIP14 (SLC39A14) | 18.1 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 17.9 | ||||
| LDTP08030 | Autophagy-related protein 9A (ATG9A) | 17.8 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 17.8 | ||||
| LDTP00872 | Peroxisomal membrane protein PMP34 (SLC25A17) | 17.8 | ||||
| LDTP04787 | Transmembrane protein 33 (TMEM33) | 17.8 | ||||
| LDTP11732 | Magnesium transporter protein 1 (MAGT1) | 17.6 | ||||
| LDTP01748 | Mitochondrial import receptor subunit TOM40 homolog (TOMM40) | 17.6 | ||||
| LDTP04723 | ATP synthase subunit f, mitochondrial (ATP5MF) | 17.5 | ||||
| LDTP00405 | Etoposide-induced protein 2.4 homolog (EI24) | 17.4 | ||||
| LDTP00821 | Mitochondrial import inner membrane translocase subunit TIM44 (TIMM44) | 17.3 | ||||
| LDTP14275 | Sodium bicarbonate cotransporter 3 (SLC4A7) | 17.3 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 17.3 | ||||
| LDTP04237 | Protein ERGIC-53 (LMAN1) | 17.0 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 17.0 | ||||
| LDTP01060 | PRA1 family protein 2 (PRAF2) | 16.7 | ||||
| LDTP10621 | Sideroflexin-2 (SFXN2) | 16.7 | ||||
| LDTP10036 | BOS complex subunit NCLN (NCLN) | 16.6 | ||||
| LDTP05236 | Phosphatidylinositol transfer protein alpha isoform (PITPNA) | 16.6 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 16.4 | ||||
| LDTP09204 | Nucleoporin NUP35 (NUP35) | 16.4 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 25.6 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 21.1 | ||||
| LDTP03772 | Basigin (BSG) | 18.4 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 99.7 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 99.7 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 99.7 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 99.7 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 99.7 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 99.7 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 92.4 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 76.1 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 75.6 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 64.4 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 64.0 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 61.8 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 59.7 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 59.3 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 57.3 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 55.3 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 51.6 | ||||
| LDTP09773 | Protein FAM3C (FAM3C) | 51.3 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 50.9 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 49.9 | ||||
| LDTP14939 | Membralin (TMEM259) | 44.9 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 44.3 | ||||
| LDTP00397 | Golgi SNAP receptor complex member 2 (GOSR2) | 44.0 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 42.5 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 42.2 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 41.9 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 41.1 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 41.1 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 41.1 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 40.8 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 40.5 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 39.9 | ||||
| LDTP11695 | Kinesin light chain 2 (KLC2) | 39.7 | ||||
| LDTP15240 | LysM and putative peptidoglycan-binding domain-containing protein 3 (LYSMD3) | 39.7 | ||||
| LDTP15294 | COMM domain-containing protein 7 (COMMD7) | 37.8 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 37.3 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 36.8 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 36.0 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 35.8 | ||||
| LDTP10442 | Thioredoxin domain-containing protein 15 (TXNDC15) | 35.0 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 34.8 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 34.5 | ||||
| LDTP18569 | PRELI domain containing protein 3B (PRELID3B) | 33.1 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 31.6 | ||||
| LDTP15095 | Receptor expression-enhancing protein 3 (REEP3) | 31.3 | ||||
| LDTP11326 | FUN14 domain-containing protein 2 (FUNDC2) | 30.7 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 30.7 | ||||
| LDTP12025 | UPF0488 protein C8orf33 (C8orf33) | 30.7 | ||||
| LDTP18132 | Protein FAM136A (FAM136A) | 30.3 | ||||
| LDTP11113 | Receptor expression-enhancing protein 2 (REEP2) | 30.3 | ||||
| LDTP08000 | Dymeclin (DYM) | 29.7 | ||||
| LDTP12746 | Gem-associated protein 8 (GEMIN8) | 29.4 | ||||
| LDTP11981 | Receptor expression-enhancing protein 4 (REEP4) | 28.8 | ||||
| LDTP13797 | HIG1 domain family member 1A, mitochondrial (HIGD1A) | 28.4 | ||||
| LDTP08796 | Protein SYS1 homolog (SYS1) | 28.4 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 27.1 | ||||
| LDTP17003 | Matrix-remodeling-associated protein 7 (MXRA7) | 27.1 | ||||
| LDTP12677 | DnaJ homolog subfamily C member 11 (DNAJC11) | 26.9 | ||||
| LDTP16980 | Small integral membrane protein 11 (SMIM11) | 26.9 | ||||
| LDTP08793 | Armadillo repeat-containing protein 10 (ARMC10) | 26.5 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 26.2 | ||||
| LDTP11906 | Phosphatidylinositol glycan anchor biosynthesis class U protein (PIGU) | 26.2 | ||||
| LDTP08073 | Tetratricopeptide repeat protein 21B (TTC21B) | 26.2 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 25.6 | ||||
| LDTP14716 | ATP synthase subunit ATP5MJ, mitochondrial (ATP5MJ) | 25.5 | ||||
| LDTP05054 | Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-5 (GNG5) | 25.1 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 25.1 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 25.1 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 23.8 | ||||
| LDTP13967 | Transmembrane emp24 domain-containing protein 5 (TMED5) | 23.8 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 23.3 | ||||
| LDTP10046 | Endoplasmic reticulum-Golgi intermediate compartment protein 1 (ERGIC1) | 22.9 | ||||
| LDTP09644 | m-AAA protease-interacting protein 1, mitochondrial (MAIP1) | 22.9 | ||||
| LDTP05715 | Vesicle transport protein SEC20 (BNIP1) | 22.8 | ||||
| LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 22.6 | ||||
| LDTP05277 | Protein SET (SET) | 22.5 | ||||
| LDTP04356 | Emerin (EMD) | 21.9 | ||||
| LDTP05530 | Induced myeloid leukemia cell differentiation protein Mcl-1 (MCL1) | 21.9 | ||||
| LDTP09813 | CCR4-NOT transcription complex subunit 9 (CNOT9) | 21.7 | ||||
| LDTP00729 | Glycosylphosphatidylinositol anchor attachment 1 protein (GPAA1) | 21.6 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 21.1 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 21.1 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 21.1 | ||||
| LDTP02297 | Vimentin (VIM) | 21.0 | ||||
| LDTP09108 | Mitoregulin (MTLN) | 20.8 | ||||
| LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 20.4 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 20.4 | ||||
| LDTP11167 | Protein YIPF4 (YIPF4) | 20.3 | ||||
| LDTP05257 | Receptor expression-enhancing protein 5 (REEP5) | 20.3 | ||||
| LDTP13863 | DnaJ homolog subfamily C member 16 (DNAJC16) | 20.1 | ||||
| LDTP07718 | MICOS complex subunit MIC27 (APOOL) | 20.0 | ||||
| LDTP10784 | Gamma-tubulin complex component 5 (TUBGCP5) | 19.3 | ||||
| LDTP19472 | Protein NCBP2AS2 (NCBP2AS2) | 19.2 | ||||
| LDTP08735 | Spartin (SPART) | 18.9 | ||||
| LDTP10487 | Protein SERAC1 (SERAC1) | 18.8 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 18.5 | ||||
| LDTP15887 | Lipase maturation factor 2 (LMF2) | 18.4 | ||||
| LDTP10216 | RNA-binding protein Musashi homolog 2 (MSI2) | 18.0 | ||||
| LDTP13626 | Ubiquilin-1 (UBQLN1) | 17.8 | ||||
| LDTP17659 | ELMO domain-containing protein 2 (ELMOD2) | 17.6 | ||||
| LDTP04207 | Heat shock 70 kDa protein 13 (HSPA13) | 17.5 | ||||
| LDTP13114 | C-type mannose receptor 2 (MRC2) | 17.3 | ||||
| LDTP13779 | 60S ribosome subunit biogenesis protein NIP7 homolog (NIP7) | 17.1 | ||||
| LDTP08606 | Nurim (NRM) | 17.1 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 17.1 | ||||
| LDTP10849 | Regulator of microtubule dynamics protein 3 (RMDN3) | 16.9 | ||||
| LDTP00759 | Tumor protein D54 (TPD52L2) | 16.8 | ||||
| LDTP06587 | Survival motor neuron protein (SMN1; SMN2) | 16.7 | ||||