Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C310 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 45.3 | ||||
| LDTP10318 | Ubiquitin thioesterase OTUB1 (OTUB1) | 44.9 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 41.1 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 40.5 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 35.0 | ||||
| LDTP02223 | Cathepsin B (CTSB) | 33.6 | ||||
| LDTP03822 | Activin receptor type-1B (ACVR1B) | 33.4 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 31.6 | ||||
| LDTP06370 | Ephrin type-A receptor 7 (EPHA7) | 30.3 | ||||
| LDTP00316 | Ribonuclease T2 (RNASET2) | 28.1 | ||||
| LDTP02006 | Tissue alpha-L-fucosidase (FUCA1) | 27.5 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 26.7 | ||||
| LDTP17305 | Glycosyltransferase 8 domain-containing protein 1 (GLT8D1) | 26.5 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 25.5 | ||||
| LDTP08226 | Serine/threonine-protein kinase tousled-like 2 (TLK2) | 25.3 | ||||
| LDTP00185 | Deoxyribonuclease-2-alpha (DNASE2) | 24.4 | ||||
| LDTP02976 | Peptidyl-glycine alpha-amidating monooxygenase (PAM) | 24.4 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 23.8 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 22.5 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 22.5 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 22.0 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 21.9 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 21.4 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 21.3 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 21.3 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 21.0 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 20.1 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 20.1 | ||||
| LDTP00282 | Beta-mannosidase (MANBA) | 19.7 | ||||
| LDTP01372 | Carboxypeptidase D (CPD) | 19.6 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 19.4 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 19.2 | ||||
| LDTP02362 | Dihydrolipoyl dehydrogenase, mitochondrial (DLD) | 19.0 | ||||
| LDTP12763 | Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase (BPNT2) | 18.9 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 18.9 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 18.5 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 18.3 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 17.8 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 17.6 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 17.5 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 17.4 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 17.1 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 16.8 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 16.4 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 16.3 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 16.2 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 15.9 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 15.8 | ||||
| LDTP12109 | Ribitol 5-phosphate transferase FKRP (FKRP) | 15.3 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 15.0 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 14.9 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 14.9 | ||||
| LDTP04893 | Ras-related protein Rab-5B (RAB5B) | 14.7 | ||||
| LDTP04572 | Dipeptidyl peptidase 1 (CTSC) | 14.5 | ||||
| LDTP09886 | Gamma-glutamyl hydrolase (GGH) | 14.4 | ||||
| LDTP06986 | Rab-like protein 3 (RABL3) | 14.3 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 14.2 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 14.1 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 14.1 | ||||
| LDTP00338 | Lysosomal alpha-mannosidase (MAN2B1) | 14.1 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 13.9 | ||||
| LDTP01219 | NADH dehydrogenase 1 beta subcomplex subunit 1 (NDUFB1) | 13.6 | ||||
| LDTP04247 | Protein farnesyltransferase subunit beta (FNTB) | 13.5 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 13.5 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 13.5 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 13.3 | ||||
| LDTP10888 | Legumain (LGMN) | 13.1 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 13.0 | ||||
| LDTP05422 | Copper-transporting ATPase 1 (ATP7A) | 12.9 | ||||
| LDTP09391 | Ceramide kinase (CERK) | 12.8 | ||||
| LDTP02216 | Beta-hexosaminidase subunit beta (HEXB) | 12.7 | ||||
| LDTP12056 | Thiol S-methyltransferase TMT1A (TMT1A) | 12.7 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 12.6 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 12.5 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 12.5 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 12.3 | ||||
| LDTP07813 | Sulfhydryl oxidase 2 (QSOX2) | 12.3 | ||||
| LDTP13804 | Heparanase (HPSE) | 12.2 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 12.0 | ||||
| LDTP11259 | Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase (ALG12) | 12.0 | ||||
| LDTP02499 | Receptor-type tyrosine-protein phosphatase F (PTPRF) | 12.0 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 11.9 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 11.9 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 11.9 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 11.8 | ||||
| LDTP02260 | Beta-glucuronidase (GUSB) | 11.7 | ||||
| LDTP09061 | Retinol dehydrogenase 13 (RDH13) | 11.6 | ||||
| LDTP09620 | Soluble calcium-activated nucleotidase 1 (CANT1) | 11.6 | ||||
| LDTP02557 | Ras-related protein Ral-A (RALA) | 11.3 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 11.2 | ||||
| LDTP03608 | RAC-beta serine/threonine-protein kinase (AKT2) | 11.2 | ||||
| LDTP04531 | Hexokinase-2 (HK2) | 11.0 | ||||
| LDTP09074 | UDP-glucuronic acid decarboxylase 1 (UXS1) | 11.0 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 10.9 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 10.6 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 10.5 | ||||
| LDTP11209 | Phosphatidylinositol 4-kinase type 2-alpha (PI4K2A) | 10.3 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 10.1 | ||||
| LDTP05561 | Lactadherin (MFGE8) | 10.1 | ||||
| LDTP08455 | Palmitoyltransferase ZDHHC13 (ZDHHC13) | 10.1 | ||||
| LDTP10441 | E3 ubiquitin-protein ligase Itchy homolog (ITCH) | 10.0 | ||||
| LDTP12470 | GTP-binding protein SAR1a (SAR1A) | 9.9 | ||||
| LDTP10699 | E3 ubiquitin-protein ligase NEDD4-like (NEDD4L) | 9.8 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 9.8 | ||||
| LDTP12524 | L-aminoadipate-semialdehyde dehydrogenase-phosphopantetheinyl transferase (AASDHPPT) | 9.7 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 9.7 | ||||
| LDTP04730 | Methionine--tRNA ligase, cytoplasmic (MARS1) | 9.6 | ||||
| LDTP12293 | Adipocyte plasma membrane-associated protein (APMAP) | 9.6 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 9.6 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 9.6 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 9.6 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 9.4 | ||||
| LDTP04884 | Proteasome subunit alpha type-6 (PSMA6) | 9.4 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 9.3 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 9.3 | ||||
| LDTP14231 | GTP-binding protein SAR1b (SAR1B) | 9.1 | ||||
| LDTP03677 | Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA (MAN1A1) | 9.1 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 9.0 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 8.9 | ||||
| LDTP03858 | Lysosomal acid lipase/cholesteryl ester hydrolase (LIPA) | 8.8 | ||||
| LDTP05623 | Polypeptide N-acetylgalactosaminyltransferase 2 (GALNT2) | 8.7 | ||||
| LDTP01785 | Epidermal growth factor receptor (EGFR) | 8.6 | ||||
| LDTP12233 | Helicase MOV-10 (MOV10) | 8.6 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 8.6 | ||||
| LDTP09835 | GPI-anchor transamidase (PIGK) | 8.6 | ||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 8.6 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 8.6 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 8.5 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 8.5 | ||||
| LDTP04080 | Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform (PHKA1) | 8.5 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 8.3 | ||||
| LDTP11788 | EH domain-containing protein 4 (EHD4) | 8.3 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 8.3 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 8.2 | ||||
| LDTP12166 | Ras-related GTP-binding protein C (RRAGC) | 8.2 | ||||
| LDTP19838 | Immunity-related GTPase family Q protein (IRGQ) | 8.1 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 8.1 | ||||
| LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 8.0 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 8.0 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 8.0 | ||||
| LDTP00575 | Glutathione S-transferase A4 (GSTA4) | 7.9 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 7.9 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 7.9 | ||||
| LDTP00400 | Torsin-1B (TOR1B) | 7.9 | ||||
| LDTP13675 | COP9 signalosome complex subunit 3 (COPS3) | 7.8 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 7.8 | ||||
| LDTP00032 | 2-hydroxyacyl-CoA lyase 2 (ILVBL) | 7.8 | ||||
| LDTP08064 | ATP-dependent RNA helicase DHX29 (DHX29) | 7.8 | ||||
| LDTP12509 | N-lysine methyltransferase SMYD2 (SMYD2) | 7.8 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 7.7 | ||||
| LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | 7.7 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 7.7 | ||||
| LDTP05006 | Ras-related protein Rab-1A (RAB1A) | 7.7 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 7.7 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 7.7 | ||||
| LDTP06721 | GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase (ALG11) | 7.6 | ||||
| LDTP02188 | Protein disulfide-isomerase (P4HB) | 7.6 | ||||
| LDTP04398 | Ras-related protein Rab-5C (RAB5C) | 7.6 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 7.6 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 7.5 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 49.5 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 46.5 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 46.2 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 38.6 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 37.3 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 37.0 | ||||
| LDTP02215 | Prosaposin (PSAP) | 36.8 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 36.3 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 34.1 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 32.4 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 31.8 | ||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | 31.1 | ||||
| LDTP06275 | Lysosomal-associated transmembrane protein 4A (LAPTM4A) | 30.1 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 29.4 | ||||
| LDTP01969 | Transferrin receptor protein 1 (TFRC) | 29.4 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 28.6 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 26.5 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 26.2 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 26.0 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 26.0 | ||||
| LDTP09838 | Sortilin-related receptor (SORL1) | 25.5 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 24.8 | ||||
| LDTP12981 | Proton-transporting V-type ATPase complex assembly regulator TMEM9 (TMEM9) | 24.1 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 23.3 | ||||
| LDTP10885 | Sortilin (SORT1) | 22.0 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 21.7 | ||||
| LDTP11812 | Protein ARV1 (ARV1) | 20.8 | ||||
| LDTP12042 | Proton-activated chloride channel (PACC1) | 20.7 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 20.3 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 20.1 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 19.6 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 19.3 | ||||
| LDTP12665 | Cell cycle control protein 50A (TMEM30A) | 19.2 | ||||
| LDTP02586 | Cation-independent mannose-6-phosphate receptor (IGF2R) | 18.9 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 18.9 | ||||
| LDTP05538 | Prolow-density lipoprotein receptor-related protein 1 (LRP1) | 18.9 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 18.8 | ||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 18.1 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 17.8 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 17.6 | ||||
| LDTP06581 | Occludin (OCLN) | 17.1 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 17.0 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 16.4 | ||||
| LDTP00321 | Podocalyxin (PODXL) | 16.1 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 16.1 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 15.9 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 15.8 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 15.7 | ||||
| LDTP05811 | Syntaxin-3 (STX3) | 15.7 | ||||
| LDTP10663 | Importin-9 (IPO9) | 15.1 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 14.7 | ||||
| LDTP00310 | Syntenin-1 (SDCBP) | 14.5 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 14.5 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 14.5 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 14.4 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 14.3 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 14.2 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 14.2 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 13.8 | ||||
| LDTP01829 | Low-density lipoprotein receptor (LDLR) | 13.7 | ||||
| LDTP02166 | Integrin alpha-V (ITGAV) | 13.4 | ||||
| LDTP05218 | Low-density lipoprotein receptor-related protein 2 (LRP2) | 13.4 | ||||
| LDTP11626 | Protein YIPF3 (YIPF3) | 13.2 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 12.9 | ||||
| LDTP09144 | Metal transporter CNNM3 (CNNM3) | 12.7 | ||||
| LDTP01427 | Slit homolog 2 protein (SLIT2) | 12.7 | ||||
| LDTP06499 | V-type proton ATPase subunit S1 (ATP6AP1) | 12.7 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 12.6 | ||||
| LDTP09807 | Sodium/hydrogen exchanger 6 (SLC9A6) | 12.6 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 12.5 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 12.5 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 12.1 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 12.1 | ||||
| LDTP05780 | Syntaxin-5 (STX5) | 12.1 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 12.0 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 11.8 | ||||
| LDTP06855 | Anoctamin-6 (ANO6) | 11.6 | ||||
| LDTP02544 | Solute carrier family 2, facilitated glucose transporter member 1 (SLC2A1) | 11.6 | ||||
| LDTP08016 | Proton-coupled amino acid transporter 1 (SLC36A1) | 11.6 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 11.5 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 11.5 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 11.1 | ||||
| LDTP10731 | Sodium-coupled neutral amino acid symporter 2 (SLC38A2) | 10.9 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 10.9 | ||||
| LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 10.9 | ||||
| LDTP03869 | Protein Mpv17 (MPV17) | 10.7 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 10.6 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 10.6 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 10.6 | ||||
| LDTP04463 | H(+)/Cl(-) exchange transporter 7 (CLCN7) | 10.6 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 10.6 | ||||
| LDTP02061 | Anion exchange protein 2 (SLC4A2) | 10.3 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 10.0 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 9.8 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 9.6 | ||||
| LDTP09261 | Major facilitator superfamily domain-containing protein 8 (MFSD8) | 9.6 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 9.5 | ||||
| LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 9.4 | ||||
| LDTP02740 | Solute carrier family 2, facilitated glucose transporter member 4 (SLC2A4) | 9.4 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 9.2 | ||||
| LDTP03061 | Cation-dependent mannose-6-phosphate receptor (M6PR) | 9.1 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 9.0 | ||||
| LDTP01309 | Renin receptor (ATP6AP2) | 8.9 | ||||
| LDTP09789 | Transmembrane 9 superfamily member 4 (TM9SF4) | 8.9 | ||||
| LDTP02256 | Amino acid transporter heavy chain SLC3A2 (SLC3A2) | 8.8 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 8.8 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 8.7 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 8.7 | ||||
| LDTP07477 | Transmembrane protein 214 (TMEM214) | 8.6 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 8.6 | ||||
| LDTP09949 | Transportin-1 (TNPO1) | 8.6 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 8.5 | ||||
| LDTP04597 | Methylosome subunit pICln (CLNS1A) | 8.3 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 8.2 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 8.2 | ||||
| LDTP01366 | Flotillin-1 (FLOT1) | 8.1 | ||||
| LDTP09203 | Nucleoporin Nup37 (NUP37) | 8.1 | ||||
| LDTP00451 | Secretory carrier-associated membrane protein 3 (SCAMP3) | 8.0 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 8.0 | ||||
| LDTP01380 | Wolframin (WFS1) | 8.0 | ||||
| LDTP11934 | EH domain-containing protein 1 (EHD1) | 7.9 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 7.9 | ||||
| LDTP03811 | V-type proton ATPase subunit E 1 (ATP6V1E1) | 7.9 | ||||
| LDTP04653 | Solute carrier family 12 member 2 (SLC12A2) | 7.8 | ||||
| LDTP02087 | ADP/ATP translocase 2 (SLC25A5) | 7.7 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 7.7 | ||||
| LDTP14275 | Sodium bicarbonate cotransporter 3 (SLC4A7) | 7.7 | ||||
| LDTP00010 | Intraflagellar transport protein 56 (IFT56) | 7.6 | ||||
| LDTP06293 | Metal cation symporter ZIP14 (SLC39A14) | 7.6 | ||||
| LDTP00433 | Neuropilin-1 (NRP1) | 7.6 | ||||
| LDTP06660 | MICOS complex subunit MIC60 (IMMT) | 7.5 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 8.6 | ||||
GPCR
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04221 | Adhesion G protein-coupled receptor E5 (ADGRE5) | 19.4 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02040 | HLA class I histocompatibility antigen, A alpha chain (HLA-A) | 19.2 | ||||
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 16.6 | ||||
| LDTP07280 | CD276 antigen (CD276) | 15.3 | ||||
| LDTP02491 | HLA class I histocompatibility antigen, C alpha chain (HLA-C) | 14.7 | ||||
| LDTP03772 | Basigin (BSG) | 12.0 | ||||
| LDTP04020 | Cell surface glycoprotein MUC18 (MCAM) | 11.8 | ||||
| LDTP10445 | Kin of IRRE-like protein 1 (KIRREL1) | 11.6 | ||||
| LDTP01913 | HLA class I histocompatibility antigen, B alpha chain (HLA-B) | 8.8 | ||||
| LDTP14203 | Junctional adhesion molecule A (F11R) | 8.5 | ||||
| LDTP07927 | Butyrophilin subfamily 2 member A1 (BTN2A1) | 8.1 | ||||
Cytokine and receptor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02775 | Interferon gamma receptor 1 (IFNGR1) | 36.3 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 76.6 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 70.5 | ||||
| LDTP08581 | CD302 antigen (CD302) | 67.2 | ||||
| LDTP00779 | Trans-Golgi network integral membrane protein 2 (TGOLN2) | 64.4 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 62.7 | ||||
| LDTP05898 | Sequestosome-1 (SQSTM1) | 54.9 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 54.6 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 53.8 | ||||
| LDTP01279 | Protein CREG1 (CREG1) | 50.9 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 49.9 | ||||
| LDTP10200 | 60S ribosomal export protein NMD3 (NMD3) | 37.5 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 37.5 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 34.5 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 30.7 | ||||
| LDTP15115 | Protein GOLM2 (GOLM2) | 27.9 | ||||
| LDTP05215 | Very low-density lipoprotein receptor (VLDLR) | 27.9 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 27.5 | ||||
| LDTP08294 | Tax1-binding protein 1 (TAX1BP1) | 27.3 | ||||
| LDTP12544 | Serine incorporator 1 (SERINC1) | 26.4 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 25.8 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 24.9 | ||||
| LDTP15240 | LysM and putative peptidoglycan-binding domain-containing protein 3 (LYSMD3) | 24.8 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 24.8 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 24.6 | ||||
| LDTP00887 | Calumenin (CALU) | 24.4 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 23.6 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 23.3 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 22.9 | ||||
| LDTP13114 | C-type mannose receptor 2 (MRC2) | 22.6 | ||||
| LDTP05491 | Amyloid beta precursor like protein 2 (APLP2) | 22.2 | ||||
| LDTP07080 | FRAS1-related extracellular matrix protein 2 (FREM2) | 22.0 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 21.7 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 21.6 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 21.0 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 20.7 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 20.5 | ||||
| LDTP06159 | Next to BRCA1 gene 1 protein (NBR1) | 20.3 | ||||
| LDTP09054 | Golgi membrane protein 1 (GOLM1) | 20.0 | ||||
| LDTP00513 | Plexin-B2 (PLXNB2) | 19.7 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 19.7 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 18.9 | ||||
| LDTP05764 | Calcium-binding and coiled-coil domain-containing protein 2 (CALCOCO2) | 18.8 | ||||
| LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | 18.8 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 18.5 | ||||
| LDTP07031 | Collectin-12 (COLEC12) | 18.1 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 18.1 | ||||
| LDTP02728 | Nidogen-1 (NID1) | 17.9 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 17.6 | ||||
| LDTP13669 | Endothelial protein C receptor (PROCR) | 17.6 | ||||
| LDTP07703 | Seizure 6-like protein 2 (SEZ6L2) | 17.5 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 17.0 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 16.7 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 16.7 | ||||
| LDTP02013 | Apolipoprotein B-100 (APOB) | 16.2 | ||||
| LDTP12623 | Zinc finger CCHC domain-containing protein 3 (ZCCHC3) | 15.8 | ||||
| LDTP17652 | Uncharacterized protein KIAA2013 (KIAA2013) | 15.7 | ||||
| LDTP05558 | Galectin-3-binding protein (LGALS3BP) | 14.8 | ||||
| LDTP11910 | Golgi phosphoprotein 3-like (GOLPH3L) | 14.6 | ||||
| LDTP00632 | Syntaxin-7 (STX7) | 14.5 | ||||
| LDTP01075 | Protein CutA (CUTA) | 14.4 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 13.8 | ||||
| LDTP11906 | Phosphatidylinositol glycan anchor biosynthesis class U protein (PIGU) | 13.8 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 13.6 | ||||
| LDTP02511 | cAMP-dependent protein kinase type I-alpha regulatory subunit (PRKAR1A) | 13.5 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 13.2 | ||||
| LDTP10469 | Engulfment and cell motility protein 2 (ELMO2) | 13.2 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 12.8 | ||||
| LDTP18732 | Protein FAM234B (FAM234B) | 12.4 | ||||
| LDTP06154 | Desmocollin-3 (DSC3) | 12.2 | ||||
| LDTP04207 | Heat shock 70 kDa protein 13 (HSPA13) | 11.9 | ||||
| LDTP02795 | Membrane cofactor protein (CD46) | 11.8 | ||||
| LDTP06413 | Microtubule-associated protein RP/EB family member 2 (MAPRE2) | 11.8 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 11.7 | ||||
| LDTP08389 | Syntaxin-12 (STX12) | 11.6 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 11.5 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 11.4 | ||||
| LDTP13922 | Tudor and KH domain-containing protein (TDRKH) | 10.8 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 10.7 | ||||
| LDTP06042 | Desmoglein-2 (DSG2) | 10.5 | ||||
| LDTP04979 | U6 snRNA-associated Sm-like protein LSm3 (LSM3) | 10.3 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 10.1 | ||||
| LDTP14939 | Membralin (TMEM259) | 9.9 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 9.7 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 9.3 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 9.3 | ||||
| LDTP05966 | Angio-associated migratory cell protein (AAMP) | 9.3 | ||||
| LDTP10033 | WW domain-binding protein 2 (WBP2) | 9.3 | ||||
| LDTP16249 | Protein angel homolog 1 (ANGEL1) | 9.2 | ||||
| LDTP02443 | Calmodulin-3 (CALM3) | 9.1 | ||||
| LDTP02230 | Laminin subunit beta-1 (LAMB1) | 9.1 | ||||
| LDTP13664 | Syntaxin-8 (STX8) | 8.9 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 8.9 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 8.9 | ||||
| LDTP11712 | Rac GTPase-activating protein 1 (RACGAP1) | 8.9 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 8.8 | ||||
| LDTP06292 | Rab3 GTPase-activating protein catalytic subunit (RAB3GAP1) | 8.8 | ||||
| LDTP13712 | Nonsense-mediated mRNA decay factor SMG5 (SMG5) | 8.7 | ||||
| LDTP04947 | DDB1- and CUL4-associated factor 7 (DCAF7) | 8.6 | ||||
| LDTP10403 | DDRGK domain-containing protein 1 (DDRGK1) | 8.5 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 8.5 | ||||
| LDTP04468 | Vesicle-associated membrane protein 7 (VAMP7) | 8.3 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 8.2 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 8.2 | ||||
| LDTP07476 | RAD50-interacting protein 1 (RINT1) | 8.1 | ||||
| LDTP10927 | COP9 signalosome complex subunit 8 (COPS8) | 7.9 | ||||
| LDTP06542 | Cysteine and glycine-rich protein 2 (CSRP2) | 7.9 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 7.9 | ||||
| LDTP04917 | Proteasome activator complex subunit 3 (PSME3) | 7.8 | ||||
| LDTP07401 | Ragulator complex protein LAMTOR1 (LAMTOR1) | 7.8 | ||||
| LDTP14259 | Testis-expressed protein 264 (TEX264) | 7.8 | ||||
| LDTP13060 | Myelin expression factor 2 (MYEF2) | 7.7 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 7.6 | ||||
| LDTP06404 | Surfeit locus protein 1 (SURF1) | 7.6 | ||||
| LDTP11525 | Kinetochore protein Nuf2 (NUF2) | 7.6 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 7.6 | ||||
| LDTP01589 | CD2 antigen cytoplasmic tail-binding protein 2 (CD2BP2) | 7.5 | ||||
