Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C134 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 99.7 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 99.7 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 99.7 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 99.7 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 84.4 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 83.9 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 81.0 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 75.1 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 70.0 | ||||
| LDTP06511 | Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial (ETFDH) | 67.6 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 58.5 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 58.5 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 57.3 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 56.5 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 55.3 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 54.9 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 51.3 | ||||
| LDTP03671 | Multidrug resistance-associated protein 1 (ABCC1) | 51.3 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 50.2 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 48.2 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 46.9 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 46.9 | ||||
| LDTP16025 | Ketosamine-3-kinase (FN3KRP) | 45.3 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 45.3 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 44.6 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 44.6 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 43.4 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 42.8 | ||||
| LDTP12639 | 1-acyl-sn-glycerol-3-phosphate acyltransferase epsilon (AGPAT5) | 42.2 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 42.2 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 42.2 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 41.1 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 40.8 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 40.8 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 40.2 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 40.2 | ||||
| LDTP10699 | E3 ubiquitin-protein ligase NEDD4-like (NEDD4L) | 39.9 | ||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 38.3 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 37.8 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 37.5 | ||||
| LDTP08799 | Lysophosphatidylserine lipase ABHD12 (ABHD12) | 37.5 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 37.3 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 36.5 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 35.8 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 35.8 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 35.8 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 35.5 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 35.5 | ||||
| LDTP14264 | Choline/ethanolaminephosphotransferase 1 (CEPT1) | 35.0 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 34.5 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 34.5 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 34.1 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 33.4 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 33.4 | ||||
| LDTP09061 | Retinol dehydrogenase 13 (RDH13) | 33.4 | ||||
| LDTP06638 | Phosphoenolpyruvate carboxykinase [GTP], mitochondrial (PCK2) | 33.1 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 32.2 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 31.8 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 31.8 | ||||
| LDTP01300 | Cartilage-associated protein (CRTAP) | 31.6 | ||||
| LDTP12886 | Glycerophosphodiester phosphodiesterase 1 (GDE1) | 31.3 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 31.3 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 30.7 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 30.3 | ||||
| LDTP02000 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase (HMGCR) | 30.1 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 30.1 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 29.9 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 29.9 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 29.2 | ||||
| LDTP07227 | Threonylcarbamoyladenosine tRNA methylthiotransferase (CDKAL1) | 29.2 | ||||
| LDTP12490 | Sphingosine kinase 2 (SPHK2) | 28.8 | ||||
| LDTP11867 | UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase (DPAGT1) | 28.8 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 28.6 | ||||
| LDTP03779 | Copper-transporting ATPase 2 (ATP7B) | 28.4 | ||||
| LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 28.2 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 27.9 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 27.7 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 27.7 | ||||
| LDTP10780 | Trimethylguanosine synthase (TGS1) | 27.7 | ||||
| LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 27.5 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 27.3 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 27.3 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 27.3 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 27.3 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 27.1 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 27.1 | ||||
| LDTP08530 | Mitofusin-1 (MFN1) | 26.9 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 26.2 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 26.2 | ||||
| LDTP03900 | ADP-ribosylation factor-like protein 1 (ARL1) | 25.8 | ||||
| LDTP16040 | Glyoxalase domain-containing protein 4 (GLOD4) | 25.8 | ||||
| LDTP12763 | Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase (BPNT2) | 25.8 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 25.6 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 25.6 | ||||
| LDTP07154 | ATPase family AAA domain-containing protein 3B (ATAD3B) | 25.5 | ||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 25.5 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 25.3 | ||||
| LDTP05228 | Calcium-transporting ATPase type 2C member 1 (ATP2C1) | 24.9 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 24.8 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 24.4 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 23.9 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 23.9 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 23.9 | ||||
| LDTP00032 | 2-hydroxyacyl-CoA lyase 2 (ILVBL) | 23.4 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 23.1 | ||||
| LDTP04333 | GMP synthase [glutamine-hydrolyzing] (GMPS) | 22.8 | ||||
| LDTP12470 | GTP-binding protein SAR1a (SAR1A) | 22.8 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 22.8 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 22.8 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 22.8 | ||||
| LDTP08177 | Dehydrodolichyl diphosphate synthase complex subunit DHDDS (DHDDS) | 22.6 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 22.6 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 22.6 | ||||
| LDTP04531 | Hexokinase-2 (HK2) | 22.6 | ||||
| LDTP01743 | NADH dehydrogenase 1 beta subcomplex subunit 10 (NDUFB10) | 22.6 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 22.6 | ||||
| LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | 22.5 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 22.3 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 22.2 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 22.2 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 22.2 | ||||
| LDTP03103 | Glutathione S-transferase Mu 3 (GSTM3) | 21.9 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 21.9 | ||||
| LDTP06721 | GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase (ALG11) | 21.7 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 21.7 | ||||
| LDTP02188 | Protein disulfide-isomerase (P4HB) | 21.6 | ||||
| LDTP13986 | Vesicle transport protein GOT1B (GOLT1B) | 21.3 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 21.1 | ||||
| LDTP01649 | Phosphatidate cytidylyltransferase 2 (CDS2) | 21.1 | ||||
| LDTP10530 | Beta-1,3-galactosyltransferase 6 (B3GALT6) | 21.0 | ||||
| LDTP12608 | Phosphatidylinositol-3-phosphatase SAC1 (SACM1L) | 21.0 | ||||
| LDTP10966 | Microsomal glutathione S-transferase 2 (MGST2) | 20.8 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 20.8 | ||||
| LDTP12180 | Retinol dehydrogenase 14 (RDH14) | 20.8 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 20.8 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 20.7 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 20.7 | ||||
| LDTP02550 | Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial (DBT) | 20.7 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 20.5 | ||||
| LDTP01465 | Glutaminase kidney isoform, mitochondrial (GLS) | 20.5 | ||||
| LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 20.5 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 20.5 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 20.3 | ||||
| LDTP09814 | Acyl-CoA:lysophosphatidylglycerol acyltransferase 1 (LPGAT1) | 20.1 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 20.1 | ||||
| LDTP01514 | NADH dehydrogenase 1 beta subcomplex subunit 4 (NDUFB4) | 20.1 | ||||
| LDTP07868 | Protein O-mannosyl-transferase TMTC3 (TMTC3) | 20.1 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15648 | BRI3-binding protein (BRI3BP) | 99.7 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 99.7 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 99.7 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 99.7 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 95.0 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 87.4 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 79.9 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 75.6 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 71.0 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 70.0 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 70.0 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 62.7 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 57.7 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 56.1 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 53.4 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 53.1 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 52.7 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 51.6 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 51.6 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 50.2 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 48.2 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 47.5 | ||||
| LDTP08016 | Proton-coupled amino acid transporter 1 (SLC36A1) | 47.2 | ||||
| LDTP02215 | Prosaposin (PSAP) | 45.6 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 45.3 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 43.7 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 41.1 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 40.8 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 40.2 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 39.9 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 39.9 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 39.4 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 39.4 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 39.1 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 38.3 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 38.3 | ||||
| LDTP01455 | Erlin-2 (ERLIN2) | 38.1 | ||||
| LDTP04237 | Protein ERGIC-53 (LMAN1) | 38.1 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 37.3 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 37.3 | ||||
| LDTP10663 | Importin-9 (IPO9) | 37.0 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 36.5 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 36.5 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 35.8 | ||||
| LDTP01060 | PRA1 family protein 2 (PRAF2) | 35.8 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 35.3 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 35.3 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 35.0 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 34.8 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 34.3 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 33.8 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 33.6 | ||||
| LDTP09294 | Proton-coupled zinc antiporter SLC30A5 (SLC30A5) | 33.4 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 32.7 | ||||
| LDTP03064 | Cytochrome c oxidase subunit 5A, mitochondrial (COX5A) | 32.0 | ||||
| LDTP13320 | Prenylated Rab acceptor protein 1 (RABAC1) | 32.0 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 31.1 | ||||
| LDTP15979 | Transmembrane protein 245 (TMEM245) | 30.7 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 30.5 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 30.5 | ||||
| LDTP04227 | Guided entry of tail-anchored proteins factor CAMLG (CAMLG) | 30.3 | ||||
| LDTP01234 | Erlin-1 (ERLIN1) | 29.7 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 29.7 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 29.2 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 29.2 | ||||
| LDTP03380 | Stomatin (STOM) | 28.8 | ||||
| LDTP09788 | Sorting nexin-19 (SNX19) | 28.6 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 28.1 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 27.7 | ||||
| LDTP07439 | Mitochondrial adenyl nucleotide antiporter SLC25A25 (SLC25A25) | 26.7 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 26.7 | ||||
| LDTP04787 | Transmembrane protein 33 (TMEM33) | 26.7 | ||||
| LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 26.5 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 26.4 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 26.2 | ||||
| LDTP14717 | ATP synthase subunit e, mitochondrial (ATP5ME) | 26.0 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 26.0 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 25.8 | ||||
| LDTP01100 | Iron-sulfur clusters transporter ABCB7, mitochondrial (ABCB7) | 25.6 | ||||
| LDTP04463 | H(+)/Cl(-) exchange transporter 7 (CLCN7) | 25.1 | ||||
| LDTP11634 | Derlin-2 (DERL2) | 24.9 | ||||
| LDTP10804 | Chloride channel CLIC-like protein 1 (CLCC1) | 24.8 | ||||
| LDTP10081 | Leucine-rich repeat-containing protein 59 (LRRC59) | 24.6 | ||||
| LDTP14275 | Sodium bicarbonate cotransporter 3 (SLC4A7) | 24.6 | ||||
| LDTP13943 | Thioredoxin-related transmembrane protein 2 (TMX2) | 24.4 | ||||
| LDTP02061 | Anion exchange protein 2 (SLC4A2) | 23.9 | ||||
| LDTP07467 | Rhomboid domain-containing protein 2 (RHBDD2) | 23.9 | ||||
| LDTP07058 | Transmembrane protein 201 (TMEM201) | 23.9 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 23.8 | ||||
| LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 23.6 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 23.6 | ||||
| LDTP09144 | Metal transporter CNNM3 (CNNM3) | 23.4 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 23.3 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 22.9 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 22.9 | ||||
| LDTP01217 | Metaxin-2 (MTX2) | 22.8 | ||||
| LDTP01748 | Mitochondrial import receptor subunit TOM40 homolog (TOMM40) | 22.8 | ||||
| LDTP07477 | Transmembrane protein 214 (TMEM214) | 22.8 | ||||
| LDTP09459 | Volume-regulated anion channel subunit LRRC8C (LRRC8C) | 22.8 | ||||
| LDTP13393 | Electrogenic aspartate/glutamate antiporter SLC25A13, mitochondrial (SLC25A13) | 22.5 | ||||
| LDTP10317 | THO complex subunit 1 (THOC1) | 22.5 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 22.5 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 22.3 | ||||
| LDTP00310 | Syntenin-1 (SDCBP) | 22.3 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 22.2 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 22.2 | ||||
| LDTP01380 | Wolframin (WFS1) | 22.0 | ||||
| LDTP03405 | Calnexin (CANX) | 21.9 | ||||
| LDTP10398 | Receptor expression-enhancing protein 6 (REEP6) | 21.7 | ||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 21.6 | ||||
| LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 21.4 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 21.4 | ||||
| LDTP12979 | Transmembrane protein 14C (TMEM14C) | 21.3 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 21.3 | ||||
| LDTP07537 | Metal transporter CNNM4 (CNNM4) | 21.1 | ||||
| LDTP12725 | Calcium uniporter regulatory subunit MCUb, mitochondrial (MCUB) | 21.0 | ||||
| LDTP11732 | Magnesium transporter protein 1 (MAGT1) | 21.0 | ||||
| LDTP08315 | THO complex subunit 6 homolog (THOC6) | 21.0 | ||||
| LDTP08981 | Cytochrome c oxidase assembly protein COX18, mitochondrial (COX18) | 20.8 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 20.8 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 20.8 | ||||
| LDTP06293 | Metal cation symporter ZIP14 (SLC39A14) | 20.5 | ||||
| LDTP13953 | Endophilin-B1 (SH3GLB1) | 20.4 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 20.3 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 42.2 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 30.3 | ||||
| LDTP03772 | Basigin (BSG) | 26.5 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11076 | Apolipoprotein L2 (APOL2) | 99.7 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 99.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 99.7 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 99.7 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 99.7 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 99.7 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 99.7 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 86.2 | ||||
| LDTP18569 | PRELI domain containing protein 3B (PRELID3B) | 75.6 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 72.0 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 70.5 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 67.2 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 64.4 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 62.2 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 58.5 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 55.7 | ||||
| LDTP15944 | Cytochrome c oxidase assembly factor 1 homolog (COA1) | 54.2 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 53.4 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 53.1 | ||||
| LDTP09773 | Protein FAM3C (FAM3C) | 53.1 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 45.6 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 44.3 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 43.7 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 43.4 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 43.4 | ||||
| LDTP11143 | Centromere protein K (CENPK) | 43.1 | ||||
| LDTP13451 | DCC-interacting protein 13-alpha (APPL1) | 42.5 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 42.2 | ||||
| LDTP15095 | Receptor expression-enhancing protein 3 (REEP3) | 41.6 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 40.5 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 40.2 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 39.9 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 39.7 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 38.1 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 37.3 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 37.0 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 36.0 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 35.5 | ||||
| LDTP13807 | PRELI domain-containing protein 1, mitochondrial (PRELID1) | 35.0 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 35.0 | ||||
| LDTP06948 | Protein YIF1B (YIF1B) | 34.5 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 33.6 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 33.6 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 33.1 | ||||
| LDTP08606 | Nurim (NRM) | 33.1 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 32.7 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 31.3 | ||||
| LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | 30.5 | ||||
| LDTP15240 | LysM and putative peptidoglycan-binding domain-containing protein 3 (LYSMD3) | 29.9 | ||||
| LDTP16322 | Mitochondrial import inner membrane translocase subunit Tim8 B (TIMM8B) | 29.9 | ||||
| LDTP13519 | Proteasome activator complex subunit 2 (PSME2) | 29.9 | ||||
| LDTP05715 | Vesicle transport protein SEC20 (BNIP1) | 29.9 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 29.0 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 28.8 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 28.4 | ||||
| LDTP01358 | Pre-mRNA-splicing factor SPF27 (BCAS2) | 28.1 | ||||
| LDTP05530 | Induced myeloid leukemia cell differentiation protein Mcl-1 (MCL1) | 27.9 | ||||
| LDTP04356 | Emerin (EMD) | 27.7 | ||||
| LDTP00779 | Trans-Golgi network integral membrane protein 2 (TGOLN2) | 27.7 | ||||
| LDTP03729 | General transcription factor IIF subunit 1 (GTF2F1) | 27.5 | ||||
| LDTP11167 | Protein YIPF4 (YIPF4) | 27.3 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 27.1 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 27.1 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 26.9 | ||||
| LDTP13802 | DNA replication complex GINS protein PSF2 (GINS2) | 26.4 | ||||
| LDTP13412 | Anaphase-promoting complex subunit 2 (ANAPC2) | 25.8 | ||||
| LDTP12982 | Mitochondrial import receptor subunit TOM7 homolog (TOMM7) | 25.8 | ||||
| LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 25.8 | ||||
| LDTP09324 | Ganglioside-induced differentiation-associated protein 1 (GDAP1) | 25.3 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 25.1 | ||||
| LDTP04703 | Tumor protein D52 (TPD52) | 24.6 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 24.4 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 24.4 | ||||
| LDTP13967 | Transmembrane emp24 domain-containing protein 5 (TMED5) | 24.4 | ||||
| LDTP13664 | Syntaxin-8 (STX8) | 24.3 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 24.1 | ||||
| LDTP07916 | Protein MTSS 2 (MTSS2) | 24.1 | ||||
| LDTP07718 | MICOS complex subunit MIC27 (APOOL) | 23.8 | ||||
| LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 23.1 | ||||
| LDTP11326 | FUN14 domain-containing protein 2 (FUNDC2) | 22.9 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 22.9 | ||||
| LDTP09589 | Charged multivesicular body protein 7 (CHMP7) | 22.8 | ||||
| LDTP17003 | Matrix-remodeling-associated protein 7 (MXRA7) | 22.5 | ||||
| LDTP04425 | Translocon-associated protein subunit delta (SSR4) | 22.3 | ||||
| LDTP13125 | Protein UXT (UXT) | 22.2 | ||||
| LDTP14080 | U6 snRNA-associated Sm-like protein LSm5 (LSM5) | 22.2 | ||||
| LDTP04626 | UV excision repair protein RAD23 homolog A (RAD23A) | 22.2 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 22.0 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 22.0 | ||||
| LDTP02297 | Vimentin (VIM) | 22.0 | ||||
| LDTP08420 | BLOC-2 complex member HPS6 (HPS6) | 21.9 | ||||
| LDTP03425 | Tropomodulin-1 (TMOD1) | 21.9 | ||||
| LDTP04207 | Heat shock 70 kDa protein 13 (HSPA13) | 21.7 | ||||
| LDTP05277 | Protein SET (SET) | 21.7 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 21.4 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 21.3 | ||||
| LDTP07598 | BRCA1-associated ATM activator 1 (BRAT1) | 21.1 | ||||
| LDTP09679 | Negative elongation factor B (NELFB) | 20.7 | ||||
| LDTP04980 | U6 snRNA-associated Sm-like protein LSm6 (LSM6) | 20.7 | ||||
| LDTP11981 | Receptor expression-enhancing protein 4 (REEP4) | 20.4 | ||||
| LDTP10703 | Leukocyte receptor cluster member 8 (LENG8) | 20.3 | ||||
| LDTP01206 | Vesicle-trafficking protein SEC22b (SEC22B) | 20.1 | ||||
