Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C055 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01769 | Dihydrofolate reductase (DHFR) | 99.7 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 99.7 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 77.2 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 63.1 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 60.5 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 57.7 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 56.5 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 56.5 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 54.6 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 51.3 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 50.9 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 49.9 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 49.5 | ||||
| LDTP16040 | Glyoxalase domain-containing protein 4 (GLOD4) | 47.5 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 45.6 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 40.8 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 40.5 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 39.7 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 39.4 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 38.1 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 35.8 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 34.3 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 32.9 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 32.7 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 31.1 | ||||
| LDTP08538 | DCN1-like protein 3 (DCUN1D3) | 31.1 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 31.1 | ||||
| LDTP00575 | Glutathione S-transferase A4 (GSTA4) | 30.9 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 30.5 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 29.2 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 29.2 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 28.8 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 27.7 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 27.1 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 26.9 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 26.9 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 26.7 | ||||
| LDTP01065 | E3 ubiquitin-protein ligase TRIM13 (TRIM13) | 26.2 | ||||
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 26.2 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 24.9 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 24.9 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 24.9 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 24.9 | ||||
| LDTP08532 | Inositol 1,4,5-trisphosphate receptor-interacting protein (ITPRIP) | 23.9 | ||||
| LDTP12639 | 1-acyl-sn-glycerol-3-phosphate acyltransferase epsilon (AGPAT5) | 23.8 | ||||
| LDTP08455 | Palmitoyltransferase ZDHHC13 (ZDHHC13) | 22.9 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 22.8 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 22.2 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 21.9 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 21.0 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 20.8 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 20.4 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 20.3 | ||||
| LDTP00462 | Branched-chain alpha-ketoacid dehydrogenase kinase (BCKDK) | 20.1 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 19.8 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 19.3 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 19.3 | ||||
| LDTP01219 | NADH dehydrogenase 1 beta subcomplex subunit 1 (NDUFB1) | 19.3 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 18.8 | ||||
| LDTP09031 | Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 (POMGNT2) | 18.5 | ||||
| LDTP01513 | NADH dehydrogenase 1 alpha subcomplex subunit 3 (NDUFA3) | 18.3 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 18.1 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 17.9 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 17.9 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 17.8 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 17.8 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 17.5 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 17.4 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 17.1 | ||||
| LDTP12420 | Xaa-Pro aminopeptidase 3 (XPNPEP3) | 17.0 | ||||
| LDTP03680 | DNA replication licensing factor MCM4 (MCM4) | 16.9 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 16.7 | ||||
| LDTP12960 | [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial (PDP1) | 16.7 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 16.6 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 16.1 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 15.9 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 15.9 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 15.5 | ||||
| LDTP10785 | Ubiquitin carboxyl-terminal hydrolase 28 (USP28) | 15.5 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 15.3 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 15.2 | ||||
| LDTP10981 | Mitochondrial intermediate peptidase (MIPEP) | 15.1 | ||||
| LDTP01502 | NADH dehydrogenase 1 beta subcomplex subunit 6 (NDUFB6) | 14.9 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 14.8 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 14.7 | ||||
| LDTP14264 | Choline/ethanolaminephosphotransferase 1 (CEPT1) | 14.5 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 14.5 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 14.5 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 14.5 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 14.4 | ||||
| LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 14.3 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 14.0 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 13.9 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 13.9 | ||||
| LDTP11199 | DCN1-like protein 5 (DCUN1D5) | 13.8 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 13.8 | ||||
| LDTP12415 | Adenosine 5'-monophosphoramidase HINT3 (HINT3) | 13.7 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 13.7 | ||||
| LDTP11852 | Presenilin-associated rhomboid-like protein, mitochondrial (PARL) | 13.6 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 13.5 | ||||
| LDTP00831 | NADH dehydrogenase 1 beta subcomplex subunit 5, mitochondrial (NDUFB5) | 13.5 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 13.5 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 13.5 | ||||
| LDTP07756 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2 (HACD2) | 13.4 | ||||
| LDTP00994 | Beta-1,4-galactosyltransferase 3 (B4GALT3) | 13.3 | ||||
| LDTP13491 | E3 ubiquitin-protein ligase AMFR (AMFR) | 13.3 | ||||
| LDTP12197 | Ethanolamine kinase 1 (ETNK1) | 13.3 | ||||
| LDTP04456 | Ubiquitin carboxyl-terminal hydrolase 11 (USP11) | 13.3 | ||||
| LDTP02589 | Cyclin-dependent kinase 4 (CDK4) | 13.2 | ||||
| LDTP00877 | Protein SCO2 homolog, mitochondrial (SCO2) | 13.2 | ||||
| LDTP12490 | Sphingosine kinase 2 (SPHK2) | 13.2 | ||||
| LDTP12470 | GTP-binding protein SAR1a (SAR1A) | 13.1 | ||||
| LDTP04531 | Hexokinase-2 (HK2) | 13.1 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 13.0 | ||||
| LDTP00758 | Thioredoxin-like protein 1 (TXNL1) | 13.0 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 13.0 | ||||
| LDTP06977 | GPI ethanolamine phosphate transferase 2 (PIGG) | 12.9 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 12.9 | ||||
| LDTP14189 | UbiA prenyltransferase domain-containing protein 1 (UBIAD1) | 12.8 | ||||
| LDTP03900 | ADP-ribosylation factor-like protein 1 (ARL1) | 12.7 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 12.7 | ||||
| LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 12.7 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 12.7 | ||||
| LDTP03608 | RAC-beta serine/threonine-protein kinase (AKT2) | 12.6 | ||||
| LDTP13154 | E3 ubiquitin-protein ligase RNF14 (RNF14) | 12.6 | ||||
| LDTP06501 | Ras-related protein Rab-11B (RAB11B) | 12.5 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 12.4 | ||||
| LDTP12908 | Ubiquinone biosynthesis O-methyltransferase, mitochondrial (COQ3) | 12.4 | ||||
| LDTP01743 | NADH dehydrogenase 1 beta subcomplex subunit 10 (NDUFB10) | 12.3 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 12.3 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 12.3 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 12.2 | ||||
| LDTP17305 | Glycosyltransferase 8 domain-containing protein 1 (GLT8D1) | 12.2 | ||||
| LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 12.2 | ||||
| LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 12.1 | ||||
| LDTP08082 | L-xylulose reductase (DCXR) | 12.1 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 12.1 | ||||
| LDTP05724 | Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial (ECH1) | 12.0 | ||||
| LDTP08323 | Lon protease homolog 2, peroxisomal (LONP2) | 12.0 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 12.0 | ||||
| LDTP05920 | Calcium/calmodulin-dependent protein kinase type II subunit gamma (CAMK2G) | 11.9 | ||||
| LDTP04569 | Geranylgeranyl transferase type-2 subunit beta (RABGGTB) | 11.9 | ||||
| LDTP00497 | Cyclin-G-associated kinase (GAK) | 11.8 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 11.7 | ||||
| LDTP10320 | tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A (TRMT61A) | 11.7 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 11.6 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 99.7 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 99.7 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 83.3 | ||||
| LDTP11927 | Essential MCU regulator, mitochondrial (SMDT1) | 79.9 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 78.2 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 73.0 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 66.7 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 64.0 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 64.0 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 48.2 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 46.9 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 46.5 | ||||
| LDTP05305 | Large neutral amino acids transporter small subunit 1 (SLC7A5) | 45.9 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 41.6 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 39.4 | ||||
| LDTP03546 | Translocator protein (TSPO) | 39.4 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 39.1 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 35.3 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 35.3 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 33.6 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 33.1 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 32.2 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 30.5 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 29.9 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 29.7 | ||||
| LDTP17682 | Zinc transporter ZIP11 (SLC39A11) | 29.7 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 29.2 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 28.8 | ||||
| LDTP08981 | Cytochrome c oxidase assembly protein COX18, mitochondrial (COX18) | 28.6 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 27.7 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 27.3 | ||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | 27.3 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 25.5 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 24.9 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 24.8 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 24.6 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 24.1 | ||||
| LDTP08279 | Mitochondrial coenzyme A transporter SLC25A42 (SLC25A42) | 22.3 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 22.0 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 21.6 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 21.0 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 20.4 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 20.4 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 20.0 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 20.0 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 19.8 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 19.7 | ||||
| LDTP04707 | Protein SEC13 homolog (SEC13) | 19.6 | ||||
| LDTP15733 | Solute carrier family 25 member 44 (SLC25A44) | 19.4 | ||||
| LDTP02256 | Amino acid transporter heavy chain SLC3A2 (SLC3A2) | 19.3 | ||||
| LDTP09278 | Multiple coagulation factor deficiency protein 2 (MCFD2) | 19.0 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 18.8 | ||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 18.1 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 17.9 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 17.9 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 17.8 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 17.0 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 17.0 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 16.8 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 16.7 | ||||
| LDTP00208 | AP-4 complex subunit mu-1 (AP4M1) | 16.6 | ||||
| LDTP14682 | Translocon-associated protein subunit beta (SSR2) | 16.6 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 16.0 | ||||
| LDTP06275 | Lysosomal-associated transmembrane protein 4A (LAPTM4A) | 15.9 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 15.9 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 15.8 | ||||
| LDTP01060 | PRA1 family protein 2 (PRAF2) | 15.5 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 15.5 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 15.3 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 15.2 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 15.2 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 15.2 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 14.9 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 14.9 | ||||
| LDTP14717 | ATP synthase subunit e, mitochondrial (ATP5ME) | 14.8 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 14.8 | ||||
| LDTP11812 | Protein ARV1 (ARV1) | 14.6 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 14.5 | ||||
| LDTP10343 | Vacuole membrane protein 1 (VMP1) | 14.4 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 14.3 | ||||
| LDTP12636 | Lysosomal cobalamin transport escort protein LMBD1 (LMBRD1) | 14.3 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 14.3 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 14.2 | ||||
| LDTP09515 | Importin-4 (IPO4) | 14.0 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 14.0 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 13.9 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 13.9 | ||||
| LDTP08469 | Complex I assembly factor TMEM126B, mitochondrial (TMEM126B) | 13.7 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 13.7 | ||||
| LDTP05662 | Cell division cycle protein 20 homolog (CDC20) | 13.6 | ||||
| LDTP01056 | Coiled-coil domain-containing protein 22 (CCDC22) | 13.5 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 13.4 | ||||
| LDTP12738 | Ceroid-lipofuscinosis neuronal protein 6 (CLN6) | 13.3 | ||||
| LDTP03104 | V-type proton ATPase subunit B, brain isoform (ATP6V1B2) | 13.3 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 13.0 | ||||
| LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 12.7 | ||||
| LDTP13661 | Sorting nexin-6 (SNX6) | 12.7 | ||||
| LDTP02215 | Prosaposin (PSAP) | 12.5 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 12.4 | ||||
| LDTP07439 | Mitochondrial adenyl nucleotide antiporter SLC25A25 (SLC25A25) | 12.2 | ||||
| LDTP05236 | Phosphatidylinositol transfer protein alpha isoform (PITPNA) | 12.1 | ||||
| LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 12.0 | ||||
| LDTP01309 | Renin receptor (ATP6AP2) | 12.0 | ||||
| LDTP09202 | Nucleoporin Nup43 (NUP43) | 12.0 | ||||
| LDTP13943 | Thioredoxin-related transmembrane protein 2 (TMX2) | 12.0 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 12.0 | ||||
| LDTP15979 | Transmembrane protein 245 (TMEM245) | 12.0 | ||||
| LDTP00010 | Intraflagellar transport protein 56 (IFT56) | 11.7 | ||||
| LDTP09203 | Nucleoporin Nup37 (NUP37) | 11.7 | ||||
| LDTP10754 | Pannexin-1 (PANX1) | 11.7 | ||||
| LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 11.6 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 20.0 | ||||
GPCR
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15303 | Membrane progestin receptor alpha (PAQR7) | 28.6 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03538 | HLA class I histocompatibility antigen, alpha chain F (HLA-F) | 26.7 | ||||
| LDTP14205 | Neuroplastin (NPTN) | 18.1 | ||||
| LDTP03772 | Basigin (BSG) | 15.6 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 99.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 99.7 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 99.7 | ||||
| LDTP15634 | Ubiquinol-cytochrome c reductase complex assembly factor 5 (UQCC5) | 92.4 | ||||
| LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 79.9 | ||||
| LDTP19859 | Small integral membrane protein 12 (SMIM12) | 76.6 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 70.0 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 67.6 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 54.2 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 49.9 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 47.8 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 45.3 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 43.7 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 41.4 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 40.5 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 39.7 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 37.5 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 37.5 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 36.8 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 36.0 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 33.8 | ||||
| LDTP09297 | Large ribosomal subunit protein mL64 (GADD45GIP1) | 33.6 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 33.1 | ||||
| LDTP03175 | Galanin peptides (GAL) | 32.7 | ||||
| LDTP18569 | PRELI domain containing protein 3B (PRELID3B) | 30.5 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 29.2 | ||||
| LDTP08000 | Dymeclin (DYM) | 28.2 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 28.1 | ||||
| LDTP14939 | Membralin (TMEM259) | 27.5 | ||||
| LDTP15095 | Receptor expression-enhancing protein 3 (REEP3) | 27.3 | ||||
| LDTP11210 | Transmembrane protein 43 (TMEM43) | 27.3 | ||||
| LDTP06948 | Protein YIF1B (YIF1B) | 26.4 | ||||
| LDTP15110 | Protein C3orf33 (C3orf33) | 26.0 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 26.0 | ||||
| LDTP13797 | HIG1 domain family member 1A, mitochondrial (HIGD1A) | 25.8 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 24.6 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 24.3 | ||||
| LDTP11143 | Centromere protein K (CENPK) | 23.9 | ||||
| LDTP14618 | Protein PET100 homolog, mitochondrial (PET100) | 23.9 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 23.6 | ||||
| LDTP08796 | Protein SYS1 homolog (SYS1) | 23.3 | ||||
| LDTP11670 | Mitochondrial fission factor (MFF) | 22.8 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 22.5 | ||||
| LDTP08606 | Nurim (NRM) | 22.5 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 22.2 | ||||
| LDTP16107 | TBC1 domain family member 13 (TBC1D13) | 22.0 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 22.0 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 21.9 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 21.3 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 21.0 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 20.5 | ||||
| LDTP14716 | ATP synthase subunit ATP5MJ, mitochondrial (ATP5MJ) | 20.3 | ||||
| LDTP17580 | FHF complex subunit HOOK-interacting protein 2B (FHIP2B) | 20.3 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 19.3 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 19.3 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 19.2 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 19.0 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 18.8 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 18.6 | ||||
| LDTP19785 | Transmembrane protein 35B (TMEM35B) | 18.4 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 18.1 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 17.8 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 17.5 | ||||
| LDTP09773 | Protein FAM3C (FAM3C) | 17.1 | ||||
| LDTP17003 | Matrix-remodeling-associated protein 7 (MXRA7) | 17.0 | ||||
| LDTP11113 | Receptor expression-enhancing protein 2 (REEP2) | 16.9 | ||||
| LDTP15333 | Trafficking protein particle complex subunit 5 (TRAPPC5) | 16.9 | ||||
| LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | 16.7 | ||||
| LDTP05715 | Vesicle transport protein SEC20 (BNIP1) | 16.4 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 16.3 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 16.3 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 16.1 | ||||
| LDTP06808 | Vacuolar ATPase assembly integral membrane protein VMA21 (VMA21) | 16.1 | ||||
| LDTP01938 | Apolipoprotein C-I (APOC1) | 16.0 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 16.0 | ||||
| LDTP11883 | Centromere protein H (CENPH) | 15.6 | ||||
| LDTP10184 | HAUS augmin-like complex subunit 1 (HAUS1) | 15.5 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 15.5 | ||||
| LDTP14259 | Testis-expressed protein 264 (TEX264) | 15.5 | ||||
| LDTP19472 | Protein NCBP2AS2 (NCBP2AS2) | 15.3 | ||||
| LDTP13125 | Protein UXT (UXT) | 15.3 | ||||
| LDTP04703 | Tumor protein D52 (TPD52) | 15.2 | ||||
| LDTP10924 | Prohibitin-2 (PHB2) | 15.0 | ||||
| LDTP10442 | Thioredoxin domain-containing protein 15 (TXNDC15) | 15.0 | ||||
| LDTP02297 | Vimentin (VIM) | 15.0 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 14.9 | ||||
| LDTP15741 | Cytochrome c oxidase assembly protein COX14 (COX14) | 14.8 | ||||
| LDTP00729 | Glycosylphosphatidylinositol anchor attachment 1 protein (GPAA1) | 14.8 | ||||
| LDTP05530 | Induced myeloid leukemia cell differentiation protein Mcl-1 (MCL1) | 14.8 | ||||
| LDTP10567 | Regulator of microtubule dynamics protein 2 (RMDN2) | 14.8 | ||||
| LDTP11326 | FUN14 domain-containing protein 2 (FUNDC2) | 14.5 | ||||
| LDTP16322 | Mitochondrial import inner membrane translocase subunit Tim8 B (TIMM8B) | 14.2 | ||||
| LDTP10116 | Lipid droplet assembly factor 1 (LDAF1) | 14.1 | ||||
| LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 14.0 | ||||
| LDTP01075 | Protein CutA (CUTA) | 13.7 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 13.5 | ||||
| LDTP05277 | Protein SET (SET) | 13.5 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 13.3 | ||||
| LDTP08509 | FUN14 domain-containing protein 1 (FUNDC1) | 13.2 | ||||
| LDTP12982 | Mitochondrial import receptor subunit TOM7 homolog (TOMM7) | 13.1 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 13.0 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 13.0 | ||||
| LDTP15434 | ADP-ribosylation factor-like protein 6-interacting protein 6 (ARL6IP6) | 12.8 | ||||
| LDTP13967 | Transmembrane emp24 domain-containing protein 5 (TMED5) | 12.8 | ||||
| LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 12.7 | ||||
| LDTP15253 | HEAT repeat-containing protein 3 (HEATR3) | 12.6 | ||||
| LDTP02180 | Neurofilament light polypeptide (NEFL) | 12.6 | ||||
| LDTP16250 | Translocon-associated protein subunit gamma (SSR3) | 12.6 | ||||
| LDTP08094 | Wings apart-like protein homolog (WAPL) | 12.6 | ||||
| LDTP02181 | Neurofilament medium polypeptide (NEFM) | 12.6 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 12.6 | ||||
| LDTP15240 | LysM and putative peptidoglycan-binding domain-containing protein 3 (LYSMD3) | 12.4 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 12.1 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 12.1 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 11.9 | ||||
| LDTP04111 | Small ribosomal subunit protein eS10 (RPS10) | 11.9 | ||||
| LDTP20361 | Coiled-coil domain-containing protein 127 (CCDC127) | 11.8 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 11.8 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 11.6 | ||||
| LDTP07508 | Polyamine-modulated factor 1 (PMF1) | 11.6 | ||||
