Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C246 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 99.7 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 79.3 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 54.6 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 52.0 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 50.2 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 45.6 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 44.6 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 42.2 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 41.6 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 40.8 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 39.9 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 39.9 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 38.9 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 37.8 | ||||
| LDTP00325 | Pirin (PIR) | 36.5 | ||||
| LDTP07831 | Transmembrane protein with metallophosphoesterase domain (TMPPE) | 36.5 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 35.5 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 35.0 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 33.8 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 33.8 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 31.1 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 30.1 | ||||
| LDTP06986 | Rab-like protein 3 (RABL3) | 29.7 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 29.4 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 29.2 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 29.0 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 28.8 | ||||
| LDTP02922 | CTP synthase 1 (CTPS1) | 28.6 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 28.2 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 27.9 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 26.9 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 26.2 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 26.0 | ||||
| LDTP01065 | E3 ubiquitin-protein ligase TRIM13 (TRIM13) | 25.8 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 25.6 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 25.6 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 25.5 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 25.3 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 24.8 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 24.6 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 23.9 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 23.8 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 23.8 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 23.4 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 22.9 | ||||
| LDTP08455 | Palmitoyltransferase ZDHHC13 (ZDHHC13) | 22.2 | ||||
| LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 22.2 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 21.9 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 21.9 | ||||
| LDTP01389 | Delta(14)-sterol reductase TM7SF2 (TM7SF2) | 21.7 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 21.7 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 21.0 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 20.8 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 20.7 | ||||
| LDTP01649 | Phosphatidate cytidylyltransferase 2 (CDS2) | 19.8 | ||||
| LDTP10177 | Medium-chain acyl-CoA ligase ACSF2, mitochondrial (ACSF2) | 19.3 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 19.0 | ||||
| LDTP05638 | CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 4 (ST3GAL4) | 18.9 | ||||
| LDTP04531 | Hexokinase-2 (HK2) | 18.8 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 18.8 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 18.8 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 18.6 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 18.4 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 18.4 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 18.1 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 17.9 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 17.8 | ||||
| LDTP09061 | Retinol dehydrogenase 13 (RDH13) | 17.6 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 17.5 | ||||
| LDTP13352 | GTP:AMP phosphotransferase AK3, mitochondrial (AK3) | 17.5 | ||||
| LDTP10930 | Membrane-associated tyrosine- and threonine-specific cdc2-inhibitory kinase (PKMYT1) | 17.4 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 17.1 | ||||
| LDTP01560 | NADH dehydrogenase 1 subunit C2 (NDUFC2) | 17.0 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 16.9 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 16.7 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 16.7 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 16.4 | ||||
| LDTP03779 | Copper-transporting ATPase 2 (ATP7B) | 16.4 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 16.4 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 16.3 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 16.3 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 16.3 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 16.2 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 16.2 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 16.0 | ||||
| LDTP14189 | UbiA prenyltransferase domain-containing protein 1 (UBIAD1) | 15.9 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 15.8 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 15.8 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 15.7 | ||||
| LDTP04358 | Carnitine O-palmitoyltransferase 1, liver isoform (CPT1A) | 15.5 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 15.5 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 15.1 | ||||
| LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | 15.1 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 15.0 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 14.9 | ||||
| LDTP15962 | Protein-L-histidine N-pros-methyltransferase (METTL9) | 14.9 | ||||
| LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 14.8 | ||||
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 14.8 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 14.8 | ||||
| LDTP11081 | NAD-capped RNA hydrolase NUDT12 (NUDT12) | 14.6 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 14.5 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 14.4 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 14.4 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 14.3 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 14.3 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 14.3 | ||||
| LDTP12056 | Thiol S-methyltransferase TMT1A (TMT1A) | 14.3 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 14.2 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 14.2 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 14.0 | ||||
| LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 13.9 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 13.9 | ||||
| LDTP05958 | Ras-related protein Rab-32 (RAB32) | 13.9 | ||||
| LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 13.8 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 13.8 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 13.7 | ||||
| LDTP07813 | Sulfhydryl oxidase 2 (QSOX2) | 13.7 | ||||
| LDTP10318 | Ubiquitin thioesterase OTUB1 (OTUB1) | 13.6 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 13.5 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 13.3 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 13.3 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 13.2 | ||||
| LDTP07591 | Neutral cholesterol ester hydrolase 1 (NCEH1) | 13.2 | ||||
| LDTP13986 | Vesicle transport protein GOT1B (GOLT1B) | 13.2 | ||||
| LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 13.1 | ||||
| LDTP09835 | GPI-anchor transamidase (PIGK) | 13.1 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 13.0 | ||||
| LDTP12318 | Calcium-independent phospholipase A2-gamma (PNPLA8) | 13.0 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 12.9 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 12.8 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 12.8 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 12.7 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 12.7 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 12.5 | ||||
| LDTP11319 | Threonine--tRNA ligase, mitochondrial (TARS2) | 12.5 | ||||
| LDTP13675 | COP9 signalosome complex subunit 3 (COPS3) | 12.4 | ||||
| LDTP07158 | Integrator complex subunit 11 (INTS11) | 12.4 | ||||
| LDTP11209 | Phosphatidylinositol 4-kinase type 2-alpha (PI4K2A) | 12.4 | ||||
| LDTP11723 | Cytosolic 5'-nucleotidase 3A (NT5C3A) | 12.3 | ||||
| LDTP12763 | Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase (BPNT2) | 12.3 | ||||
| LDTP12470 | GTP-binding protein SAR1a (SAR1A) | 12.3 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 12.2 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 88.6 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 66.3 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 64.4 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 57.7 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 57.3 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 55.7 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 55.7 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 53.4 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 52.3 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 52.0 | ||||
| LDTP10036 | BOS complex subunit NCLN (NCLN) | 48.2 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 48.2 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 47.2 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 44.3 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 43.1 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 42.8 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 41.9 | ||||
| LDTP04956 | Mitochondrial import inner membrane translocase subunit Tim10 (TIMM10) | 40.8 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 39.4 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 38.9 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 38.6 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 38.1 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 36.0 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 32.7 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 31.8 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 31.1 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 30.1 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 29.4 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 27.3 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 26.4 | ||||
| LDTP01455 | Erlin-2 (ERLIN2) | 24.9 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 24.9 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 24.8 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 24.8 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 24.6 | ||||
| LDTP09294 | Proton-coupled zinc antiporter SLC30A5 (SLC30A5) | 24.4 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 24.4 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 24.3 | ||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 23.6 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 23.4 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 22.6 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 22.6 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 22.3 | ||||
| LDTP02215 | Prosaposin (PSAP) | 22.3 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 22.2 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 22.0 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 21.6 | ||||
| LDTP01234 | Erlin-1 (ERLIN1) | 21.0 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 20.7 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 20.7 | ||||
| LDTP04501 | Importin subunit alpha-1 (KPNA2) | 20.4 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 19.8 | ||||
| LDTP01380 | Wolframin (WFS1) | 19.8 | ||||
| LDTP07467 | Rhomboid domain-containing protein 2 (RHBDD2) | 19.7 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 19.4 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 19.3 | ||||
| LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 18.6 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 18.4 | ||||
| LDTP15979 | Transmembrane protein 245 (TMEM245) | 18.4 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 18.3 | ||||
| LDTP14181 | Peroxisomal membrane protein PEX16 (PEX16) | 18.1 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 18.1 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 18.0 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 17.8 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 17.5 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 17.5 | ||||
| LDTP04787 | Transmembrane protein 33 (TMEM33) | 17.5 | ||||
| LDTP00882 | Glucose-6-phosphate exchanger SLC37A4 (SLC37A4) | 17.4 | ||||
| LDTP01180 | Programmed cell death protein 6 (PDCD6) | 17.4 | ||||
| LDTP04237 | Protein ERGIC-53 (LMAN1) | 17.1 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 16.8 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 16.7 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 16.7 | ||||
| LDTP01060 | PRA1 family protein 2 (PRAF2) | 16.6 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 16.3 | ||||
| LDTP12191 | Vezatin (VEZT) | 16.3 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 15.8 | ||||
| LDTP07058 | Transmembrane protein 201 (TMEM201) | 15.1 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 15.0 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 15.0 | ||||
| LDTP05667 | Syntaxin-4 (STX4) | 15.0 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 14.8 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 14.8 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 14.7 | ||||
| LDTP08030 | Autophagy-related protein 9A (ATG9A) | 14.6 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 14.6 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 14.5 | ||||
| LDTP08279 | Mitochondrial coenzyme A transporter SLC25A42 (SLC25A42) | 14.5 | ||||
| LDTP10931 | Succinate dehydrogenase cytochrome b560 subunit, mitochondrial (SDHC) | 14.5 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 14.5 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 14.4 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 14.4 | ||||
| LDTP07610 | Proton-coupled zinc antiporter SLC30A9, mitochondrial (SLC30A9) | 14.2 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 14.1 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 14.1 | ||||
| LDTP13943 | Thioredoxin-related transmembrane protein 2 (TMX2) | 14.1 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 13.9 | ||||
| LDTP00010 | Intraflagellar transport protein 56 (IFT56) | 13.9 | ||||
| LDTP02544 | Solute carrier family 2, facilitated glucose transporter member 1 (SLC2A1) | 13.9 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 13.7 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 13.5 | ||||
| LDTP10081 | Leucine-rich repeat-containing protein 59 (LRRC59) | 13.3 | ||||
| LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | 13.2 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 13.2 | ||||
| LDTP13393 | Electrogenic aspartate/glutamate antiporter SLC25A13, mitochondrial (SLC25A13) | 13.1 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 13.1 | ||||
| LDTP07583 | Transmembrane protein 65 (TMEM65) | 13.1 | ||||
| LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 13.0 | ||||
| LDTP13320 | Prenylated Rab acceptor protein 1 (RABAC1) | 12.9 | ||||
| LDTP13256 | SUN domain-containing protein 2 (SUN2) | 12.8 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 12.6 | ||||
| LDTP00872 | Peroxisomal membrane protein PMP34 (SLC25A17) | 12.6 | ||||
| LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 12.5 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 12.5 | ||||
| LDTP13953 | Endophilin-B1 (SH3GLB1) | 12.4 | ||||
| LDTP07477 | Transmembrane protein 214 (TMEM214) | 12.4 | ||||
| LDTP01601 | Activator of 90 kDa heat shock protein ATPase homolog 1 (AHSA1) | 12.2 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP06415 | Transcriptional enhancer factor TEF-3 (TEAD4) | 44.6 | ||||
| LDTP09694 | Paraspeckle component 1 (PSPC1) | 18.1 | ||||
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 16.0 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | 18.1 | ||||
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 16.3 | ||||
| LDTP11441 | Cell adhesion molecule 1 (CADM1) | 12.6 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11076 | Apolipoprotein L2 (APOL2) | 99.7 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 83.9 | ||||
| LDTP14939 | Membralin (TMEM259) | 78.2 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 76.6 | ||||
| LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 61.4 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 55.3 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 53.1 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 52.7 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 52.7 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 49.2 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 45.3 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 45.3 | ||||
| LDTP08796 | Protein SYS1 homolog (SYS1) | 44.6 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 41.4 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 41.4 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 41.1 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 39.9 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 39.7 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 37.5 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 36.5 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 35.5 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 34.3 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 34.1 | ||||
| LDTP15240 | LysM and putative peptidoglycan-binding domain-containing protein 3 (LYSMD3) | 32.7 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 31.3 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 28.4 | ||||
| LDTP12982 | Mitochondrial import receptor subunit TOM7 homolog (TOMM7) | 27.7 | ||||
| LDTP19785 | Transmembrane protein 35B (TMEM35B) | 26.9 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 26.5 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 25.6 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 23.6 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 23.1 | ||||
| LDTP15095 | Receptor expression-enhancing protein 3 (REEP3) | 23.1 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 22.3 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 22.2 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 22.2 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 21.6 | ||||
| LDTP15887 | Lipase maturation factor 2 (LMF2) | 20.1 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 19.8 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 19.7 | ||||
| LDTP05277 | Protein SET (SET) | 19.7 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 19.4 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 19.0 | ||||
| LDTP09870 | Signal transducing adapter molecule 1 (STAM) | 19.0 | ||||
| LDTP17003 | Matrix-remodeling-associated protein 7 (MXRA7) | 18.9 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 18.9 | ||||
| LDTP13797 | HIG1 domain family member 1A, mitochondrial (HIGD1A) | 18.5 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 18.5 | ||||
| LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 18.3 | ||||
| LDTP13954 | Complex I intermediate-associated protein 30, mitochondrial (NDUFAF1) | 17.5 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 17.3 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 16.7 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 16.7 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 16.4 | ||||
| LDTP16116 | BSD domain-containing protein 1 (BSDC1) | 16.3 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 16.2 | ||||
| LDTP11906 | Phosphatidylinositol glycan anchor biosynthesis class U protein (PIGU) | 16.2 | ||||
| LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | 16.1 | ||||
| LDTP00729 | Glycosylphosphatidylinositol anchor attachment 1 protein (GPAA1) | 15.8 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 15.7 | ||||
| LDTP06948 | Protein YIF1B (YIF1B) | 15.6 | ||||
| LDTP08606 | Nurim (NRM) | 15.5 | ||||
| LDTP05257 | Receptor expression-enhancing protein 5 (REEP5) | 15.3 | ||||
| LDTP14126 | Mitochondrial import inner membrane translocase subunit Tim9 (TIMM9) | 15.0 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 14.9 | ||||
| LDTP08300 | Reticulophagy regulator 3 (RETREG3) | 14.8 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 14.7 | ||||
| LDTP14259 | Testis-expressed protein 264 (TEX264) | 14.7 | ||||
| LDTP02180 | Neurofilament light polypeptide (NEFL) | 14.2 | ||||
| LDTP07718 | MICOS complex subunit MIC27 (APOOL) | 13.9 | ||||
| LDTP18569 | PRELI domain containing protein 3B (PRELID3B) | 13.7 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 13.6 | ||||
| LDTP00779 | Trans-Golgi network integral membrane protein 2 (TGOLN2) | 13.6 | ||||
| LDTP06868 | Angiomotin (AMOT) | 13.5 | ||||
| LDTP10275 | Mitochondrial potassium channel (CCDC51) | 13.5 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 13.5 | ||||
| LDTP16107 | TBC1 domain family member 13 (TBC1D13) | 13.5 | ||||
| LDTP12677 | DnaJ homolog subfamily C member 11 (DNAJC11) | 13.4 | ||||
| LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 13.4 | ||||
| LDTP06587 | Survival motor neuron protein (SMN1; SMN2) | 13.4 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 13.3 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 13.2 | ||||
| LDTP07318 | HAUS augmin-like complex subunit 3 (HAUS3) | 13.2 | ||||
| LDTP15793 | Protein FAM210A (FAM210A) | 13.2 | ||||
| LDTP10357 | RUS family member 1 (RUSF1) | 13.2 | ||||
| LDTP10924 | Prohibitin-2 (PHB2) | 13.0 | ||||
| LDTP08248 | NLR family member X1 (NLRX1) | 12.9 | ||||
| LDTP00871 | Microtubule nucleation factor SSNA1 (SSNA1) | 12.7 | ||||
| LDTP11113 | Receptor expression-enhancing protein 2 (REEP2) | 12.7 | ||||
| LDTP02297 | Vimentin (VIM) | 12.6 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 12.4 | ||||
| LDTP12379 | Complex I assembly factor TIMMDC1, mitochondrial (TIMMDC1) | 12.4 | ||||
| LDTP11326 | FUN14 domain-containing protein 2 (FUNDC2) | 12.4 | ||||
| LDTP00632 | Syntaxin-7 (STX7) | 12.4 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 12.3 | ||||
| LDTP10046 | Endoplasmic reticulum-Golgi intermediate compartment protein 1 (ERGIC1) | 12.3 | ||||
| LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | 12.2 | ||||
| LDTP08320 | Ankyrin repeat domain-containing protein 46 (ANKRD46) | 12.2 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 12.2 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 12.2 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 12.2 | ||||
