Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C355 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 99.7 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 99.7 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 99.7 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 99.7 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 94.4 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 91.1 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 88.6 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 84.4 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 76.1 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 75.1 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 74.0 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 69.6 | ||||
| LDTP04569 | Geranylgeranyl transferase type-2 subunit beta (RABGGTB) | 66.3 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 66.3 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 64.4 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 64.0 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 62.2 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 61.8 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 57.3 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 54.2 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 52.3 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 49.2 | ||||
| LDTP12687 | Guanine nucleotide-binding protein-like 3-like protein (GNL3L) | 48.5 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 45.9 | ||||
| LDTP12293 | Adipocyte plasma membrane-associated protein (APMAP) | 44.0 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 43.7 | ||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 43.1 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 41.9 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 41.6 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 41.1 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 40.5 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 40.2 | ||||
| LDTP12197 | Ethanolamine kinase 1 (ETNK1) | 40.2 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 40.2 | ||||
| LDTP11336 | Chitinase domain-containing protein 1 (CHID1) | 39.9 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 39.9 | ||||
| LDTP01515 | NADH dehydrogenase 1 beta subcomplex subunit 8, mitochondrial (NDUFB8) | 39.7 | ||||
| LDTP14189 | UbiA prenyltransferase domain-containing protein 1 (UBIAD1) | 39.4 | ||||
| LDTP12886 | Glycerophosphodiester phosphodiesterase 1 (GDE1) | 39.1 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 38.9 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 38.6 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 37.8 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 36.5 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 36.3 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 36.0 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 35.8 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 35.0 | ||||
| LDTP08017 | Endoplasmic reticulum metallopeptidase 1 (ERMP1) | 34.8 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 34.5 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 34.3 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 34.1 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 32.9 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 32.7 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 32.2 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 32.2 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 32.0 | ||||
| LDTP05228 | Calcium-transporting ATPase type 2C member 1 (ATP2C1) | 32.0 | ||||
| LDTP05724 | Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial (ECH1) | 31.6 | ||||
| LDTP10530 | Beta-1,3-galactosyltransferase 6 (B3GALT6) | 31.3 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 31.3 | ||||
| LDTP01389 | Delta(14)-sterol reductase TM7SF2 (TM7SF2) | 30.7 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 30.7 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 30.7 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 30.3 | ||||
| LDTP00544 | Sphingolipid delta(4)-desaturase DES1 (DEGS1) | 30.3 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 30.1 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 30.1 | ||||
| LDTP09620 | Soluble calcium-activated nucleotidase 1 (CANT1) | 30.1 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 30.1 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 29.9 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 29.7 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 29.4 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 29.4 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 29.4 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 28.8 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 28.8 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 28.6 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 28.6 | ||||
| LDTP02757 | Cytochrome b-c1 complex subunit 7 (UQCRB) | 28.4 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 28.2 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 28.2 | ||||
| LDTP09074 | UDP-glucuronic acid decarboxylase 1 (UXS1) | 28.2 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 27.9 | ||||
| LDTP06810 | Mitochondrial import inner membrane translocase subunit TIM50 (TIMM50) | 27.9 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 27.9 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 27.7 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 27.5 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 27.5 | ||||
| LDTP11225 | Deoxyhypusine hydroxylase (DOHH) | 27.5 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 27.5 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 27.5 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 27.5 | ||||
| LDTP15097 | All-trans-retinol 13,14-reductase (RETSAT) | 27.3 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 27.3 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 27.3 | ||||
| LDTP03680 | DNA replication licensing factor MCM4 (MCM4) | 27.1 | ||||
| LDTP12109 | Ribitol 5-phosphate transferase FKRP (FKRP) | 27.1 | ||||
| LDTP09628 | Fatty acyl-CoA reductase 1 (FAR1) | 26.9 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 26.4 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 26.2 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 26.2 | ||||
| LDTP05622 | Alpha-1,6-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase (MGAT2) | 26.0 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 25.8 | ||||
| LDTP02216 | Beta-hexosaminidase subunit beta (HEXB) | 25.6 | ||||
| LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 25.6 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 25.6 | ||||
| LDTP03858 | Lysosomal acid lipase/cholesteryl ester hydrolase (LIPA) | 25.6 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 25.5 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 25.3 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 25.3 | ||||
| LDTP04438 | Succinate-semialdehyde dehydrogenase, mitochondrial (ALDH5A1) | 25.1 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 24.8 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 24.8 | ||||
| LDTP07109 | ATP-binding cassette sub-family C member 10 (ABCC10) | 24.6 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 24.6 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 24.3 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 24.3 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 24.1 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 23.8 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 23.8 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 23.8 | ||||
| LDTP08933 | Chondroitin sulfate N-acetylgalactosaminyltransferase 2 (CSGALNACT2) | 23.6 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 23.4 | ||||
| LDTP01329 | Lathosterol oxidase (SC5D) | 23.4 | ||||
| LDTP14427 | Cytochrome c oxidase subunit 7A-related protein, mitochondrial (COX7A2L) | 23.1 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 23.1 | ||||
| LDTP02000 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase (HMGCR) | 22.9 | ||||
| LDTP02150 | ATP synthase subunit beta, mitochondrial (ATP5F1B) | 22.9 | ||||
| LDTP12154 | MYG1 exonuclease (MYG1) | 22.9 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 22.9 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 22.9 | ||||
| LDTP03779 | Copper-transporting ATPase 2 (ATP7B) | 22.8 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 22.6 | ||||
| LDTP01372 | Carboxypeptidase D (CPD) | 22.6 | ||||
| LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 22.6 | ||||
| LDTP01419 | Retinal dehydrogenase 2 (ALDH1A2) | 22.6 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 22.5 | ||||
| LDTP00598 | Serine palmitoyltransferase 2 (SPTLC2) | 22.5 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 22.5 | ||||
| LDTP10785 | Ubiquitin carboxyl-terminal hydrolase 28 (USP28) | 22.5 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 22.2 | ||||
| LDTP00831 | NADH dehydrogenase 1 beta subcomplex subunit 5, mitochondrial (NDUFB5) | 22.2 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 99.7 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 99.7 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 99.7 | ||||
| LDTP02215 | Prosaposin (PSAP) | 88.0 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 87.4 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 85.0 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 83.9 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 81.0 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 78.8 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 77.2 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 74.5 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 73.0 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 58.1 | ||||
| LDTP06633 | Reticulon-1 (RTN1) | 56.9 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 56.9 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 56.5 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 56.5 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 49.5 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 49.2 | ||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | 45.6 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 44.3 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 43.7 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 42.8 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 42.5 | ||||
| LDTP14178 | Heme transporter FLVCR1 (FLVCR1) | 41.1 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 39.1 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 38.3 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 37.0 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 37.0 | ||||
| LDTP00208 | AP-4 complex subunit mu-1 (AP4M1) | 36.3 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 36.0 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 36.0 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 34.3 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 33.6 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 33.1 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 32.9 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 32.9 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 32.4 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 32.4 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 32.2 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 31.3 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 31.3 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 31.3 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 31.1 | ||||
| LDTP13256 | SUN domain-containing protein 2 (SUN2) | 30.7 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 30.5 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 30.3 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 30.1 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 29.9 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 29.7 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 28.6 | ||||
| LDTP03546 | Translocator protein (TSPO) | 28.2 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 28.1 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 27.3 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 27.1 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 26.9 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 26.9 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 26.7 | ||||
| LDTP08673 | Calcium uptake protein 2, mitochondrial (MICU2) | 25.8 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 25.8 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 25.8 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 25.8 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 25.5 | ||||
| LDTP15064 | G-protein coupled receptor-associated protein LMBRD2 (LMBRD2) | 25.3 | ||||
| LDTP11634 | Derlin-2 (DERL2) | 25.1 | ||||
| LDTP07397 | THO complex subunit 7 homolog (THOC7) | 24.9 | ||||
| LDTP14717 | ATP synthase subunit e, mitochondrial (ATP5ME) | 24.6 | ||||
| LDTP03064 | Cytochrome c oxidase subunit 5A, mitochondrial (COX5A) | 24.6 | ||||
| LDTP04749 | Peroxisomal biogenesis factor 3 (PEX3) | 24.4 | ||||
| LDTP13320 | Prenylated Rab acceptor protein 1 (RABAC1) | 24.4 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 24.4 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 24.3 | ||||
| LDTP08030 | Autophagy-related protein 9A (ATG9A) | 23.9 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 23.9 | ||||
| LDTP02057 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 (RPN1) | 23.3 | ||||
| LDTP06581 | Occludin (OCLN) | 23.1 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 23.1 | ||||
| LDTP01309 | Renin receptor (ATP6AP2) | 23.1 | ||||
| LDTP04426 | B-cell receptor-associated protein 31 (BCAP31) | 22.9 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 22.9 | ||||
| LDTP14174 | Sorting nexin-5 (SNX5) | 22.8 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 22.6 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 22.3 | ||||
| LDTP03810 | ATP synthase subunit gamma, mitochondrial (ATP5F1C) | 22.2 | ||||
| LDTP01748 | Mitochondrial import receptor subunit TOM40 homolog (TOMM40) | 22.2 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 29.0 | ||||
| LDTP05235 | Transcription factor A, mitochondrial (TFAM) | 22.3 | ||||
GPCR
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15303 | Membrane progestin receptor alpha (PAQR7) | 54.2 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 99.7 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 99.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 99.7 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 99.7 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 70.5 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 69.1 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 61.8 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 55.7 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 52.7 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 51.3 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 49.9 | ||||
| LDTP06154 | Desmocollin-3 (DSC3) | 48.5 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 48.5 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 47.5 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 45.9 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 44.3 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 40.8 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 40.8 | ||||
| LDTP02297 | Vimentin (VIM) | 40.5 | ||||
| LDTP11143 | Centromere protein K (CENPK) | 39.9 | ||||
| LDTP13630 | Neudesin (NENF) | 39.4 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 39.4 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 38.9 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 38.6 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 37.3 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 36.8 | ||||
| LDTP06548 | Large ribosomal subunit protein uL23m (MRPL23) | 36.5 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 36.5 | ||||
| LDTP05226 | RNA-binding protein 3 (RBM3) | 36.5 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 35.5 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 35.3 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 35.0 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 32.7 | ||||
| LDTP03850 | RNA-binding motif protein, X chromosome (RBMX) | 32.2 | ||||
| LDTP06022 | Cold-inducible RNA-binding protein (CIRBP) | 31.8 | ||||
| LDTP06868 | Angiomotin (AMOT) | 31.3 | ||||
| LDTP10184 | HAUS augmin-like complex subunit 1 (HAUS1) | 31.3 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 31.1 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 30.7 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 30.3 | ||||
| LDTP05558 | Galectin-3-binding protein (LGALS3BP) | 29.7 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 29.4 | ||||
| LDTP16078 | Heme-binding protein 1 (HEBP1) | 29.2 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 29.0 | ||||
| LDTP04668 | Microfibrillar-associated protein 1 (MFAP1) | 29.0 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 29.0 | ||||
| LDTP13954 | Complex I intermediate-associated protein 30, mitochondrial (NDUFAF1) | 28.4 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 28.4 | ||||
| LDTP16730 | Rab GTPase-activating protein 1-like, isoform 10 (RABGAP1L) | 28.4 | ||||
| LDTP09080 | Reticulophagy regulator 2 (RETREG2) | 28.4 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 28.4 | ||||
| LDTP12764 | MICOS complex subunit MIC19 (CHCHD3) | 28.2 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 27.7 | ||||
| LDTP09143 | Divergent protein kinase domain 2A (DIPK2A) | 26.9 | ||||
| LDTP03729 | General transcription factor IIF subunit 1 (GTF2F1) | 26.7 | ||||
| LDTP13982 | Mitochondrial fission 1 protein (FIS1) | 26.7 | ||||
| LDTP15634 | Ubiquinol-cytochrome c reductase complex assembly factor 5 (UQCC5) | 26.7 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 26.5 | ||||
| LDTP17240 | ATP synthase mitochondrial F1 complex assembly factor 1 (ATPAF1) | 26.5 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 26.5 | ||||
| LDTP12956 | Coiled-coil domain-containing protein 167 (CCDC167) | 26.4 | ||||
| LDTP05530 | Induced myeloid leukemia cell differentiation protein Mcl-1 (MCL1) | 26.2 | ||||
| LDTP14939 | Membralin (TMEM259) | 26.2 | ||||
| LDTP06373 | Mitochondrial import receptor subunit TOM20 homolog (TOMM20) | 26.2 | ||||
| LDTP00417 | Programmed cell death protein 5 (PDCD5) | 26.2 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 26.0 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 26.0 | ||||
| LDTP02181 | Neurofilament medium polypeptide (NEFM) | 25.8 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 25.8 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 25.6 | ||||
| LDTP12395 | Large ribosomal subunit protein mL40 (MRPL40) | 25.6 | ||||
| LDTP08761 | NADH dehydrogenase 1 alpha subcomplex assembly factor 2 (NDUFAF2) | 25.3 | ||||
| LDTP11533 | Oxysterol-binding protein-related protein 6 (OSBPL6) | 24.9 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 24.9 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 24.8 | ||||
| LDTP09297 | Large ribosomal subunit protein mL64 (GADD45GIP1) | 24.8 | ||||
| LDTP09850 | Proline-rich protein PRCC (PRCC) | 24.8 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 24.6 | ||||
| LDTP08058 | Mitochondrial antiviral-signaling protein (MAVS) | 24.6 | ||||
| LDTP05715 | Vesicle transport protein SEC20 (BNIP1) | 24.6 | ||||
| LDTP16577 | DENN domain-containing protein 11 (DENND11) | 24.4 | ||||
| LDTP12377 | Mediator of RNA polymerase II transcription subunit 4 (MED4) | 24.4 | ||||
| LDTP00887 | Calumenin (CALU) | 24.3 | ||||
| LDTP00573 | Prefoldin subunit 6 (PFDN6) | 24.3 | ||||
| LDTP10277 | Ribosomal RNA processing protein 36 homolog (RRP36) | 24.3 | ||||
| LDTP04714 | Heterogeneous nuclear ribonucleoprotein H2 (HNRNPH2) | 23.9 | ||||
| LDTP10924 | Prohibitin-2 (PHB2) | 23.9 | ||||
| LDTP12951 | Spliceosome-associated protein CWC15 homolog (CWC15) | 23.8 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 23.8 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 23.4 | ||||
| LDTP01246 | KH domain-containing, RNA-binding, signal transduction-associated protein 3 (KHDRBS3) | 23.4 | ||||
| LDTP04207 | Heat shock 70 kDa protein 13 (HSPA13) | 23.3 | ||||
| LDTP10962 | Heterogeneous nuclear ribonucleoprotein A/B (HNRNPAB) | 23.3 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 23.3 | ||||
| LDTP12982 | Mitochondrial import receptor subunit TOM7 homolog (TOMM7) | 23.3 | ||||
| LDTP01582 | Pre-mRNA-splicing factor SLU7 (SLU7) | 23.1 | ||||
| LDTP04356 | Emerin (EMD) | 22.9 | ||||
| LDTP09183 | Periphilin-1 (PPHLN1) | 22.9 | ||||
| LDTP06272 | Pre-mRNA-splicing regulator WTAP (WTAP) | 22.9 | ||||
| LDTP13019 | Vacuolar protein sorting-associated protein 18 homolog (VPS18) | 22.9 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 22.8 | ||||
| LDTP05437 | Single-stranded DNA-binding protein, mitochondrial (SSBP1) | 22.6 | ||||
| LDTP02443 | Calmodulin-3 (CALM3) | 22.5 | ||||
| LDTP03182 | Heterogeneous nuclear ribonucleoproteins A2/B1 (HNRNPA2B1) | 22.5 | ||||
| LDTP03065 | Lamin-B1 (LMNB1) | 22.3 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 22.2 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 22.2 | ||||
