Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C287 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 88.0 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 58.5 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 51.6 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 51.6 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 49.5 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 44.9 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 38.6 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 37.8 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 37.5 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 37.3 | ||||
| LDTP10322 | Abasic site processing protein HMCES (HMCES) | 33.6 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 33.1 | ||||
| LDTP12586 | Phenylalanine--tRNA ligase beta subunit (FARSB) | 31.8 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 31.1 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 30.1 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 28.1 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 26.2 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 24.3 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 23.9 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 22.8 | ||||
| LDTP01065 | E3 ubiquitin-protein ligase TRIM13 (TRIM13) | 22.2 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 21.7 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 21.6 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 21.3 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 21.1 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 20.4 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 20.1 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 19.6 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 18.4 | ||||
| LDTP07525 | Protein arginine N-methyltransferase 9 (PRMT9) | 16.7 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 16.6 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 16.4 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 16.3 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 16.3 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 16.0 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 15.9 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 15.7 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 15.2 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 15.1 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 14.5 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 14.2 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 14.2 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 14.2 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 14.1 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 14.0 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 13.9 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 13.9 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 13.8 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 13.8 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 13.7 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 13.4 | ||||
| LDTP01649 | Phosphatidate cytidylyltransferase 2 (CDS2) | 13.1 | ||||
| LDTP16040 | Glyoxalase domain-containing protein 4 (GLOD4) | 12.9 | ||||
| LDTP06986 | Rab-like protein 3 (RABL3) | 12.9 | ||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 12.8 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 12.6 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 12.6 | ||||
| LDTP07227 | Threonylcarbamoyladenosine tRNA methylthiotransferase (CDKAL1) | 12.5 | ||||
| LDTP04438 | Succinate-semialdehyde dehydrogenase, mitochondrial (ALDH5A1) | 12.2 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 12.2 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 12.0 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 12.0 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 11.9 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 11.8 | ||||
| LDTP12197 | Ethanolamine kinase 1 (ETNK1) | 11.6 | ||||
| LDTP05228 | Calcium-transporting ATPase type 2C member 1 (ATP2C1) | 11.6 | ||||
| LDTP09285 | Atypical kinase COQ8A, mitochondrial (COQ8A) | 11.5 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 11.5 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 11.5 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 11.4 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 11.4 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 11.3 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 11.3 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 11.3 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 11.2 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 11.2 | ||||
| LDTP08687 | tRNA (uracil-5-)-methyltransferase homolog A (TRMT2A) | 11.1 | ||||
| LDTP01502 | NADH dehydrogenase 1 beta subcomplex subunit 6 (NDUFB6) | 11.0 | ||||
| LDTP11284 | Phosphatidylserine synthase 2 (PTDSS2) | 10.9 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 10.9 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 10.8 | ||||
| LDTP11225 | Deoxyhypusine hydroxylase (DOHH) | 10.8 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 10.8 | ||||
| LDTP12639 | 1-acyl-sn-glycerol-3-phosphate acyltransferase epsilon (AGPAT5) | 10.7 | ||||
| LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 10.7 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 10.7 | ||||
| LDTP04893 | Ras-related protein Rab-5B (RAB5B) | 10.6 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 10.6 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 10.6 | ||||
| LDTP13986 | Vesicle transport protein GOT1B (GOLT1B) | 10.6 | ||||
| LDTP08177 | Dehydrodolichyl diphosphate synthase complex subunit DHDDS (DHDDS) | 10.5 | ||||
| LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 10.5 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 10.4 | ||||
| LDTP19223 | Transmembrane protein 62 (TMEM62) | 10.4 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 10.3 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 10.3 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 10.3 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 10.3 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 10.2 | ||||
| LDTP10320 | tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A (TRMT61A) | 10.2 | ||||
| LDTP12494 | Carbohydrate sulfotransferase 12 (CHST12) | 10.1 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 10.1 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 10.1 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 10.0 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 10.0 | ||||
| LDTP09053 | Xyloside xylosyltransferase 1 (XXYLT1) | 10.0 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 9.9 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 9.9 | ||||
| LDTP03656 | Cystathionine gamma-lyase (CTH) | 9.6 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 9.6 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 9.6 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 9.6 | ||||
| LDTP11867 | UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase (DPAGT1) | 9.6 | ||||
| LDTP06227 | Prostaglandin reductase 1 (PTGR1) | 9.5 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 9.4 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 9.4 | ||||
| LDTP10796 | Ribosomal protein S6 kinase delta-1 (RPS6KC1) | 9.4 | ||||
| LDTP14189 | UbiA prenyltransferase domain-containing protein 1 (UBIAD1) | 9.4 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 9.2 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 9.2 | ||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 9.1 | ||||
| LDTP00416 | CDP-diacylglycerol--inositol 3-phosphatidyltransferase (CDIPT) | 8.9 | ||||
| LDTP09578 | Phosphatidylglycerophosphatase and protein-tyrosine phosphatase 1 (PTPMT1) | 8.9 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 8.9 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 8.9 | ||||
| LDTP04333 | GMP synthase [glutamine-hydrolyzing] (GMPS) | 8.9 | ||||
| LDTP06720 | Peroxisomal leader peptide-processing protease (TYSND1) | 8.9 | ||||
| LDTP03024 | Plasma membrane calcium-transporting ATPase 1 (ATP2B1) | 8.9 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 8.8 | ||||
| LDTP12757 | E3 ubiquitin-protein ligase MARCHF5 (MARCHF5) | 8.8 | ||||
| LDTP11606 | Ethanolaminephosphotransferase 1 (SELENOI) | 8.8 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 8.8 | ||||
| LDTP04531 | Hexokinase-2 (HK2) | 8.7 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 8.7 | ||||
| LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | 8.6 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 8.6 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 58.1 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 57.3 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 50.9 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 49.5 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 45.6 | ||||
| LDTP16163 | Cytochrome c oxidase assembly protein COX16 homolog, mitochondrial (COX16) | 43.7 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 42.8 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 41.6 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 40.8 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 39.7 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 38.9 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 34.5 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 34.1 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 34.1 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 33.8 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 33.1 | ||||
| LDTP06275 | Lysosomal-associated transmembrane protein 4A (LAPTM4A) | 31.6 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 31.1 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 30.7 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 30.3 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 30.3 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 29.9 | ||||
| LDTP00857 | Syntaxin-6 (STX6) | 29.9 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 26.2 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 26.0 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 25.5 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 24.6 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 23.8 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 23.4 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 22.3 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 22.0 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 21.9 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 20.1 | ||||
| LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 19.7 | ||||
| LDTP02215 | Prosaposin (PSAP) | 19.6 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 19.4 | ||||
| LDTP01160 | Peroxisomal membrane protein 11A (PEX11A) | 19.4 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 19.3 | ||||
| LDTP11927 | Essential MCU regulator, mitochondrial (SMDT1) | 19.0 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 18.9 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 18.4 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 18.3 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 18.3 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 18.0 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 18.0 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 17.3 | ||||
| LDTP11626 | Protein YIPF3 (YIPF3) | 17.3 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 17.3 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 16.7 | ||||
| LDTP14636 | Solute carrier family 25 member 16 (SLC25A16) | 16.3 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 16.1 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 16.0 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 15.9 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 15.7 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 15.7 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 15.6 | ||||
| LDTP14181 | Peroxisomal membrane protein PEX16 (PEX16) | 15.6 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 15.2 | ||||
| LDTP04597 | Methylosome subunit pICln (CLNS1A) | 15.1 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 15.1 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 14.5 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 14.5 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 14.3 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 14.0 | ||||
| LDTP15733 | Solute carrier family 25 member 44 (SLC25A44) | 13.5 | ||||
| LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 13.4 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 13.4 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 13.0 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 12.9 | ||||
| LDTP04956 | Mitochondrial import inner membrane translocase subunit Tim10 (TIMM10) | 12.8 | ||||
| LDTP11812 | Protein ARV1 (ARV1) | 12.8 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 12.7 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 12.7 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 12.6 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 12.6 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 12.6 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 12.4 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 12.2 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 12.0 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 11.9 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 11.6 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 11.3 | ||||
| LDTP09204 | Nucleoporin NUP35 (NUP35) | 11.2 | ||||
| LDTP01380 | Wolframin (WFS1) | 11.2 | ||||
| LDTP08981 | Cytochrome c oxidase assembly protein COX18, mitochondrial (COX18) | 11.1 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 11.1 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 10.5 | ||||
| LDTP01601 | Activator of 90 kDa heat shock protein ATPase homolog 1 (AHSA1) | 10.3 | ||||
| LDTP06633 | Reticulon-1 (RTN1) | 10.1 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 10.0 | ||||
| LDTP11826 | Sodium-dependent neutral amino acid transporter B(0)AT2 (SLC6A15) | 9.8 | ||||
| LDTP03380 | Stomatin (STOM) | 9.8 | ||||
| LDTP10081 | Leucine-rich repeat-containing protein 59 (LRRC59) | 9.7 | ||||
| LDTP04663 | Bax inhibitor 1 (TMBIM6) | 9.6 | ||||
| LDTP14222 | Chloride intracellular channel protein 4 (CLIC4) | 9.6 | ||||
| LDTP10931 | Succinate dehydrogenase cytochrome b560 subunit, mitochondrial (SDHC) | 9.6 | ||||
| LDTP07477 | Transmembrane protein 214 (TMEM214) | 9.5 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 9.4 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 9.3 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 9.3 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 9.2 | ||||
| LDTP15838 | Translocation protein SEC62 (SEC62) | 9.1 | ||||
| LDTP06855 | Anoctamin-6 (ANO6) | 9.0 | ||||
| LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 9.0 | ||||
| LDTP04463 | H(+)/Cl(-) exchange transporter 7 (CLCN7) | 9.0 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 8.8 | ||||
| LDTP03546 | Translocator protein (TSPO) | 8.8 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 8.7 | ||||
| LDTP00872 | Peroxisomal membrane protein PMP34 (SLC25A17) | 8.7 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 14.9 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP14205 | Neuroplastin (NPTN) | 10.4 | ||||
| LDTP03772 | Basigin (BSG) | 9.3 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 79.3 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 45.6 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 39.1 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 38.9 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 37.8 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 30.3 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 29.4 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 27.9 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 26.9 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 26.7 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 25.8 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 25.8 | ||||
| LDTP15599 | UPF0729 protein C18orf32 (C18orf32) | 23.3 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 23.1 | ||||
| LDTP10116 | Lipid droplet assembly factor 1 (LDAF1) | 22.9 | ||||
| LDTP02205 | Tubulin beta chain (TUBB) | 22.3 | ||||
| LDTP11277 | Tubulin beta-2B chain (TUBB2B) | 21.7 | ||||
| LDTP05998 | Tubulin beta-2A chain (TUBB2A) | 21.4 | ||||
| LDTP05076 | Tubulin beta-4B chain (TUBB4B) | 21.4 | ||||
| LDTP12982 | Mitochondrial import receptor subunit TOM7 homolog (TOMM7) | 20.5 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 20.4 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 19.6 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 19.2 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 18.8 | ||||
| LDTP13560 | Vang-like protein 2 (VANGL2) | 18.5 | ||||
| LDTP13214 | UPF0449 protein C19orf25 (C19orf25) | 18.4 | ||||
| LDTP10357 | RUS family member 1 (RUSF1) | 18.0 | ||||
| LDTP02037 | Tubulin beta-4A chain (TUBB4A) | 17.5 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 17.4 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 17.3 | ||||
| LDTP17003 | Matrix-remodeling-associated protein 7 (MXRA7) | 17.0 | ||||
| LDTP06948 | Protein YIF1B (YIF1B) | 16.9 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 16.3 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 16.2 | ||||
| LDTP11233 | Tubulin beta-6 chain (TUBB6) | 16.0 | ||||
| LDTP00729 | Glycosylphosphatidylinositol anchor attachment 1 protein (GPAA1) | 15.3 | ||||
| LDTP16078 | Heme-binding protein 1 (HEBP1) | 15.3 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 15.0 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 14.7 | ||||
| LDTP00875 | Striatin (STRN) | 14.7 | ||||
| LDTP08606 | Nurim (NRM) | 14.6 | ||||
| LDTP05904 | Tubulin beta-3 chain (TUBB3) | 14.4 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 14.2 | ||||
| LDTP03729 | General transcription factor IIF subunit 1 (GTF2F1) | 13.6 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 13.5 | ||||
| LDTP15240 | LysM and putative peptidoglycan-binding domain-containing protein 3 (LYSMD3) | 13.2 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 13.1 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 12.9 | ||||
| LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 12.9 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 12.8 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 12.2 | ||||
| LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 12.0 | ||||
| LDTP15887 | Lipase maturation factor 2 (LMF2) | 11.7 | ||||
| LDTP18079 | Sec1 family domain-containing protein 2 (SCFD2) | 11.6 | ||||
| LDTP04979 | U6 snRNA-associated Sm-like protein LSm3 (LSM3) | 11.6 | ||||
| LDTP13797 | HIG1 domain family member 1A, mitochondrial (HIGD1A) | 11.5 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 11.3 | ||||
| LDTP02345 | Retinol-binding protein 1 (RBP1) | 11.2 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 11.1 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 11.0 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 10.9 | ||||
| LDTP15283 | Nucleolar protein 9 (NOP9) | 10.9 | ||||
| LDTP13922 | Tudor and KH domain-containing protein (TDRKH) | 10.9 | ||||
| LDTP08000 | Dymeclin (DYM) | 10.6 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 10.5 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 10.4 | ||||
| LDTP01163 | Ubiquinone biosynthesis protein COQ9, mitochondrial (COQ9) | 10.4 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 10.3 | ||||
| LDTP15634 | Ubiquinol-cytochrome c reductase complex assembly factor 5 (UQCC5) | 10.3 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 10.2 | ||||
| LDTP10381 | Peroxisomal membrane protein 11C (PEX11G) | 10.2 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 10.1 | ||||
| LDTP08248 | NLR family member X1 (NLRX1) | 10.0 | ||||
| LDTP09970 | RNA-binding protein with multiple splicing (RBPMS) | 10.0 | ||||
| LDTP14277 | Cytochrome c oxidase assembly protein COX11, mitochondrial (COX11) | 9.8 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 9.7 | ||||
| LDTP14259 | Testis-expressed protein 264 (TEX264) | 9.6 | ||||
| LDTP12746 | Gem-associated protein 8 (GEMIN8) | 9.5 | ||||
| LDTP11906 | Phosphatidylinositol glycan anchor biosynthesis class U protein (PIGU) | 9.4 | ||||
| LDTP09773 | Protein FAM3C (FAM3C) | 9.4 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 9.4 | ||||
| LDTP12379 | Complex I assembly factor TIMMDC1, mitochondrial (TIMMDC1) | 9.2 | ||||
| LDTP10442 | Thioredoxin domain-containing protein 15 (TXNDC15) | 9.2 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 9.2 | ||||
| LDTP07345 | Cell division cycle-associated protein 2 (CDCA2) | 9.1 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 9.1 | ||||
| LDTP15915 | Large ribosomal subunit protein uL13m (MRPL13) | 9.1 | ||||
| LDTP10452 | Conserved oligomeric Golgi complex subunit 3 (COG3) | 9.1 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 9.1 | ||||
| LDTP00397 | Golgi SNAP receptor complex member 2 (GOSR2) | 9.1 | ||||
| LDTP12506 | DNA polymerase epsilon subunit 3 (POLE3) | 9.0 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 9.0 | ||||
| LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 8.9 | ||||
| LDTP13802 | DNA replication complex GINS protein PSF2 (GINS2) | 8.8 | ||||
| LDTP02736 | Myosin light chain 6B (MYL6B) | 8.8 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 8.8 | ||||
| LDTP10093 | Mitochondrial calcium uniporter regulator 1 (MCUR1) | 8.6 | ||||
| LDTP11113 | Receptor expression-enhancing protein 2 (REEP2) | 8.6 | ||||
| LDTP17652 | Uncharacterized protein KIAA2013 (KIAA2013) | 8.6 | ||||
| LDTP06868 | Angiomotin (AMOT) | 8.6 | ||||
