Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C187 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 99.7 | ||||
| LDTP04565 | Methionine aminopeptidase 1 (METAP1) | 99.7 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 99.7 | ||||
| LDTP05006 | Ras-related protein Rab-1A (RAB1A) | 99.7 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 99.7 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 71.0 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 69.1 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 65.3 | ||||
| LDTP07015 | Alanine--tRNA ligase, mitochondrial (AARS2) | 60.1 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 59.3 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 55.3 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 53.8 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 51.6 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 50.9 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 50.9 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 48.5 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 47.5 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 44.0 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 42.5 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 42.2 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 42.2 | ||||
| LDTP10215 | Carboxymethylenebutenolidase homolog (CMBL) | 41.1 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 40.2 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 38.3 | ||||
| LDTP12691 | Pyridoxine-5'-phosphate oxidase (PNPO) | 37.8 | ||||
| LDTP04618 | Ubiquitin carboxyl-terminal hydrolase 14 (USP14) | 37.5 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 37.3 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 37.0 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 36.5 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 36.5 | ||||
| LDTP00837 | Mitotic checkpoint serine/threonine-protein kinase BUB1 (BUB1) | 36.3 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 36.0 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 35.3 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 33.1 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 33.1 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 33.1 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 32.2 | ||||
| LDTP02342 | Dihydropteridine reductase (QDPR) | 32.0 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 31.1 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 29.9 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 28.2 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 28.2 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 27.3 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 26.7 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 26.0 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 25.8 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 25.6 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 25.1 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 24.9 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 24.8 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 24.3 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 24.3 | ||||
| LDTP00877 | Protein SCO2 homolog, mitochondrial (SCO2) | 24.3 | ||||
| LDTP10137 | Cytochrome c oxidase assembly factor 7 (COA7) | 24.1 | ||||
| LDTP13504 | Dermatan-sulfate epimerase (DSE) | 24.1 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 23.6 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 23.4 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 23.4 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 22.9 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 22.9 | ||||
| LDTP03417 | Proteasome subunit beta type-4 (PSMB4) | 22.9 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 22.8 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 22.5 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 22.3 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 22.2 | ||||
| LDTP14214 | Dolichyl-phosphate beta-glucosyltransferase (ALG5) | 21.9 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 21.9 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 21.4 | ||||
| LDTP04318 | Glycogen synthase kinase-3 alpha (GSK3A) | 21.4 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 21.3 | ||||
| LDTP03822 | Activin receptor type-1B (ACVR1B) | 21.0 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 21.0 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 20.8 | ||||
| LDTP07679 | Lysocardiolipin acyltransferase 1 (LCLAT1) | 20.8 | ||||
| LDTP01329 | Lathosterol oxidase (SC5D) | 20.7 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 20.7 | ||||
| LDTP11199 | DCN1-like protein 5 (DCUN1D5) | 20.3 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 20.1 | ||||
| LDTP11259 | Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase (ALG12) | 20.1 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 20.1 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 19.7 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 19.7 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 19.7 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 19.7 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 19.6 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 19.6 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 19.6 | ||||
| LDTP03779 | Copper-transporting ATPase 2 (ATP7B) | 19.2 | ||||
| LDTP07762 | Hydroxysteroid dehydrogenase-like protein 2 (HSDL2) | 18.9 | ||||
| LDTP01535 | Kinesin-like protein KIF20A (KIF20A) | 18.8 | ||||
| LDTP11055 | Telomerase RNA component interacting RNase (TRIR) | 18.5 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 18.3 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 18.3 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 18.0 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 18.0 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 18.0 | ||||
| LDTP02367 | Cytochrome c oxidase subunit 6C (COX6C) | 17.9 | ||||
| LDTP05480 | Amidophosphoribosyltransferase (PPAT) | 17.8 | ||||
| LDTP14079 | E3 ubiquitin-protein ligase ARIH1 (ARIH1) | 17.8 | ||||
| LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 17.8 | ||||
| LDTP05549 | Protein phosphatase 3 catalytic subunit alpha (PPP3CA) | 17.6 | ||||
| LDTP08209 | Acyl-coenzyme A thioesterase 1 (ACOT1) | 17.5 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 17.4 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 17.3 | ||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 17.1 | ||||
| LDTP05588 | RNA cytosine C(5)-methyltransferase NSUN2 (NSUN2) | 17.1 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 17.1 | ||||
| LDTP12543 | 14 kDa phosphohistidine phosphatase (PHPT1) | 16.8 | ||||
| LDTP11225 | Deoxyhypusine hydroxylase (DOHH) | 16.7 | ||||
| LDTP04261 | Choline-phosphate cytidylyltransferase A (PCYT1A) | 16.6 | ||||
| LDTP09835 | GPI-anchor transamidase (PIGK) | 16.6 | ||||
| LDTP13303 | NADH-cytochrome b5 reductase 1 (CYB5R1) | 16.4 | ||||
| LDTP00316 | Ribonuclease T2 (RNASET2) | 16.3 | ||||
| LDTP13131 | 7-dehydrocholesterol reductase (DHCR7) | 16.1 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 16.1 | ||||
| LDTP06620 | Thiosulfate sulfurtransferase (TST) | 16.1 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 16.0 | ||||
| LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | 16.0 | ||||
| LDTP19478 | Putative peptidyl-tRNA hydrolase PTRHD1 (PTRHD1) | 15.9 | ||||
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 15.8 | ||||
| LDTP14075 | AFG3-like protein 2 (AFG3L2) | 15.7 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 15.7 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 15.6 | ||||
| LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 15.6 | ||||
| LDTP06977 | GPI ethanolamine phosphate transferase 2 (PIGG) | 15.6 | ||||
| LDTP08666 | Xaa-Arg dipeptidase (PM20D2) | 15.5 | ||||
| LDTP04345 | Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial (IDH3A) | 15.3 | ||||
| LDTP10177 | Medium-chain acyl-CoA ligase ACSF2, mitochondrial (ACSF2) | 15.3 | ||||
| LDTP06501 | Ras-related protein Rab-11B (RAB11B) | 15.3 | ||||
| LDTP05446 | Ubiquitin-protein ligase E3A (UBE3A) | 15.3 | ||||
| LDTP03001 | E3 ubiquitin-protein ligase TRIM21 (TRIM21) | 15.2 | ||||
| LDTP00890 | S-adenosylhomocysteine hydrolase-like protein 1 (AHCYL1) | 15.2 | ||||
| LDTP13107 | SUMO-activating enzyme subunit 1 (SAE1) | 15.2 | ||||
| LDTP11268 | Acireductone dioxygenase (ADI1) | 15.1 | ||||
| LDTP09388 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B (STT3B) | 15.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 99.7 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 99.7 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 99.7 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 77.7 | ||||
| LDTP04237 | Protein ERGIC-53 (LMAN1) | 74.0 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 65.3 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 63.1 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 61.8 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 61.8 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 61.0 | ||||
| LDTP02215 | Prosaposin (PSAP) | 59.3 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 58.9 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 56.5 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 54.9 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 54.6 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 53.8 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 49.5 | ||||
| LDTP06928 | Coiled-coil domain-containing protein 93 (CCDC93) | 48.5 | ||||
| LDTP15987 | Sorting nexin-25 (SNX25) | 48.2 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 45.9 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 45.3 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 41.4 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 40.5 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 38.9 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 38.1 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 37.0 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 36.8 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 34.8 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 33.1 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 33.1 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 32.4 | ||||
| LDTP14140 | Ceramide transfer protein (CERT1) | 30.9 | ||||
| LDTP03380 | Stomatin (STOM) | 30.9 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 30.7 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 30.1 | ||||
| LDTP03064 | Cytochrome c oxidase subunit 5A, mitochondrial (COX5A) | 26.9 | ||||
| LDTP14178 | Heme transporter FLVCR1 (FLVCR1) | 26.9 | ||||
| LDTP01217 | Metaxin-2 (MTX2) | 26.7 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 26.4 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 25.1 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 24.9 | ||||
| LDTP05814 | Battenin (CLN3) | 24.6 | ||||
| LDTP00857 | Syntaxin-6 (STX6) | 23.8 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 23.6 | ||||
| LDTP04462 | H(+)/Cl(-) exchange transporter 6 (CLCN6) | 23.4 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 23.3 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 22.8 | ||||
| LDTP06855 | Anoctamin-6 (ANO6) | 22.5 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 22.0 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 22.0 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 20.8 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 20.4 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 20.1 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 19.8 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 19.7 | ||||
| LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 19.3 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 19.3 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 19.2 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 18.8 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 18.3 | ||||
| LDTP01454 | SUN domain-containing protein 1 (SUN1) | 17.9 | ||||
| LDTP11229 | Transmembrane protein 70, mitochondrial (TMEM70) | 17.5 | ||||
| LDTP06660 | MICOS complex subunit MIC60 (IMMT) | 17.1 | ||||
| LDTP01574 | Importin-7 (IPO7) | 17.0 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 17.0 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 16.9 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 16.8 | ||||
| LDTP02061 | Anion exchange protein 2 (SLC4A2) | 16.8 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 16.6 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 16.4 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 16.2 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 16.1 | ||||
| LDTP08651 | Exocyst complex component 8 (EXOC8) | 16.0 | ||||
| LDTP11732 | Magnesium transporter protein 1 (MAGT1) | 15.8 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 15.8 | ||||
| LDTP13393 | Electrogenic aspartate/glutamate antiporter SLC25A13, mitochondrial (SLC25A13) | 15.6 | ||||
| LDTP09515 | Importin-4 (IPO4) | 15.6 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 15.6 | ||||
| LDTP04924 | V-type proton ATPase subunit d 1 (ATP6V0D1) | 15.0 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP08006 | PHD finger-like domain-containing protein 5A (PHF5A) | 52.0 | ||||
| LDTP06341 | Non-POU domain-containing octamer-binding protein (NONO) | 30.3 | ||||
| LDTP08409 | Transcriptional repressor p66-alpha (GATAD2A) | 21.9 | ||||
| LDTP02343 | High mobility group protein B1 (HMGB1) | 21.7 | ||||
| LDTP03043 | Transcription factor BTF3 (BTF3) | 16.2 | ||||
| LDTP00612 | High mobility group protein B3 (HMGB3) | 15.8 | ||||
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 15.2 | ||||
| LDTP00576 | NF-kappa-B-repressing factor (NKRF) | 15.0 | ||||
GPCR
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15303 | Membrane progestin receptor alpha (PAQR7) | 64.0 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02688 | HLA class I histocompatibility antigen, alpha chain E (HLA-E) | 58.1 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 99.7 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 99.7 | ||||
| LDTP05277 | Protein SET (SET) | 95.7 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 89.9 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 85.0 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 80.4 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 72.0 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 71.5 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 70.5 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 56.9 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 55.3 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 54.6 | ||||
| LDTP12025 | UPF0488 protein C8orf33 (C8orf33) | 53.8 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 50.9 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 47.8 | ||||
| LDTP00759 | Tumor protein D54 (TPD52L2) | 44.0 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 42.5 | ||||
| LDTP05049 | Dynein light chain 1, cytoplasmic (DYNLL1) | 41.1 | ||||
| LDTP11021 | Endophilin-A3 (SH3GL3) | 40.2 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 39.4 | ||||
| LDTP12077 | Jupiter microtubule associated homolog 2 (JPT2) | 38.9 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 38.3 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 36.8 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 34.8 | ||||
| LDTP00417 | Programmed cell death protein 5 (PDCD5) | 34.3 | ||||
| LDTP11101 | Coronin-1B (CORO1B) | 34.1 | ||||
| LDTP13981 | Small ribosomal subunit protein bS16m (MRPS16) | 34.1 | ||||
| LDTP12780 | THUMP domain-containing protein 1 (THUMPD1) | 34.1 | ||||
| LDTP02736 | Myosin light chain 6B (MYL6B) | 33.4 | ||||
| LDTP12476 | Translation initiation factor eIF2B subunit gamma (EIF2B3) | 33.4 | ||||
| LDTP08292 | Zinc finger CCCH domain-containing protein 18 (ZC3H18) | 33.1 | ||||
| LDTP02940 | Large ribosomal subunit protein eL33 (RPL35A) | 31.8 | ||||
| LDTP02816 | Replication protein A 32 kDa subunit (RPA2) | 31.3 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 31.1 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 30.5 | ||||
| LDTP04926 | Large ribosomal subunit protein eL43 (RPL37A) | 30.3 | ||||
| LDTP14259 | Testis-expressed protein 264 (TEX264) | 30.3 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 27.3 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 27.3 | ||||
| LDTP07031 | Collectin-12 (COLEC12) | 27.1 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 27.1 | ||||
| LDTP05942 | Periodic tryptophan protein 1 homolog (PWP1) | 26.9 | ||||
| LDTP04356 | Emerin (EMD) | 26.2 | ||||
| LDTP10684 | RNA-binding protein 14 (RBM14) | 26.0 | ||||
| LDTP09112 | Nonsense-mediated mRNA decay factor SMG8 (SMG8) | 25.6 | ||||
| LDTP11533 | Oxysterol-binding protein-related protein 6 (OSBPL6) | 25.6 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 25.5 | ||||
| LDTP06587 | Survival motor neuron protein (SMN1; SMN2) | 25.5 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 25.5 | ||||
| LDTP05068 | Tropomyosin alpha-4 chain (TPM4) | 25.5 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 24.9 | ||||
| LDTP10093 | Mitochondrial calcium uniporter regulator 1 (MCUR1) | 24.8 | ||||
| LDTP13817 | Nuclear migration protein nudC (NUDC) | 24.3 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 23.6 | ||||
| LDTP05715 | Vesicle transport protein SEC20 (BNIP1) | 23.6 | ||||
| LDTP08552 | PHD finger protein 6 (PHF6) | 22.9 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 22.3 | ||||
| LDTP02297 | Vimentin (VIM) | 22.0 | ||||
| LDTP13956 | Putative RNA-binding protein Luc7-like 2 (LUC7L2) | 21.7 | ||||
| LDTP02335 | U1 small nuclear ribonucleoprotein C (SNRPC) | 21.6 | ||||
| LDTP05768 | Heterogeneous nuclear ribonucleoprotein A0 (HNRNPA0) | 21.4 | ||||
| LDTP04049 | Ran-specific GTPase-activating protein (RANBP1) | 21.3 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 21.0 | ||||
| LDTP09938 | Far upstream element-binding protein 2 (KHSRP) | 20.8 | ||||
| LDTP00887 | Calumenin (CALU) | 20.7 | ||||
| LDTP01206 | Vesicle-trafficking protein SEC22b (SEC22B) | 20.7 | ||||
| LDTP03027 | Eukaryotic translation initiation factor 2 subunit 2 (EIF2S2) | 20.4 | ||||
| LDTP02181 | Neurofilament medium polypeptide (NEFM) | 20.4 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 20.4 | ||||
| LDTP02164 | Nucleophosmin (NPM1) | 20.3 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 20.3 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 20.1 | ||||
| LDTP04108 | Large ribosomal subunit protein eL28 (RPL28) | 20.1 | ||||
| LDTP11906 | Phosphatidylinositol glycan anchor biosynthesis class U protein (PIGU) | 20.1 | ||||
| LDTP16162 | Large ribosomal subunit protein bL27m (MRPL27) | 20.0 | ||||
| LDTP08136 | YTH domain-containing family protein 3 (YTHDF3) | 20.0 | ||||
| LDTP05189 | Chromobox protein homolog 1 (CBX1) | 19.8 | ||||
| LDTP06952 | DBIRD complex subunit ZNF326 (ZNF326) | 19.8 | ||||
| LDTP09324 | Ganglioside-induced differentiation-associated protein 1 (GDAP1) | 19.8 | ||||
| LDTP04382 | Kinetochore-associated protein 1 (KNTC1) | 19.7 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 19.7 | ||||
| LDTP00849 | 17S U2 SnRNP complex component HTATSF1 (HTATSF1) | 19.6 | ||||
| LDTP07318 | HAUS augmin-like complex subunit 3 (HAUS3) | 19.6 | ||||
| LDTP12652 | DDB1- and CUL4-associated factor 13 (DCAF13) | 19.4 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 19.3 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 19.3 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 19.3 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 19.3 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 19.3 | ||||
| LDTP04627 | UV excision repair protein RAD23 homolog B (RAD23B) | 19.3 | ||||
| LDTP11764 | Nuclear ubiquitous casein and cyclin-dependent kinase substrate 1 (NUCKS1) | 19.0 | ||||
| LDTP12506 | DNA polymerase epsilon subunit 3 (POLE3) | 18.9 | ||||
| LDTP13919 | Thyroid hormone receptor-associated protein 3 (THRAP3) | 18.9 | ||||
| LDTP12764 | MICOS complex subunit MIC19 (CHCHD3) | 18.6 | ||||
| LDTP09850 | Proline-rich protein PRCC (PRCC) | 18.6 | ||||
| LDTP08950 | ADP-ribosylation factor GTPase-activating protein 1 (ARFGAP1) | 18.5 | ||||
| LDTP08984 | Protein enabled homolog (ENAH) | 18.5 | ||||
| LDTP01320 | Eukaryotic translation initiation factor 3 subunit J (EIF3J) | 18.4 | ||||
| LDTP05224 | RNA-binding protein 10 (RBM10) | 18.4 | ||||
| LDTP00830 | BUB3-interacting and GLEBS motif-containing protein ZNF207 (ZNF207) | 18.3 | ||||
| LDTP11312 | DET1- and DDB1-associated protein 1 (DDA1) | 18.3 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 18.3 | ||||
| LDTP00024 | Rho GTPase-activating protein 10 (ARHGAP10) | 18.3 | ||||
| LDTP04945 | Small ubiquitin-related modifier 2 (SUMO2) | 18.3 | ||||
| LDTP04914 | Large ribosomal subunit protein uL24 (RPL26) | 18.1 | ||||
| LDTP06094 | Src substrate cortactin (CTTN) | 18.0 | ||||
| LDTP06879 | Protein FAM98B (FAM98B) | 17.9 | ||||
| LDTP04140 | Large ribosomal subunit protein eL29 (RPL29) | 17.8 | ||||
| LDTP06301 | Eukaryotic translation initiation factor 4H (EIF4H) | 17.6 | ||||
| LDTP05226 | RNA-binding protein 3 (RBM3) | 17.5 | ||||
| LDTP06373 | Mitochondrial import receptor subunit TOM20 homolog (TOMM20) | 17.4 | ||||
| LDTP08735 | Spartin (SPART) | 17.4 | ||||
| LDTP07476 | RAD50-interacting protein 1 (RINT1) | 17.3 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 17.1 | ||||
| LDTP03554 | Sorcin (SRI) | 17.1 | ||||
| LDTP02165 | Tropomyosin alpha-3 chain (TPM3) | 17.1 | ||||
| LDTP00620 | Eukaryotic translation initiation factor 3 subunit H (EIF3H) | 17.0 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 17.0 | ||||
| LDTP05442 | 14-3-3 protein eta (YWHAH) | 16.9 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 16.8 | ||||
| LDTP01932 | Prelamin-A/C (LMNA) | 16.8 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 16.8 | ||||
| LDTP05533 | Kinesin light chain 1 (KLC1) | 16.7 | ||||
| LDTP08073 | Tetratricopeptide repeat protein 21B (TTC21B) | 16.7 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 16.6 | ||||
| LDTP07947 | Eukaryotic translation initiation factor 3 subunit M (EIF3M) | 16.4 | ||||
| LDTP02869 | Stathmin (STMN1) | 16.4 | ||||
| LDTP06383 | Calponin-3 (CNN3) | 16.2 | ||||
| LDTP05867 | Treacle protein (TCOF1) | 16.2 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 16.1 | ||||
| LDTP13978 | Ubiquitin-fold modifier-conjugating enzyme 1 (UFC1) | 16.1 | ||||
| LDTP13467 | RNA-binding protein Raly (RALY) | 16.0 | ||||
| LDTP00632 | Syntaxin-7 (STX7) | 16.0 | ||||
| LDTP15762 | Zinc finger RNA-binding protein (ZFR) | 15.7 | ||||
| LDTP03545 | Alpha-2-macroglobulin receptor-associated protein (LRPAP1) | 15.6 | ||||
| LDTP12826 | Bcl-2-associated transcription factor 1 (BCLAF1) | 15.6 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 15.6 | ||||
| LDTP16096 | RNA-binding protein 12 (RBM12) | 15.6 | ||||
| LDTP05834 | Eukaryotic translation initiation factor 3 subunit I (EIF3I) | 15.5 | ||||
| LDTP06583 | Serine/arginine-rich splicing factor 7 (SRSF7) | 15.5 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 15.1 | ||||
| LDTP01361 | DnaJ homolog subfamily C member 8 (DNAJC8) | 15.0 | ||||
| LDTP08795 | GH3 domain-containing protein (GHDC) | 15.0 | ||||
| LDTP03065 | Lamin-B1 (LMNB1) | 15.0 | ||||
| LDTP06220 | LIM and SH3 domain protein 1 (LASP1) | 15.0 | ||||
| LDTP13870 | Nischarin (NISCH) | 15.0 | ||||
