Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C107 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 41.9 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 31.1 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 30.7 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 30.3 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 28.2 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 27.9 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 27.1 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 25.3 | ||||
| LDTP12790 | Glutaminyl-peptide cyclotransferase-like protein (QPCTL) | 21.0 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 20.7 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 20.0 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 19.0 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 18.4 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 17.6 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 17.6 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 17.5 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 17.4 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 17.3 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 16.7 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 16.0 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 15.8 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 15.5 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 15.0 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 15.0 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 14.9 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 14.8 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 14.7 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 14.2 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 13.9 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 13.5 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 13.5 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 13.2 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 12.5 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 12.2 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 11.4 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 11.3 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 10.8 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 10.8 | ||||
| LDTP12420 | Xaa-Pro aminopeptidase 3 (XPNPEP3) | 10.6 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 10.5 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 10.5 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 10.2 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 10.2 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 10.1 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 9.8 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 9.8 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 9.8 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 9.8 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 9.5 | ||||
| LDTP12197 | Ethanolamine kinase 1 (ETNK1) | 9.4 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 9.4 | ||||
| LDTP08017 | Endoplasmic reticulum metallopeptidase 1 (ERMP1) | 9.4 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 9.4 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 9.2 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 8.8 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 8.8 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 8.8 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 8.7 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 8.6 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 8.3 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 8.2 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 8.2 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 8.1 | ||||
| LDTP12490 | Sphingosine kinase 2 (SPHK2) | 8.1 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 8.0 | ||||
| LDTP13367 | Glutathione hydrolase 7 (GGT7) | 8.0 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 7.9 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 7.9 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 7.8 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 7.7 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 7.7 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 7.7 | ||||
| LDTP11700 | Integrin-linked kinase-associated serine/threonine phosphatase 2C (ILKAP) | 7.7 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 7.7 | ||||
| LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 7.7 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 7.6 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 7.6 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 7.6 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 7.4 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 7.4 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 7.4 | ||||
| LDTP06657 | 2-hydroxyacylsphingosine 1-beta-galactosyltransferase (UGT8) | 7.3 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 7.3 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 7.3 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 7.3 | ||||
| LDTP03671 | Multidrug resistance-associated protein 1 (ABCC1) | 7.2 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 7.2 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 7.2 | ||||
| LDTP03676 | ATP-binding cassette sub-family D member 1 (ABCD1) | 7.1 | ||||
| LDTP07868 | Protein O-mannosyl-transferase TMTC3 (TMTC3) | 7.1 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 7.0 | ||||
| LDTP03680 | DNA replication licensing factor MCM4 (MCM4) | 7.0 | ||||
| LDTP10201 | Atypical kinase COQ8B, mitochondrial (COQ8B) | 6.8 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 6.8 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 6.7 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 6.7 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 6.6 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 6.6 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 6.5 | ||||
| LDTP04542 | Thimet oligopeptidase (THOP1) | 6.5 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 6.5 | ||||
| LDTP02000 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase (HMGCR) | 6.5 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 6.5 | ||||
| LDTP04333 | GMP synthase [glutamine-hydrolyzing] (GMPS) | 6.4 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 6.4 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 6.3 | ||||
| LDTP04183 | Lanosterol synthase (LSS) | 6.3 | ||||
| LDTP00975 | Mannosyl-oligosaccharide 1,2-alpha-mannosidase IB (MAN1A2) | 6.1 | ||||
| LDTP12303 | ATP-binding cassette sub-family B member 6 (ABCB6) | 6.1 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 6.1 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 6.1 | ||||
| LDTP10887 | Synaptic vesicle membrane protein VAT-1 homolog (VAT1) | 6.1 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 6.0 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 6.0 | ||||
| LDTP12293 | Adipocyte plasma membrane-associated protein (APMAP) | 5.9 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 5.9 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 5.9 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 5.9 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 5.9 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 5.9 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 5.9 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 5.9 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 5.7 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 5.7 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 5.7 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 5.7 | ||||
| LDTP12763 | Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase (BPNT2) | 5.7 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 5.7 | ||||
| LDTP13720 | Ubiquitin carboxyl-terminal hydrolase 24 (USP24) | 5.7 | ||||
| LDTP10974 | Phospholipid-transporting ATPase ABCA3 (ABCA3) | 5.5 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 99.7 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 98.4 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 41.9 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 36.3 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 35.0 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 31.3 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 28.4 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 23.6 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 22.2 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 22.0 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 21.9 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 20.7 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 20.4 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 18.6 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 18.0 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 17.1 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 17.0 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 16.6 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 16.4 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 16.3 | ||||
| LDTP00857 | Syntaxin-6 (STX6) | 16.0 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 16.0 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 14.6 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 14.6 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 13.9 | ||||
| LDTP11826 | Sodium-dependent neutral amino acid transporter B(0)AT2 (SLC6A15) | 13.2 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 13.0 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 12.3 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 12.0 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 12.0 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 11.9 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 11.8 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 11.7 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 11.5 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 11.4 | ||||
| LDTP02215 | Prosaposin (PSAP) | 11.3 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 11.3 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 11.3 | ||||
| LDTP03380 | Stomatin (STOM) | 10.8 | ||||
| LDTP09294 | Proton-coupled zinc antiporter SLC30A5 (SLC30A5) | 10.6 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 10.1 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 10.1 | ||||
| LDTP04501 | Importin subunit alpha-1 (KPNA2) | 10.1 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 9.6 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 9.6 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 9.4 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 9.3 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 9.2 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 9.1 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 9.0 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 8.9 | ||||
| LDTP10036 | BOS complex subunit NCLN (NCLN) | 8.8 | ||||
| LDTP08016 | Proton-coupled amino acid transporter 1 (SLC36A1) | 8.8 | ||||
| LDTP11812 | Protein ARV1 (ARV1) | 8.7 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 8.2 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 8.2 | ||||
| LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 8.2 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 8.2 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 7.9 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 7.8 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 7.7 | ||||
| LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | 7.6 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 7.5 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 7.5 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 7.4 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 7.4 | ||||
| LDTP04463 | H(+)/Cl(-) exchange transporter 7 (CLCN7) | 7.3 | ||||
| LDTP03546 | Translocator protein (TSPO) | 7.3 | ||||
| LDTP17682 | Zinc transporter ZIP11 (SLC39A11) | 7.3 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 7.2 | ||||
| LDTP05871 | Protein OS-9 (OS9) | 7.1 | ||||
| LDTP15979 | Transmembrane protein 245 (TMEM245) | 7.1 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 7.0 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 7.0 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 6.9 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 6.9 | ||||
| LDTP08327 | Osteopetrosis-associated transmembrane protein 1 (OSTM1) | 6.8 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 6.8 | ||||
| LDTP11634 | Derlin-2 (DERL2) | 6.8 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 6.6 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 6.5 | ||||
| LDTP13393 | Electrogenic aspartate/glutamate antiporter SLC25A13, mitochondrial (SLC25A13) | 6.4 | ||||
| LDTP06499 | V-type proton ATPase subunit S1 (ATP6AP1) | 6.2 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 6.2 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 6.1 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 6.1 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 6.0 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 5.9 | ||||
| LDTP10073 | Protein RFT1 homolog (RFT1) | 5.9 | ||||
| LDTP00405 | Etoposide-induced protein 2.4 homolog (EI24) | 5.9 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 5.9 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 5.9 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 5.9 | ||||
| LDTP11291 | Transmembrane emp24 domain-containing protein 9 (TMED9) | 5.8 | ||||
| LDTP05934 | Stromal interaction molecule 1 (STIM1) | 5.7 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 5.7 | ||||
| LDTP08981 | Cytochrome c oxidase assembly protein COX18, mitochondrial (COX18) | 5.7 | ||||
| LDTP09144 | Metal transporter CNNM3 (CNNM3) | 5.7 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 5.7 | ||||
| LDTP14275 | Sodium bicarbonate cotransporter 3 (SLC4A7) | 5.7 | ||||
| LDTP03064 | Cytochrome c oxidase subunit 5A, mitochondrial (COX5A) | 5.6 | ||||
| LDTP10769 | Intermembrane lipid transfer protein VPS13A (VPS13A) | 5.6 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 5.6 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 5.6 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 5.5 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 5.5 | ||||
| LDTP12665 | Cell cycle control protein 50A (TMEM30A) | 5.5 | ||||
| LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 5.5 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 5.5 | ||||
| LDTP10754 | Pannexin-1 (PANX1) | 5.5 | ||||
| LDTP06331 | Pericentriolar material 1 protein (PCM1) | 5.5 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 7.5 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04720 | IgG receptor FcRn large subunit p51 (FCGRT) | 13.0 | ||||
| LDTP03772 | Basigin (BSG) | 8.3 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05160 | Nucleobindin-2 (NUCB2) | 41.1 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 40.5 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 34.5 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 29.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 28.6 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 22.9 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 22.5 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 21.4 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 20.3 | ||||
| LDTP15634 | Ubiquinol-cytochrome c reductase complex assembly factor 5 (UQCC5) | 20.1 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 19.0 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 19.0 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 18.5 | ||||
| LDTP11143 | Centromere protein K (CENPK) | 17.5 | ||||
| LDTP06128 | RNA-binding protein 39 (RBM39) | 14.0 | ||||
| LDTP14939 | Membralin (TMEM259) | 13.7 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 13.3 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 12.5 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 12.4 | ||||
| LDTP08606 | Nurim (NRM) | 12.2 | ||||
| LDTP06181 | Structural maintenance of chromosomes protein 1A (SMC1A) | 12.1 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 11.8 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 11.8 | ||||
| LDTP00779 | Trans-Golgi network integral membrane protein 2 (TGOLN2) | 11.8 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 11.6 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 11.2 | ||||
| LDTP07906 | Mediator of RNA polymerase II transcription subunit 25 (MED25) | 10.9 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 10.6 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 10.6 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 10.5 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 10.5 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 9.9 | ||||
| LDTP07335 | Rho GTPase-activating protein 17 (ARHGAP17) | 9.8 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 9.5 | ||||
| LDTP08000 | Dymeclin (DYM) | 9.3 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 9.3 | ||||
| LDTP13630 | Neudesin (NENF) | 9.3 | ||||
| LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | 9.1 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 8.9 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 8.9 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 8.9 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 8.8 | ||||
| LDTP05277 | Protein SET (SET) | 8.6 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 8.5 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 8.4 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 8.3 | ||||
| LDTP01638 | YEATS domain-containing protein 4 (YEATS4) | 8.3 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 7.9 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 7.9 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 7.8 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 7.6 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 7.6 | ||||
| LDTP15599 | UPF0729 protein C18orf32 (C18orf32) | 7.6 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 7.5 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 7.5 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 7.4 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 7.3 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 7.0 | ||||
| LDTP07031 | Collectin-12 (COLEC12) | 6.9 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 6.5 | ||||
| LDTP10113 | Mitochondrial import receptor subunit TOM6 homolog (TOMM6) | 6.5 | ||||
| LDTP05922 | Dynactin subunit 2 (DCTN2) | 6.4 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 6.4 | ||||
| LDTP11167 | Protein YIPF4 (YIPF4) | 6.4 | ||||
| LDTP09255 | Motile sperm domain-containing protein 2 (MOSPD2) | 6.3 | ||||
| LDTP09069 | Kinetochore protein Spc24 (SPC24) | 6.2 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 6.1 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 6.0 | ||||
| LDTP15095 | Receptor expression-enhancing protein 3 (REEP3) | 5.9 | ||||
| LDTP12545 | Protein kish-B (TMEM167B) | 5.9 | ||||
| LDTP12741 | Ankyrin repeat and SOCS box protein 6 (ASB6) | 5.8 | ||||
| LDTP04207 | Heat shock 70 kDa protein 13 (HSPA13) | 5.8 | ||||
| LDTP01510 | Zinc finger protein-like 1 (ZFPL1) | 5.8 | ||||
| LDTP05741 | Large ribosomal subunit protein bL28m (MRPL28) | 5.7 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 5.7 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 5.7 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 5.7 | ||||
| LDTP19859 | Small integral membrane protein 12 (SMIM12) | 5.7 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 5.5 | ||||
