Details of the Probe-central Interaction Altas
General Information of Experiment
Probe Name | C288 | Probe Info | ||||
---|---|---|---|---|---|---|
Probe concentration | Probe:50uM; negative probe:50uM | |||||
Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
Quantitative Method |
TMT
|
|||||
In Vivo Experiment Model | Model Type |
|
Living cell | |||
Derived Tissue |
|
Peripheral blood | ||||
Disease Model | Normal | |||||
Model Name | Human normal cells (HEK-293T) | |||||
Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 |
Interaction Altas of This Experiment [1]
Enzyme
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 48.5 | ||||
LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 47.2 | ||||
LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 42.2 | ||||
LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 40.5 | ||||
LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 36.3 | ||||
LDTP12197 | Ethanolamine kinase 1 (ETNK1) | 35.3 | ||||
LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 28.2 | ||||
LDTP03540 | Heme oxygenase 2 (HMOX2) | 28.1 | ||||
LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 23.4 | ||||
LDTP00697 | Cytochrome b5 type B (CYB5B) | 23.3 | ||||
LDTP02505 | Lysosomal protective protein (CTSA) | 22.9 | ||||
LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 22.0 | ||||
LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 20.0 | ||||
LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 19.8 | ||||
LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 19.8 | ||||
LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 19.2 | ||||
LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 18.8 | ||||
LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 18.0 | ||||
LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 17.6 | ||||
LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 17.5 | ||||
LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 16.9 | ||||
LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 16.8 | ||||
LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 15.5 | ||||
LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 15.3 | ||||
LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 15.2 | ||||
LDTP05905 | Acid ceramidase (ASAH1) | 15.1 | ||||
LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 15.1 | ||||
LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 15.0 | ||||
LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 14.9 | ||||
LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 14.4 | ||||
LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 13.8 | ||||
LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 13.4 | ||||
LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 13.3 | ||||
LDTP04333 | GMP synthase [glutamine-hydrolyzing] (GMPS) | 13.2 | ||||
LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 12.9 | ||||
LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 12.8 | ||||
LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 12.7 | ||||
LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 12.3 | ||||
LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 12.1 | ||||
LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 12.0 | ||||
LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 11.6 | ||||
LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 11.4 | ||||
LDTP06227 | Prostaglandin reductase 1 (PTGR1) | 11.2 | ||||
LDTP08017 | Endoplasmic reticulum metallopeptidase 1 (ERMP1) | 11.2 | ||||
LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 11.1 | ||||
LDTP00701 | D-3-phosphoglycerate dehydrogenase (PHGDH) | 11.0 | ||||
LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 10.9 | ||||
LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 10.8 | ||||
LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 10.7 | ||||
LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 10.7 | ||||
LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 10.6 | ||||
LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 10.5 | ||||
LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 10.3 | ||||
LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 10.3 | ||||
LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 10.3 | ||||
LDTP11225 | Deoxyhypusine hydroxylase (DOHH) | 10.1 | ||||
LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 10.1 | ||||
LDTP12639 | 1-acyl-sn-glycerol-3-phosphate acyltransferase epsilon (AGPAT5) | 10.0 | ||||
LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 9.8 | ||||
LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 9.8 | ||||
LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 9.6 | ||||
LDTP10329 | Ceramide synthase 2 (CERS2) | 9.6 | ||||
LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 9.5 | ||||
LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 9.4 | ||||
LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 9.1 | ||||
LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 9.0 | ||||
LDTP11127 | ADP-dependent glucokinase (ADPGK) | 8.8 | ||||
LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 8.8 | ||||
LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 8.8 | ||||
LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 8.7 | ||||
LDTP12318 | Calcium-independent phospholipase A2-gamma (PNPLA8) | 8.6 | ||||
LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 8.6 | ||||
LDTP11259 | Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase (ALG12) | 8.5 | ||||
LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 8.5 | ||||
LDTP11268 | Acireductone dioxygenase (ADI1) | 8.5 | ||||
LDTP06986 | Rab-like protein 3 (RABL3) | 8.3 | ||||
LDTP01769 | Dihydrofolate reductase (DHFR) | 8.2 | ||||
LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 8.2 | ||||
LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 8.2 | ||||
LDTP05785 | Probable ATP-dependent RNA helicase DDX10 (DDX10) | 8.0 | ||||
LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 7.9 | ||||
LDTP03417 | Proteasome subunit beta type-4 (PSMB4) | 7.9 | ||||
LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 7.9 | ||||
LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 7.8 | ||||
LDTP07227 | Threonylcarbamoyladenosine tRNA methylthiotransferase (CDKAL1) | 7.8 | ||||
LDTP08687 | tRNA (uracil-5-)-methyltransferase homolog A (TRMT2A) | 7.7 | ||||
LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 7.7 | ||||
LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 7.7 | ||||
LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 7.4 | ||||
LDTP09285 | Atypical kinase COQ8A, mitochondrial (COQ8A) | 7.4 | ||||
LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 7.4 | ||||
LDTP03316 | DNA replication licensing factor MCM3 (MCM3) | 7.3 | ||||
LDTP04531 | Hexokinase-2 (HK2) | 7.3 | ||||
LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 7.3 | ||||
LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 7.3 | ||||
LDTP00032 | 2-hydroxyacyl-CoA lyase 2 (ILVBL) | 7.2 | ||||
LDTP09251 | Atlastin-2 (ATL2) | 7.2 | ||||
LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 7.1 | ||||
LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 7.1 | ||||
LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 7.1 | ||||
LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 7.1 | ||||
LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 7.1 | ||||
LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 7.1 | ||||
LDTP03787 | Choline kinase alpha (CHKA) | 7.0 | ||||
LDTP06511 | Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial (ETFDH) | 7.0 | ||||
LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 6.9 | ||||
LDTP06384 | Ribosomal protein S6 kinase alpha-1 (RPS6KA1) | 6.9 | ||||
LDTP08177 | Dehydrodolichyl diphosphate synthase complex subunit DHDDS (DHDDS) | 6.9 | ||||
LDTP04247 | Protein farnesyltransferase subunit beta (FNTB) | 6.9 | ||||
LDTP01065 | E3 ubiquitin-protein ligase TRIM13 (TRIM13) | 6.8 | ||||
LDTP04183 | Lanosterol synthase (LSS) | 6.8 | ||||
LDTP05408 | Antigen peptide transporter 1 (TAP1) | 6.7 | ||||
LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 6.7 | ||||
LDTP01649 | Phosphatidate cytidylyltransferase 2 (CDS2) | 6.7 | ||||
LDTP00988 | Protein O-GlcNAcase (OGA) | 6.7 | ||||
LDTP10320 | tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A (TRMT61A) | 6.7 | ||||
LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 6.6 | ||||
LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 6.6 | ||||
LDTP03608 | RAC-beta serine/threonine-protein kinase (AKT2) | 6.6 | ||||
LDTP04581 | Holocytochrome c-type synthase (HCCS) | 6.6 | ||||
LDTP02539 | Lysosomal acid phosphatase (ACP2) | 6.6 | ||||
LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 6.5 | ||||
LDTP02141 | Alpha-galactosidase A (GLA) | 6.5 | ||||
LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 6.5 | ||||
LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 6.5 | ||||
LDTP00886 | Nardilysin (NRDC) | 6.5 | ||||
LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 6.5 | ||||
LDTP09578 | Phosphatidylglycerophosphatase and protein-tyrosine phosphatase 1 (PTPMT1) | 6.5 | ||||
LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 6.5 | ||||
LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 6.3 | ||||
LDTP02006 | Tissue alpha-L-fucosidase (FUCA1) | 6.3 | ||||
LDTP06720 | Peroxisomal leader peptide-processing protease (TYSND1) | 6.2 | ||||
LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 6.2 | ||||
LDTP12494 | Carbohydrate sulfotransferase 12 (CHST12) | 6.2 | ||||
LDTP10020 | Ras-related protein Rab-24 (RAB24) | 6.1 |
Transporter and channel
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP20002 | Transmembrane protein 160 (TMEM160) | 41.9 | ||||
LDTP10036 | BOS complex subunit NCLN (NCLN) | 38.1 | ||||
LDTP15948 | Transmembrane protein 126A (TMEM126A) | 34.8 | ||||
LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 31.1 | ||||
LDTP07236 | Protein GPR107 (GPR107) | 29.4 | ||||
LDTP16813 | Tetraspanin-3 (TSPAN3) | 27.9 | ||||
LDTP16163 | Cytochrome c oxidase assembly protein COX16 homolog, mitochondrial (COX16) | 26.7 | ||||
LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 22.3 | ||||
LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 21.7 | ||||
LDTP01804 | ATP synthase subunit a (MT-ATP6) | 21.4 | ||||
LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 20.5 | ||||
LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 20.3 | ||||
LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 20.1 | ||||
LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 19.8 | ||||
LDTP15648 | BRI3-binding protein (BRI3BP) | 19.6 | ||||
LDTP06275 | Lysosomal-associated transmembrane protein 4A (LAPTM4A) | 18.6 | ||||
LDTP15481 | Transmembrane protein 87A (TMEM87A) | 18.4 | ||||
LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 17.9 | ||||
LDTP08881 | Transmembrane protein 199 (TMEM199) | 17.8 | ||||
LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 16.8 | ||||
LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 16.8 | ||||
LDTP11615 | Protein tweety homolog 3 (TTYH3) | 16.4 | ||||
LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 15.7 | ||||
LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 15.1 | ||||
LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 14.9 | ||||
LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 14.9 | ||||
LDTP02215 | Prosaposin (PSAP) | 14.5 | ||||
LDTP12383 | Protein GPR108 (GPR108) | 14.4 | ||||
LDTP11844 | Protein spinster homolog 1 (SPNS1) | 14.3 | ||||
LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 13.8 | ||||
LDTP15733 | Solute carrier family 25 member 44 (SLC25A44) | 13.7 | ||||
LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 13.5 | ||||
LDTP01100 | Iron-sulfur clusters transporter ABCB7, mitochondrial (ABCB7) | 13.2 | ||||
LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 13.2 | ||||
LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 13.0 | ||||
LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 12.6 | ||||
LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 12.1 | ||||
LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 11.8 | ||||
LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 11.8 | ||||
LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 11.7 | ||||
LDTP11245 | Derlin-1 (DERL1) | 11.6 | ||||
LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 11.5 | ||||
LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 11.4 | ||||
LDTP13833 | Integral membrane protein 2B (ITM2B) | 10.6 | ||||
LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 10.6 | ||||
LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 10.4 | ||||
LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 10.3 | ||||
LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 10.3 | ||||
LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 10.3 | ||||
LDTP05900 | Metaxin-1 (MTX1) | 10.2 | ||||
LDTP10065 | Transmembrane protein 230 (TMEM230) | 9.9 | ||||
LDTP11406 | Transmembrane protein 59 (TMEM59) | 9.8 | ||||
LDTP13262 | Signal recognition particle subunit SRP68 (SRP68) | 9.7 | ||||
LDTP04956 | Mitochondrial import inner membrane translocase subunit Tim10 (TIMM10) | 9.6 | ||||
LDTP04463 | H(+)/Cl(-) exchange transporter 7 (CLCN7) | 9.1 | ||||
LDTP11927 | Essential MCU regulator, mitochondrial (SMDT1) | 9.0 | ||||
LDTP01160 | Peroxisomal membrane protein 11A (PEX11A) | 9.0 | ||||
LDTP11213 | Nucleoporin NDC1 (NDC1) | 8.7 | ||||
LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 8.6 | ||||
LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 8.6 | ||||
LDTP15967 | Tetraspanin-10 (TSPAN10) | 8.6 | ||||
LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 8.5 | ||||
LDTP11626 | Protein YIPF3 (YIPF3) | 8.5 | ||||
LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 8.3 | ||||
LDTP01601 | Activator of 90 kDa heat shock protein ATPase homolog 1 (AHSA1) | 8.2 | ||||
LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 8.2 | ||||
LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 8.2 | ||||
LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 8.1 | ||||
LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 7.9 | ||||
LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 7.7 | ||||
LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 7.7 | ||||
LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 7.5 | ||||
LDTP14636 | Solute carrier family 25 member 16 (SLC25A16) | 7.5 | ||||
LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 7.4 | ||||
LDTP11250 | MICOS complex subunit MIC26 (APOO) | 7.4 | ||||
LDTP14181 | Peroxisomal membrane protein PEX16 (PEX16) | 7.4 | ||||
LDTP04597 | Methylosome subunit pICln (CLNS1A) | 7.3 | ||||
LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 7.2 | ||||
LDTP11812 | Protein ARV1 (ARV1) | 7.2 | ||||
LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 7.1 | ||||
LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 7.1 | ||||
LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 6.9 | ||||
LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 6.8 | ||||
LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 6.7 | ||||
LDTP07667 | Transmembrane protein 205 (TMEM205) | 6.7 | ||||
LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 6.7 | ||||
LDTP00592 | Surfeit locus protein 4 (SURF4) | 6.7 | ||||
LDTP12451 | Integral membrane protein 2C (ITM2C) | 6.5 | ||||
LDTP09288 | Vang-like protein 1 (VANGL1) | 6.5 | ||||
LDTP00857 | Syntaxin-6 (STX6) | 6.5 | ||||
LDTP08981 | Cytochrome c oxidase assembly protein COX18, mitochondrial (COX18) | 6.4 | ||||
LDTP07156 | Protein wntless homolog (WLS) | 6.4 | ||||
LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 6.4 | ||||
LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 6.2 | ||||
LDTP09144 | Metal transporter CNNM3 (CNNM3) | 6.1 | ||||
LDTP14275 | Sodium bicarbonate cotransporter 3 (SLC4A7) | 6.1 |
Other
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP15104 | Ankyrin repeat domain-containing protein 54 (ANKRD54) | 43.7 | ||||
LDTP16006 | Optic atrophy 3 protein (OPA3) | 34.5 | ||||
LDTP05160 | Nucleobindin-2 (NUCB2) | 26.0 | ||||
LDTP01522 | Reticulon-3 (RTN3) | 21.9 | ||||
LDTP00105 | Protein unc-119 homolog B (UNC119B) | 19.8 | ||||
LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 19.0 | ||||
LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 17.5 | ||||
LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 16.4 | ||||
LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 16.2 | ||||
LDTP11076 | Apolipoprotein L2 (APOL2) | 15.8 | ||||
LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 14.9 | ||||
LDTP14458 | Tetraspanin-6 (TSPAN6) | 14.6 | ||||
LDTP08594 | Negative elongation factor C/D (NELFCD) | 13.6 | ||||
LDTP16080 | Protein FAM114A2 (FAM114A2) | 13.6 | ||||
LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | 13.5 | ||||
LDTP10381 | Peroxisomal membrane protein 11C (PEX11G) | 13.5 | ||||
LDTP13086 | Syntaxin-18 (STX18) | 13.0 | ||||
LDTP13214 | UPF0449 protein C19orf25 (C19orf25) | 12.9 | ||||
LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 12.8 | ||||
LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 12.5 | ||||
LDTP15599 | UPF0729 protein C18orf32 (C18orf32) | 12.5 | ||||
LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 12.4 | ||||
LDTP06892 | Protein Hikeshi (HIKESHI) | 12.2 | ||||
LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 12.1 | ||||
LDTP17652 | Uncharacterized protein KIAA2013 (KIAA2013) | 11.6 | ||||
LDTP10056 | Protein FAM162A (FAM162A) | 11.4 | ||||
LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 11.2 | ||||
LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 11.2 | ||||
LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 11.0 | ||||
LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 11.0 | ||||
LDTP01075 | Protein CutA (CUTA) | 10.9 | ||||
LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 10.9 | ||||
LDTP13560 | Vang-like protein 2 (VANGL2) | 10.9 | ||||
LDTP01652 | Centrosomal protein 43 (CEP43) | 10.8 | ||||
LDTP06948 | Protein YIF1B (YIF1B) | 10.8 | ||||
LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 10.6 | ||||
LDTP05375 | Nucleobindin-1 (NUCB1) | 10.6 | ||||
LDTP10263 | KIF-binding protein (KIFBP) | 10.5 | ||||
LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 10.3 | ||||
LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 9.4 | ||||
LDTP00986 | Syntaxin-10 (STX10) | 9.4 | ||||
LDTP05904 | Tubulin beta-3 chain (TUBB3) | 9.2 | ||||
LDTP12746 | Gem-associated protein 8 (GEMIN8) | 9.0 | ||||
LDTP14792 | Small ribosomal subunit protein uS9m (MRPS9) | 9.0 | ||||
LDTP18883 | Protein CEBPZOS (CEBPZOS) | 8.9 | ||||
LDTP10357 | RUS family member 1 (RUSF1) | 8.8 | ||||
LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 8.8 | ||||
LDTP17003 | Matrix-remodeling-associated protein 7 (MXRA7) | 8.6 | ||||
LDTP10116 | Lipid droplet assembly factor 1 (LDAF1) | 8.5 | ||||
LDTP02345 | Retinol-binding protein 1 (RBP1) | 8.5 | ||||
LDTP15634 | Ubiquinol-cytochrome c reductase complex assembly factor 5 (UQCC5) | 8.3 | ||||
LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 8.3 | ||||
LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 8.2 | ||||
LDTP19963 | TraB domain-containing protein (TRABD) | 8.2 | ||||
LDTP06097 | Reticulocalbin-2 (RCN2) | 8.1 | ||||
LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 8.0 | ||||
LDTP13922 | Tudor and KH domain-containing protein (TDRKH) | 7.9 | ||||
LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 7.8 | ||||
LDTP13797 | HIG1 domain family member 1A, mitochondrial (HIGD1A) | 7.8 | ||||
LDTP15240 | LysM and putative peptidoglycan-binding domain-containing protein 3 (LYSMD3) | 7.8 | ||||
LDTP13870 | Nischarin (NISCH) | 7.6 | ||||
LDTP00729 | Glycosylphosphatidylinositol anchor attachment 1 protein (GPAA1) | 7.4 | ||||
LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 7.4 | ||||
LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 7.4 | ||||
LDTP10452 | Conserved oligomeric Golgi complex subunit 3 (COG3) | 7.3 | ||||
LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 7.3 | ||||
LDTP08224 | Protein LYRIC (MTDH) | 7.2 | ||||
LDTP15887 | Lipase maturation factor 2 (LMF2) | 7.1 | ||||
LDTP12982 | Mitochondrial import receptor subunit TOM7 homolog (TOMM7) | 7.1 | ||||
LDTP09970 | RNA-binding protein with multiple splicing (RBPMS) | 7.0 | ||||
LDTP12025 | UPF0488 protein C8orf33 (C8orf33) | 7.0 | ||||
LDTP12948 | Charged multivesicular body protein 5 (CHMP5) | 6.9 | ||||
LDTP13517 | Paraneoplastic antigen Ma2 (PNMA2) | 6.9 | ||||
LDTP03775 | RNA-binding protein FUS (FUS) | 6.8 | ||||
LDTP01359 | Dynactin subunit 3 (DCTN3) | 6.8 | ||||
LDTP14058 | Rap guanine nucleotide exchange factor 2 (RAPGEF2) | 6.7 | ||||
LDTP00859 | Synaptogyrin-2 (SYNGR2) | 6.7 | ||||
LDTP14217 | Lipid droplet-regulating VLDL assembly factor AUP1 (AUP1) | 6.6 | ||||
LDTP09297 | Large ribosomal subunit protein mL64 (GADD45GIP1) | 6.5 | ||||
LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 6.5 | ||||
LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 6.4 | ||||
LDTP01163 | Ubiquinone biosynthesis protein COQ9, mitochondrial (COQ9) | 6.4 | ||||
LDTP15714 | Mdm2-binding protein (MTBP) | 6.4 | ||||
LDTP05960 | Trophoblast glycoprotein (TPBG) | 6.3 | ||||
LDTP01213 | Cell division control protein 45 homolog (CDC45) | 6.3 | ||||
LDTP12412 | Reticulon-4 (RTN4) | 6.2 | ||||
LDTP12379 | Complex I assembly factor TIMMDC1, mitochondrial (TIMMDC1) | 6.2 | ||||
LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 6.2 | ||||
LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 6.1 | ||||
LDTP04714 | Heterogeneous nuclear ribonucleoprotein H2 (HNRNPH2) | 6.1 |