Details of the Probe-central Interaction Altas
General Information of Experiment
Probe Name | C160 | Probe Info | ||||
---|---|---|---|---|---|---|
Probe concentration | Probe:50uM; negative probe:50uM | |||||
Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
Quantitative Method |
TMT
|
|||||
In Vivo Experiment Model | Model Type |
|
Living cell | |||
Derived Tissue |
|
Peripheral blood | ||||
Disease Model | Normal | |||||
Model Name | Human normal cells (HEK-293T) | |||||
Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 |
Interaction Altas of This Experiment [1]
Enzyme
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP00697 | Cytochrome b5 type B (CYB5B) | 56.1 | ||||
LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 55.3 | ||||
LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 54.2 | ||||
LDTP12610 | Obg-like ATPase 1 (OLA1) | 43.7 | ||||
LDTP04327 | Cytosolic purine 5'-nucleotidase (NT5C2) | 35.0 | ||||
LDTP05346 | Methylmalonate-semialdehyde/malonate-semialdehyde dehydrogenase [acylating], mitochondrial (ALDH6A1) | 35.0 | ||||
LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 27.5 | ||||
LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 27.5 | ||||
LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 27.1 | ||||
LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 25.5 | ||||
LDTP03540 | Heme oxygenase 2 (HMOX2) | 25.3 | ||||
LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 25.1 | ||||
LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 24.9 | ||||
LDTP09391 | Ceramide kinase (CERK) | 23.4 | ||||
LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 23.4 | ||||
LDTP01769 | Dihydrofolate reductase (DHFR) | 22.8 | ||||
LDTP06511 | Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial (ETFDH) | 22.5 | ||||
LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 22.5 | ||||
LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 22.2 | ||||
LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 21.4 | ||||
LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 21.0 | ||||
LDTP02505 | Lysosomal protective protein (CTSA) | 20.4 | ||||
LDTP10329 | Ceramide synthase 2 (CERS2) | 20.1 | ||||
LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 19.7 | ||||
LDTP02359 | Heme oxygenase 1 (HMOX1) | 19.7 | ||||
LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 19.6 | ||||
LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 19.4 | ||||
LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 19.2 | ||||
LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 18.6 | ||||
LDTP11127 | ADP-dependent glucokinase (ADPGK) | 18.5 | ||||
LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 17.6 | ||||
LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 17.4 | ||||
LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 17.0 | ||||
LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 16.4 | ||||
LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 16.1 | ||||
LDTP03394 | Ceramide synthase 1 (CERS1) | 16.0 | ||||
LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 16.0 | ||||
LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 16.0 | ||||
LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 15.8 | ||||
LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 15.2 | ||||
LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 15.2 | ||||
LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 14.4 | ||||
LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 13.7 | ||||
LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 13.5 | ||||
LDTP06779 | Triokinase/FMN cyclase (TKFC) | 13.5 | ||||
LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 13.4 | ||||
LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 12.8 | ||||
LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 12.8 | ||||
LDTP06849 | Prolyl endopeptidase-like (PREPL) | 12.8 | ||||
LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 12.7 | ||||
LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 12.6 | ||||
LDTP07831 | Transmembrane protein with metallophosphoesterase domain (TMPPE) | 12.3 | ||||
LDTP00032 | 2-hydroxyacyl-CoA lyase 2 (ILVBL) | 12.0 | ||||
LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 12.0 | ||||
LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 12.0 | ||||
LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 11.9 | ||||
LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 11.9 | ||||
LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 11.8 | ||||
LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 11.8 | ||||
LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 11.7 | ||||
LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 11.6 | ||||
LDTP10249 | Metalloendopeptidase OMA1, mitochondrial (OMA1) | 11.6 | ||||
LDTP00544 | Sphingolipid delta(4)-desaturase DES1 (DEGS1) | 11.6 | ||||
LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 11.5 | ||||
LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 11.4 | ||||
LDTP03842 | Squalene synthase (FDFT1) | 11.1 | ||||
LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 11.0 | ||||
LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 10.9 | ||||
LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 10.7 | ||||
LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 10.6 | ||||
LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 10.5 | ||||
LDTP13131 | 7-dehydrocholesterol reductase (DHCR7) | 10.4 | ||||
LDTP00988 | Protein O-GlcNAcase (OGA) | 10.3 | ||||
LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 10.2 | ||||
LDTP03787 | Choline kinase alpha (CHKA) | 10.1 | ||||
LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 9.9 | ||||
LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 9.8 | ||||
LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 9.8 | ||||
LDTP07503 | Endoplasmic reticulum aminopeptidase 2 (ERAP2) | 9.8 | ||||
LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 9.7 | ||||
LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 9.7 | ||||
LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 9.6 | ||||
LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 9.6 | ||||
LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 9.6 | ||||
LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 9.5 | ||||
LDTP00717 | Bifunctional 3'-phosphoadenosine 5'-phosphosulfate synthase 1 (PAPSS1) | 9.5 | ||||
LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 9.4 | ||||
LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 9.4 | ||||
LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 9.3 | ||||
LDTP03060 | Proteasome subunit beta type-1 (PSMB1) | 9.3 | ||||
LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 9.2 | ||||
LDTP14264 | Choline/ethanolaminephosphotransferase 1 (CEPT1) | 9.1 | ||||
LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 9.1 | ||||
LDTP00804 | E3 ubiquitin-protein ligase RNF13 (RNF13) | 9.0 | ||||
LDTP12639 | 1-acyl-sn-glycerol-3-phosphate acyltransferase epsilon (AGPAT5) | 8.9 | ||||
LDTP10101 | Peptidyl-prolyl cis-trans isomerase FKBP10 (FKBP10) | 8.9 | ||||
LDTP05905 | Acid ceramidase (ASAH1) | 8.8 | ||||
LDTP13409 | Anaphase-promoting complex subunit 7 (ANAPC7) | 8.8 | ||||
LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 8.8 | ||||
LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 8.7 | ||||
LDTP13986 | Vesicle transport protein GOT1B (GOLT1B) | 8.7 | ||||
LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 8.6 | ||||
LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 8.5 | ||||
LDTP00975 | Mannosyl-oligosaccharide 1,2-alpha-mannosidase IB (MAN1A2) | 8.5 | ||||
LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 8.4 | ||||
LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 8.3 | ||||
LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 8.2 | ||||
LDTP15097 | All-trans-retinol 13,14-reductase (RETSAT) | 8.1 | ||||
LDTP06617 | Ceramide glucosyltransferase (UGCG) | 8.1 | ||||
LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 8.1 | ||||
LDTP02539 | Lysosomal acid phosphatase (ACP2) | 8.1 | ||||
LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 8.0 | ||||
LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 8.0 | ||||
LDTP14278 | Sulfide:quinone oxidoreductase, mitochondrial (SQOR) | 8.0 | ||||
LDTP02837 | Beta-galactosidase (GLB1) | 7.9 | ||||
LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 7.8 | ||||
LDTP11199 | DCN1-like protein 5 (DCUN1D5) | 7.8 | ||||
LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 7.8 | ||||
LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 7.7 | ||||
LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 7.7 | ||||
LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 7.7 | ||||
LDTP02141 | Alpha-galactosidase A (GLA) | 7.6 | ||||
LDTP00462 | Branched-chain alpha-ketoacid dehydrogenase kinase (BCKDK) | 7.6 | ||||
LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 7.5 | ||||
LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 7.5 | ||||
LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 7.5 | ||||
LDTP11225 | Deoxyhypusine hydroxylase (DOHH) | 7.4 | ||||
LDTP15453 | ATP-dependent RNA helicase DDX51 (DDX51) | 7.3 | ||||
LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 7.3 | ||||
LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 7.3 | ||||
LDTP17247 | 5'-nucleotidase domain-containing protein 1 (NT5DC1) | 7.2 | ||||
LDTP10020 | Ras-related protein Rab-24 (RAB24) | 7.2 | ||||
LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 7.1 | ||||
LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 7.1 | ||||
LDTP03560 | Aldehyde dehydrogenase X, mitochondrial (ALDH1B1) | 7.0 | ||||
LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 6.9 | ||||
LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 6.9 | ||||
LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 6.9 | ||||
LDTP03145 | Catechol O-methyltransferase (COMT) | 6.9 | ||||
LDTP12586 | Phenylalanine--tRNA ligase beta subunit (FARSB) | 6.9 | ||||
LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 6.9 |
Transporter and channel
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 99.7 | ||||
LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 64.0 | ||||
LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 51.3 | ||||
LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 49.2 | ||||
LDTP15948 | Transmembrane protein 126A (TMEM126A) | 43.1 | ||||
LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 40.5 | ||||
LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 39.7 | ||||
LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 38.6 | ||||
LDTP07236 | Protein GPR107 (GPR107) | 33.4 | ||||
LDTP11615 | Protein tweety homolog 3 (TTYH3) | 30.7 | ||||
LDTP16813 | Tetraspanin-3 (TSPAN3) | 29.2 | ||||
LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 26.4 | ||||
LDTP08881 | Transmembrane protein 199 (TMEM199) | 26.2 | ||||
LDTP11406 | Transmembrane protein 59 (TMEM59) | 26.2 | ||||
LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 23.1 | ||||
LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 22.6 | ||||
LDTP14140 | Ceramide transfer protein (CERT1) | 22.6 | ||||
LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 22.3 | ||||
LDTP11136 | Sugar transporter SWEET1 (SLC50A1) | 21.7 | ||||
LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 21.1 | ||||
LDTP02256 | Amino acid transporter heavy chain SLC3A2 (SLC3A2) | 21.0 | ||||
LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 20.5 | ||||
LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 19.6 | ||||
LDTP12383 | Protein GPR108 (GPR108) | 19.3 | ||||
LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 18.9 | ||||
LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 18.8 | ||||
LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 18.6 | ||||
LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 18.1 | ||||
LDTP02071 | Amyloid-beta precursor protein (APP) | 17.9 | ||||
LDTP07531 | Sideroflexin-4 (SFXN4) | 17.9 | ||||
LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 17.8 | ||||
LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 17.4 | ||||
LDTP09028 | Mitoguardin 1 (MIGA1) | 16.9 | ||||
LDTP05900 | Metaxin-1 (MTX1) | 15.5 | ||||
LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 15.2 | ||||
LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 15.1 | ||||
LDTP02215 | Prosaposin (PSAP) | 15.0 | ||||
LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 14.8 | ||||
LDTP16163 | Cytochrome c oxidase assembly protein COX16 homolog, mitochondrial (COX16) | 14.6 | ||||
LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 14.5 | ||||
LDTP11245 | Derlin-1 (DERL1) | 13.8 | ||||
LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 13.6 | ||||
LDTP06293 | Metal cation symporter ZIP14 (SLC39A14) | 13.1 | ||||
LDTP08016 | Proton-coupled amino acid transporter 1 (SLC36A1) | 13.1 | ||||
LDTP05662 | Cell division cycle protein 20 homolog (CDC20) | 13.0 | ||||
LDTP13833 | Integral membrane protein 2B (ITM2B) | 13.0 | ||||
LDTP11407 | AP-1 complex subunit mu-1 (AP1M1) | 12.9 | ||||
LDTP11213 | Nucleoporin NDC1 (NDC1) | 12.3 | ||||
LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 12.2 | ||||
LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 11.6 | ||||
LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 11.6 | ||||
LDTP05706 | Disks large homolog 1 (DLG1) | 11.5 | ||||
LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 11.3 | ||||
LDTP11844 | Protein spinster homolog 1 (SPNS1) | 11.2 | ||||
LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 11.0 | ||||
LDTP17106 | Solute carrier family 25 member 35 (SLC25A35) | 10.8 | ||||
LDTP15979 | Transmembrane protein 245 (TMEM245) | 10.7 | ||||
LDTP01217 | Metaxin-2 (MTX2) | 10.6 | ||||
LDTP07156 | Protein wntless homolog (WLS) | 10.5 | ||||
LDTP10065 | Transmembrane protein 230 (TMEM230) | 10.2 | ||||
LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 10.1 | ||||
LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 10.1 | ||||
LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 9.9 | ||||
LDTP15733 | Solute carrier family 25 member 44 (SLC25A44) | 9.9 | ||||
LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 9.7 | ||||
LDTP04707 | Protein SEC13 homolog (SEC13) | 9.6 | ||||
LDTP12451 | Integral membrane protein 2C (ITM2C) | 9.5 | ||||
LDTP16190 | Protein FAM8A1 (FAM8A1) | 9.4 | ||||
LDTP09294 | Proton-coupled zinc antiporter SLC30A5 (SLC30A5) | 9.4 | ||||
LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 9.3 | ||||
LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 9.3 | ||||
LDTP08673 | Calcium uptake protein 2, mitochondrial (MICU2) | 9.2 | ||||
LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 9.1 | ||||
LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 8.9 | ||||
LDTP01969 | Transferrin receptor protein 1 (TFRC) | 8.8 | ||||
LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 8.3 | ||||
LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 8.3 | ||||
LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | 8.1 | ||||
LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 8.0 | ||||
LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 8.0 | ||||
LDTP04787 | Transmembrane protein 33 (TMEM33) | 8.0 | ||||
LDTP14275 | Sodium bicarbonate cotransporter 3 (SLC4A7) | 7.9 | ||||
LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 7.7 | ||||
LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 7.7 | ||||
LDTP09288 | Vang-like protein 1 (VANGL1) | 7.6 | ||||
LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 7.5 | ||||
LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 7.5 | ||||
LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 7.5 | ||||
LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 7.4 | ||||
LDTP14181 | Peroxisomal membrane protein PEX16 (PEX16) | 7.4 | ||||
LDTP02544 | Solute carrier family 2, facilitated glucose transporter member 1 (SLC2A1) | 7.4 | ||||
LDTP03546 | Translocator protein (TSPO) | 7.3 | ||||
LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 7.3 | ||||
LDTP15648 | BRI3-binding protein (BRI3BP) | 7.2 | ||||
LDTP04463 | H(+)/Cl(-) exchange transporter 7 (CLCN7) | 7.1 | ||||
LDTP07610 | Proton-coupled zinc antiporter SLC30A9, mitochondrial (SLC30A9) | 7.1 | ||||
LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 7.0 | ||||
LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 7.0 | ||||
LDTP06855 | Anoctamin-6 (ANO6) | 7.0 | ||||
LDTP00821 | Mitochondrial import inner membrane translocase subunit TIM44 (TIMM44) | 7.0 | ||||
LDTP00010 | Intraflagellar transport protein 56 (IFT56) | 6.9 | ||||
LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 6.9 |
Transcription factor
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 8.2 |
Immunoglobulin
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP11441 | Cell adhesion molecule 1 (CADM1) | 7.6 | ||||
LDTP03772 | Basigin (BSG) | 7.0 |
Other
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 99.7 | ||||
LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 68.6 | ||||
LDTP05375 | Nucleobindin-1 (NUCB1) | 41.4 | ||||
LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 38.1 | ||||
LDTP05160 | Nucleobindin-2 (NUCB2) | 36.5 | ||||
LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 32.4 | ||||
LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 31.3 | ||||
LDTP14458 | Tetraspanin-6 (TSPAN6) | 29.9 | ||||
LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 29.7 | ||||
LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 26.9 | ||||
LDTP18883 | Protein CEBPZOS (CEBPZOS) | 26.7 | ||||
LDTP06121 | Caprin-1 (CAPRIN1) | 26.0 | ||||
LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 25.1 | ||||
LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 24.9 | ||||
LDTP00986 | Syntaxin-10 (STX10) | 24.4 | ||||
LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 23.9 | ||||
LDTP06562 | Histone-binding protein RBBP7 (RBBP7) | 22.8 | ||||
LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 21.1 | ||||
LDTP00105 | Protein unc-119 homolog B (UNC119B) | 21.0 | ||||
LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 20.0 | ||||
LDTP01522 | Reticulon-3 (RTN3) | 20.0 | ||||
LDTP12412 | Reticulon-4 (RTN4) | 19.4 | ||||
LDTP05868 | Protein unc-119 homolog A (UNC119) | 18.4 | ||||
LDTP14263 | TAF6-like RNA polymerase II p300/CBP-associated factor-associated factor 65 kDa subunit 6L (TAF6L) | 16.6 | ||||
LDTP13086 | Syntaxin-18 (STX18) | 14.7 | ||||
LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 14.4 | ||||
LDTP00859 | Synaptogyrin-2 (SYNGR2) | 13.8 | ||||
LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 13.4 | ||||
LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 13.2 | ||||
LDTP11143 | Centromere protein K (CENPK) | 12.8 | ||||
LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 12.4 | ||||
LDTP00779 | Trans-Golgi network integral membrane protein 2 (TGOLN2) | 11.7 | ||||
LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 11.6 | ||||
LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 11.6 | ||||
LDTP16006 | Optic atrophy 3 protein (OPA3) | 11.5 | ||||
LDTP08224 | Protein LYRIC (MTDH) | 11.4 | ||||
LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 11.2 | ||||
LDTP16080 | Protein FAM114A2 (FAM114A2) | 10.9 | ||||
LDTP05277 | Protein SET (SET) | 10.7 | ||||
LDTP09069 | Kinetochore protein Spc24 (SPC24) | 10.6 | ||||
LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 10.5 | ||||
LDTP10056 | Protein FAM162A (FAM162A) | 10.2 | ||||
LDTP05711 | Nuclear inhibitor of protein phosphatase 1 (PPP1R8) | 10.1 | ||||
LDTP06302 | Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 (ACAP2) | 9.8 | ||||
LDTP14792 | Small ribosomal subunit protein uS9m (MRPS9) | 9.8 | ||||
LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 9.8 | ||||
LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 9.7 | ||||
LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 9.6 | ||||
LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 9.6 | ||||
LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 9.6 | ||||
LDTP12545 | Protein kish-B (TMEM167B) | 9.5 | ||||
LDTP19963 | TraB domain-containing protein (TRABD) | 9.4 | ||||
LDTP06097 | Reticulocalbin-2 (RCN2) | 9.4 | ||||
LDTP10281 | Cytoplasmic dynein 2 intermediate chain 2 (DYNC2I2) | 9.3 | ||||
LDTP01494 | Protein YIF1A (YIF1A) | 9.3 | ||||
LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 9.2 | ||||
LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 9.1 | ||||
LDTP07476 | RAD50-interacting protein 1 (RINT1) | 9.0 | ||||
LDTP15701 | EF-hand domain-containing protein D2 (EFHD2) | 8.8 | ||||
LDTP14304 | MAU2 chromatid cohesion factor homolog (MAU2) | 8.6 | ||||
LDTP17713 | Tetratricopeptide repeat protein 39C (TTC39C) | 8.6 | ||||
LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 8.5 | ||||
LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 8.2 | ||||
LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 8.2 | ||||
LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 8.1 | ||||
LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 8.1 | ||||
LDTP04207 | Heat shock 70 kDa protein 13 (HSPA13) | 8.0 | ||||
LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 7.8 | ||||
LDTP02927 | Ganglioside GM2 activator (GM2A) | 7.7 | ||||
LDTP02181 | Neurofilament medium polypeptide (NEFM) | 7.7 | ||||
LDTP13125 | Protein UXT (UXT) | 7.7 | ||||
LDTP14126 | Mitochondrial import inner membrane translocase subunit Tim9 (TIMM9) | 7.6 | ||||
LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 7.6 | ||||
LDTP01167 | Reticulon-2 (RTN2) | 7.5 | ||||
LDTP02037 | Tubulin beta-4A chain (TUBB4A) | 7.5 | ||||
LDTP15623 | Neuferricin (CYB5D2) | 7.5 | ||||
LDTP18272 | Transmembrane protein 209 (TMEM209) | 7.4 | ||||
LDTP07598 | BRCA1-associated ATM activator 1 (BRAT1) | 7.3 | ||||
LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 7.3 | ||||
LDTP01359 | Dynactin subunit 3 (DCTN3) | 7.3 | ||||
LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 7.3 | ||||
LDTP09861 | General transcription factor IIH subunit 4 (GTF2H4) | 7.2 | ||||
LDTP03926 | Centrin-2 (CETN2) | 7.1 | ||||
LDTP06068 | MAGUK p55 subfamily member 2 (MPP2) | 7.1 | ||||
LDTP12651 | TBC1 domain family member 23 (TBC1D23) | 7.1 | ||||
LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 7.0 | ||||
LDTP09920 | Golgi apparatus protein 1 (GLG1) | 7.0 | ||||
LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 7.0 | ||||
LDTP07031 | Collectin-12 (COLEC12) | 7.0 | ||||
LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 7.0 | ||||
LDTP07906 | Mediator of RNA polymerase II transcription subunit 25 (MED25) | 6.9 | ||||
LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | 6.9 | ||||
LDTP11233 | Tubulin beta-6 chain (TUBB6) | 6.9 | ||||
LDTP17652 | Uncharacterized protein KIAA2013 (KIAA2013) | 6.9 |