Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C314 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01803 | Adenosine deaminase (ADA) | 86.8 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 73.0 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 64.9 | ||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 62.7 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 58.5 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 55.7 | ||||
| LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 50.2 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 49.9 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 47.2 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 45.6 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 44.0 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 42.2 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 39.9 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 39.9 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 39.4 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 35.3 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 34.8 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 32.7 | ||||
| LDTP12197 | Ethanolamine kinase 1 (ETNK1) | 32.2 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 31.6 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 30.5 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 28.8 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 26.9 | ||||
| LDTP02713 | Macrophage migration inhibitory factor (MIF) | 26.9 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 26.7 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 25.6 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 25.5 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 25.3 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 25.3 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 24.9 | ||||
| LDTP03677 | Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA (MAN1A1) | 24.3 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 24.1 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 23.6 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 22.8 | ||||
| LDTP10322 | Abasic site processing protein HMCES (HMCES) | 22.2 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 22.2 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 22.0 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 21.9 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 21.7 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 21.3 | ||||
| LDTP03680 | DNA replication licensing factor MCM4 (MCM4) | 21.3 | ||||
| LDTP09074 | UDP-glucuronic acid decarboxylase 1 (UXS1) | 20.8 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 19.8 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 19.8 | ||||
| LDTP13972 | Oligoribonuclease, mitochondrial (REXO2) | 19.4 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 19.3 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 19.2 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 19.0 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 18.9 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 18.3 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 18.3 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 17.8 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 17.6 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 17.3 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 17.1 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 17.0 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 16.9 | ||||
| LDTP02223 | Cathepsin B (CTSB) | 16.8 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 16.4 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 16.4 | ||||
| LDTP17305 | Glycosyltransferase 8 domain-containing protein 1 (GLT8D1) | 15.9 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 15.9 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 15.9 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 15.9 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 15.8 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 15.8 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 15.7 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 15.7 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 15.6 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 15.6 | ||||
| LDTP11762 | DNA-directed RNA polymerase III subunit RPC6 (POLR3F) | 15.3 | ||||
| LDTP11081 | NAD-capped RNA hydrolase NUDT12 (NUDT12) | 15.3 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 15.2 | ||||
| LDTP10495 | Ubiquitin carboxyl-terminal hydrolase 47 (USP47) | 15.2 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 15.0 | ||||
| LDTP04211 | Isocitrate dehydrogenase [NADP], mitochondrial (IDH2) | 14.9 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 14.9 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 14.8 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 14.8 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 14.4 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 14.3 | ||||
| LDTP09285 | Atypical kinase COQ8A, mitochondrial (COQ8A) | 14.2 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 14.0 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 14.0 | ||||
| LDTP13409 | Anaphase-promoting complex subunit 7 (ANAPC7) | 13.9 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 13.9 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 13.9 | ||||
| LDTP13663 | Dual specificity protein phosphatase 12 (DUSP12) | 13.7 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 13.7 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 13.6 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 13.5 | ||||
| LDTP00773 | Serine protease HTRA2, mitochondrial (HTRA2) | 13.5 | ||||
| LDTP08799 | Lysophosphatidylserine lipase ABHD12 (ABHD12) | 13.5 | ||||
| LDTP11535 | Ras-related protein Rab-34 (RAB34) | 13.5 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 13.5 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 13.3 | ||||
| LDTP04893 | Ras-related protein Rab-5B (RAB5B) | 13.3 | ||||
| LDTP00316 | Ribonuclease T2 (RNASET2) | 13.3 | ||||
| LDTP02006 | Tissue alpha-L-fucosidase (FUCA1) | 12.9 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 12.8 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 12.8 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 12.7 | ||||
| LDTP05460 | Elongation factor 1-alpha 2 (EEF1A2) | 12.6 | ||||
| LDTP13154 | E3 ubiquitin-protein ligase RNF14 (RNF14) | 12.5 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 12.4 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 12.3 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 12.1 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 12.1 | ||||
| LDTP09925 | COP9 signalosome complex subunit 5 (COPS5) | 12.0 | ||||
| LDTP12109 | Ribitol 5-phosphate transferase FKRP (FKRP) | 12.0 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 12.0 | ||||
| LDTP01333 | Isocitrate dehydrogenase [NADP] cytoplasmic (IDH1) | 11.9 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 11.9 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 11.9 | ||||
| LDTP07813 | Sulfhydryl oxidase 2 (QSOX2) | 11.7 | ||||
| LDTP01300 | Cartilage-associated protein (CRTAP) | 11.6 | ||||
| LDTP07503 | Endoplasmic reticulum aminopeptidase 2 (ERAP2) | 11.5 | ||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 11.5 | ||||
| LDTP03050 | Ras-related protein Rab-5A (RAB5A) | 11.5 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 11.5 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 11.4 | ||||
| LDTP07525 | Protein arginine N-methyltransferase 9 (PRMT9) | 11.4 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 11.3 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 87.4 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 70.5 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 66.3 | ||||
| LDTP04227 | Guided entry of tail-anchored proteins factor CAMLG (CAMLG) | 65.8 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 65.3 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 59.3 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 57.7 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 56.5 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 50.6 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 43.4 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 40.5 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 38.9 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 38.9 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 38.3 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 36.8 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 35.8 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 35.8 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 34.5 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 34.3 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 34.1 | ||||
| LDTP02215 | Prosaposin (PSAP) | 31.8 | ||||
| LDTP06702 | WASH complex subunit 4 (WASHC4) | 30.3 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 29.2 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 29.2 | ||||
| LDTP00857 | Syntaxin-6 (STX6) | 27.5 | ||||
| LDTP14181 | Peroxisomal membrane protein PEX16 (PEX16) | 26.7 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 26.4 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 26.2 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 26.2 | ||||
| LDTP01601 | Activator of 90 kDa heat shock protein ATPase homolog 1 (AHSA1) | 26.0 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 24.3 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 23.6 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 22.8 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 22.5 | ||||
| LDTP14970 | Metaxin-3 (MTX3) | 21.3 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 21.3 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 19.6 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 19.6 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 19.4 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 19.3 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 18.9 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 18.6 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 18.4 | ||||
| LDTP03546 | Translocator protein (TSPO) | 18.4 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 17.8 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 17.8 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 17.5 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 17.0 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 16.9 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 16.8 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 16.7 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 15.9 | ||||
| LDTP10533 | Sorting nexin-27 (SNX27) | 15.8 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 15.7 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 15.7 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 15.6 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 15.6 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 15.5 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 15.2 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 15.2 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 15.2 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 14.8 | ||||
| LDTP01043 | Sorting nexin-2 (SNX2) | 14.8 | ||||
| LDTP08016 | Proton-coupled amino acid transporter 1 (SLC36A1) | 14.7 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 14.5 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 14.5 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 14.1 | ||||
| LDTP10731 | Sodium-coupled neutral amino acid symporter 2 (SLC38A2) | 13.6 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 13.5 | ||||
| LDTP08981 | Cytochrome c oxidase assembly protein COX18, mitochondrial (COX18) | 13.3 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 13.3 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 13.2 | ||||
| LDTP14275 | Sodium bicarbonate cotransporter 3 (SLC4A7) | 13.2 | ||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | 12.5 | ||||
| LDTP11634 | Derlin-2 (DERL2) | 12.3 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 12.3 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 12.3 | ||||
| LDTP11041 | Calcium uptake protein 1, mitochondrial (MICU1) | 12.1 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 11.9 | ||||
| LDTP03380 | Stomatin (STOM) | 11.9 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 11.7 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 11.6 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 11.6 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 11.5 | ||||
| LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 11.4 | ||||
| LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 11.3 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 11.3 | ||||
| LDTP02352 | Clathrin light chain A (CLTA) | 11.2 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 15.6 | ||||
| LDTP05065 | Y-box-binding protein 1 (YBX1) | 13.2 | ||||
| LDTP12507 | Chromatin accessibility complex protein 1 (CHRAC1) | 12.5 | ||||
| LDTP10195 | G-protein coupled receptor-associated sorting protein 2 (GPRASP2) | 12.2 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | 15.3 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 99.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 75.1 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 53.8 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 53.1 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 51.3 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 48.2 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 47.2 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 45.6 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 41.1 | ||||
| LDTP01279 | Protein CREG1 (CREG1) | 33.4 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 32.9 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 30.1 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 29.2 | ||||
| LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 29.2 | ||||
| LDTP00871 | Microtubule nucleation factor SSNA1 (SSNA1) | 27.9 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 25.3 | ||||
| LDTP10487 | Protein SERAC1 (SERAC1) | 23.6 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 21.0 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 20.5 | ||||
| LDTP05224 | RNA-binding protein 10 (RBM10) | 20.5 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 20.4 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 19.8 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 19.4 | ||||
| LDTP12623 | Zinc finger CCHC domain-containing protein 3 (ZCCHC3) | 19.2 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 18.9 | ||||
| LDTP12929 | NCK-interacting protein with SH3 domain (NCKIPSD) | 17.9 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 17.6 | ||||
| LDTP04527 | RNA-binding protein 5 (RBM5) | 17.6 | ||||
| LDTP08000 | Dymeclin (DYM) | 17.5 | ||||
| LDTP11643 | Superkiller complex protein 8 (SKIC8) | 17.4 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 17.1 | ||||
| LDTP05226 | RNA-binding protein 3 (RBM3) | 17.0 | ||||
| LDTP00417 | Programmed cell death protein 5 (PDCD5) | 16.9 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 16.7 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 16.3 | ||||
| LDTP14716 | ATP synthase subunit ATP5MJ, mitochondrial (ATP5MJ) | 16.0 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 15.9 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 15.8 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 15.8 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 15.8 | ||||
| LDTP13507 | BAG family molecular chaperone regulator 5 (BAG5) | 15.7 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 15.7 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 15.7 | ||||
| LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 15.5 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 15.2 | ||||
| LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 15.1 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 14.8 | ||||
| LDTP16322 | Mitochondrial import inner membrane translocase subunit Tim8 B (TIMM8B) | 14.8 | ||||
| LDTP00573 | Prefoldin subunit 6 (PFDN6) | 14.8 | ||||
| LDTP13430 | Protein TASOR (TASOR) | 14.8 | ||||
| LDTP09183 | Periphilin-1 (PPHLN1) | 14.7 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 14.7 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 14.5 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 14.4 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 14.4 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 14.3 | ||||
| LDTP18467 | LYR motif-containing protein 2 (LYRM2) | 14.2 | ||||
| LDTP01711 | Protein ecdysoneless homolog (ECD) | 14.2 | ||||
| LDTP13630 | Neudesin (NENF) | 14.1 | ||||
| LDTP02297 | Vimentin (VIM) | 14.0 | ||||
| LDTP10203 | RalBP1-associated Eps domain-containing protein 1 (REPS1) | 13.8 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 13.7 | ||||
| LDTP00913 | Mitochondrial import inner membrane translocase subunit Tim8 A (TIMM8A) | 13.5 | ||||
| LDTP06022 | Cold-inducible RNA-binding protein (CIRBP) | 13.4 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 13.4 | ||||
| LDTP11695 | Kinesin light chain 2 (KLC2) | 13.3 | ||||
| LDTP12369 | Bromodomain-containing protein 7 (BRD7) | 13.1 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 13.0 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 12.9 | ||||
| LDTP03729 | General transcription factor IIF subunit 1 (GTF2F1) | 12.8 | ||||
| LDTP00729 | Glycosylphosphatidylinositol anchor attachment 1 protein (GPAA1) | 12.7 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 12.7 | ||||
| LDTP05318 | RNA-binding protein EWS (EWSR1) | 12.7 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 12.6 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 12.6 | ||||
| LDTP06373 | Mitochondrial import receptor subunit TOM20 homolog (TOMM20) | 12.5 | ||||
| LDTP01246 | KH domain-containing, RNA-binding, signal transduction-associated protein 3 (KHDRBS3) | 12.4 | ||||
| LDTP09069 | Kinetochore protein Spc24 (SPC24) | 12.4 | ||||
| LDTP02180 | Neurofilament light polypeptide (NEFL) | 12.4 | ||||
| LDTP01608 | Proteasome assembly chaperone 1 (PSMG1) | 12.3 | ||||
| LDTP00887 | Calumenin (CALU) | 12.2 | ||||
| LDTP02351 | Tropomyosin alpha-1 chain (TPM1) | 12.2 | ||||
| LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | 12.1 | ||||
| LDTP14792 | Small ribosomal subunit protein uS9m (MRPS9) | 12.0 | ||||
| LDTP10403 | DDRGK domain-containing protein 1 (DDRGK1) | 11.9 | ||||
| LDTP00513 | Plexin-B2 (PLXNB2) | 11.9 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 11.8 | ||||
| LDTP13922 | Tudor and KH domain-containing protein (TDRKH) | 11.8 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 11.7 | ||||
| LDTP04207 | Heat shock 70 kDa protein 13 (HSPA13) | 11.6 | ||||
| LDTP12764 | MICOS complex subunit MIC19 (CHCHD3) | 11.6 | ||||
| LDTP11044 | Polyadenylate-binding protein-interacting protein 2 (PAIP2) | 11.6 | ||||
| LDTP02869 | Stathmin (STMN1) | 11.6 | ||||
| LDTP06515 | Coiled-coil domain-containing protein 6 (CCDC6) | 11.6 | ||||
| LDTP00716 | RNA binding protein fox-1 homolog 2 (RBFOX2) | 11.6 | ||||
| LDTP10214 | Splicing factor ESS-2 homolog (ESS2) | 11.5 | ||||
| LDTP13838 | F-box/WD repeat-containing protein 1A (BTRC) | 11.4 | ||||
| LDTP10962 | Heterogeneous nuclear ribonucleoprotein A/B (HNRNPAB) | 11.3 | ||||
| LDTP13114 | C-type mannose receptor 2 (MRC2) | 11.2 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 11.2 | ||||
| LDTP04356 | Emerin (EMD) | 11.2 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 11.2 | ||||
| LDTP03615 | Heterogeneous nuclear ribonucleoprotein H (HNRNPH1) | 11.2 | ||||
| LDTP00991 | Heterogeneous nuclear ribonucleoprotein Q (SYNCRIP) | 11.2 | ||||
| LDTP03850 | RNA-binding motif protein, X chromosome (RBMX) | 11.2 | ||||
