Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C343 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00575 | Glutathione S-transferase A4 (GSTA4) | 68.1 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 60.5 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 52.0 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 48.2 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 40.8 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 39.9 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 38.9 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 37.3 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 37.0 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 34.8 | ||||
| LDTP06511 | Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial (ETFDH) | 34.5 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 33.1 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 32.9 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 31.1 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 30.7 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 30.3 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 28.6 | ||||
| LDTP04542 | Thimet oligopeptidase (THOP1) | 27.7 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 27.5 | ||||
| LDTP09285 | Atypical kinase COQ8A, mitochondrial (COQ8A) | 26.7 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 25.8 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 25.6 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 24.9 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 24.4 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 24.4 | ||||
| LDTP00975 | Mannosyl-oligosaccharide 1,2-alpha-mannosidase IB (MAN1A2) | 24.1 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 23.8 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 23.1 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 22.9 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 22.6 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 22.6 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 21.0 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 20.7 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 20.5 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 20.0 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 20.0 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 19.8 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 19.8 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 19.6 | ||||
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 19.6 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 19.3 | ||||
| LDTP02006 | Tissue alpha-L-fucosidase (FUCA1) | 19.2 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 18.9 | ||||
| LDTP08564 | E3 ubiquitin-protein ligase UBR1 (UBR1) | 18.8 | ||||
| LDTP10981 | Mitochondrial intermediate peptidase (MIPEP) | 18.8 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 18.6 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 18.6 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 18.5 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 18.4 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 18.4 | ||||
| LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 18.3 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 17.9 | ||||
| LDTP12163 | Calcyclin-binding protein (CACYBP) | 17.8 | ||||
| LDTP06977 | GPI ethanolamine phosphate transferase 2 (PIGG) | 17.5 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 17.1 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 17.1 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 17.1 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 16.8 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 16.8 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 15.7 | ||||
| LDTP01300 | Cartilage-associated protein (CRTAP) | 15.6 | ||||
| LDTP13367 | Glutathione hydrolase 7 (GGT7) | 15.5 | ||||
| LDTP10709 | Pseudouridylate synthase 7 homolog (PUS7) | 15.5 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 15.0 | ||||
| LDTP12318 | Calcium-independent phospholipase A2-gamma (PNPLA8) | 14.9 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 14.9 | ||||
| LDTP10101 | Peptidyl-prolyl cis-trans isomerase FKBP10 (FKBP10) | 14.7 | ||||
| LDTP01649 | Phosphatidate cytidylyltransferase 2 (CDS2) | 14.7 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 14.7 | ||||
| LDTP07259 | N-alpha-acetyltransferase 35, NatC auxiliary subunit (NAA35) | 14.6 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 14.5 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 14.2 | ||||
| LDTP07367 | Nucleoredoxin (NXN) | 14.1 | ||||
| LDTP06501 | Ras-related protein Rab-11B (RAB11B) | 14.1 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 14.0 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 13.9 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 13.9 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 13.9 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 13.9 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 13.8 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 13.8 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 13.6 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 13.5 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 13.5 | ||||
| LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | 13.5 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 13.5 | ||||
| LDTP07989 | Ribonucleoside-diphosphate reductase subunit M2 B (RRM2B) | 13.5 | ||||
| LDTP07227 | Threonylcarbamoyladenosine tRNA methylthiotransferase (CDKAL1) | 13.5 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 13.1 | ||||
| LDTP01502 | NADH dehydrogenase 1 beta subcomplex subunit 6 (NDUFB6) | 13.1 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 13.1 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 12.9 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 12.8 | ||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 12.7 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 12.7 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 12.6 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 12.6 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 12.6 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 12.5 | ||||
| LDTP04358 | Carnitine O-palmitoyltransferase 1, liver isoform (CPT1A) | 12.5 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 12.5 | ||||
| LDTP04531 | Hexokinase-2 (HK2) | 12.5 | ||||
| LDTP01219 | NADH dehydrogenase 1 beta subcomplex subunit 1 (NDUFB1) | 12.5 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 12.5 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 12.4 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 12.2 | ||||
| LDTP10903 | Ribonucleases P/MRP protein subunit POP1 (POP1) | 12.2 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 11.9 | ||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 11.9 | ||||
| LDTP12233 | Helicase MOV-10 (MOV10) | 11.8 | ||||
| LDTP01759 | Histone-lysine N-methyltransferase NSD2 (NSD2) | 11.8 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 11.7 | ||||
| LDTP09814 | Acyl-CoA:lysophosphatidylglycerol acyltransferase 1 (LPGAT1) | 11.6 | ||||
| LDTP04119 | Glycogenin-1 (GYG1) | 11.6 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 11.6 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 11.6 | ||||
| LDTP03024 | Plasma membrane calcium-transporting ATPase 1 (ATP2B1) | 11.6 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 11.5 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 11.4 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 11.4 | ||||
| LDTP11683 | Mitochondrial disaggregase (CLPB) | 11.3 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 11.2 | ||||
| LDTP00338 | Lysosomal alpha-mannosidase (MAN2B1) | 11.2 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 11.1 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 11.1 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 64.4 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 49.9 | ||||
| LDTP04932 | Protein transport protein Sec61 subunit alpha isoform 1 (SEC61A1) | 48.8 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 44.0 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 42.8 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 38.9 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 38.3 | ||||
| LDTP06633 | Reticulon-1 (RTN1) | 38.3 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 36.3 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 36.0 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 35.3 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 33.8 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 33.6 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 33.1 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 32.7 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 32.0 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 31.6 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 31.3 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 29.0 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 28.8 | ||||
| LDTP02215 | Prosaposin (PSAP) | 28.4 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 23.9 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 23.8 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 22.9 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 22.3 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 22.0 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 21.7 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 21.4 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 21.3 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 21.1 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 21.0 | ||||
| LDTP08469 | Complex I assembly factor TMEM126B, mitochondrial (TMEM126B) | 20.8 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 20.8 | ||||
| LDTP03717 | Prohibitin 1 (PHB1) | 20.8 | ||||
| LDTP12738 | Ceroid-lipofuscinosis neuronal protein 6 (CLN6) | 20.3 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 20.0 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 19.8 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 19.7 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 19.2 | ||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | 19.0 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 18.6 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 18.6 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 18.1 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 17.5 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 17.0 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 16.9 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 16.6 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 16.3 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 16.2 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 16.0 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 16.0 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 15.9 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 15.6 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 15.6 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 15.6 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 15.5 | ||||
| LDTP00857 | Syntaxin-6 (STX6) | 15.3 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 15.0 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 15.0 | ||||
| LDTP13243 | Translocation protein SEC63 homolog (SEC63) | 15.0 | ||||
| LDTP09949 | Transportin-1 (TNPO1) | 14.9 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 14.6 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 14.5 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 14.4 | ||||
| LDTP10804 | Chloride channel CLIC-like protein 1 (CLCC1) | 13.9 | ||||
| LDTP00630 | Importin-8 (IPO8) | 13.9 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 13.9 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 13.7 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 13.7 | ||||
| LDTP10533 | Sorting nexin-27 (SNX27) | 13.5 | ||||
| LDTP04787 | Transmembrane protein 33 (TMEM33) | 13.2 | ||||
| LDTP09515 | Importin-4 (IPO4) | 13.0 | ||||
| LDTP01060 | PRA1 family protein 2 (PRAF2) | 13.0 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 12.7 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 12.5 | ||||
| LDTP07152 | Acyl-CoA-binding domain-containing protein 5 (ACBD5) | 12.4 | ||||
| LDTP01380 | Wolframin (WFS1) | 12.4 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 12.2 | ||||
| LDTP03380 | Stomatin (STOM) | 12.2 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 12.0 | ||||
| LDTP07477 | Transmembrane protein 214 (TMEM214) | 12.0 | ||||
| LDTP10885 | Sortilin (SORT1) | 11.9 | ||||
| LDTP14717 | ATP synthase subunit e, mitochondrial (ATP5ME) | 11.6 | ||||
| LDTP06660 | MICOS complex subunit MIC60 (IMMT) | 11.6 | ||||
| LDTP09204 | Nucleoporin NUP35 (NUP35) | 11.6 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 11.6 | ||||
| LDTP01454 | SUN domain-containing protein 1 (SUN1) | 11.6 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 11.1 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 22.8 | ||||
| LDTP05307 | Transcription factor AP-4 (TFAP4) | 12.6 | ||||
| LDTP12471 | DNA polymerase epsilon subunit 4 (POLE4) | 11.2 | ||||
GPCR
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP14610 | Golgi pH regulator B (GPR89B) | 11.6 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | 16.1 | ||||
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 13.5 | ||||
| LDTP14205 | Neuroplastin (NPTN) | 12.6 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 99.7 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 85.0 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 79.9 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 60.1 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 58.5 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 49.9 | ||||
| LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 45.3 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 39.4 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 38.9 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 38.6 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 38.1 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 37.3 | ||||
| LDTP02511 | cAMP-dependent protein kinase type I-alpha regulatory subunit (PRKAR1A) | 37.0 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 36.5 | ||||
| LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 33.4 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 31.3 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 31.1 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 30.7 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 27.7 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 26.7 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 23.9 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 23.3 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 22.8 | ||||
| LDTP15095 | Receptor expression-enhancing protein 3 (REEP3) | 22.5 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 22.3 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 21.7 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 21.4 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 21.0 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 20.7 | ||||
| LDTP17003 | Matrix-remodeling-associated protein 7 (MXRA7) | 20.0 | ||||
| LDTP11328 | Splicing factor 3B subunit 5 (SF3B5) | 19.8 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 18.4 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 18.3 | ||||
| LDTP12741 | Ankyrin repeat and SOCS box protein 6 (ASB6) | 17.9 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 17.9 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 17.8 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 17.6 | ||||
| LDTP12379 | Complex I assembly factor TIMMDC1, mitochondrial (TIMMDC1) | 17.3 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 17.3 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 17.1 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 16.3 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 16.2 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 16.1 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 16.1 | ||||
| LDTP12830 | U3 small nucleolar RNA-associated protein 6 homolog (UTP6) | 15.9 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 15.6 | ||||
| LDTP15283 | Nucleolar protein 9 (NOP9) | 15.3 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 15.3 | ||||
| LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 15.3 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 15.2 | ||||
| LDTP00618 | Fanconi anemia group A protein (FANCA) | 15.1 | ||||
| LDTP07916 | Protein MTSS 2 (MTSS2) | 15.0 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 14.8 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 14.5 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 14.5 | ||||
| LDTP13813 | Eukaryotic translation initiation factor 3 subunit L (EIF3L) | 14.4 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 14.3 | ||||
| LDTP12395 | Large ribosomal subunit protein mL40 (MRPL40) | 14.3 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 13.8 | ||||
| LDTP06915 | Borealin (CDCA8) | 13.7 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 13.7 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 13.6 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 13.4 | ||||
| LDTP11981 | Receptor expression-enhancing protein 4 (REEP4) | 13.4 | ||||
| LDTP14126 | Mitochondrial import inner membrane translocase subunit Tim9 (TIMM9) | 13.0 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 12.9 | ||||
| LDTP11326 | FUN14 domain-containing protein 2 (FUNDC2) | 12.6 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 12.5 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 12.5 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 12.2 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 12.1 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 12.0 | ||||
| LDTP00913 | Mitochondrial import inner membrane translocase subunit Tim8 A (TIMM8A) | 12.0 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 11.9 | ||||
| LDTP00871 | Microtubule nucleation factor SSNA1 (SSNA1) | 11.8 | ||||
| LDTP08420 | BLOC-2 complex member HPS6 (HPS6) | 11.6 | ||||
| LDTP13125 | Protein UXT (UXT) | 11.6 | ||||
| LDTP09215 | Torsin-1A-interacting protein 2 (TOR1AIP2) | 11.5 | ||||
| LDTP01075 | Protein CutA (CUTA) | 11.4 | ||||
| LDTP13412 | Anaphase-promoting complex subunit 2 (ANAPC2) | 11.3 | ||||
| LDTP19860 | Coiled-coil domain-containing protein 97 (CCDC97) | 11.3 | ||||
| LDTP06068 | MAGUK p55 subfamily member 2 (MPP2) | 11.3 | ||||
| LDTP08874 | Mitochondrial intermembrane space import and assembly protein 40 (CHCHD4) | 11.3 | ||||
| LDTP17808 | SHC SH2 domain-binding protein 1 (SHCBP1) | 11.2 | ||||
