Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C233 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 70.5 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 67.6 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 67.2 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 48.5 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 47.5 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 45.3 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 39.7 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 38.6 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 37.5 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 36.8 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 33.1 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 30.9 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 30.7 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 29.9 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 29.9 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 29.7 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 28.4 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 28.1 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 26.9 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 26.5 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 26.4 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 25.1 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 24.9 | ||||
| LDTP09285 | Atypical kinase COQ8A, mitochondrial (COQ8A) | 24.8 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 24.1 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 24.1 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 23.9 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 23.8 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 23.8 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 22.2 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 21.3 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 20.5 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 20.3 | ||||
| LDTP02569 | Glucose-6-phosphate 1-dehydrogenase (G6PD) | 19.8 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 19.4 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 18.8 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 18.5 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 18.1 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 17.6 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 17.5 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 17.4 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 16.1 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 16.0 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 15.8 | ||||
| LDTP08455 | Palmitoyltransferase ZDHHC13 (ZDHHC13) | 15.7 | ||||
| LDTP00758 | Thioredoxin-like protein 1 (TXNL1) | 15.5 | ||||
| LDTP02565 | Medium-chain specific acyl-CoA dehydrogenase, mitochondrial (ACADM) | 14.9 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 14.9 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 14.9 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 14.8 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 14.6 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 14.6 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 14.6 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 14.5 | ||||
| LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 14.3 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 14.2 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 14.1 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 14.0 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 13.9 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 13.8 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 13.8 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 13.7 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 13.7 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 13.6 | ||||
| LDTP05346 | Methylmalonate-semialdehyde/malonate-semialdehyde dehydrogenase [acylating], mitochondrial (ALDH6A1) | 13.4 | ||||
| LDTP06338 | Prostaglandin E synthase 3 (PTGES3) | 13.3 | ||||
| LDTP06320 | [Pyruvate dehydrogenase (acetyl-transferring)] kinase isozyme 1, mitochondrial (PDK1) | 13.1 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 13.0 | ||||
| LDTP11199 | DCN1-like protein 5 (DCUN1D5) | 12.9 | ||||
| LDTP16040 | Glyoxalase domain-containing protein 4 (GLOD4) | 12.6 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 12.4 | ||||
| LDTP16025 | Ketosamine-3-kinase (FN3KRP) | 12.2 | ||||
| LDTP10201 | Atypical kinase COQ8B, mitochondrial (COQ8B) | 12.0 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 11.9 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 11.9 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 11.9 | ||||
| LDTP08017 | Endoplasmic reticulum metallopeptidase 1 (ERMP1) | 11.8 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 11.8 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 11.6 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 11.4 | ||||
| LDTP05724 | Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial (ECH1) | 11.4 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 11.2 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 11.2 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 11.1 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 10.9 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 10.9 | ||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 10.9 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 10.6 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 10.3 | ||||
| LDTP01219 | NADH dehydrogenase 1 beta subcomplex subunit 1 (NDUFB1) | 10.2 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 10.1 | ||||
| LDTP10322 | Abasic site processing protein HMCES (HMCES) | 10.0 | ||||
| LDTP11259 | Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase (ALG12) | 10.0 | ||||
| LDTP00544 | Sphingolipid delta(4)-desaturase DES1 (DEGS1) | 10.0 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 9.9 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 9.8 | ||||
| LDTP02721 | Farnesyl pyrophosphate synthase (FDPS) | 9.8 | ||||
| LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 9.8 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 9.7 | ||||
| LDTP03858 | Lysosomal acid lipase/cholesteryl ester hydrolase (LIPA) | 9.7 | ||||
| LDTP12415 | Adenosine 5'-monophosphoramidase HINT3 (HINT3) | 9.6 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 9.6 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 9.6 | ||||
| LDTP00836 | ATPase GET3 (GET3) | 9.6 | ||||
| LDTP08799 | Lysophosphatidylserine lipase ABHD12 (ABHD12) | 9.6 | ||||
| LDTP10862 | Proteasome subunit beta type-7 (PSMB7) | 9.5 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 9.4 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 9.2 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 9.2 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 9.1 | ||||
| LDTP04531 | Hexokinase-2 (HK2) | 9.0 | ||||
| LDTP04183 | Lanosterol synthase (LSS) | 9.0 | ||||
| LDTP07504 | Lysophospholipid acyltransferase 5 (LPCAT3) | 8.9 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 8.9 | ||||
| LDTP04471 | Ribosomal protein S6 kinase alpha-3 (RPS6KA3) | 8.9 | ||||
| LDTP03900 | ADP-ribosylation factor-like protein 1 (ARL1) | 8.8 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 8.8 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 8.8 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 8.8 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 8.7 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 8.6 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 8.6 | ||||
| LDTP12835 | Large ribosomal subunit protein mL39 (MRPL39) | 8.6 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 8.6 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 72.5 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 68.6 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 63.6 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 45.6 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 44.3 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 44.3 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 42.2 | ||||
| LDTP01601 | Activator of 90 kDa heat shock protein ATPase homolog 1 (AHSA1) | 38.3 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 36.3 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 35.5 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 34.3 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 33.6 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 33.4 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 31.3 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 30.9 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 28.2 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 27.1 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 26.7 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 25.8 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 25.8 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 25.6 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 25.6 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 25.3 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 24.8 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 24.4 | ||||
| LDTP02215 | Prosaposin (PSAP) | 24.1 | ||||
| LDTP15000 | Solute carrier family 35 member F1 (SLC35F1) | 23.9 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 22.9 | ||||
| LDTP08016 | Proton-coupled amino acid transporter 1 (SLC36A1) | 21.9 | ||||
| LDTP09261 | Major facilitator superfamily domain-containing protein 8 (MFSD8) | 21.7 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 21.1 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 20.5 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 20.4 | ||||
| LDTP11927 | Essential MCU regulator, mitochondrial (SMDT1) | 19.4 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 19.4 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 19.0 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 18.9 | ||||
| LDTP04463 | H(+)/Cl(-) exchange transporter 7 (CLCN7) | 18.6 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 18.4 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 18.3 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 18.3 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 18.0 | ||||
| LDTP14181 | Peroxisomal membrane protein PEX16 (PEX16) | 17.5 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 17.4 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 16.7 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 16.4 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 16.3 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 16.2 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 16.0 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 16.0 | ||||
| LDTP10731 | Sodium-coupled neutral amino acid symporter 2 (SLC38A2) | 15.6 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 14.8 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 14.6 | ||||
| LDTP03546 | Translocator protein (TSPO) | 14.6 | ||||
| LDTP07462 | MFS-type transporter SLC18B1 (SLC18B1) | 14.5 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 13.9 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 13.6 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 12.8 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 12.7 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 12.6 | ||||
| LDTP08469 | Complex I assembly factor TMEM126B, mitochondrial (TMEM126B) | 11.9 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 11.9 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 11.7 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 11.2 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 11.1 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 11.0 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 10.9 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 10.9 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 10.9 | ||||
| LDTP11041 | Calcium uptake protein 1, mitochondrial (MICU1) | 10.8 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 10.8 | ||||
| LDTP11812 | Protein ARV1 (ARV1) | 10.8 | ||||
| LDTP10370 | Solute carrier family 41 member 3 (SLC41A3) | 10.8 | ||||
| LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 10.6 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 10.6 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 10.6 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 10.4 | ||||
| LDTP04956 | Mitochondrial import inner membrane translocase subunit Tim10 (TIMM10) | 10.1 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 10.1 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 10.0 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 9.9 | ||||
| LDTP11732 | Magnesium transporter protein 1 (MAGT1) | 9.6 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 9.6 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 9.5 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 9.3 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 9.3 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 9.2 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 9.1 | ||||
| LDTP04749 | Peroxisomal biogenesis factor 3 (PEX3) | 9.1 | ||||
| LDTP05780 | Syntaxin-5 (STX5) | 9.0 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 8.9 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 8.8 | ||||
| LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 8.8 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 8.8 | ||||
| LDTP12191 | Vezatin (VEZT) | 8.8 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 8.7 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 8.6 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13928 | Zinc finger protein 281 (ZNF281) | 12.5 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 10.8 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 97.7 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 93.1 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 58.9 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 51.3 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 46.5 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 34.8 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 34.1 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 30.7 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 30.5 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 28.8 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 26.2 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 26.2 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 25.6 | ||||
| LDTP14939 | Membralin (TMEM259) | 25.5 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 24.3 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 22.8 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 22.8 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 21.6 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 21.4 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 21.0 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 19.3 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 18.9 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 18.4 | ||||
| LDTP06352 | Reticulocalbin-1 (RCN1) | 18.3 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 18.0 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 17.1 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 17.1 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 17.0 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 16.7 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 16.3 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 16.0 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 15.6 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 15.5 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 15.3 | ||||
| LDTP01638 | YEATS domain-containing protein 4 (YEATS4) | 15.2 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 14.8 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 14.3 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 14.3 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 13.9 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 13.5 | ||||
| LDTP18132 | Protein FAM136A (FAM136A) | 13.2 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 13.1 | ||||
| LDTP08058 | Mitochondrial antiviral-signaling protein (MAVS) | 13.1 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 12.5 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 12.4 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 12.4 | ||||
| LDTP00887 | Calumenin (CALU) | 12.0 | ||||
| LDTP03729 | General transcription factor IIF subunit 1 (GTF2F1) | 12.0 | ||||
| LDTP07655 | Pre-mRNA 3'-end-processing factor FIP1 (FIP1L1) | 12.0 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 11.8 | ||||
| LDTP11044 | Polyadenylate-binding protein-interacting protein 2 (PAIP2) | 11.6 | ||||
| LDTP08248 | NLR family member X1 (NLRX1) | 11.4 | ||||
| LDTP01711 | Protein ecdysoneless homolog (ECD) | 11.4 | ||||
| LDTP00875 | Striatin (STRN) | 11.2 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 11.2 | ||||
| LDTP13630 | Neudesin (NENF) | 11.0 | ||||
| LDTP06413 | Microtubule-associated protein RP/EB family member 2 (MAPRE2) | 10.9 | ||||
| LDTP10357 | RUS family member 1 (RUSF1) | 10.9 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 10.7 | ||||
| LDTP08094 | Wings apart-like protein homolog (WAPL) | 10.6 | ||||
| LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 10.4 | ||||
| LDTP09297 | Large ribosomal subunit protein mL64 (GADD45GIP1) | 10.3 | ||||
| LDTP11906 | Phosphatidylinositol glycan anchor biosynthesis class U protein (PIGU) | 10.3 | ||||
| LDTP13167 | Peflin (PEF1) | 10.1 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 10.0 | ||||
| LDTP10203 | RalBP1-associated Eps domain-containing protein 1 (REPS1) | 10.0 | ||||
| LDTP10469 | Engulfment and cell motility protein 2 (ELMO2) | 9.8 | ||||
| LDTP00729 | Glycosylphosphatidylinositol anchor attachment 1 protein (GPAA1) | 9.6 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 9.6 | ||||
| LDTP17721 | Refilin-B (RFLNB) | 9.4 | ||||
| LDTP11239 | Protein misato homolog 1 (MSTO1) | 9.3 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 9.3 | ||||
| LDTP06128 | RNA-binding protein 39 (RBM39) | 9.3 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 9.1 | ||||
| LDTP12677 | DnaJ homolog subfamily C member 11 (DNAJC11) | 9.0 | ||||
| LDTP06068 | MAGUK p55 subfamily member 2 (MPP2) | 8.9 | ||||
| LDTP05277 | Protein SET (SET) | 8.8 | ||||
| LDTP15687 | Large ribosomal subunit protein uL24m (MRPL24) | 8.7 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 8.7 | ||||
