Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C210 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01803 | Adenosine deaminase (ADA) | 99.7 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 99.7 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 99.7 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 99.7 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 99.7 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 99.7 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 99.7 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 99.7 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 99.7 | ||||
| LDTP10930 | Membrane-associated tyrosine- and threonine-specific cdc2-inhibitory kinase (PKMYT1) | 99.0 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 95.0 | ||||
| LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 89.9 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 84.4 | ||||
| LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 83.9 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 83.3 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 82.1 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 81.6 | ||||
| LDTP04203 | Phosphatidylserine synthase 1 (PTDSS1) | 79.3 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 77.7 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 75.6 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 75.1 | ||||
| LDTP11617 | Myotubularin-related protein 12 (MTMR12) | 74.0 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 72.0 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 72.0 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 70.0 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 69.6 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 69.1 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 68.6 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 68.1 | ||||
| LDTP13352 | GTP:AMP phosphotransferase AK3, mitochondrial (AK3) | 68.1 | ||||
| LDTP04114 | E3 ubiquitin-protein ligase NEDD4 (NEDD4) | 66.7 | ||||
| LDTP05143 | Endonuclease III-like protein 1 (NTHL1) | 65.3 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 65.3 | ||||
| LDTP09620 | Soluble calcium-activated nucleotidase 1 (CANT1) | 64.9 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 64.0 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 63.6 | ||||
| LDTP00218 | NADH dehydrogenase iron-sulfur protein 8, mitochondrial (NDUFS8) | 63.6 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 62.7 | ||||
| LDTP04196 | 26S proteasome non-ATPase regulatory subunit 8 (PSMD8) | 62.2 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 61.8 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 61.8 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 60.1 | ||||
| LDTP10699 | E3 ubiquitin-protein ligase NEDD4-like (NEDD4L) | 59.7 | ||||
| LDTP00400 | Torsin-1B (TOR1B) | 59.3 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 58.9 | ||||
| LDTP01518 | NADH dehydrogenase 1 alpha subcomplex subunit 7 (NDUFA7) | 58.9 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 57.7 | ||||
| LDTP08933 | Chondroitin sulfate N-acetylgalactosaminyltransferase 2 (CSGALNACT2) | 56.5 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 56.5 | ||||
| LDTP14723 | Selenocysteine-specific elongation factor (EEFSEC) | 56.5 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 56.5 | ||||
| LDTP03223 | Small ribosomal subunit protein uS3 (RPS3) | 56.1 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 55.3 | ||||
| LDTP04565 | Methionine aminopeptidase 1 (METAP1) | 55.3 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 54.6 | ||||
| LDTP08598 | NAD-dependent protein deacetylase sirtuin-2 (SIRT2) | 53.4 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 52.3 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 52.3 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 52.3 | ||||
| LDTP04263 | Cysteine--tRNA ligase, cytoplasmic (CARS1) | 52.0 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 52.0 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 51.6 | ||||
| LDTP14264 | Choline/ethanolaminephosphotransferase 1 (CEPT1) | 49.2 | ||||
| LDTP00890 | S-adenosylhomocysteine hydrolase-like protein 1 (AHCYL1) | 49.2 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 48.8 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 48.8 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 48.8 | ||||
| LDTP06501 | Ras-related protein Rab-11B (RAB11B) | 48.2 | ||||
| LDTP09061 | Retinol dehydrogenase 13 (RDH13) | 48.2 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 48.2 | ||||
| LDTP07154 | ATPase family AAA domain-containing protein 3B (ATAD3B) | 47.8 | ||||
| LDTP13959 | Dehydrogenase/reductase SDR family member 7 (DHRS7) | 47.5 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 46.9 | ||||
| LDTP09070 | Outer mitochondrial transmembrane helix translocase (ATAD1) | 46.5 | ||||
| LDTP10471 | Protein disulfide-isomerase TMX3 (TMX3) | 46.5 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 46.2 | ||||
| LDTP07227 | Threonylcarbamoyladenosine tRNA methylthiotransferase (CDKAL1) | 46.2 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 45.6 | ||||
| LDTP04353 | Protoporphyrinogen oxidase (PPOX) | 45.6 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 45.6 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 45.3 | ||||
| LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 44.9 | ||||
| LDTP00645 | Prolyl 4-hydroxylase subunit alpha-2 (P4HA2) | 44.9 | ||||
| LDTP05769 | Serine/threonine-protein kinase PAK 1 (PAK1) | 44.6 | ||||
| LDTP09074 | UDP-glucuronic acid decarboxylase 1 (UXS1) | 44.6 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 44.3 | ||||
| LDTP08530 | Mitofusin-1 (MFN1) | 44.3 | ||||
| LDTP07813 | Sulfhydryl oxidase 2 (QSOX2) | 44.3 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 44.0 | ||||
| LDTP07577 | Serine/threonine-protein kinase ULK3 (ULK3) | 44.0 | ||||
| LDTP05946 | Cullin-1 (CUL1) | 43.4 | ||||
| LDTP05228 | Calcium-transporting ATPase type 2C member 1 (ATP2C1) | 43.1 | ||||
| LDTP13986 | Vesicle transport protein GOT1B (GOLT1B) | 42.8 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 42.2 | ||||
| LDTP07873 | Acyl-CoA dehydrogenase family member 11 (ACAD11) | 41.9 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 41.9 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 41.6 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 41.4 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 41.1 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 40.2 | ||||
| LDTP11209 | Phosphatidylinositol 4-kinase type 2-alpha (PI4K2A) | 40.2 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 39.9 | ||||
| LDTP12763 | Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase (BPNT2) | 39.9 | ||||
| LDTP02721 | Farnesyl pyrophosphate synthase (FDPS) | 39.4 | ||||
| LDTP09390 | Polyribonucleotide nucleotidyltransferase 1, mitochondrial (PNPT1) | 39.4 | ||||
| LDTP15154 | Dehydrogenase/reductase SDR family member 13 (DHRS13) | 39.1 | ||||
| LDTP10432 | ATP synthase membrane subunit K, mitochondrial (ATP5MK) | 38.9 | ||||
| LDTP01502 | NADH dehydrogenase 1 beta subcomplex subunit 6 (NDUFB6) | 38.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 99.7 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 99.7 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 99.7 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 99.7 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 99.7 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 99.7 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 99.7 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 99.7 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 99.7 | ||||
| LDTP15733 | Solute carrier family 25 member 44 (SLC25A44) | 99.7 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 99.7 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 99.7 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 99.7 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 99.7 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 95.7 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 95.0 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 94.4 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 88.6 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 85.6 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 84.4 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 78.8 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 78.2 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 77.2 | ||||
| LDTP10036 | BOS complex subunit NCLN (NCLN) | 76.1 | ||||
| LDTP03546 | Translocator protein (TSPO) | 76.1 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 74.0 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 73.0 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 72.5 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 72.0 | ||||
| LDTP13256 | SUN domain-containing protein 2 (SUN2) | 71.5 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 70.0 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 68.6 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 67.2 | ||||
| LDTP15979 | Transmembrane protein 245 (TMEM245) | 64.9 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 64.4 | ||||
| LDTP01217 | Metaxin-2 (MTX2) | 63.6 | ||||
| LDTP07439 | Mitochondrial adenyl nucleotide antiporter SLC25A25 (SLC25A25) | 62.7 | ||||
| LDTP03811 | V-type proton ATPase subunit E 1 (ATP6V1E1) | 62.7 | ||||
| LDTP09294 | Proton-coupled zinc antiporter SLC30A5 (SLC30A5) | 62.2 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 60.1 | ||||
| LDTP08469 | Complex I assembly factor TMEM126B, mitochondrial (TMEM126B) | 58.9 | ||||
| LDTP08279 | Mitochondrial coenzyme A transporter SLC25A42 (SLC25A42) | 58.5 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 58.5 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 57.7 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 57.7 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 57.3 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 56.5 | ||||
| LDTP02215 | Prosaposin (PSAP) | 56.5 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 55.3 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 55.3 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 54.9 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 54.6 | ||||
| LDTP11607 | Exportin-4 (XPO4) | 53.4 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 53.4 | ||||
| LDTP12979 | Transmembrane protein 14C (TMEM14C) | 53.1 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 52.0 | ||||
| LDTP14717 | ATP synthase subunit e, mitochondrial (ATP5ME) | 49.9 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 49.9 | ||||
| LDTP06660 | MICOS complex subunit MIC60 (IMMT) | 48.8 | ||||
| LDTP05780 | Syntaxin-5 (STX5) | 48.8 | ||||
| LDTP01380 | Wolframin (WFS1) | 48.8 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 48.2 | ||||
| LDTP00310 | Syntenin-1 (SDCBP) | 47.8 | ||||
| LDTP12644 | Mitochondrial potassium channel ATP-binding subunit (ABCB8) | 47.5 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 46.9 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 46.9 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 45.6 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 44.6 | ||||
| LDTP10804 | Chloride channel CLIC-like protein 1 (CLCC1) | 43.1 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 43.1 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 42.8 | ||||
| LDTP11136 | Sugar transporter SWEET1 (SLC50A1) | 42.8 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 42.2 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 41.9 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 41.9 | ||||
| LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 41.6 | ||||
| LDTP01748 | Mitochondrial import receptor subunit TOM40 homolog (TOMM40) | 41.1 | ||||
| LDTP09204 | Nucleoporin NUP35 (NUP35) | 41.1 | ||||
| LDTP05871 | Protein OS-9 (OS9) | 39.9 | ||||
| LDTP12704 | Anoctamin-10 (ANO10) | 39.4 | ||||
| LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 39.1 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 39.1 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05065 | Y-box-binding protein 1 (YBX1) | 49.9 | ||||
| LDTP03212 | Splicing factor, proline- and glutamine-rich (SFPQ) | 43.1 | ||||
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 39.4 | ||||
| LDTP09694 | Paraspeckle component 1 (PSPC1) | 39.4 | ||||
| LDTP12507 | Chromatin accessibility complex protein 1 (CHRAC1) | 38.9 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 99.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 99.7 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 99.7 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 99.7 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 99.7 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 99.7 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 99.7 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 99.7 | ||||
| LDTP02297 | Vimentin (VIM) | 99.7 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 92.4 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 91.8 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 90.5 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 89.3 | ||||
| LDTP12379 | Complex I assembly factor TIMMDC1, mitochondrial (TIMMDC1) | 88.6 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 87.4 | ||||
| LDTP02443 | Calmodulin-3 (CALM3) | 85.0 | ||||
| LDTP01932 | Prelamin-A/C (LMNA) | 84.4 | ||||
| LDTP05277 | Protein SET (SET) | 80.4 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 73.0 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 72.0 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 71.5 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 71.5 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 68.1 | ||||
| LDTP10046 | Endoplasmic reticulum-Golgi intermediate compartment protein 1 (ERGIC1) | 67.6 | ||||
| LDTP02181 | Neurofilament medium polypeptide (NEFM) | 67.6 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 66.3 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 64.0 | ||||
| LDTP14939 | Membralin (TMEM259) | 63.6 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 63.6 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 62.7 | ||||
| LDTP13922 | Tudor and KH domain-containing protein (TDRKH) | 62.7 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 61.8 | ||||
| LDTP05437 | Single-stranded DNA-binding protein, mitochondrial (SSBP1) | 61.4 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 61.0 | ||||
| LDTP00887 | Calumenin (CALU) | 60.1 | ||||
| LDTP14716 | ATP synthase subunit ATP5MJ, mitochondrial (ATP5MJ) | 59.7 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 59.7 | ||||
| LDTP02180 | Neurofilament light polypeptide (NEFL) | 59.3 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 59.3 | ||||
| LDTP13125 | Protein UXT (UXT) | 59.3 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 58.9 | ||||
| LDTP05068 | Tropomyosin alpha-4 chain (TPM4) | 58.9 | ||||
| LDTP10924 | Prohibitin-2 (PHB2) | 58.5 | ||||
| LDTP16055 | Large ribosomal subunit protein mL65 (MRPS30) | 57.3 | ||||
| LDTP05530 | Induced myeloid leukemia cell differentiation protein Mcl-1 (MCL1) | 56.9 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 55.7 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 55.7 | ||||
| LDTP16322 | Mitochondrial import inner membrane translocase subunit Tim8 B (TIMM8B) | 55.3 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 55.3 | ||||
| LDTP08796 | Protein SYS1 homolog (SYS1) | 55.3 | ||||
| LDTP05226 | RNA-binding protein 3 (RBM3) | 54.6 | ||||
| LDTP15095 | Receptor expression-enhancing protein 3 (REEP3) | 54.2 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 53.8 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 53.8 | ||||
| LDTP19859 | Small integral membrane protein 12 (SMIM12) | 53.8 | ||||
| LDTP04718 | Eukaryotic translation initiation factor 3 subunit B (EIF3B) | 53.1 | ||||
| LDTP06301 | Eukaryotic translation initiation factor 4H (EIF4H) | 52.7 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 51.6 | ||||
| LDTP08761 | NADH dehydrogenase 1 alpha subcomplex assembly factor 2 (NDUFAF2) | 51.3 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 50.9 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 50.6 | ||||
| LDTP12545 | Protein kish-B (TMEM167B) | 50.6 | ||||
| LDTP17652 | Uncharacterized protein KIAA2013 (KIAA2013) | 50.2 | ||||
| LDTP06527 | Alpha-internexin (INA) | 49.9 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 49.9 | ||||
| LDTP11044 | Polyadenylate-binding protein-interacting protein 2 (PAIP2) | 49.5 | ||||
| LDTP04425 | Translocon-associated protein subunit delta (SSR4) | 49.2 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 49.2 | ||||
| LDTP00531 | Centrosomal protein of 290 kDa (CEP290) | 48.8 | ||||
| LDTP09410 | Protein bicaudal D homolog 2 (BICD2) | 48.8 | ||||
| LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 48.5 | ||||
| LDTP18467 | LYR motif-containing protein 2 (LYRM2) | 48.2 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 48.2 | ||||
| LDTP13622 | NFU1 iron-sulfur cluster scaffold homolog, mitochondrial (NFU1) | 47.5 | ||||
| LDTP02351 | Tropomyosin alpha-1 chain (TPM1) | 46.9 | ||||
| LDTP07718 | MICOS complex subunit MIC27 (APOOL) | 45.9 | ||||
| LDTP06291 | ADP-ribosylation factor-like protein 6-interacting protein 1 (ARL6IP1) | 45.6 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 45.6 | ||||
| LDTP11326 | FUN14 domain-containing protein 2 (FUNDC2) | 44.9 | ||||
| LDTP05400 | Lamin-B2 (LMNB2) | 44.9 | ||||
| LDTP15885 | Leucine-rich repeat-containing protein 1 (LRRC1) | 44.9 | ||||
| LDTP16577 | DENN domain-containing protein 11 (DENND11) | 44.6 | ||||
| LDTP16249 | Protein angel homolog 1 (ANGEL1) | 44.3 | ||||
| LDTP11995 | WD repeat and coiled-coil-containing protein (WDCP) | 44.0 | ||||
| LDTP10782 | Erbin (ERBIN) | 43.7 | ||||
| LDTP19912 | Protein NipSnap homolog 1 (NIPSNAP1) | 43.4 | ||||
| LDTP13214 | UPF0449 protein C19orf25 (C19orf25) | 43.4 | ||||
| LDTP11327 | RNA polymerase II-associated protein 1 (RPAP1) | 43.1 | ||||
| LDTP04181 | Coatomer subunit delta (ARCN1) | 42.8 | ||||
| LDTP11825 | Phosducin-like protein 3 (PDCL3) | 42.8 | ||||
| LDTP17129 | UPF0489 protein C5orf22 (C5orf22) | 42.8 | ||||
| LDTP04902 | Actin-related protein 3 (ACTR3) | 42.2 | ||||
| LDTP18079 | Sec1 family domain-containing protein 2 (SCFD2) | 41.9 | ||||
| LDTP13091 | Ataxin-10 (ATXN10) | 41.6 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 41.6 | ||||
| LDTP03615 | Heterogeneous nuclear ribonucleoprotein H (HNRNPH1) | 41.4 | ||||
| LDTP09325 | Iron-sulfur cluster transfer protein NUBPL (NUBPL) | 41.1 | ||||
| LDTP12982 | Mitochondrial import receptor subunit TOM7 homolog (TOMM7) | 41.1 | ||||
| LDTP13967 | Transmembrane emp24 domain-containing protein 5 (TMED5) | 41.1 | ||||
| LDTP12591 | Kinesin light chain 4 (KLC4) | 40.8 | ||||
| LDTP13152 | DnaJ homolog subfamily B member 11 (DNAJB11) | 40.5 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 40.5 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 40.5 | ||||
| LDTP05937 | Transformer-2 protein homolog alpha (TRA2A) | 40.5 | ||||
| LDTP07132 | Ubiquitin-associated protein 2 (UBAP2) | 40.5 | ||||
| LDTP10203 | RalBP1-associated Eps domain-containing protein 1 (REPS1) | 40.2 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 39.4 | ||||
| LDTP12677 | DnaJ homolog subfamily C member 11 (DNAJC11) | 39.1 | ||||
| LDTP00417 | Programmed cell death protein 5 (PDCD5) | 39.1 | ||||
| LDTP04206 | Nestin (NES) | 38.9 | ||||
| LDTP06587 | Survival motor neuron protein (SMN1; SMN2) | 38.9 | ||||
| LDTP02165 | Tropomyosin alpha-3 chain (TPM3) | 38.9 | ||||
