Details of the Probe-central Interaction Altas
General Information of Experiment
Probe Name | C225 | Probe Info | ||||
---|---|---|---|---|---|---|
Probe concentration | Probe:50uM; negative probe:50uM | |||||
Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
Quantitative Method |
TMT
|
|||||
In Vivo Experiment Model | Model Type |
|
Living cell | |||
Derived Tissue |
|
Peripheral blood | ||||
Disease Model | Normal | |||||
Model Name | Human normal cells (HEK-293T) | |||||
Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 |
Interaction Altas of This Experiment [1]
Enzyme
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 38.1 | ||||
LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 36.3 | ||||
LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 32.2 | ||||
LDTP03540 | Heme oxygenase 2 (HMOX2) | 28.4 | ||||
LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 25.6 | ||||
LDTP00697 | Cytochrome b5 type B (CYB5B) | 24.3 | ||||
LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 23.1 | ||||
LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 21.0 | ||||
LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 20.3 | ||||
LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 19.8 | ||||
LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 17.8 | ||||
LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 16.8 | ||||
LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 16.3 | ||||
LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 15.0 | ||||
LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 14.8 | ||||
LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 13.8 | ||||
LDTP05905 | Acid ceramidase (ASAH1) | 13.2 | ||||
LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 12.6 | ||||
LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 12.3 | ||||
LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 12.0 | ||||
LDTP02359 | Heme oxygenase 1 (HMOX1) | 12.0 | ||||
LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 11.8 | ||||
LDTP01389 | Delta(14)-sterol reductase TM7SF2 (TM7SF2) | 11.6 | ||||
LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 11.5 | ||||
LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 11.3 | ||||
LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 11.2 | ||||
LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 10.9 | ||||
LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 10.4 | ||||
LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 10.3 | ||||
LDTP02837 | Beta-galactosidase (GLB1) | 10.3 | ||||
LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 10.3 | ||||
LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 10.2 | ||||
LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 10.1 | ||||
LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 10.1 | ||||
LDTP03394 | Ceramide synthase 1 (CERS1) | 9.8 | ||||
LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 9.8 | ||||
LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 9.6 | ||||
LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 9.6 | ||||
LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 9.3 | ||||
LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 9.2 | ||||
LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 9.0 | ||||
LDTP11867 | UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase (DPAGT1) | 9.0 | ||||
LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 8.9 | ||||
LDTP06511 | Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial (ETFDH) | 8.8 | ||||
LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 8.7 | ||||
LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 8.6 | ||||
LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 8.6 | ||||
LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 8.5 | ||||
LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 8.2 | ||||
LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 8.2 | ||||
LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 8.1 | ||||
LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 8.0 | ||||
LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 7.8 | ||||
LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 7.8 | ||||
LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 7.7 | ||||
LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 7.6 | ||||
LDTP13751 | Exonuclease 1 (EXO1) | 7.5 | ||||
LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 7.5 | ||||
LDTP10329 | Ceramide synthase 2 (CERS2) | 7.4 | ||||
LDTP04183 | Lanosterol synthase (LSS) | 7.4 | ||||
LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 7.3 | ||||
LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 7.3 | ||||
LDTP02505 | Lysosomal protective protein (CTSA) | 7.2 | ||||
LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 7.1 | ||||
LDTP03858 | Lysosomal acid lipase/cholesteryl ester hydrolase (LIPA) | 7.0 | ||||
LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 6.9 | ||||
LDTP04247 | Protein farnesyltransferase subunit beta (FNTB) | 6.8 | ||||
LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 6.8 | ||||
LDTP07417 | Serine/threonine-protein phosphatase 4 regulatory subunit 3A (PPP4R3A) | 6.7 | ||||
LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 6.6 | ||||
LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 6.5 | ||||
LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 6.5 | ||||
LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 6.5 | ||||
LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 6.5 | ||||
LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 6.4 | ||||
LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 6.3 | ||||
LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 6.2 | ||||
LDTP03145 | Catechol O-methyltransferase (COMT) | 6.1 | ||||
LDTP03779 | Copper-transporting ATPase 2 (ATP7B) | 6.1 | ||||
LDTP02539 | Lysosomal acid phosphatase (ACP2) | 6.1 | ||||
LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 6.1 | ||||
LDTP12386 | Polyamine-transporting ATPase 13A2 (ATP13A2) | 6.0 | ||||
LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 6.0 | ||||
LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 6.0 | ||||
LDTP07620 | Peroxisomal N(1)-acetyl-spermine/spermidine oxidase (PAOX) | 6.0 | ||||
LDTP12490 | Sphingosine kinase 2 (SPHK2) | 5.9 | ||||
LDTP02776 | Arylsulfatase A (ARSA) | 5.9 | ||||
LDTP07504 | Lysophospholipid acyltransferase 5 (LPCAT3) | 5.9 | ||||
LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 5.8 | ||||
LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 5.8 | ||||
LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 5.7 | ||||
LDTP06384 | Ribosomal protein S6 kinase alpha-1 (RPS6KA1) | 5.7 | ||||
LDTP07931 | Heme A synthase COX15 (COX15) | 5.7 | ||||
LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 5.6 | ||||
LDTP05785 | Probable ATP-dependent RNA helicase DDX10 (DDX10) | 5.6 | ||||
LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 5.6 | ||||
LDTP11127 | ADP-dependent glucokinase (ADPGK) | 5.6 | ||||
LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 5.6 | ||||
LDTP12679 | Trimethyllysine dioxygenase, mitochondrial (TMLHE) | 5.6 | ||||
LDTP14264 | Choline/ethanolaminephosphotransferase 1 (CEPT1) | 5.5 | ||||
LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 5.5 | ||||
LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 5.5 | ||||
LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 5.5 | ||||
LDTP02362 | Dihydrolipoyl dehydrogenase, mitochondrial (DLD) | 5.4 | ||||
LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 5.4 | ||||
LDTP11852 | Presenilin-associated rhomboid-like protein, mitochondrial (PARL) | 5.4 | ||||
LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 5.4 | ||||
LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 5.3 | ||||
LDTP11290 | Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase (ALG8) | 5.3 | ||||
LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 5.3 | ||||
LDTP06977 | GPI ethanolamine phosphate transferase 2 (PIGG) | 5.3 | ||||
LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 5.2 | ||||
LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 5.2 | ||||
LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 5.2 | ||||
LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 5.2 | ||||
LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 5.1 | ||||
LDTP10020 | Ras-related protein Rab-24 (RAB24) | 5.1 | ||||
LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 5.1 | ||||
LDTP12639 | 1-acyl-sn-glycerol-3-phosphate acyltransferase epsilon (AGPAT5) | 5.0 | ||||
LDTP00836 | ATPase GET3 (GET3) | 5.0 | ||||
LDTP04581 | Holocytochrome c-type synthase (HCCS) | 5.0 | ||||
LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 5.0 | ||||
LDTP11259 | Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase (ALG12) | 5.0 | ||||
LDTP04333 | GMP synthase [glutamine-hydrolyzing] (GMPS) | 5.0 | ||||
LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 5.0 | ||||
LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 4.9 |
Transporter and channel
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 99.7 | ||||
LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 25.8 | ||||
LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 25.6 | ||||
LDTP16813 | Tetraspanin-3 (TSPAN3) | 24.8 | ||||
LDTP01804 | ATP synthase subunit a (MT-ATP6) | 24.4 | ||||
LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 22.8 | ||||
LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 22.0 | ||||
LDTP15967 | Tetraspanin-10 (TSPAN10) | 20.3 | ||||
LDTP15948 | Transmembrane protein 126A (TMEM126A) | 20.3 | ||||
LDTP11615 | Protein tweety homolog 3 (TTYH3) | 19.8 | ||||
LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 18.4 | ||||
LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 16.3 | ||||
LDTP15481 | Transmembrane protein 87A (TMEM87A) | 16.2 | ||||
LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 15.7 | ||||
LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 14.9 | ||||
LDTP11927 | Essential MCU regulator, mitochondrial (SMDT1) | 14.6 | ||||
LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 14.4 | ||||
LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 14.1 | ||||
LDTP20002 | Transmembrane protein 160 (TMEM160) | 13.8 | ||||
LDTP07236 | Protein GPR107 (GPR107) | 13.2 | ||||
LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 13.1 | ||||
LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 13.0 | ||||
LDTP02215 | Prosaposin (PSAP) | 12.9 | ||||
LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 12.6 | ||||
LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 12.2 | ||||
LDTP16190 | Protein FAM8A1 (FAM8A1) | 11.8 | ||||
LDTP08881 | Transmembrane protein 199 (TMEM199) | 11.6 | ||||
LDTP15648 | BRI3-binding protein (BRI3BP) | 11.4 | ||||
LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 11.2 | ||||
LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 11.0 | ||||
LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 10.9 | ||||
LDTP04463 | H(+)/Cl(-) exchange transporter 7 (CLCN7) | 10.6 | ||||
LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 10.3 | ||||
LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 9.9 | ||||
LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 9.8 | ||||
LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 9.6 | ||||
LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 9.6 | ||||
LDTP08279 | Mitochondrial coenzyme A transporter SLC25A42 (SLC25A42) | 9.3 | ||||
LDTP11213 | Nucleoporin NDC1 (NDC1) | 9.1 | ||||
LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | 8.9 | ||||
LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 8.8 | ||||
LDTP12383 | Protein GPR108 (GPR108) | 8.8 | ||||
LDTP00592 | Surfeit locus protein 4 (SURF4) | 8.8 | ||||
LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 8.6 | ||||
LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 8.4 | ||||
LDTP09028 | Mitoguardin 1 (MIGA1) | 7.9 | ||||
LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 7.8 | ||||
LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 7.8 | ||||
LDTP09294 | Proton-coupled zinc antiporter SLC30A5 (SLC30A5) | 7.6 | ||||
LDTP12451 | Integral membrane protein 2C (ITM2C) | 7.5 | ||||
LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 7.3 | ||||
LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 7.1 | ||||
LDTP11245 | Derlin-1 (DERL1) | 7.0 | ||||
LDTP05900 | Metaxin-1 (MTX1) | 7.0 | ||||
LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 6.9 | ||||
LDTP03380 | Stomatin (STOM) | 6.9 | ||||
LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 6.9 | ||||
LDTP15979 | Transmembrane protein 245 (TMEM245) | 6.8 | ||||
LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 6.7 | ||||
LDTP07531 | Sideroflexin-4 (SFXN4) | 6.7 | ||||
LDTP09180 | Zinc transporter 7 (SLC30A7) | 6.7 | ||||
LDTP11844 | Protein spinster homolog 1 (SPNS1) | 6.6 | ||||
LDTP10065 | Transmembrane protein 230 (TMEM230) | 6.5 | ||||
LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 6.4 | ||||
LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 6.2 | ||||
LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 6.0 | ||||
LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 5.9 | ||||
LDTP12704 | Anoctamin-10 (ANO10) | 5.7 | ||||
LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 5.7 | ||||
LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 5.6 | ||||
LDTP07439 | Mitochondrial adenyl nucleotide antiporter SLC25A25 (SLC25A25) | 5.6 | ||||
LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 5.6 | ||||
LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 5.5 | ||||
LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 5.5 | ||||
LDTP09203 | Nucleoporin Nup37 (NUP37) | 5.5 | ||||
LDTP01060 | PRA1 family protein 2 (PRAF2) | 5.5 | ||||
LDTP07156 | Protein wntless homolog (WLS) | 5.5 | ||||
LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 5.5 | ||||
LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 5.5 | ||||
LDTP08469 | Complex I assembly factor TMEM126B, mitochondrial (TMEM126B) | 5.4 | ||||
LDTP04787 | Transmembrane protein 33 (TMEM33) | 5.4 | ||||
LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 5.4 | ||||
LDTP11250 | MICOS complex subunit MIC26 (APOO) | 5.4 | ||||
LDTP06293 | Metal cation symporter ZIP14 (SLC39A14) | 5.3 | ||||
LDTP02562 | Lysosome-associated membrane glycoprotein 1 (LAMP1) | 5.2 | ||||
LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 5.2 | ||||
LDTP11406 | Transmembrane protein 59 (TMEM59) | 5.1 | ||||
LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 5.1 | ||||
LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 5.1 | ||||
LDTP18053 | Probable mitochondrial glutathione transporter SLC25A40 (SLC25A40) | 4.9 | ||||
LDTP12979 | Transmembrane protein 14C (TMEM14C) | 4.9 |
Transcription factor
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP08006 | PHD finger-like domain-containing protein 5A (PHF5A) | 5.9 | ||||
LDTP12471 | DNA polymerase epsilon subunit 4 (POLE4) | 5.9 | ||||
LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 5.8 |
GPCR
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP15303 | Membrane progestin receptor alpha (PAQR7) | 19.8 |
Immunoglobulin
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 5.4 |
Other
Target ID | Target Name | Binding Ratio | ||||
---|---|---|---|---|---|---|
LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 32.4 | ||||
LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 31.8 | ||||
LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 29.4 | ||||
LDTP11076 | Apolipoprotein L2 (APOL2) | 27.3 | ||||
LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 26.7 | ||||
LDTP05160 | Nucleobindin-2 (NUCB2) | 20.5 | ||||
LDTP01522 | Reticulon-3 (RTN3) | 19.7 | ||||
LDTP08796 | Protein SYS1 homolog (SYS1) | 17.3 | ||||
LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 17.1 | ||||
LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 15.3 | ||||
LDTP14458 | Tetraspanin-6 (TSPAN6) | 14.0 | ||||
LDTP05375 | Nucleobindin-1 (NUCB1) | 13.2 | ||||
LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 13.1 | ||||
LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 12.9 | ||||
LDTP05868 | Protein unc-119 homolog A (UNC119) | 12.0 | ||||
LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 12.0 | ||||
LDTP18883 | Protein CEBPZOS (CEBPZOS) | 11.6 | ||||
LDTP12412 | Reticulon-4 (RTN4) | 11.4 | ||||
LDTP16006 | Optic atrophy 3 protein (OPA3) | 10.6 | ||||
LDTP16080 | Protein FAM114A2 (FAM114A2) | 10.2 | ||||
LDTP10056 | Protein FAM162A (FAM162A) | 9.8 | ||||
LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 9.7 | ||||
LDTP14263 | TAF6-like RNA polymerase II p300/CBP-associated factor-associated factor 65 kDa subunit 6L (TAF6L) | 9.6 | ||||
LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 9.4 | ||||
LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 8.3 | ||||
LDTP14939 | Membralin (TMEM259) | 8.3 | ||||
LDTP00071 | Vacuolar protein sorting-associated protein 37C (VPS37C) | 7.5 | ||||
LDTP13086 | Syntaxin-18 (STX18) | 7.4 | ||||
LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 7.2 | ||||
LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 7.1 | ||||
LDTP15634 | Ubiquinol-cytochrome c reductase complex assembly factor 5 (UQCC5) | 7.1 | ||||
LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 6.8 | ||||
LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 6.6 | ||||
LDTP12025 | UPF0488 protein C8orf33 (C8orf33) | 6.5 | ||||
LDTP02927 | Ganglioside GM2 activator (GM2A) | 6.3 | ||||
LDTP08224 | Protein LYRIC (MTDH) | 6.2 | ||||
LDTP12925 | CCR4-NOT transcription complex subunit 2 (CNOT2) | 6.1 | ||||
LDTP19963 | TraB domain-containing protein (TRABD) | 5.9 | ||||
LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 5.9 | ||||
LDTP10116 | Lipid droplet assembly factor 1 (LDAF1) | 5.9 | ||||
LDTP06404 | Surfeit locus protein 1 (SURF1) | 5.8 | ||||
LDTP08000 | Dymeclin (DYM) | 5.7 | ||||
LDTP15434 | ADP-ribosylation factor-like protein 6-interacting protein 6 (ARL6IP6) | 5.7 | ||||
LDTP16577 | DENN domain-containing protein 11 (DENND11) | 5.5 | ||||
LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 5.5 | ||||
LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 5.5 | ||||
LDTP09787 | Nicastrin (NCSTN) | 5.4 | ||||
LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 5.4 | ||||
LDTP11695 | Kinesin light chain 2 (KLC2) | 5.3 | ||||
LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 5.3 | ||||
LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 5.2 | ||||
LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 5.2 | ||||
LDTP01167 | Reticulon-2 (RTN2) | 5.1 | ||||
LDTP14792 | Small ribosomal subunit protein uS9m (MRPS9) | 5.1 | ||||
LDTP01494 | Protein YIF1A (YIF1A) | 5.1 | ||||
LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 5.0 | ||||
LDTP08606 | Nurim (NRM) | 5.0 | ||||
LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 5.0 | ||||
LDTP00859 | Synaptogyrin-2 (SYNGR2) | 5.0 | ||||
LDTP06097 | Reticulocalbin-2 (RCN2) | 5.0 | ||||
LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 5.0 | ||||
LDTP12762 | Transmembrane protein 161A (TMEM161A) | 5.0 | ||||
LDTP07031 | Collectin-12 (COLEC12) | 4.9 |