Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C356 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 68.1 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 55.3 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 53.4 | ||||
| LDTP00325 | Pirin (PIR) | 44.6 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 33.8 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 32.9 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 31.6 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 29.7 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 29.0 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 28.2 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 27.1 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 26.4 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 25.8 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 24.4 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 23.3 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 22.3 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 21.1 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 20.8 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 20.8 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 20.4 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 20.4 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 20.1 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 19.8 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 19.8 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 19.7 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 19.4 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 19.2 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 18.6 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 17.8 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 17.6 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 17.5 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 16.8 | ||||
| LDTP11268 | Acireductone dioxygenase (ADI1) | 16.4 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 16.3 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 16.1 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 16.0 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 15.3 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 15.2 | ||||
| LDTP01515 | NADH dehydrogenase 1 beta subcomplex subunit 8, mitochondrial (NDUFB8) | 15.2 | ||||
| LDTP12197 | Ethanolamine kinase 1 (ETNK1) | 14.8 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 14.7 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 14.6 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 14.5 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 14.5 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 14.3 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 14.1 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 14.1 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 13.7 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 13.5 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 13.5 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 13.1 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 12.9 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 12.5 | ||||
| LDTP12886 | Glycerophosphodiester phosphodiesterase 1 (GDE1) | 12.4 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 12.3 | ||||
| LDTP12586 | Phenylalanine--tRNA ligase beta subunit (FARSB) | 12.3 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 12.1 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 12.1 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 11.9 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 11.8 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 11.7 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 11.6 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 11.6 | ||||
| LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 11.6 | ||||
| LDTP05724 | Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial (ECH1) | 11.5 | ||||
| LDTP00544 | Sphingolipid delta(4)-desaturase DES1 (DEGS1) | 11.3 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 11.2 | ||||
| LDTP08933 | Chondroitin sulfate N-acetylgalactosaminyltransferase 2 (CSGALNACT2) | 11.2 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 11.1 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 11.1 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 10.9 | ||||
| LDTP14189 | UbiA prenyltransferase domain-containing protein 1 (UBIAD1) | 10.8 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 10.7 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 10.5 | ||||
| LDTP07109 | ATP-binding cassette sub-family C member 10 (ABCC10) | 10.3 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 10.1 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 10.0 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 10.0 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 9.8 | ||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 9.8 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 9.6 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 9.6 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 9.6 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 9.5 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 9.5 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 9.4 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 9.4 | ||||
| LDTP05228 | Calcium-transporting ATPase type 2C member 1 (ATP2C1) | 9.3 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 9.3 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 9.3 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 9.3 | ||||
| LDTP01974 | Ferritin heavy chain (FTH1) | 9.2 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 9.2 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 9.1 | ||||
| LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 9.1 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 9.1 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 9.1 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 9.1 | ||||
| LDTP09061 | Retinol dehydrogenase 13 (RDH13) | 9.1 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 9.0 | ||||
| LDTP10785 | Ubiquitin carboxyl-terminal hydrolase 28 (USP28) | 9.0 | ||||
| LDTP02000 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase (HMGCR) | 8.9 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 8.9 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 8.9 | ||||
| LDTP12293 | Adipocyte plasma membrane-associated protein (APMAP) | 8.9 | ||||
| LDTP04183 | Lanosterol synthase (LSS) | 8.9 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 8.9 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 8.8 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 8.8 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 8.8 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 8.7 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 8.7 | ||||
| LDTP04384 | Cyclin-dependent kinase 9 (CDK9) | 8.6 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 8.6 | ||||
| LDTP10110 | Exosome complex component RRP43 (EXOSC8) | 8.6 | ||||
| LDTP09620 | Soluble calcium-activated nucleotidase 1 (CANT1) | 8.6 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 8.5 | ||||
| LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 8.3 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 8.3 | ||||
| LDTP10530 | Beta-1,3-galactosyltransferase 6 (B3GALT6) | 8.3 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 8.2 | ||||
| LDTP13154 | E3 ubiquitin-protein ligase RNF14 (RNF14) | 8.2 | ||||
| LDTP00645 | Prolyl 4-hydroxylase subunit alpha-2 (P4HA2) | 8.2 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 8.2 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 8.2 | ||||
| LDTP12420 | Xaa-Pro aminopeptidase 3 (XPNPEP3) | 8.2 | ||||
| LDTP07966 | COP9 signalosome complex subunit 6 (COPS6) | 8.1 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 8.1 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 8.1 | ||||
| LDTP10887 | Synaptic vesicle membrane protein VAT-1 homolog (VAT1) | 8.1 | ||||
| LDTP01389 | Delta(14)-sterol reductase TM7SF2 (TM7SF2) | 8.0 | ||||
| LDTP03680 | DNA replication licensing factor MCM4 (MCM4) | 8.0 | ||||
| LDTP11437 | Peroxisomal trans-2-enoyl-CoA reductase (PECR) | 8.0 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 7.9 | ||||
| LDTP01300 | Cartilage-associated protein (CRTAP) | 7.9 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 7.9 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 7.9 | ||||
| LDTP06067 | Tubulin--tyrosine ligase-like protein 12 (TTLL12) | 7.8 | ||||
| LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | 7.8 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 99.7 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 57.3 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 42.8 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 35.8 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 34.8 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 34.5 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 34.1 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 32.7 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 31.3 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 31.1 | ||||
| LDTP02215 | Prosaposin (PSAP) | 29.9 | ||||
| LDTP06633 | Reticulon-1 (RTN1) | 28.6 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 28.1 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 27.1 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 25.6 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 22.3 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 21.6 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 19.7 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 19.4 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 18.4 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 17.5 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 16.8 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 16.8 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 16.6 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 16.1 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 15.7 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 15.3 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 14.5 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 14.3 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 13.6 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 13.2 | ||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | 12.3 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 11.8 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 11.5 | ||||
| LDTP01100 | Iron-sulfur clusters transporter ABCB7, mitochondrial (ABCB7) | 11.5 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 11.5 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 11.3 | ||||
| LDTP08673 | Calcium uptake protein 2, mitochondrial (MICU2) | 11.2 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 11.1 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 10.9 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 10.9 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 10.3 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 10.1 | ||||
| LDTP08030 | Autophagy-related protein 9A (ATG9A) | 10.1 | ||||
| LDTP06293 | Metal cation symporter ZIP14 (SLC39A14) | 9.9 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 9.8 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 9.8 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 9.7 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 9.6 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 9.6 | ||||
| LDTP14178 | Heme transporter FLVCR1 (FLVCR1) | 9.3 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 9.2 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 9.1 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 9.0 | ||||
| LDTP10036 | BOS complex subunit NCLN (NCLN) | 8.9 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 8.9 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 8.9 | ||||
| LDTP11826 | Sodium-dependent neutral amino acid transporter B(0)AT2 (SLC6A15) | 8.8 | ||||
| LDTP13256 | SUN domain-containing protein 2 (SUN2) | 8.8 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 8.8 | ||||
| LDTP04749 | Peroxisomal biogenesis factor 3 (PEX3) | 8.6 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 8.6 | ||||
| LDTP11041 | Calcium uptake protein 1, mitochondrial (MICU1) | 8.5 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 8.5 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 8.5 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 8.5 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 8.4 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 8.4 | ||||
| LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 8.3 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 8.2 | ||||
| LDTP14174 | Sorting nexin-5 (SNX5) | 8.1 | ||||
| LDTP06499 | V-type proton ATPase subunit S1 (ATP6AP1) | 8.1 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 8.0 | ||||
| LDTP14717 | ATP synthase subunit e, mitochondrial (ATP5ME) | 7.9 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 7.9 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 9.3 | ||||
GPCR
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15303 | Membrane progestin receptor alpha (PAQR7) | 18.9 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 73.0 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 58.1 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 55.3 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 53.1 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 49.9 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 39.7 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 29.9 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 28.8 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 26.7 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 24.3 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 24.1 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 21.9 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 18.8 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 18.3 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 18.1 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 17.6 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 16.0 | ||||
| LDTP13630 | Neudesin (NENF) | 15.9 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 15.0 | ||||
| LDTP11533 | Oxysterol-binding protein-related protein 6 (OSBPL6) | 15.0 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 14.9 | ||||
| LDTP10255 | Protein Hook homolog 2 (HOOK2) | 14.8 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 14.7 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 14.5 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 14.5 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 14.1 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 14.1 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 13.4 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 12.7 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 12.0 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 11.9 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 11.6 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 11.2 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 10.9 | ||||
| LDTP15634 | Ubiquinol-cytochrome c reductase complex assembly factor 5 (UQCC5) | 10.9 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 10.8 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 10.6 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 10.6 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 10.6 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 10.5 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 10.3 | ||||
| LDTP13802 | DNA replication complex GINS protein PSF2 (GINS2) | 10.3 | ||||
| LDTP11058 | Glutamate-rich WD repeat-containing protein 1 (GRWD1) | 9.8 | ||||
| LDTP10184 | HAUS augmin-like complex subunit 1 (HAUS1) | 9.8 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 9.7 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 9.6 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 9.6 | ||||
| LDTP03520 | Phosphatidylethanolamine-binding protein 1 (PEBP1) | 9.4 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 9.4 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 9.4 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 9.2 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 9.1 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 9.0 | ||||
| LDTP09080 | Reticulophagy regulator 2 (RETREG2) | 9.0 | ||||
| LDTP13338 | Vacuolar protein sorting-associated protein 51 homolog (VPS51) | 9.0 | ||||
| LDTP10857 | c-Myc-binding protein (MYCBP) | 8.9 | ||||
| LDTP05226 | RNA-binding protein 3 (RBM3) | 8.9 | ||||
| LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | 8.9 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 8.9 | ||||
| LDTP09297 | Large ribosomal subunit protein mL64 (GADD45GIP1) | 8.9 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 8.9 | ||||
| LDTP04091 | Adapter molecule crk (CRK) | 8.8 | ||||
| LDTP00871 | Microtubule nucleation factor SSNA1 (SSNA1) | 8.8 | ||||
| LDTP10469 | Engulfment and cell motility protein 2 (ELMO2) | 8.8 | ||||
| LDTP05277 | Protein SET (SET) | 8.3 | ||||
| LDTP02297 | Vimentin (VIM) | 8.2 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 8.2 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 8.2 | ||||
| LDTP14058 | Rap guanine nucleotide exchange factor 2 (RAPGEF2) | 8.0 | ||||
| LDTP14792 | Small ribosomal subunit protein uS9m (MRPS9) | 8.0 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 7.9 | ||||
| LDTP06022 | Cold-inducible RNA-binding protein (CIRBP) | 7.9 | ||||
| LDTP13954 | Complex I intermediate-associated protein 30, mitochondrial (NDUFAF1) | 7.9 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 7.9 | ||||
| LDTP10924 | Prohibitin-2 (PHB2) | 7.9 | ||||
| LDTP11239 | Protein misato homolog 1 (MSTO1) | 7.8 | ||||
