Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C264 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 85.0 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 63.6 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 61.8 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 58.9 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 57.7 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 52.3 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 52.3 | ||||
| LDTP00325 | Pirin (PIR) | 50.9 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 50.2 | ||||
| LDTP07525 | Protein arginine N-methyltransferase 9 (PRMT9) | 48.8 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 47.2 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 45.9 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 42.8 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 42.5 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 42.2 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 41.4 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 40.2 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 39.1 | ||||
| LDTP04164 | NADP-dependent malic enzyme (ME1) | 38.9 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 37.8 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 37.3 | ||||
| LDTP17305 | Glycosyltransferase 8 domain-containing protein 1 (GLT8D1) | 36.5 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 36.0 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 35.0 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 33.4 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 32.7 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 32.4 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 32.0 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 31.8 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 30.9 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 29.2 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 29.0 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 29.0 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 29.0 | ||||
| LDTP11199 | DCN1-like protein 5 (DCUN1D5) | 28.4 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 28.2 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 28.2 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 28.1 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 28.1 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 28.1 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 28.1 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 27.1 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 26.7 | ||||
| LDTP07503 | Endoplasmic reticulum aminopeptidase 2 (ERAP2) | 26.5 | ||||
| LDTP06501 | Ras-related protein Rab-11B (RAB11B) | 26.4 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 25.8 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 25.6 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 25.6 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 25.5 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 24.9 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 24.6 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 24.4 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 24.4 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 24.3 | ||||
| LDTP12197 | Ethanolamine kinase 1 (ETNK1) | 23.9 | ||||
| LDTP07989 | Ribonucleoside-diphosphate reductase subunit M2 B (RRM2B) | 23.9 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 23.6 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 23.3 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 23.3 | ||||
| LDTP00836 | ATPase GET3 (GET3) | 22.9 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 22.6 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 21.7 | ||||
| LDTP02868 | Fumarylacetoacetase (FAH) | 21.6 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 21.0 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 20.7 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 20.7 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 20.4 | ||||
| LDTP12415 | Adenosine 5'-monophosphoramidase HINT3 (HINT3) | 20.3 | ||||
| LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 20.1 | ||||
| LDTP04542 | Thimet oligopeptidase (THOP1) | 19.8 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 19.4 | ||||
| LDTP06721 | GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase (ALG11) | 19.3 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 19.3 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 19.2 | ||||
| LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 19.0 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 18.9 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 18.9 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 18.9 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 18.8 | ||||
| LDTP10966 | Microsomal glutathione S-transferase 2 (MGST2) | 18.8 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 18.8 | ||||
| LDTP05446 | Ubiquitin-protein ligase E3A (UBE3A) | 18.8 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 18.6 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 18.4 | ||||
| LDTP04374 | Dynamin-2 (DNM2) | 18.4 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 18.4 | ||||
| LDTP05228 | Calcium-transporting ATPase type 2C member 1 (ATP2C1) | 18.3 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 18.3 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 18.3 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 18.1 | ||||
| LDTP12215 | rRNA methyltransferase 3, mitochondrial (MRM3) | 17.9 | ||||
| LDTP13986 | Vesicle transport protein GOT1B (GOLT1B) | 17.9 | ||||
| LDTP11284 | Phosphatidylserine synthase 2 (PTDSS2) | 17.8 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 17.6 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 17.6 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 17.4 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 17.3 | ||||
| LDTP11733 | Ras-related protein Rab-1B (RAB1B) | 17.3 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 17.3 | ||||
| LDTP09061 | Retinol dehydrogenase 13 (RDH13) | 17.1 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 17.0 | ||||
| LDTP14723 | Selenocysteine-specific elongation factor (EEFSEC) | 17.0 | ||||
| LDTP00654 | Synaptobrevin homolog YKT6 (YKT6) | 17.0 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 16.9 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 16.7 | ||||
| LDTP11259 | Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase (ALG12) | 16.4 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 16.4 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 16.3 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 16.3 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 16.2 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 99.7 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 99.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 86.2 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 82.7 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 77.7 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 72.0 | ||||
| LDTP06633 | Reticulon-1 (RTN1) | 69.6 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 59.7 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 57.3 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 54.2 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 50.2 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 47.2 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 46.2 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 44.9 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 44.0 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 43.4 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 42.8 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 40.8 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 39.9 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 39.4 | ||||
| LDTP09204 | Nucleoporin NUP35 (NUP35) | 39.1 | ||||
| LDTP02215 | Prosaposin (PSAP) | 38.3 | ||||
| LDTP00857 | Syntaxin-6 (STX6) | 37.5 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 37.3 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 36.8 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 36.0 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 34.8 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 34.1 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 34.1 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 33.6 | ||||
| LDTP01601 | Activator of 90 kDa heat shock protein ATPase homolog 1 (AHSA1) | 30.7 | ||||
| LDTP04956 | Mitochondrial import inner membrane translocase subunit Tim10 (TIMM10) | 30.1 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 30.1 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 29.7 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 29.7 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 29.4 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 28.8 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 28.4 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 27.9 | ||||
| LDTP11927 | Essential MCU regulator, mitochondrial (SMDT1) | 27.3 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 27.3 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 27.1 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 26.9 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 26.7 | ||||
| LDTP09788 | Sorting nexin-19 (SNX19) | 26.4 | ||||
| LDTP01574 | Importin-7 (IPO7) | 26.0 | ||||
| LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 25.1 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 24.8 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 24.1 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 24.1 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 23.9 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 23.8 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 23.4 | ||||
| LDTP00970 | Gasdermin-E (GSDME) | 23.3 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 22.6 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 22.6 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 22.0 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 22.0 | ||||
| LDTP08981 | Cytochrome c oxidase assembly protein COX18, mitochondrial (COX18) | 21.9 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 21.9 | ||||
| LDTP03546 | Translocator protein (TSPO) | 21.9 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 21.7 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 21.6 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 21.6 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 21.3 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 21.3 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 21.0 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 20.4 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 20.0 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 19.7 | ||||
| LDTP11626 | Protein YIPF3 (YIPF3) | 19.4 | ||||
| LDTP14181 | Peroxisomal membrane protein PEX16 (PEX16) | 19.0 | ||||
| LDTP06499 | V-type proton ATPase subunit S1 (ATP6AP1) | 18.8 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 18.6 | ||||
| LDTP07058 | Transmembrane protein 201 (TMEM201) | 18.5 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 18.4 | ||||
| LDTP07610 | Proton-coupled zinc antiporter SLC30A9, mitochondrial (SLC30A9) | 18.4 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 18.3 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 18.3 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 18.0 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 17.5 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 17.5 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 17.4 | ||||
| LDTP06855 | Anoctamin-6 (ANO6) | 17.4 | ||||
| LDTP00882 | Glucose-6-phosphate exchanger SLC37A4 (SLC37A4) | 17.3 | ||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 17.3 | ||||
| LDTP04512 | Cationic amino acid transporter 2 (SLC7A2) | 16.9 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 16.9 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 16.9 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 16.7 | ||||
| LDTP04707 | Protein SEC13 homolog (SEC13) | 16.7 | ||||
| LDTP11136 | Sugar transporter SWEET1 (SLC50A1) | 16.7 | ||||
| LDTP04227 | Guided entry of tail-anchored proteins factor CAMLG (CAMLG) | 16.6 | ||||
| LDTP12704 | Anoctamin-10 (ANO10) | 16.4 | ||||
| LDTP01380 | Wolframin (WFS1) | 16.2 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 24.8 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 17.0 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11076 | Apolipoprotein L2 (APOL2) | 99.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 99.7 | ||||
| LDTP11277 | Tubulin beta-2B chain (TUBB2B) | 99.7 | ||||
| LDTP05076 | Tubulin beta-4B chain (TUBB4B) | 86.2 | ||||
| LDTP11233 | Tubulin beta-6 chain (TUBB6) | 85.6 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 85.0 | ||||
| LDTP02205 | Tubulin beta chain (TUBB) | 78.8 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 72.5 | ||||
| LDTP05998 | Tubulin beta-2A chain (TUBB2A) | 72.0 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 70.5 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 64.4 | ||||
| LDTP14939 | Membralin (TMEM259) | 63.6 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 56.9 | ||||
| LDTP02037 | Tubulin beta-4A chain (TUBB4A) | 53.8 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 48.8 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 45.9 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 45.6 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 44.9 | ||||
| LDTP13797 | HIG1 domain family member 1A, mitochondrial (HIGD1A) | 43.4 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 42.8 | ||||
| LDTP05386 | Dystonin (DST) | 42.5 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 41.9 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 38.6 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 36.0 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 35.8 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 35.3 | ||||
| LDTP08606 | Nurim (NRM) | 34.5 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 34.1 | ||||
| LDTP16116 | BSD domain-containing protein 1 (BSDC1) | 33.8 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 33.6 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 32.7 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 32.7 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 30.5 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 29.2 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 28.8 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 28.8 | ||||
| LDTP10116 | Lipid droplet assembly factor 1 (LDAF1) | 28.2 | ||||
| LDTP09773 | Protein FAM3C (FAM3C) | 28.2 | ||||
| LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 28.1 | ||||
| LDTP07574 | Superkiller complex protein 3 (SKIC3) | 28.1 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 25.3 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 24.3 | ||||
| LDTP07274 | MICOS complex subunit MIC13 (MICOS13) | 23.3 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 21.7 | ||||
| LDTP08000 | Dymeclin (DYM) | 21.4 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 21.1 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 20.7 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 20.7 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 20.1 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 19.8 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 19.6 | ||||
| LDTP15101 | Armadillo repeat-containing protein 6 (ARMC6) | 19.3 | ||||
| LDTP19859 | Small integral membrane protein 12 (SMIM12) | 19.3 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 19.2 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 19.2 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 19.2 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 19.0 | ||||
| LDTP01608 | Proteasome assembly chaperone 1 (PSMG1) | 18.8 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 18.0 | ||||
| LDTP05715 | Vesicle transport protein SEC20 (BNIP1) | 18.0 | ||||
| LDTP12623 | Zinc finger CCHC domain-containing protein 3 (ZCCHC3) | 18.0 | ||||
| LDTP13273 | Ubiquilin-2 (UBQLN2) | 17.8 | ||||
| LDTP09069 | Kinetochore protein Spc24 (SPC24) | 17.6 | ||||
| LDTP02047 | Calpain small subunit 1 (CAPNS1) | 17.4 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 17.4 | ||||
| LDTP12545 | Protein kish-B (TMEM167B) | 17.4 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 17.4 | ||||
| LDTP02887 | Transmembrane protein 11, mitochondrial (TMEM11) | 17.4 | ||||
| LDTP04703 | Tumor protein D52 (TPD52) | 17.3 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 17.1 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 17.1 | ||||
| LDTP11239 | Protein misato homolog 1 (MSTO1) | 17.1 | ||||
| LDTP19005 | SLC35A4 upstream open reading frame protein (SLC35A4) | 17.0 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 16.9 | ||||
| LDTP10214 | Splicing factor ESS-2 homolog (ESS2) | 16.9 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 16.8 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 16.6 | ||||
| LDTP06268 | Condensin complex subunit 2 (NCAPH) | 16.6 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 16.3 | ||||
