Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C382 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01803 | Adenosine deaminase (ADA) | 99.7 | ||||
| LDTP01743 | NADH dehydrogenase 1 beta subcomplex subunit 10 (NDUFB10) | 56.5 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 52.3 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 48.5 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 39.7 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 35.5 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 33.4 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 31.8 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 31.1 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 29.0 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 28.1 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 27.5 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 26.9 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 26.5 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 26.5 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 24.9 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 24.3 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 24.1 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 22.9 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 22.3 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 22.2 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 22.0 | ||||
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 21.7 | ||||
| LDTP16235 | Paladin (PALD1) | 21.6 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 21.1 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 21.0 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 20.7 | ||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 18.8 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 18.3 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 18.0 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 17.9 | ||||
| LDTP12679 | Trimethyllysine dioxygenase, mitochondrial (TMLHE) | 17.1 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 17.0 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 16.8 | ||||
| LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 16.3 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 15.9 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 15.8 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 15.2 | ||||
| LDTP07831 | Transmembrane protein with metallophosphoesterase domain (TMPPE) | 15.0 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 14.8 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 14.7 | ||||
| LDTP06645 | Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial (HADH) | 14.4 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 14.4 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 14.3 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 13.8 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 13.8 | ||||
| LDTP11081 | NAD-capped RNA hydrolase NUDT12 (NUDT12) | 13.5 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 13.5 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 13.3 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 13.2 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 12.9 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 12.9 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 12.7 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 12.6 | ||||
| LDTP07989 | Ribonucleoside-diphosphate reductase subunit M2 B (RRM2B) | 12.6 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 12.5 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 12.4 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 12.3 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 12.0 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 11.9 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 11.7 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 11.6 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 11.4 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 11.3 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 11.2 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 11.1 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 11.0 | ||||
| LDTP04358 | Carnitine O-palmitoyltransferase 1, liver isoform (CPT1A) | 10.9 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 10.9 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 10.9 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 10.8 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 10.8 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 10.7 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 10.6 | ||||
| LDTP07966 | COP9 signalosome complex subunit 6 (COPS6) | 10.5 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 10.5 | ||||
| LDTP10293 | UDP-N-acetylglucosamine transferase subunit ALG14 homolog (ALG14) | 10.5 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 10.4 | ||||
| LDTP01573 | Acyl-protein thioesterase 2 (LYPLA2) | 10.3 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 10.3 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 10.2 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 10.2 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 10.2 | ||||
| LDTP06384 | Ribosomal protein S6 kinase alpha-1 (RPS6KA1) | 10.2 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 9.9 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 9.9 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 9.8 | ||||
| LDTP01699 | Acyl-CoA 6-desaturase (FADS2) | 9.8 | ||||
| LDTP13204 | Gamma-adducin (ADD3) | 9.8 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 9.7 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 9.7 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 9.7 | ||||
| LDTP01514 | NADH dehydrogenase 1 beta subcomplex subunit 4 (NDUFB4) | 9.7 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 9.6 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 9.6 | ||||
| LDTP01004 | Mitotic checkpoint serine/threonine-protein kinase BUB1 beta (BUB1B) | 9.5 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 9.5 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 9.5 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 9.3 | ||||
| LDTP05493 | Sulfotransferase 2A1 (SULT2A1) | 9.3 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 9.2 | ||||
| LDTP06546 | Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform (PPP2R5E) | 9.1 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 9.1 | ||||
| LDTP04246 | Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha (FNTA) | 9.0 | ||||
| LDTP12318 | Calcium-independent phospholipase A2-gamma (PNPLA8) | 8.9 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 8.9 | ||||
| LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 8.9 | ||||
| LDTP06839 | NAD kinase 2, mitochondrial (NADK2) | 8.9 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 8.9 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 8.9 | ||||
| LDTP11199 | DCN1-like protein 5 (DCUN1D5) | 8.8 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 8.8 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 8.8 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 8.8 | ||||
| LDTP08598 | NAD-dependent protein deacetylase sirtuin-2 (SIRT2) | 8.7 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 8.6 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 8.6 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 88.6 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 60.1 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 52.3 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 50.9 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 37.8 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 37.3 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 36.5 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 33.8 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 29.7 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 28.4 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 26.4 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 25.5 | ||||
| LDTP03546 | Translocator protein (TSPO) | 23.3 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 23.3 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 22.8 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 22.0 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 21.1 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 20.7 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 20.0 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 18.9 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 18.6 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 18.3 | ||||
| LDTP11812 | Protein ARV1 (ARV1) | 17.0 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 16.9 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 16.4 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 16.2 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 16.2 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 15.9 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 15.6 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 15.3 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 14.9 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 14.4 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 13.9 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 13.8 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 13.8 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 13.7 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 13.1 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 13.0 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 13.0 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 12.9 | ||||
| LDTP02215 | Prosaposin (PSAP) | 12.8 | ||||
| LDTP14970 | Metaxin-3 (MTX3) | 12.7 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 12.7 | ||||
| LDTP09769 | Zinc transporter SLC39A7 (SLC39A7) | 12.7 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 12.6 | ||||
| LDTP01100 | Iron-sulfur clusters transporter ABCB7, mitochondrial (ABCB7) | 12.2 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 12.1 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 12.0 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 11.8 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 11.6 | ||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | 11.6 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 11.0 | ||||
| LDTP13823 | Mitochondrial chaperone BCS1 (BCS1L) | 10.9 | ||||
| LDTP11826 | Sodium-dependent neutral amino acid transporter B(0)AT2 (SLC6A15) | 10.9 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 10.7 | ||||
| LDTP07462 | MFS-type transporter SLC18B1 (SLC18B1) | 10.4 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 10.4 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 10.2 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 10.1 | ||||
| LDTP00810 | Exportin-T (XPOT) | 10.1 | ||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 10.1 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 9.8 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 9.7 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 9.7 | ||||
| LDTP00970 | Gasdermin-E (GSDME) | 9.6 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 9.6 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 9.4 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 9.3 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 9.2 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 9.1 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 8.9 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 8.8 | ||||
| LDTP03380 | Stomatin (STOM) | 8.8 | ||||
| LDTP10769 | Intermembrane lipid transfer protein VPS13A (VPS13A) | 8.8 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16717 | Forkhead-associated domain-containing protein 1 (FHAD1) | 34.3 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11076 | Apolipoprotein L2 (APOL2) | 99.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 84.4 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 42.5 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 35.0 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 35.0 | ||||
| LDTP05386 | Dystonin (DST) | 34.8 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 34.8 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 30.9 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 30.1 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 29.0 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 28.6 | ||||
| LDTP11277 | Tubulin beta-2B chain (TUBB2B) | 28.4 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 28.2 | ||||
| LDTP06373 | Mitochondrial import receptor subunit TOM20 homolog (TOMM20) | 27.1 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 24.6 | ||||
| LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 23.3 | ||||
| LDTP05998 | Tubulin beta-2A chain (TUBB2A) | 22.3 | ||||
| LDTP05076 | Tubulin beta-4B chain (TUBB4B) | 22.2 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 21.9 | ||||
| LDTP02037 | Tubulin beta-4A chain (TUBB4A) | 21.9 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 21.1 | ||||
| LDTP02205 | Tubulin beta chain (TUBB) | 21.1 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 20.8 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 20.0 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 18.8 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 18.8 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 18.5 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 18.3 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 17.4 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 17.3 | ||||
| LDTP10857 | c-Myc-binding protein (MYCBP) | 16.8 | ||||
| LDTP08248 | NLR family member X1 (NLRX1) | 16.8 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 16.7 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 16.3 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 15.8 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 15.7 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 15.1 | ||||
| LDTP11233 | Tubulin beta-6 chain (TUBB6) | 14.7 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 14.2 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 14.1 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 12.8 | ||||
| LDTP08606 | Nurim (NRM) | 12.6 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 12.1 | ||||
| LDTP02297 | Vimentin (VIM) | 12.0 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 12.0 | ||||
| LDTP08073 | Tetratricopeptide repeat protein 21B (TTC21B) | 11.8 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 11.7 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 11.7 | ||||
| LDTP04714 | Heterogeneous nuclear ribonucleoprotein H2 (HNRNPH2) | 11.6 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 11.5 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 11.2 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 11.2 | ||||
| LDTP14792 | Small ribosomal subunit protein uS9m (MRPS9) | 11.2 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 11.2 | ||||
| LDTP12623 | Zinc finger CCHC domain-containing protein 3 (ZCCHC3) | 11.1 | ||||
| LDTP08793 | Armadillo repeat-containing protein 10 (ARMC10) | 10.6 | ||||
| LDTP00887 | Calumenin (CALU) | 10.4 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 10.4 | ||||
| LDTP09297 | Large ribosomal subunit protein mL64 (GADD45GIP1) | 10.4 | ||||
| LDTP06022 | Cold-inducible RNA-binding protein (CIRBP) | 10.3 | ||||
| LDTP15240 | LysM and putative peptidoglycan-binding domain-containing protein 3 (LYSMD3) | 10.1 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 10.0 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 10.0 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 10.0 | ||||
| LDTP12418 | Mitochondrial dynamics protein MIEF1 (MIEF1) | 9.9 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 9.8 | ||||
| LDTP00871 | Microtubule nucleation factor SSNA1 (SSNA1) | 9.8 | ||||
| LDTP13967 | Transmembrane emp24 domain-containing protein 5 (TMED5) | 9.8 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 9.7 | ||||
| LDTP09644 | m-AAA protease-interacting protein 1, mitochondrial (MAIP1) | 9.5 | ||||
| LDTP13922 | Tudor and KH domain-containing protein (TDRKH) | 9.5 | ||||
| LDTP15778 | Protein PRRC1 (PRRC1) | 9.4 | ||||
| LDTP04514 | Heterogeneous nuclear ribonucleoprotein F (HNRNPF) | 9.4 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 9.4 | ||||
| LDTP09069 | Kinetochore protein Spc24 (SPC24) | 9.3 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 9.3 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 9.2 | ||||
| LDTP16322 | Mitochondrial import inner membrane translocase subunit Tim8 B (TIMM8B) | 9.1 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 9.1 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 9.1 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 9.1 | ||||
| LDTP15852 | Protein FAM118B (FAM118B) | 9.1 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 9.0 | ||||
| LDTP04207 | Heat shock 70 kDa protein 13 (HSPA13) | 8.9 | ||||
| LDTP09773 | Protein FAM3C (FAM3C) | 8.8 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 8.8 | ||||
| LDTP03615 | Heterogeneous nuclear ribonucleoprotein H (HNRNPH1) | 8.8 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 8.8 | ||||
| LDTP05036 | Transformer-2 protein homolog beta (TRA2B) | 8.8 | ||||
| LDTP17715 | S1 RNA-binding domain-containing protein 1 (SRBD1) | 8.6 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 8.6 | ||||
| LDTP03182 | Heterogeneous nuclear ribonucleoproteins A2/B1 (HNRNPA2B1) | 8.6 | ||||
