Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C219 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 32.0 | ||||
| LDTP08455 | Palmitoyltransferase ZDHHC13 (ZDHHC13) | 27.5 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 26.7 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 26.7 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 25.3 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 23.1 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 21.0 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 20.5 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 20.4 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 19.3 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 18.9 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 18.9 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 17.4 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 16.8 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 16.6 | ||||
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 16.3 | ||||
| LDTP02565 | Medium-chain specific acyl-CoA dehydrogenase, mitochondrial (ACADM) | 15.9 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 15.0 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 14.7 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 14.6 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 14.5 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 14.4 | ||||
| LDTP01983 | NADH-ubiquinone oxidoreductase chain 2 (MT-ND2) | 13.8 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 13.5 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 13.2 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 11.8 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 11.6 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 11.6 | ||||
| LDTP04542 | Thimet oligopeptidase (THOP1) | 10.7 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 10.6 | ||||
| LDTP00544 | Sphingolipid delta(4)-desaturase DES1 (DEGS1) | 10.5 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 10.0 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 10.0 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 9.8 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 9.8 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 9.8 | ||||
| LDTP00758 | Thioredoxin-like protein 1 (TXNL1) | 9.7 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 9.6 | ||||
| LDTP07831 | Transmembrane protein with metallophosphoesterase domain (TMPPE) | 9.6 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 9.5 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 9.4 | ||||
| LDTP02264 | Asparagine synthetase [glutamine-hydrolyzing] (ASNS) | 9.4 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 9.3 | ||||
| LDTP13131 | 7-dehydrocholesterol reductase (DHCR7) | 9.2 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 9.1 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 9.1 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 8.8 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 8.7 | ||||
| LDTP12415 | Adenosine 5'-monophosphoramidase HINT3 (HINT3) | 8.6 | ||||
| LDTP01300 | Cartilage-associated protein (CRTAP) | 8.5 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 8.5 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 8.4 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 8.2 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 7.8 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 7.7 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 7.6 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 7.6 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 7.5 | ||||
| LDTP12639 | 1-acyl-sn-glycerol-3-phosphate acyltransferase epsilon (AGPAT5) | 7.5 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 7.5 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 7.5 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 7.3 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 7.3 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 7.2 | ||||
| LDTP07868 | Protein O-mannosyl-transferase TMTC3 (TMTC3) | 7.2 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 7.1 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 7.1 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 7.0 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 7.0 | ||||
| LDTP02067 | Sodium/potassium-transporting ATPase subunit alpha-1 (ATP1A1) | 7.0 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 7.0 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 7.0 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 7.0 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 6.9 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 6.9 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 6.8 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 6.8 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 6.7 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 6.7 | ||||
| LDTP09556 | E3 ubiquitin-protein ligase RNF139 (RNF139) | 6.7 | ||||
| LDTP04601 | Arginine--tRNA ligase, cytoplasmic (RARS1) | 6.6 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 6.6 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 6.5 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 6.5 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 6.5 | ||||
| LDTP05136 | DNA-dependent protein kinase catalytic subunit (PRKDC) | 6.4 | ||||
| LDTP11259 | Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase (ALG12) | 6.4 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 6.3 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 6.2 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 6.1 | ||||
| LDTP01219 | NADH dehydrogenase 1 beta subcomplex subunit 1 (NDUFB1) | 6.0 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 5.9 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 5.8 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 5.8 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 5.7 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 5.7 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 5.7 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 5.7 | ||||
| LDTP04471 | Ribosomal protein S6 kinase alpha-3 (RPS6KA3) | 5.6 | ||||
| LDTP03779 | Copper-transporting ATPase 2 (ATP7B) | 5.4 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 5.3 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 5.3 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 5.2 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 5.2 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 5.2 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 5.2 | ||||
| LDTP01649 | Phosphatidate cytidylyltransferase 2 (CDS2) | 5.0 | ||||
| LDTP11867 | UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase (DPAGT1) | 5.0 | ||||
| LDTP12293 | Adipocyte plasma membrane-associated protein (APMAP) | 5.0 | ||||
| LDTP10981 | Mitochondrial intermediate peptidase (MIPEP) | 5.0 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 5.0 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 4.9 | ||||
| LDTP00344 | Stearoyl-CoA desaturase (SCD) | 4.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 64.0 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 56.1 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 46.9 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 33.1 | ||||
| LDTP05116 | CMP-sialic acid transporter (SLC35A1) | 29.4 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 29.2 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 29.0 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 23.3 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 22.8 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 21.1 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 20.5 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 18.9 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 18.6 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 18.4 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 18.1 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 18.0 | ||||
| LDTP10036 | BOS complex subunit NCLN (NCLN) | 17.5 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 16.8 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 16.3 | ||||
| LDTP11136 | Sugar transporter SWEET1 (SLC50A1) | 15.2 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 14.5 | ||||
| LDTP08981 | Cytochrome c oxidase assembly protein COX18, mitochondrial (COX18) | 14.4 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 14.3 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 14.2 | ||||
| LDTP07490 | Zinc transporter 6 (SLC30A6) | 14.2 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 13.7 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 13.0 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 12.7 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 12.7 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 12.6 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 12.0 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 11.8 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 11.2 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 10.9 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 10.9 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 10.8 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 10.6 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 10.3 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 10.1 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 10.1 | ||||
| LDTP08016 | Proton-coupled amino acid transporter 1 (SLC36A1) | 9.4 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 9.4 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 8.9 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 8.9 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 8.8 | ||||
| LDTP06293 | Metal cation symporter ZIP14 (SLC39A14) | 8.7 | ||||
| LDTP11826 | Sodium-dependent neutral amino acid transporter B(0)AT2 (SLC6A15) | 8.4 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 8.4 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 8.3 | ||||
| LDTP02215 | Prosaposin (PSAP) | 8.3 | ||||
| LDTP07467 | Rhomboid domain-containing protein 2 (RHBDD2) | 8.1 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 7.2 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 6.8 | ||||
| LDTP09294 | Proton-coupled zinc antiporter SLC30A5 (SLC30A5) | 6.7 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 6.7 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 6.5 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 6.5 | ||||
| LDTP06855 | Anoctamin-6 (ANO6) | 6.4 | ||||
| LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 6.4 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 6.4 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 6.3 | ||||
| LDTP09203 | Nucleoporin Nup37 (NUP37) | 6.2 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 6.1 | ||||
| LDTP11626 | Protein YIPF3 (YIPF3) | 6.1 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 6.1 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 6.0 | ||||
| LDTP08673 | Calcium uptake protein 2, mitochondrial (MICU2) | 5.9 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 5.9 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 5.9 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 5.9 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 5.8 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 5.7 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 5.7 | ||||
| LDTP01380 | Wolframin (WFS1) | 5.5 | ||||
| LDTP04463 | H(+)/Cl(-) exchange transporter 7 (CLCN7) | 5.5 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 5.5 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 5.4 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 5.4 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 5.4 | ||||
| LDTP00590 | Protein RER1 (RER1) | 5.4 | ||||
| LDTP12704 | Anoctamin-10 (ANO10) | 5.3 | ||||
| LDTP06331 | Pericentriolar material 1 protein (PCM1) | 5.3 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 5.2 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 5.2 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 5.1 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 5.0 | ||||
| LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 5.0 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05572 | Leukocyte surface antigen CD47 (CD47) | 7.3 | ||||
| LDTP03772 | Basigin (BSG) | 5.2 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 44.3 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 36.0 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 26.9 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 24.8 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 22.5 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 20.8 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 19.6 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 18.9 | ||||
| LDTP06128 | RNA-binding protein 39 (RBM39) | 17.5 | ||||
| LDTP13802 | DNA replication complex GINS protein PSF2 (GINS2) | 16.1 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 15.9 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 15.5 | ||||
| LDTP01451 | UBX domain-containing protein 7 (UBXN7) | 15.0 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 14.6 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 14.5 | ||||
| LDTP05233 | 55 kDa erythrocyte membrane protein (MPP1) | 13.3 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 12.6 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 11.9 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 11.6 | ||||
| LDTP02156 | Eukaryotic translation initiation factor 4E (EIF4E) | 11.4 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 10.4 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 10.3 | ||||
| LDTP07906 | Mediator of RNA polymerase II transcription subunit 25 (MED25) | 10.3 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 10.2 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 10.1 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 9.8 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 9.6 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 9.5 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 9.5 | ||||
| LDTP07574 | Superkiller complex protein 3 (SKIC3) | 9.4 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 9.1 | ||||
| LDTP13425 | U6 snRNA-associated Sm-like protein LSm7 (LSM7) | 9.0 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 8.9 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 8.3 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 8.2 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 8.2 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 7.7 | ||||
| LDTP04947 | DDB1- and CUL4-associated factor 7 (DCAF7) | 7.5 | ||||
| LDTP14939 | Membralin (TMEM259) | 7.5 | ||||
| LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | 7.5 | ||||
| LDTP10357 | RUS family member 1 (RUSF1) | 7.4 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 7.3 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 7.0 | ||||
| LDTP09297 | Large ribosomal subunit protein mL64 (GADD45GIP1) | 7.0 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 7.0 | ||||
| LDTP11906 | Phosphatidylinositol glycan anchor biosynthesis class U protein (PIGU) | 6.9 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 6.9 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 6.9 | ||||
| LDTP08796 | Protein SYS1 homolog (SYS1) | 6.8 | ||||
| LDTP06352 | Reticulocalbin-1 (RCN1) | 6.8 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 6.6 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 6.5 | ||||
| LDTP08248 | NLR family member X1 (NLRX1) | 5.9 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 5.9 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 5.9 | ||||
| LDTP15240 | LysM and putative peptidoglycan-binding domain-containing protein 3 (LYSMD3) | 5.9 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 5.8 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 5.8 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 5.7 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 5.5 | ||||
| LDTP12434 | Exosome complex component RRP40 (EXOSC3) | 5.4 | ||||
| LDTP15712 | RING finger and SPRY domain-containing protein 1 (RSPRY1) | 5.4 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 5.3 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 5.1 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 5.1 | ||||
