Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C191 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05006 | Ras-related protein Rab-1A (RAB1A) | 99.7 | ||||
| LDTP11081 | NAD-capped RNA hydrolase NUDT12 (NUDT12) | 61.4 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 57.3 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 38.3 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 37.8 | ||||
| LDTP10215 | Carboxymethylenebutenolidase homolog (CMBL) | 35.8 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 34.1 | ||||
| LDTP05480 | Amidophosphoribosyltransferase (PPAT) | 32.0 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 31.8 | ||||
| LDTP12610 | Obg-like ATPase 1 (OLA1) | 30.5 | ||||
| LDTP00837 | Mitotic checkpoint serine/threonine-protein kinase BUB1 (BUB1) | 30.3 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 29.9 | ||||
| LDTP01640 | CCR4-NOT transcription complex subunit 4 (CNOT4) | 26.7 | ||||
| LDTP02342 | Dihydropteridine reductase (QDPR) | 26.0 | ||||
| LDTP01333 | Isocitrate dehydrogenase [NADP] cytoplasmic (IDH1) | 25.8 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 25.1 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 23.6 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 22.8 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 22.0 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 21.3 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 20.5 | ||||
| LDTP14083 | E3 ubiquitin-protein ligase RNF114 (RNF114) | 19.6 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 18.8 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 18.5 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 18.3 | ||||
| LDTP01311 | Ribonuclease H2 subunit A (RNASEH2A) | 18.3 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 17.5 | ||||
| LDTP04211 | Isocitrate dehydrogenase [NADP], mitochondrial (IDH2) | 17.1 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 16.9 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 16.6 | ||||
| LDTP10137 | Cytochrome c oxidase assembly factor 7 (COA7) | 16.2 | ||||
| LDTP04318 | Glycogen synthase kinase-3 alpha (GSK3A) | 15.6 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 15.5 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 14.8 | ||||
| LDTP03001 | E3 ubiquitin-protein ligase TRIM21 (TRIM21) | 14.7 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 14.5 | ||||
| LDTP00645 | Prolyl 4-hydroxylase subunit alpha-2 (P4HA2) | 14.4 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 14.3 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 14.0 | ||||
| LDTP12233 | Helicase MOV-10 (MOV10) | 13.8 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 13.5 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 13.5 | ||||
| LDTP07679 | Lysocardiolipin acyltransferase 1 (LCLAT1) | 13.3 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 13.2 | ||||
| LDTP01535 | Kinesin-like protein KIF20A (KIF20A) | 13.2 | ||||
| LDTP05446 | Ubiquitin-protein ligase E3A (UBE3A) | 13.0 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 12.7 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 12.6 | ||||
| LDTP11055 | Telomerase RNA component interacting RNase (TRIR) | 12.5 | ||||
| LDTP02706 | Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial (MTHFD2) | 12.4 | ||||
| LDTP05549 | Protein phosphatase 3 catalytic subunit alpha (PPP3CA) | 12.4 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 12.3 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 12.3 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 12.3 | ||||
| LDTP02922 | CTP synthase 1 (CTPS1) | 12.2 | ||||
| LDTP10987 | Tumor susceptibility gene 101 protein (TSG101) | 12.2 | ||||
| LDTP14079 | E3 ubiquitin-protein ligase ARIH1 (ARIH1) | 12.1 | ||||
| LDTP19478 | Putative peptidyl-tRNA hydrolase PTRHD1 (PTRHD1) | 12.1 | ||||
| LDTP00877 | Protein SCO2 homolog, mitochondrial (SCO2) | 12.0 | ||||
| LDTP01514 | NADH dehydrogenase 1 beta subcomplex subunit 4 (NDUFB4) | 11.7 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 11.6 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 11.6 | ||||
| LDTP05289 | AMP deaminase 2 (AMPD2) | 11.6 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 11.6 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 11.6 | ||||
| LDTP13303 | NADH-cytochrome b5 reductase 1 (CYB5R1) | 11.6 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 11.5 | ||||
| LDTP13504 | Dermatan-sulfate epimerase (DSE) | 11.5 | ||||
| LDTP08666 | Xaa-Arg dipeptidase (PM20D2) | 11.5 | ||||
| LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 11.4 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 11.3 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 11.3 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 11.3 | ||||
| LDTP04962 | 26S proteasome regulatory subunit 4 (PSMC1) | 11.2 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 11.2 | ||||
| LDTP09835 | GPI-anchor transamidase (PIGK) | 11.2 | ||||
| LDTP11199 | DCN1-like protein 5 (DCUN1D5) | 11.1 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 11.1 | ||||
| LDTP06620 | Thiosulfate sulfurtransferase (TST) | 11.0 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 10.9 | ||||
| LDTP14075 | AFG3-like protein 2 (AFG3L2) | 10.9 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 10.8 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 10.6 | ||||
| LDTP14214 | Dolichyl-phosphate beta-glucosyltransferase (ALG5) | 10.5 | ||||
| LDTP12543 | 14 kDa phosphohistidine phosphatase (PHPT1) | 10.4 | ||||
| LDTP09388 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B (STT3B) | 10.3 | ||||
| LDTP02225 | Heat shock protein HSP 90-alpha (HSP90AA1) | 10.3 | ||||
| LDTP04345 | Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial (IDH3A) | 10.3 | ||||
| LDTP09598 | Mitochondrial coenzyme A diphosphatase NUDT8 (NUDT8) | 10.3 | ||||
| LDTP13107 | SUMO-activating enzyme subunit 1 (SAE1) | 10.3 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 10.2 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 10.1 | ||||
| LDTP03152 | Protein-L-isoaspartate(D-aspartate) O-methyltransferase (PCMT1) | 10.0 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 9.9 | ||||
| LDTP06049 | Septin-6 (SEPTIN6) | 9.9 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 9.8 | ||||
| LDTP02721 | Farnesyl pyrophosphate synthase (FDPS) | 9.8 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 9.8 | ||||
| LDTP04093 | Translation initiation factor IF-2, mitochondrial (MTIF2) | 9.8 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 9.7 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 9.6 | ||||
| LDTP12163 | Calcyclin-binding protein (CACYBP) | 9.6 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 9.6 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 9.6 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 9.6 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 9.5 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 9.5 | ||||
| LDTP07762 | Hydroxysteroid dehydrogenase-like protein 2 (HSDL2) | 9.5 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 47.8 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 46.9 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 45.6 | ||||
| LDTP04237 | Protein ERGIC-53 (LMAN1) | 44.3 | ||||
| LDTP14140 | Ceramide transfer protein (CERT1) | 34.1 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 33.1 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 27.5 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 25.8 | ||||
| LDTP09949 | Transportin-1 (TNPO1) | 23.4 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 21.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 20.8 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 20.7 | ||||
| LDTP01031 | Importin subunit alpha-7 (KPNA6) | 20.5 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 20.5 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 19.0 | ||||
| LDTP05814 | Battenin (CLN3) | 18.6 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 18.3 | ||||
| LDTP04502 | Importin subunit alpha-5 (KPNA1) | 17.9 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 17.8 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 17.5 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 17.3 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 17.1 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 16.8 | ||||
| LDTP10513 | Exocyst complex component 2 (EXOC2) | 15.2 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 14.9 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 14.8 | ||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 14.6 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 14.2 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 14.0 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 13.4 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 13.2 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 13.1 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 12.8 | ||||
| LDTP08651 | Exocyst complex component 8 (EXOC8) | 12.7 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 12.6 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 12.6 | ||||
| LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 12.4 | ||||
| LDTP02262 | Heat shock protein HSP 90-beta (HSP90AB1) | 11.6 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 11.6 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 11.6 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 11.2 | ||||
| LDTP04462 | H(+)/Cl(-) exchange transporter 6 (CLCN6) | 10.7 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 10.5 | ||||
| LDTP12090 | Sideroflexin-1 (SFXN1) | 10.5 | ||||
| LDTP03385 | 14-3-3 protein theta (YWHAQ) | 10.4 | ||||
| LDTP03952 | Reduced folate transporter (SLC19A1) | 10.3 | ||||
| LDTP01454 | SUN domain-containing protein 1 (SUN1) | 10.3 | ||||
| LDTP01455 | Erlin-2 (ERLIN2) | 10.0 | ||||
| LDTP04969 | 14-3-3 protein epsilon (YWHAE) | 9.9 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 9.9 | ||||
| LDTP12966 | Vesicle-associated membrane protein-associated protein A (VAPA) | 9.9 | ||||
| LDTP06660 | MICOS complex subunit MIC60 (IMMT) | 9.8 | ||||
| LDTP13142 | Vacuolar protein sorting-associated protein 29 (VPS29) | 9.8 | ||||
| LDTP02061 | Anion exchange protein 2 (SLC4A2) | 9.6 | ||||
| LDTP03837 | Signal recognition particle 14 kDa protein (SRP14) | 9.6 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 9.6 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP08006 | PHD finger-like domain-containing protein 5A (PHF5A) | 35.5 | ||||
| LDTP06341 | Non-POU domain-containing octamer-binding protein (NONO) | 17.4 | ||||
| LDTP02343 | High mobility group protein B1 (HMGB1) | 15.6 | ||||
| LDTP08409 | Transcriptional repressor p66-alpha (GATAD2A) | 14.1 | ||||
| LDTP13361 | Homeobox protein SIX4 (SIX4) | 11.6 | ||||
| LDTP00612 | High mobility group protein B3 (HMGB3) | 10.6 | ||||
| LDTP12792 | CDKN2A-interacting protein (CDKN2AIP) | 10.4 | ||||
| LDTP05201 | Forkhead box protein K1 (FOXK1) | 10.0 | ||||
GPCR
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15303 | Membrane progestin receptor alpha (PAQR7) | 46.2 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02688 | HLA class I histocompatibility antigen, alpha chain E (HLA-E) | 32.4 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 81.0 | ||||
| LDTP12025 | UPF0488 protein C8orf33 (C8orf33) | 58.1 | ||||
| LDTP14792 | Small ribosomal subunit protein uS9m (MRPS9) | 49.5 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 49.2 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 47.5 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 47.2 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 45.3 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 44.0 | ||||
| LDTP05049 | Dynein light chain 1, cytoplasmic (DYNLL1) | 36.8 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 36.8 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 35.0 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 34.5 | ||||
| LDTP12077 | Jupiter microtubule associated homolog 2 (JPT2) | 29.9 | ||||
| LDTP06066 | Malectin (MLEC) | 29.7 | ||||
| LDTP04926 | Large ribosomal subunit protein eL43 (RPL37A) | 29.0 | ||||
| LDTP00759 | Tumor protein D54 (TPD52L2) | 28.8 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 28.2 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 28.1 | ||||
| LDTP12780 | THUMP domain-containing protein 1 (THUMPD1) | 28.1 | ||||
| LDTP02816 | Replication protein A 32 kDa subunit (RPA2) | 26.9 | ||||
| LDTP03520 | Phosphatidylethanolamine-binding protein 1 (PEBP1) | 25.3 | ||||
| LDTP08292 | Zinc finger CCCH domain-containing protein 18 (ZC3H18) | 25.1 | ||||
| LDTP11101 | Coronin-1B (CORO1B) | 24.8 | ||||
| LDTP05768 | Heterogeneous nuclear ribonucleoprotein A0 (HNRNPA0) | 24.6 | ||||
| LDTP07221 | Myomegalin (PDE4DIP) | 23.6 | ||||
| LDTP02940 | Large ribosomal subunit protein eL33 (RPL35A) | 23.4 | ||||
| LDTP00417 | Programmed cell death protein 5 (PDCD5) | 23.1 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 22.9 | ||||
| LDTP07318 | HAUS augmin-like complex subunit 3 (HAUS3) | 22.3 | ||||
| LDTP10684 | RNA-binding protein 14 (RBM14) | 22.3 | ||||
| LDTP13981 | Small ribosomal subunit protein bS16m (MRPS16) | 21.6 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 21.3 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 21.1 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 20.8 | ||||
| LDTP04356 | Emerin (EMD) | 20.5 | ||||
| LDTP09850 | Proline-rich protein PRCC (PRCC) | 20.4 | ||||
| LDTP06220 | LIM and SH3 domain protein 1 (LASP1) | 20.3 | ||||
| LDTP01075 | Protein CutA (CUTA) | 20.1 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 19.7 | ||||
| LDTP06383 | Calponin-3 (CNN3) | 18.3 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 18.3 | ||||
| LDTP09938 | Far upstream element-binding protein 2 (KHSRP) | 18.3 | ||||
| LDTP13807 | PRELI domain-containing protein 1, mitochondrial (PRELID1) | 18.3 | ||||
| LDTP08136 | YTH domain-containing family protein 3 (YTHDF3) | 18.0 | ||||
| LDTP07476 | RAD50-interacting protein 1 (RINT1) | 17.9 | ||||
| LDTP02335 | U1 small nuclear ribonucleoprotein C (SNRPC) | 17.9 | ||||
| LDTP00830 | BUB3-interacting and GLEBS motif-containing protein ZNF207 (ZNF207) | 17.4 | ||||
| LDTP01320 | Eukaryotic translation initiation factor 3 subunit J (EIF3J) | 17.3 | ||||
| LDTP06952 | DBIRD complex subunit ZNF326 (ZNF326) | 17.0 | ||||
| LDTP13817 | Nuclear migration protein nudC (NUDC) | 17.0 | ||||
| LDTP08552 | PHD finger protein 6 (PHF6) | 16.8 | ||||
| LDTP05277 | Protein SET (SET) | 16.7 | ||||
| LDTP00887 | Calumenin (CALU) | 16.6 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 16.6 | ||||
| LDTP12476 | Translation initiation factor eIF2B subunit gamma (EIF2B3) | 16.6 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 16.4 | ||||
| LDTP16028 | Protein Njmu-R1 (C17orf75) | 16.4 | ||||
| LDTP06879 | Protein FAM98B (FAM98B) | 16.3 | ||||
| LDTP08735 | Spartin (SPART) | 16.0 | ||||
| LDTP01206 | Vesicle-trafficking protein SEC22b (SEC22B) | 16.0 | ||||
| LDTP06301 | Eukaryotic translation initiation factor 4H (EIF4H) | 15.8 | ||||
| LDTP16162 | Large ribosomal subunit protein bL27m (MRPL27) | 15.8 | ||||
| LDTP09324 | Ganglioside-induced differentiation-associated protein 1 (GDAP1) | 15.6 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 15.5 | ||||
| LDTP06587 | Survival motor neuron protein (SMN1; SMN2) | 15.5 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 15.1 | ||||
| LDTP06094 | Src substrate cortactin (CTTN) | 15.0 | ||||
| LDTP00472 | PDZ domain-containing protein GIPC1 (GIPC1) | 14.8 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 14.8 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 14.7 | ||||
| LDTP08950 | ADP-ribosylation factor GTPase-activating protein 1 (ARFGAP1) | 14.6 | ||||
| LDTP04108 | Large ribosomal subunit protein eL28 (RPL28) | 14.6 | ||||
| LDTP12652 | DDB1- and CUL4-associated factor 13 (DCAF13) | 14.4 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 14.4 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 14.4 | ||||
| LDTP04914 | Large ribosomal subunit protein uL24 (RPL26) | 14.3 | ||||
| LDTP05224 | RNA-binding protein 10 (RBM10) | 14.3 | ||||
| LDTP06174 | Pumilio homolog 1 (PUM1) | 14.2 | ||||
| LDTP13956 | Putative RNA-binding protein Luc7-like 2 (LUC7L2) | 14.2 | ||||
| LDTP07574 | Superkiller complex protein 3 (SKIC3) | 14.0 | ||||
| LDTP00620 | Eukaryotic translation initiation factor 3 subunit H (EIF3H) | 13.6 | ||||
| LDTP11238 | Heterogeneous nuclear ribonucleoprotein U-like protein 1 (HNRNPUL1) | 13.5 | ||||
| LDTP12826 | Bcl-2-associated transcription factor 1 (BCLAF1) | 13.5 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 13.4 | ||||
| LDTP06391 | Protein transport protein Sec23B (SEC23B) | 13.4 | ||||
| LDTP05189 | Chromobox protein homolog 1 (CBX1) | 13.3 | ||||
| LDTP09655 | Ataxin-2-like protein (ATXN2L) | 13.1 | ||||
| LDTP13813 | Eukaryotic translation initiation factor 3 subunit L (EIF3L) | 13.1 | ||||
| LDTP02181 | Neurofilament medium polypeptide (NEFM) | 13.1 | ||||
| LDTP03554 | Sorcin (SRI) | 13.1 | ||||
| LDTP03027 | Eukaryotic translation initiation factor 2 subunit 2 (EIF2S2) | 13.0 | ||||
| LDTP05226 | RNA-binding protein 3 (RBM3) | 13.0 | ||||
| LDTP13919 | Thyroid hormone receptor-associated protein 3 (THRAP3) | 13.0 | ||||
| LDTP03404 | Microtubule-associated protein 4 (MAP4) | 12.7 | ||||
| LDTP04945 | Small ubiquitin-related modifier 2 (SUMO2) | 12.7 | ||||
| LDTP04049 | Ran-specific GTPase-activating protein (RANBP1) | 12.6 | ||||
| LDTP14259 | Testis-expressed protein 264 (TEX264) | 12.6 | ||||
| LDTP05867 | Treacle protein (TCOF1) | 12.6 | ||||
| LDTP01361 | DnaJ homolog subfamily C member 8 (DNAJC8) | 12.5 | ||||
| LDTP12192 | Kinetochore protein Spc25 (SPC25) | 12.5 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 12.3 | ||||
| LDTP02164 | Nucleophosmin (NPM1) | 12.3 | ||||
| LDTP02297 | Vimentin (VIM) | 12.3 | ||||
| LDTP15762 | Zinc finger RNA-binding protein (ZFR) | 12.3 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 12.2 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 12.2 | ||||
| LDTP05068 | Tropomyosin alpha-4 chain (TPM4) | 12.2 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 12.1 | ||||
| LDTP05442 | 14-3-3 protein eta (YWHAH) | 11.9 | ||||
| LDTP11312 | DET1- and DDB1-associated protein 1 (DDA1) | 11.9 | ||||
| LDTP04514 | Heterogeneous nuclear ribonucleoprotein F (HNRNPF) | 11.9 | ||||
| LDTP00991 | Heterogeneous nuclear ribonucleoprotein Q (SYNCRIP) | 11.9 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 11.8 | ||||
| LDTP10990 | T-complex protein 1 subunit eta (CCT7) | 11.8 | ||||
| LDTP14228 | Transforming acidic coiled-coil-containing protein 3 (TACC3) | 11.8 | ||||
| LDTP03182 | Heterogeneous nuclear ribonucleoproteins A2/B1 (HNRNPA2B1) | 11.6 | ||||
| LDTP05834 | Eukaryotic translation initiation factor 3 subunit I (EIF3I) | 11.5 | ||||
| LDTP12764 | MICOS complex subunit MIC19 (CHCHD3) | 11.5 | ||||
| LDTP13467 | RNA-binding protein Raly (RALY) | 11.5 | ||||
| LDTP00880 | A-kinase anchor protein 8 (AKAP8) | 11.4 | ||||
| LDTP10078 | Far upstream element-binding protein 1 (FUBP1) | 11.3 | ||||
| LDTP09851 | Protein TFG (TFG) | 11.3 | ||||
| LDTP18561 | Small ribosomal subunit protein mS33 (MRPS33) | 11.3 | ||||
| LDTP13402 | Dynactin subunit 4 (DCTN4) | 11.2 | ||||
| LDTP11764 | Nuclear ubiquitous casein and cyclin-dependent kinase substrate 1 (NUCKS1) | 11.2 | ||||
| LDTP00512 | Protein transport protein Sec16A (SEC16A) | 11.2 | ||||
| LDTP11324 | RNA-binding protein 4 (RBM4) | 11.2 | ||||
| LDTP06060 | Ubiquitin-associated protein 2-like (UBAP2L) | 11.2 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 11.0 | ||||
| LDTP13657 | Melanoma-associated antigen D2 (MAGED2) | 11.0 | ||||
| LDTP14085 | Protein PRRC2C (PRRC2C) | 11.0 | ||||
| LDTP07132 | Ubiquitin-associated protein 2 (UBAP2) | 11.0 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 10.9 | ||||
| LDTP18146 | RNA binding motif protein, X-linked-like-1 (RBMXL1) | 10.9 | ||||
| LDTP10408 | Far upstream element-binding protein 3 (FUBP3) | 10.9 | ||||
| LDTP04140 | Large ribosomal subunit protein eL29 (RPL29) | 10.9 | ||||
| LDTP05274 | Nucleolysin TIAR (TIAL1) | 10.9 | ||||
| LDTP08984 | Protein enabled homolog (ENAH) | 10.9 | ||||
| LDTP04627 | UV excision repair protein RAD23 homolog B (RAD23B) | 10.9 | ||||
| LDTP12737 | BRISC and BRCA1-A complex member 1 (BABAM1) | 10.8 | ||||
| LDTP04714 | Heterogeneous nuclear ribonucleoprotein H2 (HNRNPH2) | 10.8 | ||||
| LDTP05525 | KH domain-containing, RNA-binding, signal transduction-associated protein 1 (KHDRBS1) | 10.7 | ||||
| LDTP11709 | Nuclear speckle splicing regulatory protein 1 (NSRP1) | 10.6 | ||||
| LDTP06368 | Elongin-C (ELOC) | 10.6 | ||||
| LDTP00376 | Coatomer subunit epsilon (COPE) | 10.5 | ||||
| LDTP12506 | DNA polymerase epsilon subunit 3 (POLE3) | 10.5 | ||||
| LDTP10947 | Ataxin-2 (ATXN2) | 10.3 | ||||
| LDTP06032 | Heterogeneous nuclear ribonucleoprotein D0 (HNRNPD) | 10.3 | ||||
| LDTP16156 | Protein PALS2 (PALS2) | 10.3 | ||||
| LDTP04971 | Small ribosomal subunit protein uS12 (RPS23) | 10.3 | ||||
| LDTP05715 | Vesicle transport protein SEC20 (BNIP1) | 10.3 | ||||
| LDTP05765 | Translation initiation factor eIF2B subunit epsilon (EIF2B5) | 10.2 | ||||
| LDTP00849 | 17S U2 SnRNP complex component HTATSF1 (HTATSF1) | 10.1 | ||||
| LDTP05668 | G-rich sequence factor 1 (GRSF1) | 10.1 | ||||
| LDTP03545 | Alpha-2-macroglobulin receptor-associated protein (LRPAP1) | 10.1 | ||||
| LDTP02292 | U1 small nuclear ribonucleoprotein 70 kDa (SNRNP70) | 10.1 | ||||
| LDTP15413 | Formin-binding protein 4 (FNBP4) | 10.0 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 10.0 | ||||
| LDTP18287 | Protein CMSS1 (CMSS1) | 10.0 | ||||
| LDTP16096 | RNA-binding protein 12 (RBM12) | 10.0 | ||||
| LDTP11466 | YTH domain-containing family protein 1 (YTHDF1) | 10.0 | ||||
| LDTP03695 | Heat shock 70 kDa protein 4 (HSPA4) | 9.9 | ||||
| LDTP03982 | Epidermal growth factor receptor substrate 15 (EPS15) | 9.8 | ||||
| LDTP05087 | Nucleolar protein 14 (NOP14) | 9.8 | ||||
| LDTP05360 | Large ribosomal subunit protein eL20 (RPL18A) | 9.8 | ||||
| LDTP04952 | Heterogeneous nuclear ribonucleoprotein K (HNRNPK) | 9.7 | ||||
| LDTP09049 | NHL repeat-containing protein 2 (NHLRC2) | 9.7 | ||||
| LDTP06583 | Serine/arginine-rich splicing factor 7 (SRSF7) | 9.7 | ||||
| LDTP07605 | La-related protein 1 (LARP1) | 9.6 | ||||
| LDTP15057 | TBC1 domain family member 9B (TBC1D9B) | 9.6 | ||||
| LDTP05750 | Chromatin assembly factor 1 subunit A (CHAF1A) | 9.5 | ||||
| LDTP13199 | Death domain-associated protein 6 (DAXX) | 9.5 | ||||
| LDTP10962 | Heterogeneous nuclear ribonucleoprotein A/B (HNRNPAB) | 9.5 | ||||
| LDTP05533 | Kinesin light chain 1 (KLC1) | 9.5 | ||||
