Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C004 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01333 | Isocitrate dehydrogenase [NADP] cytoplasmic (IDH1) | 31.1 | ||||
| LDTP00575 | Glutathione S-transferase A4 (GSTA4) | 29.9 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 21.9 | ||||
| LDTP04211 | Isocitrate dehydrogenase [NADP], mitochondrial (IDH2) | 21.1 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 19.4 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 18.1 | ||||
| LDTP00994 | Beta-1,4-galactosyltransferase 3 (B4GALT3) | 17.9 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 17.4 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 17.3 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 16.8 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 15.8 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 15.7 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 15.6 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 15.3 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 15.3 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 15.3 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 14.8 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 14.8 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 14.0 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 13.4 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 11.6 | ||||
| LDTP00032 | 2-hydroxyacyl-CoA lyase 2 (ILVBL) | 11.6 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 11.4 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 11.1 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 10.9 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 10.6 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 10.6 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 10.3 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 10.1 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 10.1 | ||||
| LDTP04620 | 5'-AMP-activated protein kinase catalytic subunit alpha-2 (PRKAA2) | 10.0 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 9.9 | ||||
| LDTP13504 | Dermatan-sulfate epimerase (DSE) | 9.8 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 9.7 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 9.5 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 9.4 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 9.4 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 9.4 | ||||
| LDTP01300 | Cartilage-associated protein (CRTAP) | 9.3 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 9.2 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 9.1 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 9.0 | ||||
| LDTP04114 | E3 ubiquitin-protein ligase NEDD4 (NEDD4) | 8.8 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 8.7 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 8.7 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 8.6 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 8.6 | ||||
| LDTP09031 | Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 (POMGNT2) | 8.5 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 8.2 | ||||
| LDTP00479 | Histone acetyltransferase type B catalytic subunit (HAT1) | 8.2 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 8.1 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 8.1 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 8.0 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 7.7 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 7.7 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 7.6 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 7.6 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 7.6 | ||||
| LDTP05493 | Sulfotransferase 2A1 (SULT2A1) | 7.5 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 7.4 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 7.3 | ||||
| LDTP10322 | Abasic site processing protein HMCES (HMCES) | 7.3 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 7.2 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 7.2 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 7.2 | ||||
| LDTP04327 | Cytosolic purine 5'-nucleotidase (NT5C2) | 7.2 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 7.1 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 7.1 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 7.1 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 7.1 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 7.1 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 7.0 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 7.0 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 6.9 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 6.9 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 6.9 | ||||
| LDTP12055 | Probable ATP-dependent RNA helicase DDX31 (DDX31) | 6.9 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 6.8 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 6.8 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 6.7 | ||||
| LDTP12679 | Trimethyllysine dioxygenase, mitochondrial (TMLHE) | 6.6 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 6.6 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 6.5 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 6.4 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 6.4 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 6.4 | ||||
| LDTP10699 | E3 ubiquitin-protein ligase NEDD4-like (NEDD4L) | 6.4 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 6.4 | ||||
| LDTP15097 | All-trans-retinol 13,14-reductase (RETSAT) | 6.3 | ||||
| LDTP05409 | Antigen peptide transporter 2 (TAP2) | 6.3 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 6.2 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 6.2 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 6.2 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 6.2 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 6.1 | ||||
| LDTP04506 | Diacylglycerol kinase epsilon (DGKE) | 6.1 | ||||
| LDTP00975 | Mannosyl-oligosaccharide 1,2-alpha-mannosidase IB (MAN1A2) | 6.1 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 6.1 | ||||
| LDTP07868 | Protein O-mannosyl-transferase TMTC3 (TMTC3) | 6.1 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 6.0 | ||||
| LDTP18414 | 5'-nucleotidase domain-containing protein 2 (NT5DC2) | 5.9 | ||||
| LDTP09355 | Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma (PIP4K2C) | 5.9 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 5.8 | ||||
| LDTP00267 | DNA-directed RNA polymerase, mitochondrial (POLRMT) | 5.8 | ||||
| LDTP01382 | ATP-dependent Clp protease ATP-binding subunit clpX-like, mitochondrial (CLPX) | 5.8 | ||||
| LDTP06199 | Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform (PPP2R5D) | 5.8 | ||||
| LDTP03769 | Sterol O-acyltransferase 1 (SOAT1) | 5.8 | ||||
| LDTP10495 | Ubiquitin carboxyl-terminal hydrolase 47 (USP47) | 5.8 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 5.7 | ||||
| LDTP07154 | ATPase family AAA domain-containing protein 3B (ATAD3B) | 5.7 | ||||
| LDTP11199 | DCN1-like protein 5 (DCUN1D5) | 5.7 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 5.7 | ||||
| LDTP00404 | Lysosomal cobalamin transporter ABCD4 (ABCD4) | 5.7 | ||||
| LDTP12318 | Calcium-independent phospholipase A2-gamma (PNPLA8) | 5.7 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 5.7 | ||||
| LDTP02074 | Aldehyde dehydrogenase, mitochondrial (ALDH2) | 5.6 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 5.6 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 5.6 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 5.6 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 5.5 | ||||
| LDTP07525 | Protein arginine N-methyltransferase 9 (PRMT9) | 5.5 | ||||
| LDTP06501 | Ras-related protein Rab-11B (RAB11B) | 5.5 | ||||
| LDTP02260 | Beta-glucuronidase (GUSB) | 5.5 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 5.5 | ||||
| LDTP10491 | Fatty acyl-CoA reductase 2 (FAR2) | 5.5 | ||||
| LDTP10951 | Methionine synthase (MTR) | 5.5 | ||||
| LDTP06721 | GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase (ALG11) | 5.5 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 5.5 | ||||
| LDTP10981 | Mitochondrial intermediate peptidase (MIPEP) | 5.5 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 5.5 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 5.5 | ||||
| LDTP12670 | SET domain-containing protein 4 (SETD4) | 5.5 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03546 | Translocator protein (TSPO) | 31.1 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 26.0 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 21.7 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 20.8 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 20.1 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 18.6 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 18.3 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 17.5 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 16.6 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 16.4 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 16.2 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 15.9 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 15.2 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 15.2 | ||||
| LDTP02215 | Prosaposin (PSAP) | 15.1 | ||||
| LDTP10897 | Nuclear pore complex protein Nup88 (NUP88) | 14.1 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 13.0 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 12.6 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 12.6 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 12.5 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 11.4 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 11.0 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 10.9 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 10.9 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 10.7 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 10.5 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 10.1 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 9.8 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 9.7 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 9.3 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 9.2 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 8.9 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 8.8 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 8.7 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 8.6 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 8.6 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 8.4 | ||||
| LDTP04502 | Importin subunit alpha-5 (KPNA1) | 8.3 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 8.3 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 8.1 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 8.0 | ||||
| LDTP09028 | Mitoguardin 1 (MIGA1) | 7.8 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 7.6 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 7.6 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 7.5 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 7.5 | ||||
| LDTP02010 | Annexin A1 (ANXA1) | 7.3 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 7.3 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 7.2 | ||||
| LDTP06855 | Anoctamin-6 (ANO6) | 7.1 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 7.1 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 6.8 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 6.7 | ||||
| LDTP10343 | Vacuole membrane protein 1 (VMP1) | 6.7 | ||||
| LDTP06293 | Metal cation symporter ZIP14 (SLC39A14) | 6.7 | ||||
| LDTP01031 | Importin subunit alpha-7 (KPNA6) | 6.6 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 6.4 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 6.4 | ||||
| LDTP09949 | Transportin-1 (TNPO1) | 6.4 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 6.3 | ||||
| LDTP05238 | Solute carrier family 25 member 3 (SLC25A3) | 6.3 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 6.2 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 6.2 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 6.2 | ||||
| LDTP06549 | Hsp90 co-chaperone Cdc37 (CDC37) | 6.1 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 6.1 | ||||
| LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | 6.0 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 6.0 | ||||
| LDTP09789 | Transmembrane 9 superfamily member 4 (TM9SF4) | 5.9 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 5.8 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 5.7 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 5.7 | ||||
| LDTP00310 | Syntenin-1 (SDCBP) | 5.6 | ||||
| LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 5.6 | ||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 5.6 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 5.5 | ||||
| LDTP06124 | Beclin-1 (BECN1) | 5.5 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04720 | IgG receptor FcRn large subunit p51 (FCGRT) | 8.6 | ||||
| LDTP02040 | HLA class I histocompatibility antigen, A alpha chain (HLA-A) | 5.9 | ||||
| LDTP03772 | Basigin (BSG) | 5.6 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11076 | Apolipoprotein L2 (APOL2) | 31.3 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 29.9 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 28.6 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 23.8 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 20.8 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 17.6 | ||||
| LDTP11065 | Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial (ECSIT) | 15.8 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 15.6 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 14.2 | ||||
| LDTP13922 | Tudor and KH domain-containing protein (TDRKH) | 12.6 | ||||
| LDTP14186 | Heme-binding protein 2 (HEBP2) | 12.0 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 12.0 | ||||
| LDTP01075 | Protein CutA (CUTA) | 11.9 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 10.7 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 10.7 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 10.6 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 10.3 | ||||
| LDTP07255 | Proteasome adapter and scaffold protein ECM29 (ECPAS) | 10.2 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 9.9 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 9.6 | ||||
| LDTP09215 | Torsin-1A-interacting protein 2 (TOR1AIP2) | 9.6 | ||||
| LDTP04395 | RNA-binding protein FXR1 (FXR1) | 9.5 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 9.1 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 9.0 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 8.9 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 8.8 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 8.8 | ||||
| LDTP04396 | RNA-binding protein FXR2 (FXR2) | 8.8 | ||||
| LDTP12287 | Ran guanine nucleotide release factor (RANGRF) | 8.7 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 8.6 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 8.6 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 8.3 | ||||
| LDTP14136 | Mitochondrial import inner membrane translocase subunit Tim13 (TIMM13) | 8.1 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 8.0 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 8.0 | ||||
| LDTP02570 | Ubiquitin-like protein 4A (UBL4A) | 8.0 | ||||
| LDTP04708 | NHP2-like protein 1 (SNU13) | 7.9 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 7.9 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 7.8 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 7.8 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 7.8 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 7.3 | ||||
| LDTP06032 | Heterogeneous nuclear ribonucleoprotein D0 (HNRNPD) | 7.3 | ||||
| LDTP13813 | Eukaryotic translation initiation factor 3 subunit L (EIF3L) | 7.3 | ||||
| LDTP09298 | WD repeat-containing protein 48 (WDR48) | 7.3 | ||||
| LDTP08606 | Nurim (NRM) | 7.2 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 7.2 | ||||
| LDTP10962 | Heterogeneous nuclear ribonucleoprotein A/B (HNRNPAB) | 7.1 | ||||
| LDTP00417 | Programmed cell death protein 5 (PDCD5) | 7.1 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 7.1 | ||||
| LDTP11389 | Bcl-2-like protein 13 (BCL2L13) | 6.9 | ||||
| LDTP13402 | Dynactin subunit 4 (DCTN4) | 6.9 | ||||
| LDTP14792 | Small ribosomal subunit protein uS9m (MRPS9) | 6.9 | ||||
| LDTP12729 | Required for meiotic nuclear division protein 1 homolog (RMND1) | 6.8 | ||||
| LDTP18517 | RNA-binding protein 27 (RBM27) | 6.8 | ||||
| LDTP14263 | TAF6-like RNA polymerase II p300/CBP-associated factor-associated factor 65 kDa subunit 6L (TAF6L) | 6.8 | ||||
| LDTP00991 | Heterogeneous nuclear ribonucleoprotein Q (SYNCRIP) | 6.7 | ||||
| LDTP16322 | Mitochondrial import inner membrane translocase subunit Tim8 B (TIMM8B) | 6.7 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 6.7 | ||||
| LDTP00729 | Glycosylphosphatidylinositol anchor attachment 1 protein (GPAA1) | 6.6 | ||||
| LDTP04714 | Heterogeneous nuclear ribonucleoprotein H2 (HNRNPH2) | 6.6 | ||||
| LDTP00756 | Heterogeneous nuclear ribonucleoprotein R (HNRNPR) | 6.6 | ||||
| LDTP03615 | Heterogeneous nuclear ribonucleoprotein H (HNRNPH1) | 6.6 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 6.5 | ||||
| LDTP05501 | Fragile X messenger ribonucleoprotein 1 (FMR1) | 6.5 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 6.3 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 6.2 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 6.2 | ||||
| LDTP14304 | MAU2 chromatid cohesion factor homolog (MAU2) | 6.1 | ||||
| LDTP01582 | Pre-mRNA-splicing factor SLU7 (SLU7) | 6.0 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 6.0 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 6.0 | ||||
| LDTP17065 | Heterogeneous nuclear ribonucleoprotein U-like protein 2 (HNRNPUL2) | 6.0 | ||||
| LDTP13288 | Scm-like with four MBT domains protein 1 (SFMBT1) | 6.0 | ||||
| LDTP19625 | Integral membrane protein GPR180 (GPR180) | 5.9 | ||||
| LDTP13863 | DnaJ homolog subfamily C member 16 (DNAJC16) | 5.9 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 5.9 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 5.7 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 5.7 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 5.7 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 5.6 | ||||
| LDTP05224 | RNA-binding protein 10 (RBM10) | 5.5 | ||||
| LDTP05318 | RNA-binding protein EWS (EWSR1) | 5.5 | ||||
