Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C376 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 67.6 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 47.8 | ||||
| LDTP15886 | Diphthine methyltransferase (DPH7) | 39.1 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 30.9 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 30.3 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 28.1 | ||||
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 26.9 | ||||
| LDTP13337 | Leucine carboxyl methyltransferase 1 (LCMT1) | 26.7 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 26.7 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 26.5 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 26.2 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 26.0 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 23.1 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 21.4 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 19.3 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 19.0 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 18.9 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 18.6 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 18.5 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 18.4 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 17.6 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 17.4 | ||||
| LDTP12679 | Trimethyllysine dioxygenase, mitochondrial (TMLHE) | 17.0 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 16.9 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 16.9 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 16.8 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 16.7 | ||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 16.6 | ||||
| LDTP07831 | Transmembrane protein with metallophosphoesterase domain (TMPPE) | 16.1 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 15.9 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 15.2 | ||||
| LDTP05493 | Sulfotransferase 2A1 (SULT2A1) | 14.9 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 14.1 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 13.8 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 13.4 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 13.3 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 13.2 | ||||
| LDTP06511 | Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial (ETFDH) | 13.1 | ||||
| LDTP07931 | Heme A synthase COX15 (COX15) | 12.7 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 12.7 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 12.6 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 12.6 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 12.5 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 12.4 | ||||
| LDTP06849 | Prolyl endopeptidase-like (PREPL) | 12.3 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 12.1 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 11.7 | ||||
| LDTP12163 | Calcyclin-binding protein (CACYBP) | 11.1 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 11.0 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 10.6 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 10.4 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 9.8 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 9.5 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 9.1 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 9.0 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 9.0 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 8.9 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 8.8 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 8.6 | ||||
| LDTP00338 | Lysosomal alpha-mannosidase (MAN2B1) | 8.6 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 8.5 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 8.4 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 8.4 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 8.3 | ||||
| LDTP11318 | ADP-ribose pyrophosphatase, mitochondrial (NUDT9) | 8.3 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 8.3 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 8.2 | ||||
| LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 8.2 | ||||
| LDTP05850 | Probable methyltransferase TARBP1 (TARBP1) | 8.2 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 8.0 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 7.9 | ||||
| LDTP01759 | Histone-lysine N-methyltransferase NSD2 (NSD2) | 7.9 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 7.9 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 7.9 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 7.8 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 7.8 | ||||
| LDTP11081 | NAD-capped RNA hydrolase NUDT12 (NUDT12) | 7.7 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 7.6 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 7.5 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 7.5 | ||||
| LDTP05372 | Peptidyl-prolyl cis-trans isomerase FKBP4 (FKBP4) | 7.5 | ||||
| LDTP04243 | Fatty acid synthase (FASN) | 7.4 | ||||
| LDTP03024 | Plasma membrane calcium-transporting ATPase 1 (ATP2B1) | 7.4 | ||||
| LDTP03060 | Proteasome subunit beta type-1 (PSMB1) | 7.4 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 7.4 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 7.4 | ||||
| LDTP00836 | ATPase GET3 (GET3) | 7.3 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 7.3 | ||||
| LDTP01018 | High affinity cAMP-specific and IBMX-insensitive 3',5'-cyclic phosphodiesterase 8A (PDE8A) | 7.3 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 7.2 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 7.1 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 7.1 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 6.9 | ||||
| LDTP04358 | Carnitine O-palmitoyltransferase 1, liver isoform (CPT1A) | 6.9 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 6.9 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 6.8 | ||||
| LDTP11703 | Histone deacetylase complex subunit SAP130 (SAP130) | 6.8 | ||||
| LDTP13814 | Phospholipase A-2-activating protein (PLAA) | 6.8 | ||||
| LDTP01141 | E3 ubiquitin-protein ligase BRE1B (RNF40) | 6.8 | ||||
| LDTP18087 | Dephospho-CoA kinase domain-containing protein (DCAKD) | 6.7 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 6.6 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 6.6 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 6.6 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 6.6 | ||||
| LDTP10981 | Mitochondrial intermediate peptidase (MIPEP) | 6.5 | ||||
| LDTP05877 | Peptidyl-prolyl cis-trans isomerase FKBP5 (FKBP5) | 6.5 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 6.5 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 6.5 | ||||
| LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 6.5 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 6.5 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 6.5 | ||||
| LDTP04542 | Thimet oligopeptidase (THOP1) | 6.5 | ||||
| LDTP10101 | Peptidyl-prolyl cis-trans isomerase FKBP10 (FKBP10) | 6.4 | ||||
| LDTP01707 | Thioredoxin domain-containing protein 12 (TXNDC12) | 6.4 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 89.9 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 33.1 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 30.9 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 30.5 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 30.1 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 27.9 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 27.1 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 26.5 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 26.2 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 24.9 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 24.6 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 23.1 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 23.1 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 22.8 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 21.1 | ||||
| LDTP02215 | Prosaposin (PSAP) | 20.0 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 18.4 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 16.9 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 16.6 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 15.8 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 15.2 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 15.0 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 14.0 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 14.0 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 13.6 | ||||
| LDTP00970 | Gasdermin-E (GSDME) | 11.8 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 11.6 | ||||
| LDTP11812 | Protein ARV1 (ARV1) | 11.4 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 11.2 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 11.2 | ||||
| LDTP04501 | Importin subunit alpha-1 (KPNA2) | 10.9 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 10.6 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 10.6 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 10.6 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 10.4 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 10.1 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 9.6 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 9.6 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 9.5 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 9.3 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 8.9 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 8.8 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 8.6 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 8.3 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 8.3 | ||||
| LDTP07462 | MFS-type transporter SLC18B1 (SLC18B1) | 8.2 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 8.2 | ||||
| LDTP09949 | Transportin-1 (TNPO1) | 8.2 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 7.9 | ||||
| LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | 7.8 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 7.8 | ||||
| LDTP13393 | Electrogenic aspartate/glutamate antiporter SLC25A13, mitochondrial (SLC25A13) | 7.7 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 7.7 | ||||
| LDTP03380 | Stomatin (STOM) | 7.6 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 7.6 | ||||
| LDTP06499 | V-type proton ATPase subunit S1 (ATP6AP1) | 7.4 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 7.1 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 7.1 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 7.1 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 7.0 | ||||
| LDTP09769 | Zinc transporter SLC39A7 (SLC39A7) | 6.9 | ||||
| LDTP09515 | Importin-4 (IPO4) | 6.8 | ||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | 6.8 | ||||
| LDTP09651 | Choline transporter-like protein 1 (SLC44A1) | 6.7 | ||||
| LDTP05690 | Vesicular integral-membrane protein VIP36 (LMAN2) | 6.7 | ||||
| LDTP13262 | Signal recognition particle subunit SRP68 (SRP68) | 6.6 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 6.5 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16717 | Forkhead-associated domain-containing protein 1 (FHAD1) | 15.6 | ||||
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 6.6 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | 9.2 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11076 | Apolipoprotein L2 (APOL2) | 86.2 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 59.7 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 41.9 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 39.4 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 38.3 | ||||
| LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 24.6 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 24.6 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 21.4 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 20.8 | ||||
| LDTP07839 | Capping protein-inhibiting regulator of actin dynamics (CRACD) | 20.0 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 18.8 | ||||
| LDTP06373 | Mitochondrial import receptor subunit TOM20 homolog (TOMM20) | 18.1 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 18.1 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 15.9 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 15.5 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 15.1 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 14.8 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 14.6 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 14.5 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 14.3 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 12.6 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 11.7 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 11.3 | ||||
| LDTP11421 | Fanconi anemia group D2 protein (FANCD2) | 11.2 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 11.2 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 10.9 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 10.1 | ||||
| LDTP01387 | SEC14-like protein 2 (SEC14L2) | 10.1 | ||||
| LDTP02511 | cAMP-dependent protein kinase type I-alpha regulatory subunit (PRKAR1A) | 9.8 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 9.7 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 9.5 | ||||
| LDTP15253 | HEAT repeat-containing protein 3 (HEATR3) | 9.3 | ||||
| LDTP08606 | Nurim (NRM) | 9.1 | ||||
| LDTP14263 | TAF6-like RNA polymerase II p300/CBP-associated factor-associated factor 65 kDa subunit 6L (TAF6L) | 8.9 | ||||
| LDTP07476 | RAD50-interacting protein 1 (RINT1) | 8.8 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 8.7 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 8.6 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 8.5 | ||||
| LDTP08248 | NLR family member X1 (NLRX1) | 8.3 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 8.3 | ||||
| LDTP11643 | Superkiller complex protein 8 (SKIC8) | 8.3 | ||||
| LDTP04395 | RNA-binding protein FXR1 (FXR1) | 8.3 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 8.3 | ||||
| LDTP07916 | Protein MTSS 2 (MTSS2) | 8.2 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 8.2 | ||||
| LDTP00871 | Microtubule nucleation factor SSNA1 (SSNA1) | 8.1 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 8.1 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 7.9 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 7.9 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 7.8 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 7.8 | ||||
| LDTP00417 | Programmed cell death protein 5 (PDCD5) | 7.7 | ||||
| LDTP09054 | Golgi membrane protein 1 (GOLM1) | 7.7 | ||||
| LDTP13813 | Eukaryotic translation initiation factor 3 subunit L (EIF3L) | 7.4 | ||||
| LDTP08793 | Armadillo repeat-containing protein 10 (ARMC10) | 7.2 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 7.2 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 7.1 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 7.1 | ||||
| LDTP05558 | Galectin-3-binding protein (LGALS3BP) | 7.1 | ||||
| LDTP09069 | Kinetochore protein Spc24 (SPC24) | 7.0 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 6.9 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 6.9 | ||||
| LDTP13955 | Calcium-binding protein 39 (CAB39) | 6.9 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 6.8 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 6.8 | ||||
| LDTP12830 | U3 small nucleolar RNA-associated protein 6 homolog (UTP6) | 6.7 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 6.6 | ||||
| LDTP09644 | m-AAA protease-interacting protein 1, mitochondrial (MAIP1) | 6.6 | ||||
| LDTP05545 | TLE family member 5 (TLE5) | 6.5 | ||||
| LDTP09773 | Protein FAM3C (FAM3C) | 6.5 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 6.5 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 6.5 | ||||
