Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | FFF probe4 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:200uM; negative probe:200uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
SILAC
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11701 | 5'-3' exoribonuclease 2 (XRN2) | 20.0 | ||||
| LDTP15290 | 5'-nucleotidase domain-containing protein 3 (NT5DC3) | 20.0 | ||||
| LDTP00150 | Acyl-coenzyme A diphosphatase NUDT19 (NUDT19) | 20.0 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 20.0 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 20.0 | ||||
| LDTP12163 | Calcyclin-binding protein (CACYBP) | 20.0 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 20.0 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 20.0 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 20.0 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 20.0 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 20.0 | ||||
| LDTP02235 | Fumarate hydratase, mitochondrial (FH) | 20.0 | ||||
| LDTP01771 | Glutathione reductase, mitochondrial (GSR) | 20.0 | ||||
| LDTP15879 | Haloacid dehalogenase-like hydrolase domain-containing protein 3 (HDHD3) | 20.0 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 20.0 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 20.0 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 20.0 | ||||
| LDTP02565 | Medium-chain specific acyl-CoA dehydrogenase, mitochondrial (ACADM) | 20.0 | ||||
| LDTP05346 | Methylmalonate-semialdehyde/malonate-semialdehyde dehydrogenase [acylating], mitochondrial (ALDH6A1) | 20.0 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 20.0 | ||||
| LDTP01770 | NADH-cytochrome b5 reductase 3 (CYB5R3) | 20.0 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 20.0 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 20.0 | ||||
| LDTP13831 | Phenylalanine--tRNA ligase alpha subunit (FARSA) | 20.0 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 20.0 | ||||
| LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 20.0 | ||||
| LDTP06849 | Prolyl endopeptidase-like (PREPL) | 20.0 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 20.0 | ||||
| LDTP03331 | Proteasome subunit alpha type-2 (PSMA2) | 20.0 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 20.0 | ||||
| LDTP10862 | Proteasome subunit beta type-7 (PSMB7) | 20.0 | ||||
| LDTP01335 | Protein SCO1 homolog, mitochondrial (SCO1) | 20.0 | ||||
| LDTP04992 | Ras-related protein Rab-11A (RAB11A) | 20.0 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 20.0 | ||||
| LDTP03572 | Succinate dehydrogenase flavoprotein subunit, mitochondrial (SDHA) | 20.0 | ||||
| LDTP06067 | Tubulin--tyrosine ligase-like protein 12 (TTLL12) | 20.0 | ||||
| LDTP04333 | GMP synthase [glutamine-hydrolyzing] (GMPS) | 19.8 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 19.6 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 19.1 | ||||
| LDTP02362 | Dihydrolipoyl dehydrogenase, mitochondrial (DLD) | 18.6 | ||||
| LDTP04263 | Cysteine--tRNA ligase, cytoplasmic (CARS1) | 18.3 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 18.1 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 18.0 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 17.9 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 17.0 | ||||
| LDTP02602 | Histidine--tRNA ligase, cytoplasmic (HARS1) | 16.8 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 16.6 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 16.4 | ||||
| LDTP02198 | Cathepsin D (CTSD) | 16.3 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 16.1 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 16.1 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 15.8 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 15.6 | ||||
| LDTP05369 | Dual specificity mitogen-activated protein kinase kinase 1 (MAP2K1) | 15.6 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 15.5 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 15.3 | ||||
| LDTP02019 | Superoxide dismutase [Mn], mitochondrial (SOD2) | 15.0 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 14.7 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 14.5 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 14.4 | ||||
| LDTP09070 | Outer mitochondrial transmembrane helix translocase (ATAD1) | 14.4 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 14.4 | ||||
| LDTP06810 | Mitochondrial import inner membrane translocase subunit TIM50 (TIMM50) | 14.3 | ||||
| LDTP04471 | Ribosomal protein S6 kinase alpha-3 (RPS6KA3) | 14.3 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 14.2 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 14.2 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 14.1 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 14.0 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 13.8 | ||||
| LDTP02743 | Insulin-degrading enzyme (IDE) | 13.7 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 13.4 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 13.3 | ||||
| LDTP02216 | Beta-hexosaminidase subunit beta (HEXB) | 13.3 | ||||
| LDTP05724 | Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial (ECH1) | 13.1 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 13.1 | ||||
| LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 13.1 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 13.0 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 13.0 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 13.0 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 12.8 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 12.8 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 12.8 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 12.7 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 12.6 | ||||
| LDTP04251 | Elongation factor Tu, mitochondrial (TUFM) | 12.5 | ||||
| LDTP02640 | X-ray repair cross-complementing protein 6 (XRCC6) | 12.5 | ||||
| LDTP03610 | Cytochrome b-c1 complex subunit 1, mitochondrial (UQCRC1) | 12.4 | ||||
| LDTP02179 | L-lactate dehydrogenase B chain (LDHB) | 12.3 | ||||
| LDTP04061 | 26S proteasome regulatory subunit 6B (PSMC4) | 12.2 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 12.1 | ||||
| LDTP00527 | Phosphoribosylformylglycinamidine synthase (PFAS) | 12.1 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 12.0 | ||||
| LDTP02223 | Cathepsin B (CTSB) | 11.7 | ||||
| LDTP03155 | rRNA 2'-O-methyltransferase fibrillarin (FBL) | 11.6 | ||||
| LDTP03682 | DNA replication licensing factor MCM7 (MCM7) | 10.4 | ||||
| LDTP04519 | Kinesin-like protein KIF11 (KIF11) | 10.3 | ||||
| LDTP05373 | Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 (PLOD1) | 10.2 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 10.0 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 9.8 | ||||
| LDTP12293 | Adipocyte plasma membrane-associated protein (APMAP) | 9.7 | ||||
| LDTP03808 | Dual specificity mitogen-activated protein kinase kinase 2 (MAP2K2) | 9.4 | ||||
| LDTP11388 | N-alpha-acetyltransferase 15, NatA auxiliary subunit (NAA15) | 9.3 | ||||
| LDTP04096 | Vesicle-fusing ATPase (NSF) | 8.3 | ||||
| LDTP12227 | Methylcrotonoyl-CoA carboxylase beta chain, mitochondrial (MCCC2) | 8.2 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 7.3 | ||||
| LDTP04963 | 26S proteasome regulatory subunit 8 (PSMC5) | 7.0 | ||||
| LDTP07907 | Tubulin alpha-1A chain (TUBA1A) | 6.9 | ||||
| LDTP05193 | ADP-ribosylation factor 5 (ARF5) | 6.7 | ||||
| LDTP02611 | Inosine-5'-monophosphate dehydrogenase 2 (IMPDH2) | 6.7 | ||||
| LDTP05075 | Tubulin alpha-4A chain (TUBA4A) | 6.4 | ||||
| LDTP00714 | 26S proteasome non-ATPase regulatory subunit 3 (PSMD3) | 6.4 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 6.3 | ||||
| LDTP04646 | Delta-1-pyrroline-5-carboxylate synthase (ALDH18A1) | 6.2 | ||||
| LDTP16040 | Glyoxalase domain-containing protein 4 (GLOD4) | 6.1 | ||||
| LDTP12810 | Tubulin alpha-8 chain (TUBA8) | 6.1 | ||||
| LDTP02580 | C-1-tetrahydrofolate synthase, cytoplasmic (MTHFD1) | 5.9 | ||||
| LDTP00701 | D-3-phosphoglycerate dehydrogenase (PHGDH) | 5.9 | ||||
| LDTP03861 | Eukaryotic initiation factor 4A-III (EIF4A3) | 5.8 | ||||
| LDTP13623 | Pre-mRNA-processing factor 19 (PRPF19) | 5.5 | ||||
| LDTP02161 | Glycogen phosphorylase, liver form (PYGL) | 5.4 | ||||
| LDTP05782 | 26S proteasome non-ATPase regulatory subunit 2 (PSMD2) | 5.4 | ||||
| LDTP02677 | Protein disulfide-isomerase A4 (PDIA4) | 5.4 | ||||
| LDTP06645 | Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial (HADH) | 5.3 | ||||
| LDTP13887 | Exosome complex exonuclease RRP44 (DIS3) | 5.1 | ||||
| LDTP04617 | Tyrosine--tRNA ligase, cytoplasmic (YARS1) | 5.0 | ||||
| LDTP05071 | Elongation factor 1-alpha 1 (EEF1A1) | 5.0 | ||||
| LDTP02924 | Probable ATP-dependent RNA helicase DDX5 (DDX5) | 5.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01366 | Flotillin-1 (FLOT1) | 20.0 | ||||
| LDTP05084 | Hemoglobin subunit alpha (HBA1; HBA2) | 20.0 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 20.0 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 20.0 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 20.0 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 20.0 | ||||
| LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 20.0 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 20.0 | ||||
| LDTP02215 | Prosaposin (PSAP) | 20.0 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 20.0 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 20.0 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 20.0 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 20.0 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 20.0 | ||||
| LDTP13243 | Translocation protein SEC63 homolog (SEC63) | 20.0 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 20.0 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 20.0 | ||||
| LDTP04553 | Tricarboxylate transport protein, mitochondrial (SLC25A1) | 20.0 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 20.0 | ||||
| LDTP11250 | MICOS complex subunit MIC26 (APOO) | 19.5 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 19.1 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 18.7 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 18.6 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 18.5 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 18.3 | ||||
| LDTP01601 | Activator of 90 kDa heat shock protein ATPase homolog 1 (AHSA1) | 17.4 | ||||
| LDTP10036 | BOS complex subunit NCLN (NCLN) | 17.3 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 16.8 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 16.6 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 15.2 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 15.0 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 14.8 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 14.3 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 14.1 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 13.4 | ||||
| LDTP03717 | Prohibitin 1 (PHB1) | 13.1 | ||||
| LDTP12090 | Sideroflexin-1 (SFXN1) | 12.7 | ||||
| LDTP00383 | AP-3 complex subunit delta-1 (AP3D1) | 12.7 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 12.6 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 12.5 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 12.5 | ||||
| LDTP05238 | Solute carrier family 25 member 3 (SLC25A3) | 12.3 | ||||
| LDTP06660 | MICOS complex subunit MIC60 (IMMT) | 12.2 | ||||
| LDTP08769 | Nuclear pore complex protein Nup93 (NUP93) | 12.1 | ||||
| LDTP03405 | Calnexin (CANX) | 12.1 | ||||
| LDTP01301 | Electrogenic aspartate/glutamate antiporter SLC25A12, mitochondrial (SLC25A12) | 11.8 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 11.7 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 11.4 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 10.2 | ||||
| LDTP02087 | ADP/ATP translocase 2 (SLC25A5) | 9.0 | ||||
| LDTP02609 | ADP/ATP translocase 3 (SLC25A6) | 8.9 | ||||
| LDTP09515 | Importin-4 (IPO4) | 8.8 | ||||
| LDTP05690 | Vesicular integral-membrane protein VIP36 (LMAN2) | 8.4 | ||||
| LDTP13953 | Endophilin-B1 (SH3GLB1) | 7.4 | ||||
| LDTP02057 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 (RPN1) | 7.3 | ||||
| LDTP13393 | Electrogenic aspartate/glutamate antiporter SLC25A13, mitochondrial (SLC25A13) | 6.9 | ||||
| LDTP01748 | Mitochondrial import receptor subunit TOM40 homolog (TOMM40) | 6.8 | ||||
| LDTP02009 | Cystatin-B (CSTB) | 6.6 | ||||
| LDTP12042 | Proton-activated chloride channel (PACC1) | 6.3 | ||||
| LDTP05384 | Mitochondrial 2-oxoglutarate/malate carrier protein (SLC25A11) | 5.2 | ||||
| LDTP04391 | T-complex protein 1 subunit delta (CCT4) | 5.1 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00425 | Homeobox protein Meis2 (MEIS2) | 20.0 | ||||
| LDTP02870 | Y-box-binding protein 3 (YBX3) | 20.0 | ||||
| LDTP02879 | Zinc finger protein 24 (ZNF24) | 20.0 | ||||
| LDTP03212 | Splicing factor, proline- and glutamine-rich (SFPQ) | 12.4 | ||||
| LDTP03363 | High mobility group protein B2 (HMGB2) | 10.0 | ||||
| LDTP02343 | High mobility group protein B1 (HMGB1) | 7.2 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | 12.3 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04091 | Adapter molecule crk (CRK) | 20.0 | ||||
| LDTP00778 | Band 4.1-like protein 2 (EPB41L2) | 20.0 | ||||
| LDTP00887 | Calumenin (CALU) | 20.0 | ||||
| LDTP04518 | DNA mismatch repair protein Msh6 (MSH6) | 20.0 | ||||
| LDTP04356 | Emerin (EMD) | 20.0 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 20.0 | ||||
| LDTP08425 | Hornerin (HRNR) | 20.0 | ||||
| LDTP08238 | Kinectin (KTN1) | 20.0 | ||||
| LDTP03967 | Lamina-associated polypeptide 2, isoform alpha (TMPO) | 20.0 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 20.0 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 20.0 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 20.0 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 20.0 | ||||
| LDTP05274 | Nucleolysin TIAR (TIAL1) | 20.0 | ||||
| LDTP06366 | Poly(rC)-binding protein 1 (PCBP1) | 20.0 | ||||
| LDTP01358 | Pre-mRNA-splicing factor SPF27 (BCAS2) | 20.0 | ||||
| LDTP04917 | Proteasome activator complex subunit 3 (PSME3) | 20.0 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 20.0 | ||||
| LDTP06352 | Reticulocalbin-1 (RCN1) | 20.0 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 20.0 | ||||
| LDTP15356 | Ribonucleoprotein PTB-binding 1 (RAVER1) | 20.0 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 20.0 | ||||
| LDTP02165 | Tropomyosin alpha-3 chain (TPM3) | 20.0 | ||||
| LDTP05068 | Tropomyosin alpha-4 chain (TPM4) | 20.0 | ||||
| LDTP13626 | Ubiquilin-1 (UBQLN1) | 20.0 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 19.9 | ||||
| LDTP06182 | Ribosomal RNA processing protein 1 homolog B (RRP1B) | 18.8 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 18.7 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 18.6 | ||||
| LDTP12729 | Required for meiotic nuclear division protein 1 homolog (RMND1) | 17.9 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 17.6 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 17.6 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 17.2 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 16.5 | ||||
| LDTP11238 | Heterogeneous nuclear ribonucleoprotein U-like protein 1 (HNRNPUL1) | 15.1 | ||||
| LDTP19912 | Protein NipSnap homolog 1 (NIPSNAP1) | 15.0 | ||||
| LDTP11575 | Apoptosis inhibitor 5 (API5) | 14.8 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 14.6 | ||||
| LDTP05036 | Transformer-2 protein homolog beta (TRA2B) | 14.6 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 14.5 | ||||
| LDTP10924 | Prohibitin-2 (PHB2) | 14.3 | ||||
| LDTP05277 | Protein SET (SET) | 14.2 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 13.4 | ||||
| LDTP06385 | Scaffold attachment factor B1 (SAFB) | 13.3 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 13.2 | ||||
| LDTP02297 | Vimentin (VIM) | 13.1 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 13.1 | ||||
| LDTP13630 | Neudesin (NENF) | 13.0 | ||||
| LDTP15253 | HEAT repeat-containing protein 3 (HEATR3) | 13.0 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 12.9 | ||||
| LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | 12.9 | ||||
| LDTP15609 | Ribosome biogenesis protein BRX1 homolog (BRIX1) | 12.2 | ||||
| LDTP10684 | RNA-binding protein 14 (RBM14) | 12.2 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 12.1 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 11.2 | ||||
| LDTP05922 | Dynactin subunit 2 (DCTN2) | 10.8 | ||||
| LDTP11233 | Tubulin beta-6 chain (TUBB6) | 10.4 | ||||
| LDTP05688 | Interleukin enhancer-binding factor 2 (ILF2) | 8.0 | ||||
| LDTP02101 | Eukaryotic translation initiation factor 2 subunit 1 (EIF2S1) | 7.9 | ||||
| LDTP00838 | Mitotic checkpoint protein BUB3 (BUB3) | 7.8 | ||||
| LDTP06450 | ELAV-like protein 1 (ELAVL1) | 7.8 | ||||
| LDTP07234 | BRO1 domain-containing protein BROX (BROX) | 7.5 | ||||
| LDTP11197 | Mini-chromosome maintenance complex-binding protein (MCMBP) | 7.4 | ||||
| LDTP13813 | Eukaryotic translation initiation factor 3 subunit L (EIF3L) | 7.1 | ||||
| LDTP05800 | Serine/arginine-rich splicing factor 9 (SRSF9) | 7.1 | ||||
| LDTP05985 | Spectrin alpha chain, non-erythrocytic 1 (SPTAN1) | 6.9 | ||||
| LDTP04935 | Prefoldin subunit 3 (VBP1) | 6.8 | ||||
| LDTP04914 | Large ribosomal subunit protein uL24 (RPL26) | 6.6 | ||||
| LDTP05904 | Tubulin beta-3 chain (TUBB3) | 6.6 | ||||
| LDTP09086 | Protein FAM98A (FAM98A) | 6.5 | ||||
| LDTP04952 | Heterogeneous nuclear ribonucleoprotein K (HNRNPK) | 6.5 | ||||
| LDTP04495 | Heterogeneous nuclear ribonucleoprotein A3 (HNRNPA3) | 6.5 | ||||
| LDTP09580 | Programmed cell death 6-interacting protein (PDCD6IP) | 6.4 | ||||
| LDTP02227 | Heterogeneous nuclear ribonucleoproteins C1/C2 (HNRNPC) | 6.4 | ||||
| LDTP00843 | Alpha-actinin-4 (ACTN4) | 6.1 | ||||
| LDTP11144 | Endoplasmic reticulum resident protein 44 (ERP44) | 6.1 | ||||
| LDTP05768 | Heterogeneous nuclear ribonucleoprotein A0 (HNRNPA0) | 6.0 | ||||
| LDTP17097 | Heterogeneous nuclear ribonucleoprotein A1-like 2 (HNRNPA1L2) | 5.9 | ||||
| LDTP04514 | Heterogeneous nuclear ribonucleoprotein F (HNRNPF) | 5.8 | ||||
| LDTP04027 | Matrin-3 (MATR3) | 5.4 | ||||
| LDTP06128 | RNA-binding protein 39 (RBM39) | 5.4 | ||||
| LDTP02734 | Endoplasmin (HSP90B1) | 5.2 | ||||
| LDTP05034 | Ubiquitin-ribosomal protein eL40 fusion protein (UBA52) | 5.2 | ||||
| LDTP02825 | Histone H2AX (H2AX) | 5.2 | ||||
| LDTP00620 | Eukaryotic translation initiation factor 3 subunit H (EIF3H) | 5.1 | ||||
| LDTP04990 | Large ribosomal subunit protein eL8 (RPL7A) | 5.1 | ||||
