Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C383 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 99.7 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 77.7 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 67.6 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 60.1 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 41.4 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 38.6 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 37.5 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 34.5 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 33.6 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 33.4 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 29.0 | ||||
| LDTP17247 | 5'-nucleotidase domain-containing protein 1 (NT5DC1) | 28.4 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 28.2 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 26.4 | ||||
| LDTP05588 | RNA cytosine C(5)-methyltransferase NSUN2 (NSUN2) | 26.2 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 25.6 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 25.3 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 22.5 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 22.5 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 22.3 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 22.2 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 22.0 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 21.4 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 20.8 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 19.4 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 19.0 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 18.6 | ||||
| LDTP05480 | Amidophosphoribosyltransferase (PPAT) | 18.1 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 18.1 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 18.1 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 18.0 | ||||
| LDTP11225 | Deoxyhypusine hydroxylase (DOHH) | 17.8 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 17.6 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 17.6 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 17.4 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 17.4 | ||||
| LDTP01004 | Mitotic checkpoint serine/threonine-protein kinase BUB1 beta (BUB1B) | 17.4 | ||||
| LDTP03984 | Caspase-3 (CASP3) | 17.3 | ||||
| LDTP03813 | Oxygen-dependent coproporphyrinogen-III oxidase, mitochondrial (CPOX) | 17.3 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 17.0 | ||||
| LDTP00844 | Maleylacetoacetate isomerase (GSTZ1) | 16.7 | ||||
| LDTP09225 | sn-1-specific diacylglycerol lipase ABHD11 (ABHD11) | 16.7 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 16.4 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 16.4 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 16.3 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 15.8 | ||||
| LDTP03417 | Proteasome subunit beta type-4 (PSMB4) | 15.7 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 15.6 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 15.6 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 15.5 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 15.2 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 14.9 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 14.7 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 14.5 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 14.2 | ||||
| LDTP11494 | Neurolysin, mitochondrial (NLN) | 14.2 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 14.2 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 14.0 | ||||
| LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 13.8 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 13.6 | ||||
| LDTP12293 | Adipocyte plasma membrane-associated protein (APMAP) | 13.5 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 13.5 | ||||
| LDTP12524 | L-aminoadipate-semialdehyde dehydrogenase-phosphopantetheinyl transferase (AASDHPPT) | 13.3 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 13.2 | ||||
| LDTP02188 | Protein disulfide-isomerase (P4HB) | 12.8 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 12.7 | ||||
| LDTP10699 | E3 ubiquitin-protein ligase NEDD4-like (NEDD4L) | 12.7 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 12.6 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 12.6 | ||||
| LDTP06427 | Translin (TSN) | 12.6 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 12.4 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 12.4 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 12.1 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 12.1 | ||||
| LDTP13972 | Oligoribonuclease, mitochondrial (REXO2) | 12.0 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 11.9 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 11.9 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 11.8 | ||||
| LDTP00415 | Acyl-coenzyme A thioesterase 8 (ACOT8) | 11.7 | ||||
| LDTP02713 | Macrophage migration inhibitory factor (MIF) | 11.7 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 11.7 | ||||
| LDTP17785 | Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial (PDPR) | 11.7 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 11.6 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 11.6 | ||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 11.6 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 11.6 | ||||
| LDTP00316 | Ribonuclease T2 (RNASET2) | 11.4 | ||||
| LDTP10495 | Ubiquitin carboxyl-terminal hydrolase 47 (USP47) | 11.3 | ||||
| LDTP15097 | All-trans-retinol 13,14-reductase (RETSAT) | 11.2 | ||||
| LDTP10201 | Atypical kinase COQ8B, mitochondrial (COQ8B) | 11.2 | ||||
| LDTP09899 | Probable ATP-dependent RNA helicase DDX17 (DDX17) | 11.0 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 10.9 | ||||
| LDTP11081 | NAD-capped RNA hydrolase NUDT12 (NUDT12) | 10.9 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 10.9 | ||||
| LDTP03289 | Low molecular weight phosphotyrosine protein phosphatase (ACP1) | 10.7 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 99.7 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 63.1 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 49.9 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 40.8 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 34.3 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 34.1 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 33.8 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 31.6 | ||||
| LDTP02215 | Prosaposin (PSAP) | 31.1 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 27.9 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 26.4 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 25.5 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 24.3 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 23.4 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 22.5 | ||||
| LDTP08769 | Nuclear pore complex protein Nup93 (NUP93) | 21.9 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 21.0 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 20.0 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 19.4 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 18.9 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 18.8 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 18.8 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 18.4 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 17.5 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 17.5 | ||||
| LDTP12636 | Lysosomal cobalamin transport escort protein LMBD1 (LMBRD1) | 16.9 | ||||
| LDTP15733 | Solute carrier family 25 member 44 (SLC25A44) | 16.8 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 16.3 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 15.9 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 15.9 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 15.5 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 15.1 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 15.1 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 15.0 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 14.8 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 14.7 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 14.7 | ||||
| LDTP11406 | Transmembrane protein 59 (TMEM59) | 14.7 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 14.6 | ||||
| LDTP00821 | Mitochondrial import inner membrane translocase subunit TIM44 (TIMM44) | 14.6 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 14.5 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 14.1 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 13.5 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 13.4 | ||||
| LDTP13335 | Exportin-7 (XPO7) | 12.6 | ||||
| LDTP04849 | CD81 antigen (CD81) | 12.6 | ||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | 12.5 | ||||
| LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 12.4 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 12.2 | ||||
| LDTP06947 | Transmembrane protein 128 (TMEM128) | 12.2 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 12.1 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 12.0 | ||||
| LDTP10073 | Protein RFT1 homolog (RFT1) | 11.7 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 11.6 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 11.6 | ||||
| LDTP08981 | Cytochrome c oxidase assembly protein COX18, mitochondrial (COX18) | 11.5 | ||||
| LDTP04227 | Guided entry of tail-anchored proteins factor CAMLG (CAMLG) | 11.2 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 11.2 | ||||
| LDTP06331 | Pericentriolar material 1 protein (PCM1) | 11.1 | ||||
| LDTP11634 | Derlin-2 (DERL2) | 11.0 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 10.9 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02016 | Glucocorticoid receptor (NR3C1) | 10.9 | ||||
GPCR
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15303 | Membrane progestin receptor alpha (PAQR7) | 13.8 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03538 | HLA class I histocompatibility antigen, alpha chain F (HLA-F) | 28.6 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11076 | Apolipoprotein L2 (APOL2) | 74.5 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 72.0 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 70.5 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 63.1 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 41.6 | ||||
| LDTP18467 | LYR motif-containing protein 2 (LYRM2) | 34.1 | ||||
| LDTP15634 | Ubiquinol-cytochrome c reductase complex assembly factor 5 (UQCC5) | 31.8 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 29.4 | ||||
| LDTP14939 | Membralin (TMEM259) | 27.9 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 27.5 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 26.2 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 23.9 | ||||
| LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 23.4 | ||||
| LDTP09297 | Large ribosomal subunit protein mL64 (GADD45GIP1) | 22.5 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 22.0 | ||||
| LDTP11379 | TBC1 domain family member 10A (TBC1D10A) | 21.3 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 21.1 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 20.5 | ||||
| LDTP00887 | Calumenin (CALU) | 20.1 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 19.0 | ||||
| LDTP06068 | MAGUK p55 subfamily member 2 (MPP2) | 18.9 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 18.9 | ||||
| LDTP04558 | Arfaptin-1 (ARFIP1) | 18.1 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 18.1 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 18.0 | ||||
| LDTP10442 | Thioredoxin domain-containing protein 15 (TXNDC15) | 17.9 | ||||
| LDTP01608 | Proteasome assembly chaperone 1 (PSMG1) | 17.4 | ||||
| LDTP07574 | Superkiller complex protein 3 (SKIC3) | 17.4 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 17.3 | ||||
| LDTP01075 | Protein CutA (CUTA) | 17.3 | ||||
| LDTP16577 | DENN domain-containing protein 11 (DENND11) | 17.0 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 17.0 | ||||
| LDTP07476 | RAD50-interacting protein 1 (RINT1) | 16.9 | ||||
| LDTP15101 | Armadillo repeat-containing protein 6 (ARMC6) | 16.8 | ||||
| LDTP12623 | Zinc finger CCHC domain-containing protein 3 (ZCCHC3) | 16.4 | ||||
| LDTP04557 | Arfaptin-2 (ARFIP2) | 15.8 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 15.8 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 15.5 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 15.5 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 15.3 | ||||
| LDTP16322 | Mitochondrial import inner membrane translocase subunit Tim8 B (TIMM8B) | 15.1 | ||||
| LDTP16156 | Protein PALS2 (PALS2) | 15.1 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 14.5 | ||||
| LDTP00871 | Microtubule nucleation factor SSNA1 (SSNA1) | 14.5 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 14.5 | ||||
| LDTP14126 | Mitochondrial import inner membrane translocase subunit Tim9 (TIMM9) | 14.4 | ||||
| LDTP02297 | Vimentin (VIM) | 14.3 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 14.2 | ||||
| LDTP17477 | WD repeat-containing protein 87 (WDR87) | 14.1 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 14.0 | ||||
| LDTP01246 | KH domain-containing, RNA-binding, signal transduction-associated protein 3 (KHDRBS3) | 13.9 | ||||
| LDTP02180 | Neurofilament light polypeptide (NEFL) | 13.9 | ||||
| LDTP02511 | cAMP-dependent protein kinase type I-alpha regulatory subunit (PRKAR1A) | 13.8 | ||||
| LDTP08606 | Nurim (NRM) | 13.8 | ||||
| LDTP11825 | Phosducin-like protein 3 (PDCL3) | 13.7 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 13.5 | ||||
| LDTP06022 | Cold-inducible RNA-binding protein (CIRBP) | 13.5 | ||||
| LDTP13019 | Vacuolar protein sorting-associated protein 18 homolog (VPS18) | 13.5 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 13.4 | ||||
| LDTP11695 | Kinesin light chain 2 (KLC2) | 13.3 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 13.2 | ||||
| LDTP06756 | Erythroid differentiation-related factor 1 (EDRF1) | 13.0 | ||||
| LDTP06853 | TBC1 domain family member 10B (TBC1D10B) | 13.0 | ||||
| LDTP19860 | Coiled-coil domain-containing protein 97 (CCDC97) | 12.9 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 12.6 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 12.6 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 12.4 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 12.4 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 12.4 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 12.3 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 12.0 | ||||
| LDTP08058 | Mitochondrial antiviral-signaling protein (MAVS) | 11.9 | ||||
| LDTP01600 | BAG family molecular chaperone regulator 4 (BAG4) | 11.8 | ||||
| LDTP07839 | Capping protein-inhibiting regulator of actin dynamics (CRACD) | 11.6 | ||||
| LDTP06527 | Alpha-internexin (INA) | 11.5 | ||||
| LDTP13114 | C-type mannose receptor 2 (MRC2) | 11.5 | ||||
| LDTP01286 | Centriole and centriolar satellite protein OFD1 (OFD1) | 11.5 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 11.5 | ||||
| LDTP01582 | Pre-mRNA-splicing factor SLU7 (SLU7) | 11.5 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 11.4 | ||||
| LDTP03615 | Heterogeneous nuclear ribonucleoprotein H (HNRNPH1) | 11.3 | ||||
| LDTP05828 | Interferon-induced protein with tetratricopeptide repeats 5 (IFIT5) | 11.3 | ||||
| LDTP14263 | TAF6-like RNA polymerase II p300/CBP-associated factor-associated factor 65 kDa subunit 6L (TAF6L) | 11.3 | ||||
| LDTP05558 | Galectin-3-binding protein (LGALS3BP) | 11.2 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 11.2 | ||||
| LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | 11.2 | ||||
| LDTP08346 | Cerebellar degeneration-related protein 2-like (CDR2L) | 11.1 | ||||
| LDTP07318 | HAUS augmin-like complex subunit 3 (HAUS3) | 11.0 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 10.9 | ||||
| LDTP04514 | Heterogeneous nuclear ribonucleoprotein F (HNRNPF) | 10.9 | ||||
| LDTP00991 | Heterogeneous nuclear ribonucleoprotein Q (SYNCRIP) | 10.9 | ||||
| LDTP00417 | Programmed cell death protein 5 (PDCD5) | 10.9 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 10.8 | ||||
| LDTP06948 | Protein YIF1B (YIF1B) | 10.7 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 10.7 | ||||
