Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C141 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 86.8 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 48.5 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 48.5 | ||||
| LDTP01983 | NADH-ubiquinone oxidoreductase chain 2 (MT-ND2) | 45.3 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 38.1 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 32.0 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 30.9 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 30.5 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 29.0 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 28.8 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 27.5 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 25.5 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 25.5 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 25.3 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 25.1 | ||||
| LDTP04542 | Thimet oligopeptidase (THOP1) | 24.4 | ||||
| LDTP00975 | Mannosyl-oligosaccharide 1,2-alpha-mannosidase IB (MAN1A2) | 24.3 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 23.8 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 22.5 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 22.2 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 21.9 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 21.0 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 20.3 | ||||
| LDTP11700 | Integrin-linked kinase-associated serine/threonine phosphatase 2C (ILKAP) | 19.0 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 18.9 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 18.5 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 18.4 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 18.1 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 17.9 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 17.5 | ||||
| LDTP10318 | Ubiquitin thioesterase OTUB1 (OTUB1) | 17.0 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 16.9 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 16.8 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 16.6 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 15.8 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 15.7 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 15.6 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 15.6 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 15.6 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 15.5 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 15.3 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 15.0 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 14.9 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 14.3 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 13.5 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 13.4 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 13.2 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 13.1 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 13.0 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 12.8 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 12.8 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 12.4 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 12.4 | ||||
| LDTP06283 | Exosome complex component RRP42 (EXOSC7) | 12.3 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 12.1 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 12.1 | ||||
| LDTP01141 | E3 ubiquitin-protein ligase BRE1B (RNF40) | 12.1 | ||||
| LDTP07620 | Peroxisomal N(1)-acetyl-spermine/spermidine oxidase (PAOX) | 12.1 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 11.9 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 11.9 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 11.7 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 11.6 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 11.6 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 11.6 | ||||
| LDTP08979 | Prostaglandin reductase 2 (PTGR2) | 11.6 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 11.4 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 11.3 | ||||
| LDTP00717 | Bifunctional 3'-phosphoadenosine 5'-phosphosulfate synthase 1 (PAPSS1) | 11.2 | ||||
| LDTP14214 | Dolichyl-phosphate beta-glucosyltransferase (ALG5) | 11.2 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 11.2 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 11.2 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 10.9 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 10.8 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 10.7 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 10.6 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 10.5 | ||||
| LDTP12163 | Calcyclin-binding protein (CACYBP) | 10.3 | ||||
| LDTP07504 | Lysophospholipid acyltransferase 5 (LPCAT3) | 10.3 | ||||
| LDTP02000 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase (HMGCR) | 10.1 | ||||
| LDTP00338 | Lysosomal alpha-mannosidase (MAN2B1) | 10.1 | ||||
| LDTP03249 | Plasma membrane calcium-transporting ATPase 4 (ATP2B4) | 10.1 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 9.9 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 9.9 | ||||
| LDTP13131 | 7-dehydrocholesterol reductase (DHCR7) | 9.8 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 9.8 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 9.8 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 9.8 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 9.6 | ||||
| LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 9.4 | ||||
| LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 9.4 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 9.3 | ||||
| LDTP07218 | E3 ubiquitin-protein ligase BRE1A (RNF20) | 9.3 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 9.2 | ||||
| LDTP12509 | N-lysine methyltransferase SMYD2 (SMYD2) | 9.2 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 9.2 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 9.1 | ||||
| LDTP10981 | Mitochondrial intermediate peptidase (MIPEP) | 9.1 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 9.1 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 9.1 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 9.1 | ||||
| LDTP04203 | Phosphatidylserine synthase 1 (PTDSS1) | 9.1 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 9.1 | ||||
| LDTP01389 | Delta(14)-sterol reductase TM7SF2 (TM7SF2) | 8.9 | ||||
| LDTP07367 | Nucleoredoxin (NXN) | 8.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 65.3 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 50.9 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 42.8 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 40.5 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 40.2 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 39.4 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 35.3 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 32.7 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 31.8 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 31.6 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 31.1 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 30.5 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 30.3 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 29.9 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 29.2 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 28.8 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 27.9 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 26.4 | ||||
| LDTP02215 | Prosaposin (PSAP) | 26.0 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 25.6 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 23.8 | ||||
| LDTP12636 | Lysosomal cobalamin transport escort protein LMBD1 (LMBRD1) | 22.3 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 21.0 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 20.1 | ||||
| LDTP11812 | Protein ARV1 (ARV1) | 19.7 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 19.6 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 19.4 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 18.1 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 17.5 | ||||
| LDTP00970 | Gasdermin-E (GSDME) | 16.2 | ||||
| LDTP03380 | Stomatin (STOM) | 16.2 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 15.9 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 15.6 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 15.1 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 15.0 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 14.9 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 14.2 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 14.2 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 13.7 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 13.4 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 12.8 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 12.6 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 12.6 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 12.5 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 12.4 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 12.3 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 12.2 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 12.1 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 11.8 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 11.7 | ||||
| LDTP09515 | Importin-4 (IPO4) | 11.6 | ||||
| LDTP06549 | Hsp90 co-chaperone Cdc37 (CDC37) | 11.6 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 11.4 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 10.8 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 10.7 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 10.7 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 10.7 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 10.6 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 10.6 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 10.4 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 10.1 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 9.8 | ||||
| LDTP11041 | Calcium uptake protein 1, mitochondrial (MICU1) | 9.5 | ||||
| LDTP13833 | Integral membrane protein 2B (ITM2B) | 9.4 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 9.4 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 9.4 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 8.9 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 14.9 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05160 | Nucleobindin-2 (NUCB2) | 99.0 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 95.7 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 64.9 | ||||
| LDTP18145 | Small integral membrane protein 19 (SMIM19) | 50.6 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 47.2 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 45.6 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 43.1 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 41.1 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 38.6 | ||||
| LDTP15634 | Ubiquinol-cytochrome c reductase complex assembly factor 5 (UQCC5) | 37.3 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 34.1 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 29.7 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 26.9 | ||||
| LDTP13797 | HIG1 domain family member 1A, mitochondrial (HIGD1A) | 22.5 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 22.0 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 21.9 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 21.1 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 21.1 | ||||
| LDTP01075 | Protein CutA (CUTA) | 21.1 | ||||
| LDTP13630 | Neudesin (NENF) | 20.3 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 19.6 | ||||
| LDTP14939 | Membralin (TMEM259) | 19.4 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 19.2 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 19.2 | ||||
| LDTP07476 | RAD50-interacting protein 1 (RINT1) | 18.9 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 18.3 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 18.0 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 17.4 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 17.4 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 17.3 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 17.0 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 16.7 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 15.6 | ||||
| LDTP02511 | cAMP-dependent protein kinase type I-alpha regulatory subunit (PRKAR1A) | 14.9 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 14.9 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 14.6 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 13.9 | ||||
| LDTP12377 | Mediator of RNA polymerase II transcription subunit 4 (MED4) | 13.5 | ||||
| LDTP15283 | Nucleolar protein 9 (NOP9) | 13.5 | ||||
| LDTP07916 | Protein MTSS 2 (MTSS2) | 13.5 | ||||
| LDTP00871 | Microtubule nucleation factor SSNA1 (SSNA1) | 13.1 | ||||
| LDTP19785 | Transmembrane protein 35B (TMEM35B) | 13.0 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 12.2 | ||||
| LDTP00779 | Trans-Golgi network integral membrane protein 2 (TGOLN2) | 12.0 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 12.0 | ||||
| LDTP03175 | Galanin peptides (GAL) | 11.6 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 11.6 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 11.4 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 11.3 | ||||
| LDTP11143 | Centromere protein K (CENPK) | 11.1 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 11.1 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 10.9 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 10.2 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 10.1 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 9.7 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 9.6 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 9.6 | ||||
| LDTP15095 | Receptor expression-enhancing protein 3 (REEP3) | 9.6 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 9.5 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 9.4 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 9.4 | ||||
| LDTP10046 | Endoplasmic reticulum-Golgi intermediate compartment protein 1 (ERGIC1) | 9.1 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 9.1 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 9.0 | ||||
