Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C193 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05006 | Ras-related protein Rab-1A (RAB1A) | 60.5 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 32.9 | ||||
| LDTP13504 | Dermatan-sulfate epimerase (DSE) | 23.8 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 21.1 | ||||
| LDTP11199 | DCN1-like protein 5 (DCUN1D5) | 20.7 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 19.2 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 16.6 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 16.2 | ||||
| LDTP10215 | Carboxymethylenebutenolidase homolog (CMBL) | 15.2 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 14.9 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 13.9 | ||||
| LDTP00837 | Mitotic checkpoint serine/threonine-protein kinase BUB1 (BUB1) | 13.6 | ||||
| LDTP02342 | Dihydropteridine reductase (QDPR) | 13.4 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 13.2 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 12.9 | ||||
| LDTP01640 | CCR4-NOT transcription complex subunit 4 (CNOT4) | 12.3 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 12.0 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 11.9 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 11.7 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 11.1 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 10.8 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 10.3 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 10.1 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 9.3 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 8.8 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 8.6 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 8.4 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 8.2 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 8.1 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 8.1 | ||||
| LDTP04318 | Glycogen synthase kinase-3 alpha (GSK3A) | 7.9 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 7.8 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 7.7 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 7.6 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 7.6 | ||||
| LDTP07679 | Lysocardiolipin acyltransferase 1 (LCLAT1) | 7.5 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 7.5 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 7.5 | ||||
| LDTP15480 | Prenylcysteine oxidase-like (PCYOX1L) | 7.1 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 7.1 | ||||
| LDTP07620 | Peroxisomal N(1)-acetyl-spermine/spermidine oxidase (PAOX) | 6.9 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 6.5 | ||||
| LDTP10137 | Cytochrome c oxidase assembly factor 7 (COA7) | 6.5 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 6.4 | ||||
| LDTP01535 | Kinesin-like protein KIF20A (KIF20A) | 6.2 | ||||
| LDTP11841 | ATP-dependent DNA/RNA helicase DHX36 (DHX36) | 6.2 | ||||
| LDTP01329 | Lathosterol oxidase (SC5D) | 6.2 | ||||
| LDTP13303 | NADH-cytochrome b5 reductase 1 (CYB5R1) | 6.2 | ||||
| LDTP05549 | Protein phosphatase 3 catalytic subunit alpha (PPP3CA) | 6.1 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 6.1 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 6.1 | ||||
| LDTP03522 | Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform (PPP2R1A) | 6.0 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 6.0 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 6.0 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 5.9 | ||||
| LDTP02222 | Bifunctional glutamate/proline--tRNA ligase (EPRS1) | 5.9 | ||||
| LDTP09835 | GPI-anchor transamidase (PIGK) | 5.9 | ||||
| LDTP11055 | Telomerase RNA component interacting RNase (TRIR) | 5.9 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 5.8 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 5.8 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 5.8 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 5.7 | ||||
| LDTP19478 | Putative peptidyl-tRNA hydrolase PTRHD1 (PTRHD1) | 5.7 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 5.6 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 5.6 | ||||
| LDTP02008 | Fructose-bisphosphate aldolase A (ALDOA) | 5.5 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 5.5 | ||||
| LDTP08666 | Xaa-Arg dipeptidase (PM20D2) | 5.5 | ||||
| LDTP10249 | Metalloendopeptidase OMA1, mitochondrial (OMA1) | 5.5 | ||||
| LDTP05289 | AMP deaminase 2 (AMPD2) | 5.5 | ||||
| LDTP14079 | E3 ubiquitin-protein ligase ARIH1 (ARIH1) | 5.5 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 5.5 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 5.4 | ||||
| LDTP00877 | Protein SCO2 homolog, mitochondrial (SCO2) | 5.4 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 5.4 | ||||
| LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 5.4 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 5.4 | ||||
| LDTP04345 | Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial (IDH3A) | 5.3 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 5.3 | ||||
| LDTP13107 | SUMO-activating enzyme subunit 1 (SAE1) | 5.3 | ||||
| LDTP06620 | Thiosulfate sulfurtransferase (TST) | 5.3 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 5.2 | ||||
| LDTP12227 | Methylcrotonoyl-CoA carboxylase beta chain, mitochondrial (MCCC2) | 5.2 | ||||
| LDTP03816 | Oxidized purine nucleoside triphosphate hydrolase (NUDT1) | 5.2 | ||||
| LDTP09388 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B (STT3B) | 5.1 | ||||
| LDTP16040 | Glyoxalase domain-containing protein 4 (GLOD4) | 5.1 | ||||
| LDTP08979 | Prostaglandin reductase 2 (PTGR2) | 5.1 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 5.0 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 5.0 | ||||
| LDTP00645 | Prolyl 4-hydroxylase subunit alpha-2 (P4HA2) | 5.0 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 4.9 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 39.7 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 26.4 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 25.8 | ||||
| LDTP04237 | Protein ERGIC-53 (LMAN1) | 18.8 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 17.4 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 16.9 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 16.6 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 14.0 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 13.8 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 13.7 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 13.3 | ||||
| LDTP03905 | Peroxisomal biogenesis factor 19 (PEX19) | 12.8 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 11.7 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 11.6 | ||||
| LDTP14140 | Ceramide transfer protein (CERT1) | 10.3 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 10.1 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 9.9 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 9.6 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 8.9 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 8.8 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 8.2 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 8.1 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 7.5 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 7.4 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 7.3 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 7.3 | ||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 7.2 | ||||
| LDTP02256 | Amino acid transporter heavy chain SLC3A2 (SLC3A2) | 7.1 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 6.8 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 6.4 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 6.2 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 6.1 | ||||
| LDTP08651 | Exocyst complex component 8 (EXOC8) | 5.9 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 5.9 | ||||
| LDTP03284 | ATP synthase F(0) complex subunit B1, mitochondrial (ATP5PB) | 5.8 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 5.7 | ||||
| LDTP02061 | Anion exchange protein 2 (SLC4A2) | 5.7 | ||||
| LDTP03546 | Translocator protein (TSPO) | 5.7 | ||||
| LDTP13142 | Vacuolar protein sorting-associated protein 29 (VPS29) | 5.5 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 5.4 | ||||
| LDTP04462 | H(+)/Cl(-) exchange transporter 6 (CLCN6) | 5.4 | ||||
| LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 5.2 | ||||
| LDTP02262 | Heat shock protein HSP 90-beta (HSP90AB1) | 5.2 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 5.2 | ||||
| LDTP12090 | Sideroflexin-1 (SFXN1) | 5.2 | ||||
| LDTP01454 | SUN domain-containing protein 1 (SUN1) | 5.2 | ||||
| LDTP02215 | Prosaposin (PSAP) | 5.1 | ||||
| LDTP12966 | Vesicle-associated membrane protein-associated protein A (VAPA) | 5.0 | ||||
| LDTP03385 | 14-3-3 protein theta (YWHAQ) | 5.0 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 5.0 | ||||
| LDTP03837 | Signal recognition particle 14 kDa protein (SRP14) | 4.9 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP08006 | PHD finger-like domain-containing protein 5A (PHF5A) | 14.1 | ||||
| LDTP08409 | Transcriptional repressor p66-alpha (GATAD2A) | 8.3 | ||||
| LDTP02343 | High mobility group protein B1 (HMGB1) | 8.3 | ||||
| LDTP06341 | Non-POU domain-containing octamer-binding protein (NONO) | 7.9 | ||||
| LDTP12792 | CDKN2A-interacting protein (CDKN2AIP) | 5.5 | ||||
| LDTP00612 | High mobility group protein B3 (HMGB3) | 5.5 | ||||
GPCR
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15303 | Membrane progestin receptor alpha (PAQR7) | 27.9 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02688 | HLA class I histocompatibility antigen, alpha chain E (HLA-E) | 12.5 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12025 | UPF0488 protein C8orf33 (C8orf33) | 99.7 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 30.9 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 30.5 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 30.5 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 22.5 | ||||
| LDTP05049 | Dynein light chain 1, cytoplasmic (DYNLL1) | 19.2 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 19.0 | ||||
| LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 15.0 | ||||
| LDTP12780 | THUMP domain-containing protein 1 (THUMPD1) | 14.9 | ||||
| LDTP04926 | Large ribosomal subunit protein eL43 (RPL37A) | 14.8 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 14.8 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 14.6 | ||||
| LDTP00759 | Tumor protein D54 (TPD52L2) | 13.8 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 13.4 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 13.1 | ||||
| LDTP11101 | Coronin-1B (CORO1B) | 12.9 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 12.9 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 12.7 | ||||
| LDTP08292 | Zinc finger CCCH domain-containing protein 18 (ZC3H18) | 12.7 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 12.5 | ||||
| LDTP02940 | Large ribosomal subunit protein eL33 (RPL35A) | 12.2 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 11.7 | ||||
| LDTP02816 | Replication protein A 32 kDa subunit (RPA2) | 11.6 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 10.3 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 10.3 | ||||
| LDTP02335 | U1 small nuclear ribonucleoprotein C (SNRPC) | 10.1 | ||||
| LDTP13981 | Small ribosomal subunit protein bS16m (MRPS16) | 10.1 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 9.8 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 9.5 | ||||
| LDTP00830 | BUB3-interacting and GLEBS motif-containing protein ZNF207 (ZNF207) | 9.0 | ||||
| LDTP05768 | Heterogeneous nuclear ribonucleoprotein A0 (HNRNPA0) | 8.8 | ||||
| LDTP04108 | Large ribosomal subunit protein eL28 (RPL28) | 8.4 | ||||
| LDTP08552 | PHD finger protein 6 (PHF6) | 8.4 | ||||
| LDTP12652 | DDB1- and CUL4-associated factor 13 (DCAF13) | 8.1 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 8.0 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 7.9 | ||||
| LDTP16162 | Large ribosomal subunit protein bL27m (MRPL27) | 7.8 | ||||
| LDTP13956 | Putative RNA-binding protein Luc7-like 2 (LUC7L2) | 7.8 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 7.8 | ||||
| LDTP10684 | RNA-binding protein 14 (RBM14) | 7.8 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 7.7 | ||||
| LDTP13817 | Nuclear migration protein nudC (NUDC) | 7.7 | ||||
| LDTP05867 | Treacle protein (TCOF1) | 7.7 | ||||
| LDTP03729 | General transcription factor IIF subunit 1 (GTF2F1) | 7.6 | ||||
| LDTP09938 | Far upstream element-binding protein 2 (KHSRP) | 7.5 | ||||
| LDTP06952 | DBIRD complex subunit ZNF326 (ZNF326) | 7.5 | ||||
| LDTP11312 | DET1- and DDB1-associated protein 1 (DDA1) | 7.5 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 7.5 | ||||
| LDTP06587 | Survival motor neuron protein (SMN1; SMN2) | 7.4 | ||||
| LDTP14058 | Rap guanine nucleotide exchange factor 2 (RAPGEF2) | 7.3 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 7.3 | ||||
| LDTP01206 | Vesicle-trafficking protein SEC22b (SEC22B) | 7.3 | ||||
| LDTP04356 | Emerin (EMD) | 7.2 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 7.2 | ||||
| LDTP01320 | Eukaryotic translation initiation factor 3 subunit J (EIF3J) | 7.1 | ||||
| LDTP06879 | Protein FAM98B (FAM98B) | 7.1 | ||||
| LDTP04914 | Large ribosomal subunit protein uL24 (RPL26) | 7.1 | ||||
| LDTP02164 | Nucleophosmin (NPM1) | 7.1 | ||||
| LDTP04945 | Small ubiquitin-related modifier 2 (SUMO2) | 7.1 | ||||
| LDTP12476 | Translation initiation factor eIF2B subunit gamma (EIF2B3) | 7.0 | ||||
| LDTP09324 | Ganglioside-induced differentiation-associated protein 1 (GDAP1) | 6.9 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 6.8 | ||||
| LDTP07318 | HAUS augmin-like complex subunit 3 (HAUS3) | 6.8 | ||||
| LDTP06301 | Eukaryotic translation initiation factor 4H (EIF4H) | 6.6 | ||||
| LDTP03027 | Eukaryotic translation initiation factor 2 subunit 2 (EIF2S2) | 6.6 | ||||
| LDTP03520 | Phosphatidylethanolamine-binding protein 1 (PEBP1) | 6.5 | ||||
| LDTP08136 | YTH domain-containing family protein 3 (YTHDF3) | 6.5 | ||||
| LDTP05442 | 14-3-3 protein eta (YWHAH) | 6.3 | ||||
| LDTP03404 | Microtubule-associated protein 4 (MAP4) | 6.3 | ||||
| LDTP08950 | ADP-ribosylation factor GTPase-activating protein 1 (ARFGAP1) | 6.2 | ||||
| LDTP00620 | Eukaryotic translation initiation factor 3 subunit H (EIF3H) | 6.2 | ||||
| LDTP13162 | Mortality factor 4-like protein 1 (MORF4L1) | 6.2 | ||||
| LDTP04049 | Ran-specific GTPase-activating protein (RANBP1) | 6.2 | ||||
| LDTP04140 | Large ribosomal subunit protein eL29 (RPL29) | 6.2 | ||||
| LDTP06383 | Calponin-3 (CNN3) | 6.1 | ||||
| LDTP05641 | WASH complex subunit 5 (WASHC5) | 6.1 | ||||
| LDTP05189 | Chromobox protein homolog 1 (CBX1) | 6.1 | ||||
| LDTP12192 | Kinetochore protein Spc25 (SPC25) | 6.1 | ||||
| LDTP12826 | Bcl-2-associated transcription factor 1 (BCLAF1) | 6.0 | ||||
| LDTP06094 | Src substrate cortactin (CTTN) | 6.0 | ||||
| LDTP07476 | RAD50-interacting protein 1 (RINT1) | 5.9 | ||||
| LDTP05277 | Protein SET (SET) | 5.9 | ||||
| LDTP05224 | RNA-binding protein 10 (RBM10) | 5.9 | ||||
| LDTP04971 | Small ribosomal subunit protein uS12 (RPS23) | 5.8 | ||||
| LDTP12506 | DNA polymerase epsilon subunit 3 (POLE3) | 5.7 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 5.7 | ||||
| LDTP06174 | Pumilio homolog 1 (PUM1) | 5.7 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 5.7 | ||||
| LDTP15762 | Zinc finger RNA-binding protein (ZFR) | 5.7 | ||||
| LDTP02973 | DNA repair protein XRCC1 (XRCC1) | 5.7 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 5.7 | ||||
| LDTP08984 | Protein enabled homolog (ENAH) | 5.7 | ||||
| LDTP13919 | Thyroid hormone receptor-associated protein 3 (THRAP3) | 5.6 | ||||
| LDTP06684 | Sister chromatid cohesion protein PDS5 homolog A (PDS5A) | 5.5 | ||||
| LDTP05765 | Translation initiation factor eIF2B subunit epsilon (EIF2B5) | 5.5 | ||||
| LDTP09655 | Ataxin-2-like protein (ATXN2L) | 5.5 | ||||
| LDTP05834 | Eukaryotic translation initiation factor 3 subunit I (EIF3I) | 5.5 | ||||
| LDTP13657 | Melanoma-associated antigen D2 (MAGED2) | 5.5 | ||||
| LDTP13807 | PRELI domain-containing protein 1, mitochondrial (PRELID1) | 5.5 | ||||
| LDTP09850 | Proline-rich protein PRCC (PRCC) | 5.5 | ||||
| LDTP18287 | Protein CMSS1 (CMSS1) | 5.5 | ||||
| LDTP14228 | Transforming acidic coiled-coil-containing protein 3 (TACC3) | 5.5 | ||||
| LDTP05196 | Large ribosomal subunit protein eL19 (RPL19) | 5.4 | ||||
| LDTP02292 | U1 small nuclear ribonucleoprotein 70 kDa (SNRNP70) | 5.4 | ||||
| LDTP13402 | Dynactin subunit 4 (DCTN4) | 5.4 | ||||
| LDTP16096 | RNA-binding protein 12 (RBM12) | 5.4 | ||||
| LDTP14259 | Testis-expressed protein 264 (TEX264) | 5.4 | ||||
| LDTP02297 | Vimentin (VIM) | 5.4 | ||||
| LDTP12737 | BRISC and BRCA1-A complex member 1 (BABAM1) | 5.3 | ||||
| LDTP11709 | Nuclear speckle splicing regulatory protein 1 (NSRP1) | 5.2 | ||||
| LDTP00849 | 17S U2 SnRNP complex component HTATSF1 (HTATSF1) | 5.2 | ||||
| LDTP05750 | Chromatin assembly factor 1 subunit A (CHAF1A) | 5.2 | ||||
| LDTP04913 | Small ribosomal subunit protein eS1 (RPS3A) | 5.2 | ||||
| LDTP03322 | Bromodomain-containing protein 2 (BRD2) | 5.1 | ||||
| LDTP00887 | Calumenin (CALU) | 5.1 | ||||
| LDTP06368 | Elongin-C (ELOC) | 5.1 | ||||
| LDTP05360 | Large ribosomal subunit protein eL20 (RPL18A) | 5.1 | ||||
| LDTP06220 | LIM and SH3 domain protein 1 (LASP1) | 5.1 | ||||
| LDTP11764 | Nuclear ubiquitous casein and cyclin-dependent kinase substrate 1 (NUCKS1) | 5.1 | ||||
| LDTP09049 | NHL repeat-containing protein 2 (NHLRC2) | 5.1 | ||||
| LDTP09201 | Folliculin (FLCN) | 5.0 | ||||
| LDTP12764 | MICOS complex subunit MIC19 (CHCHD3) | 5.0 | ||||
| LDTP13813 | Eukaryotic translation initiation factor 3 subunit L (EIF3L) | 5.0 | ||||
| LDTP11238 | Heterogeneous nuclear ribonucleoprotein U-like protein 1 (HNRNPUL1) | 5.0 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 5.0 | ||||
| LDTP02181 | Neurofilament medium polypeptide (NEFM) | 5.0 | ||||
| LDTP05087 | Nucleolar protein 14 (NOP14) | 5.0 | ||||
| LDTP08735 | Spartin (SPART) | 5.0 | ||||
| LDTP10947 | Ataxin-2 (ATXN2) | 4.9 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 4.9 | ||||
