Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C399 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 66.7 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 26.9 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 25.5 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 24.3 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 23.8 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 22.5 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 21.4 | ||||
| LDTP11081 | NAD-capped RNA hydrolase NUDT12 (NUDT12) | 21.3 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 21.3 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 21.0 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 20.5 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 20.1 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 18.9 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 18.8 | ||||
| LDTP04333 | GMP synthase [glutamine-hydrolyzing] (GMPS) | 18.4 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 17.9 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 17.1 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 17.0 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 17.0 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 16.9 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 16.9 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 16.4 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 15.0 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 14.6 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 14.0 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 13.9 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 13.6 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 13.6 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 13.1 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 13.1 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 12.8 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 12.8 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 12.6 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 12.6 | ||||
| LDTP07259 | N-alpha-acetyltransferase 35, NatC auxiliary subunit (NAA35) | 12.5 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 12.5 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 12.3 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 12.2 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 12.0 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 12.0 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 11.8 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 11.8 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 11.6 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 11.5 | ||||
| LDTP17305 | Glycosyltransferase 8 domain-containing protein 1 (GLT8D1) | 11.4 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 11.4 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 11.3 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 10.7 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 10.6 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 10.6 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 9.9 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 9.8 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 9.8 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 9.7 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 9.6 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 9.6 | ||||
| LDTP00544 | Sphingolipid delta(4)-desaturase DES1 (DEGS1) | 9.5 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 9.3 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 9.3 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 9.3 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 9.0 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 9.0 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 8.9 | ||||
| LDTP16040 | Glyoxalase domain-containing protein 4 (GLOD4) | 8.9 | ||||
| LDTP03417 | Proteasome subunit beta type-4 (PSMB4) | 8.9 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 8.9 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 8.8 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 8.7 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 8.6 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 8.6 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 8.6 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 7.9 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 7.9 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 7.9 | ||||
| LDTP11703 | Histone deacetylase complex subunit SAP130 (SAP130) | 7.9 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 7.9 | ||||
| LDTP01759 | Histone-lysine N-methyltransferase NSD2 (NSD2) | 7.8 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 7.7 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 7.7 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 7.6 | ||||
| LDTP10888 | Legumain (LGMN) | 7.6 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 7.6 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 7.5 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 7.3 | ||||
| LDTP10930 | Membrane-associated tyrosine- and threonine-specific cdc2-inhibitory kinase (PKMYT1) | 7.3 | ||||
| LDTP04114 | E3 ubiquitin-protein ligase NEDD4 (NEDD4) | 7.3 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 7.2 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 7.2 | ||||
| LDTP03523 | Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform (PPP2R1B) | 7.1 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 6.8 | ||||
| LDTP11107 | Serine/threonine-protein phosphatase CPPED1 (CPPED1) | 6.8 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 6.7 | ||||
| LDTP11606 | Ethanolaminephosphotransferase 1 (SELENOI) | 6.7 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 6.7 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 99.7 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 49.9 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 33.4 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 29.2 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 28.6 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 26.2 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 25.6 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 25.6 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 25.3 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 21.9 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 21.9 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 19.8 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 18.9 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 18.8 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 18.3 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 17.8 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 17.8 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 17.4 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 16.1 | ||||
| LDTP11812 | Protein ARV1 (ARV1) | 15.7 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 14.9 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 14.8 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 14.6 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 14.6 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 14.3 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 14.2 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 13.9 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 13.3 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 13.1 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 12.9 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 12.8 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 12.6 | ||||
| LDTP13142 | Vacuolar protein sorting-associated protein 29 (VPS29) | 12.0 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 11.6 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 11.2 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 11.2 | ||||
| LDTP12451 | Integral membrane protein 2C (ITM2C) | 11.1 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 10.7 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 10.5 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 10.3 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 9.6 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 9.2 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 9.1 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 8.9 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 8.9 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 8.8 | ||||
| LDTP10343 | Vacuole membrane protein 1 (VMP1) | 8.8 | ||||
| LDTP10769 | Intermembrane lipid transfer protein VPS13A (VPS13A) | 8.8 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 8.6 | ||||
| LDTP02608 | ADP/ATP translocase 1 (SLC25A4) | 8.5 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 8.3 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 8.1 | ||||
| LDTP03380 | Stomatin (STOM) | 8.0 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 7.9 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 7.7 | ||||
| LDTP08279 | Mitochondrial coenzyme A transporter SLC25A42 (SLC25A42) | 7.7 | ||||
| LDTP05978 | THO complex subunit 5 homolog (THOC5) | 7.7 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 7.5 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 7.3 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 7.2 | ||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 7.1 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 7.1 | ||||
| LDTP00857 | Syntaxin-6 (STX6) | 7.1 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 7.0 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 6.9 | ||||
| LDTP16163 | Cytochrome c oxidase assembly protein COX16 homolog, mitochondrial (COX16) | 6.8 | ||||
| LDTP07439 | Mitochondrial adenyl nucleotide antiporter SLC25A25 (SLC25A25) | 6.8 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 7.8 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 65.3 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 37.3 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 31.3 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 23.8 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 22.0 | ||||
| LDTP08716 | Abnormal spindle-like microcephaly-associated protein (ASPM) | 20.1 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 19.7 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 19.2 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 17.6 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 17.4 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 16.1 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 15.7 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 15.0 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 14.4 | ||||
| LDTP14080 | U6 snRNA-associated Sm-like protein LSm5 (LSM5) | 13.9 | ||||
| LDTP14939 | Membralin (TMEM259) | 13.5 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 13.5 | ||||
| LDTP15599 | UPF0729 protein C18orf32 (C18orf32) | 13.0 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 12.6 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 12.4 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 11.9 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 11.6 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 11.1 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 10.9 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 10.7 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 10.1 | ||||
| LDTP10191 | Gamma-tubulin complex component 3 (TUBGCP3) | 10.0 | ||||
| LDTP06305 | WD repeat-containing protein 43 (WDR43) | 9.4 | ||||
| LDTP09773 | Protein FAM3C (FAM3C) | 9.4 | ||||
| LDTP04304 | Translation initiation factor eIF2B subunit beta (EIF2B2) | 9.3 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 9.2 | ||||
| LDTP01075 | Protein CutA (CUTA) | 9.1 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 9.0 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 8.9 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 8.8 | ||||
| LDTP10849 | Regulator of microtubule dynamics protein 3 (RMDN3) | 8.6 | ||||
| LDTP13125 | Protein UXT (UXT) | 8.5 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 8.5 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 8.3 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 8.2 | ||||
| LDTP16078 | Heme-binding protein 1 (HEBP1) | 8.1 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 8.1 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 8.0 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 7.9 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 7.8 | ||||
| LDTP14263 | TAF6-like RNA polymerase II p300/CBP-associated factor-associated factor 65 kDa subunit 6L (TAF6L) | 7.8 | ||||
| LDTP11766 | Activating signal cointegrator 1 complex subunit 2 (ASCC2) | 7.7 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 7.6 | ||||
| LDTP15253 | HEAT repeat-containing protein 3 (HEATR3) | 7.5 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 7.4 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 7.2 | ||||
| LDTP08904 | Protein jagunal homolog 1 (JAGN1) | 7.0 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 7.0 | ||||
| LDTP12788 | BRISC and BRCA1-A complex member 2 (BABAM2) | 6.9 | ||||
| LDTP06373 | Mitochondrial import receptor subunit TOM20 homolog (TOMM20) | 6.9 | ||||
| LDTP12891 | Glycolipid transfer protein (GLTP) | 6.8 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 6.8 | ||||
| LDTP06250 | Proteasome activator complex subunit 4 (PSME4) | 6.8 | ||||
| LDTP13782 | RNA transcription, translation and transport factor protein (RTRAF) | 6.8 | ||||
| LDTP09143 | Divergent protein kinase domain 2A (DIPK2A) | 6.7 | ||||
| LDTP11328 | Splicing factor 3B subunit 5 (SF3B5) | 6.7 | ||||
| LDTP18132 | Protein FAM136A (FAM136A) | 6.7 | ||||
