Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C313 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 53.8 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 47.2 | ||||
| LDTP10981 | Mitochondrial intermediate peptidase (MIPEP) | 44.6 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 43.4 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 38.1 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 36.8 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 34.5 | ||||
| LDTP06227 | Prostaglandin reductase 1 (PTGR1) | 32.7 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 32.0 | ||||
| LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 29.4 | ||||
| LDTP19745 | ADP-ribosylation factor-like protein 10 (ARL10) | 29.2 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 27.3 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 26.0 | ||||
| LDTP12691 | Pyridoxine-5'-phosphate oxidase (PNPO) | 24.4 | ||||
| LDTP12197 | Ethanolamine kinase 1 (ETNK1) | 23.9 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 23.1 | ||||
| LDTP04114 | E3 ubiquitin-protein ligase NEDD4 (NEDD4) | 22.8 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 22.2 | ||||
| LDTP03677 | Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA (MAN1A1) | 20.7 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 20.4 | ||||
| LDTP12105 | L-2-hydroxyglutarate dehydrogenase, mitochondrial (L2HGDH) | 20.3 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 20.1 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 19.8 | ||||
| LDTP09074 | UDP-glucuronic acid decarboxylase 1 (UXS1) | 19.7 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 18.8 | ||||
| LDTP12109 | Ribitol 5-phosphate transferase FKRP (FKRP) | 18.8 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 18.5 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 18.4 | ||||
| LDTP09285 | Atypical kinase COQ8A, mitochondrial (COQ8A) | 18.3 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 18.0 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 17.8 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 17.5 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 17.0 | ||||
| LDTP06023 | Calcium/calmodulin-dependent protein kinase type 1 (CAMK1) | 16.8 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 16.8 | ||||
| LDTP00645 | Prolyl 4-hydroxylase subunit alpha-2 (P4HA2) | 16.4 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 16.2 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 16.0 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 15.2 | ||||
| LDTP04746 | NADH dehydrogenase 1 alpha subcomplex subunit 6 (NDUFA6) | 15.0 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 14.8 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 14.7 | ||||
| LDTP03060 | Proteasome subunit beta type-1 (PSMB1) | 14.7 | ||||
| LDTP13154 | E3 ubiquitin-protein ligase RNF14 (RNF14) | 14.6 | ||||
| LDTP03608 | RAC-beta serine/threonine-protein kinase (AKT2) | 14.5 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 14.5 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 14.4 | ||||
| LDTP03223 | Small ribosomal subunit protein uS3 (RPS3) | 14.0 | ||||
| LDTP06614 | NADH dehydrogenase 1 alpha subcomplex subunit 5 (NDUFA5) | 13.9 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 13.9 | ||||
| LDTP06427 | Translin (TSN) | 13.9 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 13.8 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 13.8 | ||||
| LDTP05944 | Myotubularin-related protein 2 (MTMR2) | 13.8 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 13.7 | ||||
| LDTP07503 | Endoplasmic reticulum aminopeptidase 2 (ERAP2) | 13.7 | ||||
| LDTP00773 | Serine protease HTRA2, mitochondrial (HTRA2) | 13.7 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 13.6 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 13.6 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 13.5 | ||||
| LDTP08598 | NAD-dependent protein deacetylase sirtuin-2 (SIRT2) | 13.5 | ||||
| LDTP17305 | Glycosyltransferase 8 domain-containing protein 1 (GLT8D1) | 13.3 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 12.9 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 12.8 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 12.5 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 12.5 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 12.4 | ||||
| LDTP12763 | Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase (BPNT2) | 12.3 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 12.2 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 12.2 | ||||
| LDTP13972 | Oligoribonuclease, mitochondrial (REXO2) | 12.2 | ||||
| LDTP11535 | Ras-related protein Rab-34 (RAB34) | 12.2 | ||||
| LDTP13862 | GDP-fucose protein O-fucosyltransferase 2 (POFUT2) | 12.1 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 75.1 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 70.5 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 40.8 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 30.5 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 26.5 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 26.5 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 24.3 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 22.2 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 21.9 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 21.7 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 21.6 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 21.4 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 21.0 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 20.5 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 19.2 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 19.0 | ||||
| LDTP02215 | Prosaposin (PSAP) | 18.3 | ||||
| LDTP01217 | Metaxin-2 (MTX2) | 17.5 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 17.1 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 17.1 | ||||
| LDTP00857 | Syntaxin-6 (STX6) | 16.9 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 16.8 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 16.3 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 15.3 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 15.1 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 14.6 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 14.6 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 14.3 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 14.1 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 13.6 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 13.6 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 13.5 | ||||
| LDTP08029 | Nucleoporin p54 (NUP54) | 13.3 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 13.3 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 12.7 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 12.6 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 12.6 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 12.4 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 12.3 | ||||
| LDTP10885 | Sortilin (SORT1) | 12.1 | ||||
| LDTP13243 | Translocation protein SEC63 homolog (SEC63) | 12.1 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05065 | Y-box-binding protein 1 (YBX1) | 18.9 | ||||
| LDTP09694 | Paraspeckle component 1 (PSPC1) | 13.9 | ||||
| LDTP10195 | G-protein coupled receptor-associated sorting protein 2 (GPRASP2) | 12.3 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02040 | HLA class I histocompatibility antigen, A alpha chain (HLA-A) | 12.9 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 67.2 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 55.3 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 49.2 | ||||
| LDTP01932 | Prelamin-A/C (LMNA) | 49.2 | ||||
| LDTP01279 | Protein CREG1 (CREG1) | 39.9 | ||||
| LDTP08594 | Negative elongation factor C/D (NELFCD) | 38.9 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 33.4 | ||||
| LDTP06004 | Nuclear nucleic acid-binding protein C1D (C1D) | 30.7 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 29.7 | ||||
| LDTP18467 | LYR motif-containing protein 2 (LYRM2) | 28.8 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 28.2 | ||||
| LDTP02297 | Vimentin (VIM) | 28.2 | ||||
| LDTP09069 | Kinetochore protein Spc24 (SPC24) | 28.1 | ||||
| LDTP10255 | Protein Hook homolog 2 (HOOK2) | 28.1 | ||||
| LDTP05012 | Small ribosomal subunit protein eS24 (RPS24) | 27.5 | ||||
| LDTP04979 | U6 snRNA-associated Sm-like protein LSm3 (LSM3) | 25.3 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 25.1 | ||||
| LDTP05226 | RNA-binding protein 3 (RBM3) | 24.8 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 24.1 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 23.9 | ||||
| LDTP02940 | Large ribosomal subunit protein eL33 (RPL35A) | 23.8 | ||||
| LDTP00871 | Microtubule nucleation factor SSNA1 (SSNA1) | 23.6 | ||||
| LDTP02181 | Neurofilament medium polypeptide (NEFM) | 23.4 | ||||
| LDTP03303 | Adenomatous polyposis coli protein (APC) | 22.8 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 22.2 | ||||
| LDTP10203 | RalBP1-associated Eps domain-containing protein 1 (REPS1) | 22.0 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 21.6 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 21.4 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 21.4 | ||||
| LDTP05277 | Protein SET (SET) | 20.8 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 20.5 | ||||
| LDTP01075 | Protein CutA (CUTA) | 20.5 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 20.4 | ||||
| LDTP02180 | Neurofilament light polypeptide (NEFL) | 19.3 | ||||
| LDTP09297 | Large ribosomal subunit protein mL64 (GADD45GIP1) | 19.2 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 18.6 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 18.5 | ||||
| LDTP02351 | Tropomyosin alpha-1 chain (TPM1) | 18.4 | ||||
| LDTP16322 | Mitochondrial import inner membrane translocase subunit Tim8 B (TIMM8B) | 17.9 | ||||
| LDTP00887 | Calumenin (CALU) | 17.8 | ||||
| LDTP06515 | Coiled-coil domain-containing protein 6 (CCDC6) | 17.6 | ||||
| LDTP06022 | Cold-inducible RNA-binding protein (CIRBP) | 17.5 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 17.4 | ||||
| LDTP00417 | Programmed cell death protein 5 (PDCD5) | 17.4 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 17.3 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 17.0 | ||||
| LDTP13630 | Neudesin (NENF) | 16.9 | ||||
| LDTP08000 | Dymeclin (DYM) | 16.8 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 16.4 | ||||
| LDTP10213 | Anaphase-promoting complex subunit 16 (ANAPC16) | 16.3 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 16.3 | ||||
| LDTP14259 | Testis-expressed protein 264 (TEX264) | 16.3 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 16.2 | ||||
| LDTP12395 | Large ribosomal subunit protein mL40 (MRPL40) | 16.1 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 16.0 | ||||
| LDTP14126 | Mitochondrial import inner membrane translocase subunit Tim9 (TIMM9) | 15.8 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 15.7 | ||||
| LDTP11044 | Polyadenylate-binding protein-interacting protein 2 (PAIP2) | 15.7 | ||||
| LDTP16193 | Craniofacial development protein 1 (CFDP1) | 15.5 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 15.1 | ||||
| LDTP00913 | Mitochondrial import inner membrane translocase subunit Tim8 A (TIMM8A) | 15.1 | ||||
| LDTP08073 | Tetratricopeptide repeat protein 21B (TTC21B) | 15.1 | ||||
| LDTP09183 | Periphilin-1 (PPHLN1) | 14.9 | ||||
| LDTP01711 | Protein ecdysoneless homolog (ECD) | 14.8 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 14.6 | ||||
| LDTP03850 | RNA-binding motif protein, X chromosome (RBMX) | 14.6 | ||||
| LDTP13114 | C-type mannose receptor 2 (MRC2) | 14.5 | ||||
| LDTP01246 | KH domain-containing, RNA-binding, signal transduction-associated protein 3 (KHDRBS3) | 14.4 | ||||
| LDTP10469 | Engulfment and cell motility protein 2 (ELMO2) | 14.2 | ||||
| LDTP03615 | Heterogeneous nuclear ribonucleoprotein H (HNRNPH1) | 14.2 | ||||
| LDTP05400 | Lamin-B2 (LMNB2) | 14.2 | ||||
| LDTP00716 | RNA binding protein fox-1 homolog 2 (RBFOX2) | 14.2 | ||||
| LDTP05318 | RNA-binding protein EWS (EWSR1) | 14.2 | ||||
| LDTP13309 | Prefoldin subunit 2 (PFDN2) | 14.0 | ||||
| LDTP05068 | Tropomyosin alpha-4 chain (TPM4) | 14.0 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 13.9 | ||||
| LDTP04514 | Heterogeneous nuclear ribonucleoprotein F (HNRNPF) | 13.9 | ||||
| LDTP11695 | Kinesin light chain 2 (KLC2) | 13.9 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 13.9 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 13.7 | ||||
| LDTP13519 | Proteasome activator complex subunit 2 (PSME2) | 13.7 | ||||
| LDTP02526 | Clusterin (CLU) | 13.6 | ||||
| LDTP11825 | Phosducin-like protein 3 (PDCL3) | 13.6 | ||||
| LDTP05089 | Immunoglobulin-binding protein 1 (IGBP1) | 13.5 | ||||
| LDTP00573 | Prefoldin subunit 6 (PFDN6) | 13.5 | ||||
| LDTP00991 | Heterogeneous nuclear ribonucleoprotein Q (SYNCRIP) | 13.5 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 13.5 | ||||
| LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | 13.4 | ||||
| LDTP12925 | CCR4-NOT transcription complex subunit 2 (CNOT2) | 13.4 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 13.4 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 13.4 | ||||
| LDTP17652 | Uncharacterized protein KIAA2013 (KIAA2013) | 13.4 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 13.2 | ||||
| LDTP09410 | Protein bicaudal D homolog 2 (BICD2) | 13.2 | ||||
| LDTP00864 | Alpha-endosulfine (ENSA) | 13.1 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 13.1 | ||||
| LDTP00862 | Small glutamine-rich tetratricopeptide repeat-containing protein alpha (SGTA) | 13.0 | ||||
| LDTP12764 | MICOS complex subunit MIC19 (CHCHD3) | 12.9 | ||||
| LDTP11682 | Polyadenylate-binding protein-interacting protein 1 (PAIP1) | 12.9 | ||||
| LDTP11910 | Golgi phosphoprotein 3-like (GOLPH3L) | 12.8 | ||||
| LDTP04206 | Nestin (NES) | 12.8 | ||||
| LDTP04111 | Small ribosomal subunit protein eS10 (RPS10) | 12.7 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 12.6 | ||||
| LDTP10403 | DDRGK domain-containing protein 1 (DDRGK1) | 12.5 | ||||
| LDTP11911 | Golgi phosphoprotein 3 (GOLPH3) | 12.5 | ||||
| LDTP09994 | BLOC-2 complex member HPS3 (HPS3) | 12.4 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 12.4 | ||||
| LDTP09719 | Progesterone-induced-blocking factor 1 (PIBF1) | 12.4 | ||||
| LDTP04952 | Heterogeneous nuclear ribonucleoprotein K (HNRNPK) | 12.3 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 12.3 | ||||
| LDTP02165 | Tropomyosin alpha-3 chain (TPM3) | 12.2 | ||||
| LDTP13626 | Ubiquilin-1 (UBQLN1) | 12.2 | ||||
| LDTP10857 | c-Myc-binding protein (MYCBP) | 12.1 | ||||
| LDTP13922 | Tudor and KH domain-containing protein (TDRKH) | 12.1 | ||||
