Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C420 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 66.7 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 59.7 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 50.9 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 47.5 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 46.5 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 45.6 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 43.7 | ||||
| LDTP03671 | Multidrug resistance-associated protein 1 (ABCC1) | 42.8 | ||||
| LDTP11081 | NAD-capped RNA hydrolase NUDT12 (NUDT12) | 36.3 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 36.3 | ||||
| LDTP01983 | NADH-ubiquinone oxidoreductase chain 2 (MT-ND2) | 34.8 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 34.3 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 34.1 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 33.1 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 31.1 | ||||
| LDTP02362 | Dihydrolipoyl dehydrogenase, mitochondrial (DLD) | 30.3 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 29.7 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 29.4 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 29.4 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 28.8 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 27.7 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 27.1 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 26.7 | ||||
| LDTP15962 | Protein-L-histidine N-pros-methyltransferase (METTL9) | 26.5 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 26.2 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 26.2 | ||||
| LDTP03680 | DNA replication licensing factor MCM4 (MCM4) | 25.3 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 23.1 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 21.9 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 21.7 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 21.7 | ||||
| LDTP13972 | Oligoribonuclease, mitochondrial (REXO2) | 21.6 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 20.4 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 20.1 | ||||
| LDTP06849 | Prolyl endopeptidase-like (PREPL) | 20.0 | ||||
| LDTP02074 | Aldehyde dehydrogenase, mitochondrial (ALDH2) | 19.8 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 19.8 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 19.7 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 19.2 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 19.0 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 18.9 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 18.3 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 18.3 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 18.3 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 17.8 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 17.6 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 17.5 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 17.5 | ||||
| LDTP10495 | Ubiquitin carboxyl-terminal hydrolase 47 (USP47) | 17.4 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 16.7 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 16.0 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 15.9 | ||||
| LDTP00497 | Cyclin-G-associated kinase (GAK) | 15.6 | ||||
| LDTP02640 | X-ray repair cross-complementing protein 6 (XRCC6) | 15.6 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 15.5 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 15.5 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 15.3 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 15.1 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 15.0 | ||||
| LDTP10888 | Legumain (LGMN) | 15.0 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 15.0 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 14.9 | ||||
| LDTP02713 | Macrophage migration inhibitory factor (MIF) | 14.9 | ||||
| LDTP00316 | Ribonuclease T2 (RNASET2) | 14.6 | ||||
| LDTP00246 | Eukaryotic translation initiation factor 3 subunit F (EIF3F) | 14.2 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 14.2 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 14.1 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 13.8 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 13.8 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 13.6 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 13.6 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 13.5 | ||||
| LDTP02260 | Beta-glucuronidase (GUSB) | 13.1 | ||||
| LDTP02216 | Beta-hexosaminidase subunit beta (HEXB) | 13.0 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 12.9 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 12.7 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 12.6 | ||||
| LDTP06023 | Calcium/calmodulin-dependent protein kinase type 1 (CAMK1) | 12.4 | ||||
| LDTP11225 | Deoxyhypusine hydroxylase (DOHH) | 12.4 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 12.3 | ||||
| LDTP03060 | Proteasome subunit beta type-1 (PSMB1) | 12.1 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 12.0 | ||||
| LDTP04438 | Succinate-semialdehyde dehydrogenase, mitochondrial (ALDH5A1) | 12.0 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 11.7 | ||||
| LDTP01759 | Histone-lysine N-methyltransferase NSD2 (NSD2) | 11.6 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 11.6 | ||||
| LDTP03607 | RAC-alpha serine/threonine-protein kinase (AKT1) | 11.6 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 11.5 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 11.4 | ||||
| LDTP00890 | S-adenosylhomocysteine hydrolase-like protein 1 (AHCYL1) | 11.2 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 11.1 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 10.9 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 10.9 | ||||
| LDTP11518 | Histone-lysine N-methyltransferase NSD3 (NSD3) | 10.9 | ||||
| LDTP07961 | Protein arginine methyltransferase NDUFAF7, mitochondrial (NDUFAF7) | 10.9 | ||||
| LDTP04925 | Pterin-4-alpha-carbinolamine dehydratase (PCBD1) | 10.9 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 10.6 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 10.6 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 10.6 | ||||
| LDTP07762 | Hydroxysteroid dehydrogenase-like protein 2 (HSDL2) | 10.3 | ||||
| LDTP05588 | RNA cytosine C(5)-methyltransferase NSUN2 (NSUN2) | 10.3 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 10.2 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 10.1 | ||||
| LDTP06049 | Septin-6 (SEPTIN6) | 10.1 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 10.1 | ||||
| LDTP12524 | L-aminoadipate-semialdehyde dehydrogenase-phosphopantetheinyl transferase (AASDHPPT) | 10.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 87.4 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 69.6 | ||||
| LDTP02215 | Prosaposin (PSAP) | 64.9 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 64.9 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 44.3 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 42.5 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 29.4 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 29.2 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 29.0 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 28.4 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 28.4 | ||||
| LDTP07462 | MFS-type transporter SLC18B1 (SLC18B1) | 27.1 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 25.3 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 24.4 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 23.1 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 22.8 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 22.2 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 20.5 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 20.4 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 18.9 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 18.8 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 18.6 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 18.4 | ||||
| LDTP04501 | Importin subunit alpha-1 (KPNA2) | 18.0 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 17.3 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 17.1 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 15.9 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 15.7 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 14.7 | ||||
| LDTP03839 | Nuclear pore glycoprotein p62 (NUP62) | 14.5 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 14.0 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 14.0 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 13.9 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 13.6 | ||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | 13.6 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 13.5 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 13.3 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 13.0 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 12.4 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 12.0 | ||||
| LDTP11824 | Sodium-coupled neutral amino acid symporter 1 (SLC38A1) | 11.2 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 11.1 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 11.0 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 10.5 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 10.3 | ||||
| LDTP08769 | Nuclear pore complex protein Nup93 (NUP93) | 10.2 | ||||
| LDTP04459 | H(+)/Cl(-) exchange transporter 3 (CLCN3) | 10.1 | ||||
| LDTP04940 | NPC intracellular cholesterol transporter 2 (NPC2) | 10.1 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 99.7 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 45.3 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 42.8 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 40.8 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 32.4 | ||||
| LDTP04951 | Nuclear transport factor 2 (NUTF2) | 31.8 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 25.1 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 24.6 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 24.4 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 23.8 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 22.6 | ||||
| LDTP15714 | Mdm2-binding protein (MTBP) | 21.6 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 21.4 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 21.3 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 20.5 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 19.8 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 19.7 | ||||
| LDTP08073 | Tetratricopeptide repeat protein 21B (TTC21B) | 19.7 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 19.0 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 18.8 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 18.5 | ||||
| LDTP02297 | Vimentin (VIM) | 18.0 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 16.8 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 16.7 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 16.6 | ||||
| LDTP08081 | Hepatoma-derived growth factor-related protein 2 (HDGFL2) | 16.3 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 15.9 | ||||
| LDTP11044 | Polyadenylate-binding protein-interacting protein 2 (PAIP2) | 15.2 | ||||
| LDTP01466 | HAUS augmin-like complex subunit 5 (HAUS5) | 15.1 | ||||
| LDTP04241 | Nuclear autoantigenic sperm protein (NASP) | 15.1 | ||||
| LDTP06887 | Nuclear cap-binding protein subunit 3 (NCBP3) | 14.9 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 14.9 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 14.8 | ||||
| LDTP05558 | Galectin-3-binding protein (LGALS3BP) | 14.7 | ||||
| LDTP08796 | Protein SYS1 homolog (SYS1) | 14.6 | ||||
| LDTP13630 | Neudesin (NENF) | 14.5 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 14.4 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 14.4 | ||||
| LDTP08760 | Cell cycle and apoptosis regulator protein 2 (CCAR2) | 14.3 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 14.1 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 14.0 | ||||
| LDTP00934 | C-Jun-amino-terminal kinase-interacting protein 4 (SPAG9) | 13.2 | ||||
| LDTP07031 | Collectin-12 (COLEC12) | 12.8 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 12.8 | ||||
| LDTP18135 | Protein phosphatase 1 regulatory subunit 14B (PPP1R14B) | 12.8 | ||||
| LDTP14263 | TAF6-like RNA polymerase II p300/CBP-associated factor-associated factor 65 kDa subunit 6L (TAF6L) | 12.6 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 12.4 | ||||
| LDTP18132 | Protein FAM136A (FAM136A) | 12.4 | ||||
| LDTP06684 | Sister chromatid cohesion protein PDS5 homolog A (PDS5A) | 12.4 | ||||
| LDTP01075 | Protein CutA (CUTA) | 12.3 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 12.2 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 11.9 | ||||
| LDTP08094 | Wings apart-like protein homolog (WAPL) | 11.9 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 11.3 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 11.2 | ||||
| LDTP12623 | Zinc finger CCHC domain-containing protein 3 (ZCCHC3) | 11.2 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 11.0 | ||||
| LDTP02205 | Tubulin beta chain (TUBB) | 10.8 | ||||
| LDTP08735 | Spartin (SPART) | 10.6 | ||||
| LDTP05076 | Tubulin beta-4B chain (TUBB4B) | 10.6 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 10.6 | ||||
| LDTP00756 | Heterogeneous nuclear ribonucleoprotein R (HNRNPR) | 10.6 | ||||
| LDTP05226 | RNA-binding protein 3 (RBM3) | 10.5 | ||||
| LDTP01362 | Survival of motor neuron-related-splicing factor 30 (SMNDC1) | 10.5 | ||||
| LDTP00991 | Heterogeneous nuclear ribonucleoprotein Q (SYNCRIP) | 10.4 | ||||
| LDTP06527 | Alpha-internexin (INA) | 10.3 | ||||
| LDTP04356 | Emerin (EMD) | 10.3 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 10.2 | ||||
| LDTP01932 | Prelamin-A/C (LMNA) | 10.1 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 10.1 | ||||
| LDTP03615 | Heterogeneous nuclear ribonucleoprotein H (HNRNPH1) | 10.1 | ||||
| LDTP01638 | YEATS domain-containing protein 4 (YEATS4) | 10.1 | ||||
| LDTP06952 | DBIRD complex subunit ZNF326 (ZNF326) | 10.0 | ||||
| LDTP05318 | RNA-binding protein EWS (EWSR1) | 10.0 | ||||
