Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C413 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 99.7 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 91.8 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 69.6 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 69.6 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 66.7 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 59.3 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 56.1 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 45.6 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 44.9 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 41.4 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 41.4 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 39.7 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 38.6 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 38.1 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 36.8 | ||||
| LDTP03671 | Multidrug resistance-associated protein 1 (ABCC1) | 36.3 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 35.3 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 34.1 | ||||
| LDTP02223 | Cathepsin B (CTSB) | 31.1 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 30.1 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 29.7 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 29.0 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 27.7 | ||||
| LDTP12586 | Phenylalanine--tRNA ligase beta subunit (FARSB) | 27.1 | ||||
| LDTP07966 | COP9 signalosome complex subunit 6 (COPS6) | 26.4 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 26.2 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 25.1 | ||||
| LDTP00544 | Sphingolipid delta(4)-desaturase DES1 (DEGS1) | 24.6 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 24.4 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 23.9 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 23.9 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 23.3 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 23.1 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 22.3 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 22.2 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 22.0 | ||||
| LDTP11199 | DCN1-like protein 5 (DCUN1D5) | 21.9 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 21.7 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 21.6 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 19.7 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 19.3 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 19.2 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 18.8 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 18.5 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 18.0 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 17.5 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 17.3 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 17.1 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 16.8 | ||||
| LDTP03680 | DNA replication licensing factor MCM4 (MCM4) | 16.7 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 15.9 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 15.5 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 15.5 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 15.5 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 15.2 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 15.1 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 14.8 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 14.8 | ||||
| LDTP12003 | Ribosomal oxygenase 1 (RIOX1) | 14.8 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 14.8 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 14.7 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 14.5 | ||||
| LDTP00316 | Ribonuclease T2 (RNASET2) | 14.5 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 14.3 | ||||
| LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 14.1 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 14.0 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 13.9 | ||||
| LDTP01743 | NADH dehydrogenase 1 beta subcomplex subunit 10 (NDUFB10) | 13.8 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 13.6 | ||||
| LDTP11225 | Deoxyhypusine hydroxylase (DOHH) | 13.5 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 13.3 | ||||
| LDTP03779 | Copper-transporting ATPase 2 (ATP7B) | 13.2 | ||||
| LDTP02539 | Lysosomal acid phosphatase (ACP2) | 13.2 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 12.9 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 12.9 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 12.8 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 12.7 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 12.6 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 12.6 | ||||
| LDTP01515 | NADH dehydrogenase 1 beta subcomplex subunit 8, mitochondrial (NDUFB8) | 12.5 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 12.4 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 12.4 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 12.3 | ||||
| LDTP13409 | Anaphase-promoting complex subunit 7 (ANAPC7) | 12.1 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 12.0 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 11.9 | ||||
| LDTP13056 | Leucine--tRNA ligase, cytoplasmic (LARS1) | 11.8 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 11.7 | ||||
| LDTP05724 | Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial (ECH1) | 11.6 | ||||
| LDTP01300 | Cartilage-associated protein (CRTAP) | 11.6 | ||||
| LDTP04333 | GMP synthase [glutamine-hydrolyzing] (GMPS) | 11.3 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 11.0 | ||||
| LDTP11081 | NAD-capped RNA hydrolase NUDT12 (NUDT12) | 11.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 93.7 | ||||
| LDTP03546 | Translocator protein (TSPO) | 83.3 | ||||
| LDTP02215 | Prosaposin (PSAP) | 73.5 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 65.3 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 55.7 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 55.7 | ||||
| LDTP01671 | STARD3 N-terminal-like protein (STARD3NL) | 55.7 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 49.5 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 49.5 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 47.5 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 46.5 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 45.9 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 44.9 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 44.3 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 42.2 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 38.9 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 33.1 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 32.2 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 31.3 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 30.5 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 29.7 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 29.2 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 25.1 | ||||
| LDTP07462 | MFS-type transporter SLC18B1 (SLC18B1) | 23.6 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 21.7 | ||||
| LDTP10036 | BOS complex subunit NCLN (NCLN) | 21.4 | ||||
| LDTP03327 | ATP synthase subunit alpha, mitochondrial (ATP5F1A) | 21.0 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 20.7 | ||||
| LDTP08016 | Proton-coupled amino acid transporter 1 (SLC36A1) | 20.5 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 19.8 | ||||
| LDTP09203 | Nucleoporin Nup37 (NUP37) | 18.9 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 18.8 | ||||
| LDTP14002 | Transmembrane emp24 domain-containing protein 3 (TMED3) | 17.8 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 17.5 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 17.3 | ||||
| LDTP01100 | Iron-sulfur clusters transporter ABCB7, mitochondrial (ABCB7) | 16.7 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 15.9 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 15.5 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 15.2 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 15.0 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 14.1 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 14.0 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 14.0 | ||||
| LDTP01601 | Activator of 90 kDa heat shock protein ATPase homolog 1 (AHSA1) | 13.7 | ||||
| LDTP00547 | Secretory carrier-associated membrane protein 2 (SCAMP2) | 13.7 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 13.7 | ||||
| LDTP04237 | Protein ERGIC-53 (LMAN1) | 13.5 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 13.3 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 12.7 | ||||
| LDTP04597 | Methylosome subunit pICln (CLNS1A) | 12.4 | ||||
| LDTP10343 | Vacuole membrane protein 1 (VMP1) | 12.3 | ||||
| LDTP01043 | Sorting nexin-2 (SNX2) | 12.2 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 12.0 | ||||
| LDTP11869 | Growth hormone-inducible transmembrane protein (GHITM) | 12.0 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 12.0 | ||||
| LDTP02061 | Anion exchange protein 2 (SLC4A2) | 11.9 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 11.8 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 11.6 | ||||
| LDTP13393 | Electrogenic aspartate/glutamate antiporter SLC25A13, mitochondrial (SLC25A13) | 11.2 | ||||
| LDTP15845 | Transmembrane 9 superfamily member 2 (TM9SF2) | 11.2 | ||||
| LDTP10317 | THO complex subunit 1 (THOC1) | 11.1 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03772 | Basigin (BSG) | 12.4 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11076 | Apolipoprotein L2 (APOL2) | 99.7 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 89.9 | ||||
| LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 59.3 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 49.9 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 48.5 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 44.0 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 37.3 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 36.3 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 34.3 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 34.3 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 30.7 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 29.0 | ||||
| LDTP13797 | HIG1 domain family member 1A, mitochondrial (HIGD1A) | 27.1 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 25.5 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 24.8 | ||||
| LDTP15253 | HEAT repeat-containing protein 3 (HEATR3) | 24.3 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 23.6 | ||||
| LDTP10255 | Protein Hook homolog 2 (HOOK2) | 23.1 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 23.1 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 21.1 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 20.8 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 20.5 | ||||
| LDTP14179 | Cytosolic Fe-S cluster assembly factor NUBP2 (NUBP2) | 20.3 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 20.1 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 19.7 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 19.3 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 19.2 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 18.8 | ||||
| LDTP05076 | Tubulin beta-4B chain (TUBB4B) | 18.8 | ||||
| LDTP02297 | Vimentin (VIM) | 18.5 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 18.4 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 17.8 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 17.8 | ||||
| LDTP02205 | Tubulin beta chain (TUBB) | 17.8 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 17.5 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 17.3 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 17.3 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 16.8 | ||||
| LDTP05277 | Protein SET (SET) | 16.6 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 16.6 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 16.3 | ||||
| LDTP11525 | Kinetochore protein Nuf2 (NUF2) | 16.0 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 15.2 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 14.3 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 14.2 | ||||
| LDTP05998 | Tubulin beta-2A chain (TUBB2A) | 14.2 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 14.1 | ||||
| LDTP12476 | Translation initiation factor eIF2B subunit gamma (EIF2B3) | 14.0 | ||||
| LDTP08760 | Cell cycle and apoptosis regulator protein 2 (CCAR2) | 13.8 | ||||
| LDTP11233 | Tubulin beta-6 chain (TUBB6) | 13.5 | ||||
| LDTP11277 | Tubulin beta-2B chain (TUBB2B) | 13.2 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 13.0 | ||||
| LDTP03926 | Centrin-2 (CETN2) | 12.7 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 12.7 | ||||
| LDTP01932 | Prelamin-A/C (LMNA) | 12.6 | ||||
| LDTP04207 | Heat shock 70 kDa protein 13 (HSPA13) | 12.5 | ||||
| LDTP13519 | Proteasome activator complex subunit 2 (PSME2) | 12.3 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 12.3 | ||||
| LDTP00223 | 26S proteasome non-ATPase regulatory subunit 11 (PSMD11) | 12.2 | ||||
| LDTP12623 | Zinc finger CCHC domain-containing protein 3 (ZCCHC3) | 12.2 | ||||
| LDTP14792 | Small ribosomal subunit protein uS9m (MRPS9) | 12.0 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 11.8 | ||||
| LDTP02037 | Tubulin beta-4A chain (TUBB4A) | 11.7 | ||||
| LDTP11197 | Mini-chromosome maintenance complex-binding protein (MCMBP) | 11.6 | ||||
| LDTP04514 | Heterogeneous nuclear ribonucleoprotein F (HNRNPF) | 11.3 | ||||
| LDTP05068 | Tropomyosin alpha-4 chain (TPM4) | 11.2 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 11.2 | ||||
| LDTP00887 | Calumenin (CALU) | 11.1 | ||||
| LDTP19924 | Protein PBDC1 (PBDC1) | 11.1 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 11.0 | ||||
