Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | FFF probe15 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:200uM; negative probe:200uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
SILAC
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 20.0 | ||||
| LDTP00968 | Acyl-CoA (8-3)-desaturase (FADS1) | 20.0 | ||||
| LDTP01699 | Acyl-CoA 6-desaturase (FADS2) | 20.0 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 20.0 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 20.0 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 20.0 | ||||
| LDTP05171 | Dermcidin (DCD) | 20.0 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 20.0 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 20.0 | ||||
| LDTP11259 | Dol-P-Man:Man(7)GlcNAc(2)-PP-Dol alpha-1,6-mannosyltransferase (ALG12) | 20.0 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 20.0 | ||||
| LDTP09200 | FAD synthase (FLAD1) | 20.0 | ||||
| LDTP02651 | Gamma-interferon-inducible lysosomal thiol reductase (IFI30) | 20.0 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 20.0 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 20.0 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 20.0 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 20.0 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 20.0 | ||||
| LDTP06638 | Phosphoenolpyruvate carboxykinase [GTP], mitochondrial (PCK2) | 20.0 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 20.0 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 20.0 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 20.0 | ||||
| LDTP00877 | Protein SCO2 homolog, mitochondrial (SCO2) | 20.0 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 20.0 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 20.0 | ||||
| LDTP00544 | Sphingolipid delta(4)-desaturase DES1 (DEGS1) | 20.0 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 20.0 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 20.0 | ||||
| LDTP00344 | Stearoyl-CoA desaturase (SCD) | 20.0 | ||||
| LDTP04251 | Elongation factor Tu, mitochondrial (TUFM) | 19.1 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 18.8 | ||||
| LDTP02198 | Cathepsin D (CTSD) | 17.6 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 16.7 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 16.6 | ||||
| LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 16.6 | ||||
| LDTP02602 | Histidine--tRNA ligase, cytoplasmic (HARS1) | 16.6 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 16.2 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 15.7 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 15.5 | ||||
| LDTP12048 | Complex I assembly factor ACAD9, mitochondrial (ACAD9) | 14.7 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 14.2 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 14.2 | ||||
| LDTP02141 | Alpha-galactosidase A (GLA) | 14.1 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 13.8 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 13.5 | ||||
| LDTP07154 | ATPase family AAA domain-containing protein 3B (ATAD3B) | 13.3 | ||||
| LDTP03680 | DNA replication licensing factor MCM4 (MCM4) | 13.3 | ||||
| LDTP05724 | Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial (ECH1) | 12.8 | ||||
| LDTP10101 | Peptidyl-prolyl cis-trans isomerase FKBP10 (FKBP10) | 12.7 | ||||
| LDTP02565 | Medium-chain specific acyl-CoA dehydrogenase, mitochondrial (ACADM) | 12.4 | ||||
| LDTP03433 | NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial (NDUFS1) | 12.4 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 12.2 | ||||
| LDTP00950 | Dynamin-like 120 kDa protein, mitochondrial (OPA1) | 12.1 | ||||
| LDTP05301 | Hydroxymethylglutaryl-CoA synthase, cytoplasmic (HMGCS1) | 12.1 | ||||
| LDTP02231 | Tyrosine-protein kinase Yes (YES1) | 12.1 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 12.0 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 11.5 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 11.4 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 10.9 | ||||
| LDTP08799 | Lysophosphatidylserine lipase ABHD12 (ABHD12) | 10.8 | ||||
| LDTP11081 | NAD-capped RNA hydrolase NUDT12 (NUDT12) | 10.8 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 10.6 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 10.5 | ||||
| LDTP06901 | Very-long-chain 3-oxoacyl-CoA reductase (HSD17B12) | 10.1 | ||||
| LDTP11874 | Thioredoxin-related transmembrane protein 1 (TMX1) | 9.9 | ||||
| LDTP12233 | Helicase MOV-10 (MOV10) | 9.8 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 9.7 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 9.6 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 9.4 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 9.2 | ||||
| LDTP06905 | Acylglycerol kinase, mitochondrial (AGK) | 9.0 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 9.0 | ||||
| LDTP12681 | ATPase family AAA domain-containing protein 3A (ATAD3A) | 8.9 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 8.8 | ||||
| LDTP09251 | Atlastin-2 (ATL2) | 8.7 | ||||
| LDTP02223 | Cathepsin B (CTSB) | 8.7 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 8.7 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 8.5 | ||||
| LDTP04572 | Dipeptidyl peptidase 1 (CTSC) | 8.5 | ||||
| LDTP06720 | Peroxisomal leader peptide-processing protease (TYSND1) | 8.3 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 8.0 | ||||
| LDTP01768 | Glutamate dehydrogenase 1, mitochondrial (GLUD1) | 7.9 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 7.8 | ||||
| LDTP14213 | Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase (ALG6) | 7.6 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 7.5 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 7.5 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 7.4 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 7.3 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 7.2 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 7.2 | ||||
| LDTP11437 | Peroxisomal trans-2-enoyl-CoA reductase (PECR) | 6.8 | ||||
| LDTP03139 | Succinate dehydrogenase iron-sulfur subunit, mitochondrial (SDHB) | 6.8 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 6.8 | ||||
| LDTP04284 | Proteasome subunit beta type-3 (PSMB3) | 6.6 | ||||
| LDTP03060 | Proteasome subunit beta type-1 (PSMB1) | 6.6 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 6.5 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 6.5 | ||||
| LDTP06104 | Peptidyl-prolyl cis-trans isomerase FKBP8 (FKBP8) | 6.4 | ||||
| LDTP09388 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B (STT3B) | 6.4 | ||||
| LDTP04471 | Ribosomal protein S6 kinase alpha-3 (RPS6KA3) | 6.4 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 6.3 | ||||
| LDTP11209 | Phosphatidylinositol 4-kinase type 2-alpha (PI4K2A) | 6.1 | ||||
| LDTP03753 | Cystathionine beta-synthase (CBS) | 6.0 | ||||
| LDTP10888 | Legumain (LGMN) | 5.9 | ||||
| LDTP00597 | Serine palmitoyltransferase 1 (SPTLC1) | 5.9 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 5.9 | ||||
| LDTP02743 | Insulin-degrading enzyme (IDE) | 5.8 | ||||
| LDTP07504 | Lysophospholipid acyltransferase 5 (LPCAT3) | 5.8 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 5.7 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 5.7 | ||||
| LDTP04327 | Cytosolic purine 5'-nucleotidase (NT5C2) | 5.7 | ||||
| LDTP09962 | Ubiquitin carboxyl-terminal hydrolase 7 (USP7) | 5.7 | ||||
| LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 5.6 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 5.6 | ||||
| LDTP03689 | Serine hydroxymethyltransferase, mitochondrial (SHMT2) | 5.5 | ||||
| LDTP07362 | Atlastin-3 (ATL3) | 5.5 | ||||
| LDTP03525 | Cell division cycle protein 27 homolog (CDC27) | 5.5 | ||||
| LDTP08596 | Mitochondrial Rho GTPase 2 (RHOT2) | 5.5 | ||||
| LDTP13744 | Dynamin-3 (DNM3) | 5.5 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 5.5 | ||||
| LDTP09886 | Gamma-glutamyl hydrolase (GGH) | 5.4 | ||||
| LDTP10862 | Proteasome subunit beta type-7 (PSMB7) | 5.4 | ||||
| LDTP04962 | 26S proteasome regulatory subunit 4 (PSMC1) | 5.4 | ||||
| LDTP00032 | 2-hydroxyacyl-CoA lyase 2 (ILVBL) | 5.4 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 5.4 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 5.3 | ||||
| LDTP02216 | Beta-hexosaminidase subunit beta (HEXB) | 5.3 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 5.3 | ||||
| LDTP10318 | Ubiquitin thioesterase OTUB1 (OTUB1) | 5.2 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 5.2 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 5.2 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 5.1 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 5.1 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 5.1 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11245 | Derlin-1 (DERL1) | 20.0 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 20.0 | ||||
| LDTP10513 | Exocyst complex component 2 (EXOC2) | 20.0 | ||||
| LDTP01366 | Flotillin-1 (FLOT1) | 20.0 | ||||
| LDTP05080 | Hemoglobin subunit beta (HBB) | 20.0 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 20.0 | ||||
| LDTP07472 | Mitochondrial adenyl nucleotide antiporter SLC25A24 (SLC25A24) | 20.0 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 20.0 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 20.0 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 20.0 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 20.0 | ||||
| LDTP02215 | Prosaposin (PSAP) | 20.0 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 20.0 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 20.0 | ||||
| LDTP14084 | Sorting and assembly machinery component 50 homolog (SAMM50) | 20.0 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 20.0 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 20.0 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 19.4 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 18.3 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 18.2 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 17.7 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 17.4 | ||||
| LDTP11844 | Protein spinster homolog 1 (SPNS1) | 17.0 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 16.6 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 15.9 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 15.7 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 15.0 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 14.3 | ||||
| LDTP01301 | Electrogenic aspartate/glutamate antiporter SLC25A12, mitochondrial (SLC25A12) | 14.2 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 14.2 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 13.2 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 12.9 | ||||
| LDTP03104 | V-type proton ATPase subunit B, brain isoform (ATP6V1B2) | 12.9 | ||||
| LDTP04553 | Tricarboxylate transport protein, mitochondrial (SLC25A1) | 12.2 | ||||
| LDTP04501 | Importin subunit alpha-1 (KPNA2) | 12.1 | ||||
| LDTP13393 | Electrogenic aspartate/glutamate antiporter SLC25A13, mitochondrial (SLC25A13) | 11.8 | ||||
| LDTP00310 | Syntenin-1 (SDCBP) | 11.6 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 11.5 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 11.2 | ||||
| LDTP00434 | Transportin-2 (TNPO2) | 10.7 | ||||
| LDTP10036 | BOS complex subunit NCLN (NCLN) | 9.7 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 9.5 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 9.1 | ||||
| LDTP12042 | Proton-activated chloride channel (PACC1) | 8.8 | ||||
| LDTP04707 | Protein SEC13 homolog (SEC13) | 8.7 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 7.8 | ||||
| LDTP11531 | Oxysterol-binding protein-related protein 8 (OSBPL8) | 7.8 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 7.7 | ||||
| LDTP04932 | Protein transport protein Sec61 subunit alpha isoform 1 (SEC61A1) | 7.6 | ||||
| LDTP02655 | Lysosome-associated membrane glycoprotein 2 (LAMP2) | 7.5 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 6.6 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 6.5 | ||||
| LDTP08960 | ER membrane protein complex subunit 1 (EMC1) | 6.5 | ||||
| LDTP06660 | MICOS complex subunit MIC60 (IMMT) | 6.4 | ||||
| LDTP13243 | Translocation protein SEC63 homolog (SEC63) | 6.4 | ||||
| LDTP01601 | Activator of 90 kDa heat shock protein ATPase homolog 1 (AHSA1) | 6.3 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 6.3 | ||||
| LDTP05690 | Vesicular integral-membrane protein VIP36 (LMAN2) | 6.2 | ||||
| LDTP03810 | ATP synthase subunit gamma, mitochondrial (ATP5F1C) | 5.8 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 5.8 | ||||
| LDTP11934 | EH domain-containing protein 1 (EHD1) | 5.7 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 5.4 | ||||
| LDTP10663 | Importin-9 (IPO9) | 5.3 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 5.1 | ||||
| LDTP03405 | Calnexin (CANX) | 5.1 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 5.1 | ||||
| LDTP12090 | Sideroflexin-1 (SFXN1) | 5.0 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00286 | Homeobox protein Meis1 (MEIS1) | 18.2 | ||||
| LDTP00425 | Homeobox protein Meis2 (MEIS2) | 12.8 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP02491 | HLA class I histocompatibility antigen, C alpha chain (HLA-C) | 13.9 | ||||
| LDTP03772 | Basigin (BSG) | 5.6 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04904 | Alpha-centractin (ACTR1A) | 20.0 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 20.0 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 20.0 | ||||
| LDTP05567 | Desmocollin-1 (DSC1) | 20.0 | ||||
| LDTP05353 | Desmoglein-1 (DSG1) | 20.0 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 20.0 | ||||
| LDTP15253 | HEAT repeat-containing protein 3 (HEATR3) | 20.0 | ||||
| LDTP08425 | Hornerin (HRNR) | 20.0 | ||||
| LDTP07136 | Keratinocyte proline-rich protein (KPRP) | 20.0 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 20.0 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 20.0 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 20.0 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 20.0 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 20.0 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 20.0 | ||||
| LDTP07476 | RAD50-interacting protein 1 (RINT1) | 20.0 | ||||
| LDTP06352 | Reticulocalbin-1 (RCN1) | 20.0 | ||||
| LDTP03493 | Serpin B3 (SERPINB3) | 20.0 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 20.0 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 15.0 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 14.9 | ||||
| LDTP00887 | Calumenin (CALU) | 14.8 | ||||
| LDTP13630 | Neudesin (NENF) | 14.1 | ||||
| LDTP00512 | Protein transport protein Sec16A (SEC16A) | 13.6 | ||||
| LDTP14792 | Small ribosomal subunit protein uS9m (MRPS9) | 13.4 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 13.2 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 13.1 | ||||
| LDTP10185 | FAS-associated factor 2 (FAF2) | 12.3 | ||||
| LDTP13044 | Ribosome-binding protein 1 (RRBP1) | 12.3 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 12.2 | ||||
| LDTP09545 | Nucleolar complex protein 3 homolog (NOC3L) | 11.8 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 11.0 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 10.8 | ||||
| LDTP05491 | Amyloid beta precursor like protein 2 (APLP2) | 10.7 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 9.9 | ||||
| LDTP05012 | Small ribosomal subunit protein eS24 (RPS24) | 9.1 | ||||
| LDTP13338 | Vacuolar protein sorting-associated protein 51 homolog (VPS51) | 8.3 | ||||
| LDTP14217 | Lipid droplet-regulating VLDL assembly factor AUP1 (AUP1) | 7.8 | ||||
| LDTP13430 | Protein TASOR (TASOR) | 7.8 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 7.6 | ||||
| LDTP06305 | WD repeat-containing protein 43 (WDR43) | 7.5 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 7.4 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 7.3 | ||||
| LDTP02297 | Vimentin (VIM) | 6.6 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 6.5 | ||||
| LDTP09787 | Nicastrin (NCSTN) | 6.3 | ||||
| LDTP13402 | Dynactin subunit 4 (DCTN4) | 6.1 | ||||
| LDTP03352 | Splicing factor U2AF 65 kDa subunit (U2AF2) | 6.0 | ||||
| LDTP07598 | BRCA1-associated ATM activator 1 (BRAT1) | 5.9 | ||||
| LDTP02756 | Junction plakoglobin (JUP) | 5.9 | ||||
| LDTP05922 | Dynactin subunit 2 (DCTN2) | 5.7 | ||||
| LDTP17065 | Heterogeneous nuclear ribonucleoprotein U-like protein 2 (HNRNPUL2) | 5.5 | ||||
| LDTP01432 | Mitochondrial import receptor subunit TOM70 (TOMM70) | 5.3 | ||||
| LDTP04290 | YLP motif-containing protein 1 (YLPM1) | 5.3 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 5.3 | ||||
| LDTP04382 | Kinetochore-associated protein 1 (KNTC1) | 5.1 | ||||
