Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C380 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 33.6 | ||||
| LDTP10699 | E3 ubiquitin-protein ligase NEDD4-like (NEDD4L) | 30.3 | ||||
| LDTP03680 | DNA replication licensing factor MCM4 (MCM4) | 23.1 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 22.6 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 20.8 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 20.3 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 19.4 | ||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 17.9 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 17.5 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 17.0 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 16.7 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 15.3 | ||||
| LDTP12679 | Trimethyllysine dioxygenase, mitochondrial (TMLHE) | 15.2 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 13.5 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 12.8 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 11.3 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 11.2 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 11.0 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 10.5 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 10.4 | ||||
| LDTP01300 | Cartilage-associated protein (CRTAP) | 9.7 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 9.7 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 9.7 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 9.6 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 9.6 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 9.1 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 8.8 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 8.7 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 8.7 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 8.6 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 8.4 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 8.3 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 8.2 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 8.1 | ||||
| LDTP06427 | Translin (TSN) | 8.1 | ||||
| LDTP00575 | Glutathione S-transferase A4 (GSTA4) | 8.0 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 7.8 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 7.7 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 7.6 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 7.5 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 7.4 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 7.3 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 7.3 | ||||
| LDTP05493 | Sulfotransferase 2A1 (SULT2A1) | 7.1 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 7.0 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 7.0 | ||||
| LDTP06849 | Prolyl endopeptidase-like (PREPL) | 6.9 | ||||
| LDTP09395 | Signal peptide peptidase-like 2A (SPPL2A) | 6.8 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 6.7 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 6.6 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 6.5 | ||||
| LDTP02505 | Lysosomal protective protein (CTSA) | 6.5 | ||||
| LDTP05396 | Histone-lysine N-methyltransferase 2A (KMT2A) | 6.5 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 6.4 | ||||
| LDTP11437 | Peroxisomal trans-2-enoyl-CoA reductase (PECR) | 6.4 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 6.3 | ||||
| LDTP00589 | Peroxisomal acyl-coenzyme A oxidase 3 (ACOX3) | 6.2 | ||||
| LDTP06511 | Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial (ETFDH) | 6.2 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 6.2 | ||||
| LDTP01018 | High affinity cAMP-specific and IBMX-insensitive 3',5'-cyclic phosphodiesterase 8A (PDE8A) | 6.1 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 6.1 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 6.1 | ||||
| LDTP07831 | Transmembrane protein with metallophosphoesterase domain (TMPPE) | 6.1 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 6.1 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 6.1 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 6.0 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 5.9 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 5.9 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 5.9 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 5.8 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 5.7 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 5.7 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 5.7 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 5.7 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 5.7 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 5.7 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 5.7 | ||||
| LDTP13154 | E3 ubiquitin-protein ligase RNF14 (RNF14) | 5.7 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 5.6 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 5.5 | ||||
| LDTP09043 | Lysine-specific histone demethylase 2 (KDM1B) | 5.5 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 5.5 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 5.5 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 5.4 | ||||
| LDTP02896 | Sphingomyelin phosphodiesterase (SMPD1) | 5.4 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 5.4 | ||||
| LDTP00186 | Alkyldihydroxyacetonephosphate synthase, peroxisomal (AGPS) | 5.3 | ||||
| LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 5.3 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 5.3 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 5.3 | ||||
| LDTP16025 | Ketosamine-3-kinase (FN3KRP) | 5.1 | ||||
| LDTP07989 | Ribonucleoside-diphosphate reductase subunit M2 B (RRM2B) | 5.1 | ||||
| LDTP07417 | Serine/threonine-protein phosphatase 4 regulatory subunit 3A (PPP4R3A) | 5.1 | ||||
| LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 5.1 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 27.9 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 26.0 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 22.3 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 19.3 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 17.4 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 16.4 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 16.1 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 15.0 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 14.7 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 14.4 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 13.6 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 11.8 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 11.2 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 9.9 | ||||
| LDTP04463 | H(+)/Cl(-) exchange transporter 7 (CLCN7) | 9.8 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 9.7 | ||||
| LDTP03546 | Translocator protein (TSPO) | 9.3 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 9.2 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 8.6 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 7.9 | ||||
| LDTP07462 | MFS-type transporter SLC18B1 (SLC18B1) | 7.8 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 7.7 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 7.5 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 7.5 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 7.4 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 7.4 | ||||
| LDTP01217 | Metaxin-2 (MTX2) | 7.3 | ||||
| LDTP02215 | Prosaposin (PSAP) | 7.1 | ||||
| LDTP04293 | Transmembrane emp24 domain-containing protein 10 (TMED10) | 7.1 | ||||
| LDTP11812 | Protein ARV1 (ARV1) | 6.9 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 6.8 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 6.7 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 6.5 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 6.3 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 6.2 | ||||
| LDTP00970 | Gasdermin-E (GSDME) | 6.1 | ||||
| LDTP07531 | Sideroflexin-4 (SFXN4) | 6.1 | ||||
| LDTP06221 | StAR-related lipid transfer protein 3 (STARD3) | 6.1 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 6.1 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 5.9 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 5.8 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 5.8 | ||||
| LDTP11826 | Sodium-dependent neutral amino acid transporter B(0)AT2 (SLC6A15) | 5.8 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 5.7 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 5.4 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 5.2 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 5.1 | ||||
| LDTP13969 | Transmembrane emp24 domain-containing protein 7 (TMED7) | 5.1 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 5.0 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16717 | Forkhead-associated domain-containing protein 1 (FHAD1) | 31.3 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP16099 | p53 and DNA damage-regulated protein 1 (PDRG1) | 39.9 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 27.5 | ||||
| LDTP03729 | General transcription factor IIF subunit 1 (GTF2F1) | 25.3 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 19.0 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 17.4 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 14.4 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 12.6 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 12.1 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 11.7 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 11.6 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 11.1 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 10.5 | ||||
| LDTP07839 | Capping protein-inhibiting regulator of actin dynamics (CRACD) | 8.7 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 8.5 | ||||
| LDTP01075 | Protein CutA (CUTA) | 8.3 | ||||
| LDTP13402 | Dynactin subunit 4 (DCTN4) | 7.8 | ||||
| LDTP06373 | Mitochondrial import receptor subunit TOM20 homolog (TOMM20) | 7.6 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 7.4 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 7.4 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 7.4 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 7.0 | ||||
| LDTP08793 | Armadillo repeat-containing protein 10 (ARMC10) | 6.9 | ||||
| LDTP08130 | Rab9 effector protein with kelch motifs (RABEPK) | 6.8 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 6.5 | ||||
| LDTP17715 | S1 RNA-binding domain-containing protein 1 (SRBD1) | 6.5 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 6.5 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 6.1 | ||||
| LDTP08154 | Large ribosomal subunit protein uL10m (MRPL10) | 6.0 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 5.9 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 5.9 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 5.9 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 5.9 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 5.9 | ||||
| LDTP15834 | Integrator complex subunit 14 (INTS14) | 5.8 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 5.8 | ||||
| LDTP04714 | Heterogeneous nuclear ribonucleoprotein H2 (HNRNPH2) | 5.7 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 5.7 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 5.7 | ||||
| LDTP06022 | Cold-inducible RNA-binding protein (CIRBP) | 5.5 | ||||
| LDTP18272 | Transmembrane protein 209 (TMEM209) | 5.5 | ||||
| LDTP01358 | Pre-mRNA-splicing factor SPF27 (BCAS2) | 5.5 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 5.5 | ||||
| LDTP09069 | Kinetochore protein Spc24 (SPC24) | 5.4 | ||||
| LDTP12418 | Mitochondrial dynamics protein MIEF1 (MIEF1) | 5.3 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 5.3 | ||||
| LDTP14058 | Rap guanine nucleotide exchange factor 2 (RAPGEF2) | 5.2 | ||||
| LDTP09644 | m-AAA protease-interacting protein 1, mitochondrial (MAIP1) | 5.2 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 5.2 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 5.2 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 5.1 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 5.1 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 5.1 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 5.0 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 5.0 | ||||
| LDTP06684 | Sister chromatid cohesion protein PDS5 homolog A (PDS5A) | 5.0 | ||||
| LDTP14263 | TAF6-like RNA polymerase II p300/CBP-associated factor-associated factor 65 kDa subunit 6L (TAF6L) | 5.0 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 5.0 | ||||
