Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C354 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 72.0 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 56.9 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 37.3 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 35.8 | ||||
| LDTP03189 | Cytochrome b-c1 complex subunit 2, mitochondrial (UQCRC2) | 28.2 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 25.1 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 25.1 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 24.9 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 23.9 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 22.6 | ||||
| LDTP01743 | NADH dehydrogenase 1 beta subcomplex subunit 10 (NDUFB10) | 21.1 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 20.4 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 18.3 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 17.5 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 16.6 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 16.4 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 16.3 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 16.2 | ||||
| LDTP03417 | Proteasome subunit beta type-4 (PSMB4) | 15.3 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 15.1 | ||||
| LDTP03223 | Small ribosomal subunit protein uS3 (RPS3) | 14.8 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 13.9 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 13.9 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 13.9 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 13.5 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 12.9 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 12.6 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 12.4 | ||||
| LDTP01419 | Retinal dehydrogenase 2 (ALDH1A2) | 12.0 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 11.7 | ||||
| LDTP04925 | Pterin-4-alpha-carbinolamine dehydratase (PCBD1) | 11.6 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 11.6 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 11.6 | ||||
| LDTP03560 | Aldehyde dehydrogenase X, mitochondrial (ALDH1B1) | 11.5 | ||||
| LDTP03001 | E3 ubiquitin-protein ligase TRIM21 (TRIM21) | 11.5 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 11.2 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 10.9 | ||||
| LDTP09799 | DCN1-like protein 4 (DCUN1D4) | 10.7 | ||||
| LDTP08979 | Prostaglandin reductase 2 (PTGR2) | 10.2 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 10.1 | ||||
| LDTP11321 | Acetyl-CoA acetyltransferase, cytosolic (ACAT2) | 10.0 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 9.8 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 9.8 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 9.4 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 9.4 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 9.4 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 9.3 | ||||
| LDTP05029 | Peptidyl-prolyl cis-trans isomerase FKBP1A (FKBP1A) | 9.3 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 8.9 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 8.6 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 8.6 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 8.6 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 8.5 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 8.4 | ||||
| LDTP03608 | RAC-beta serine/threonine-protein kinase (AKT2) | 8.3 | ||||
| LDTP10249 | Metalloendopeptidase OMA1, mitochondrial (OMA1) | 8.3 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 8.3 | ||||
| LDTP10862 | Proteasome subunit beta type-7 (PSMB7) | 8.3 | ||||
| LDTP00907 | Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta (PDE6D) | 8.3 | ||||
| LDTP01168 | NADH dehydrogenase iron-sulfur protein 2, mitochondrial (NDUFS2) | 8.2 | ||||
| LDTP06315 | Platelet-activating factor acetylhydrolase IB subunit alpha1 (PAFAH1B3) | 8.2 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 8.2 | ||||
| LDTP06849 | Prolyl endopeptidase-like (PREPL) | 8.1 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 8.0 | ||||
| LDTP19838 | Immunity-related GTPase family Q protein (IRGQ) | 8.0 | ||||
| LDTP12959 | NADH dehydrogenase 1 alpha subcomplex subunit 13 (NDUFA13) | 7.9 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 7.7 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 7.5 | ||||
| LDTP02169 | Beta-hexosaminidase subunit alpha (HEXA) | 7.4 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 7.4 | ||||
| LDTP03697 | Mannose-6-phosphate isomerase (MPI) | 7.2 | ||||
| LDTP06023 | Calcium/calmodulin-dependent protein kinase type 1 (CAMK1) | 7.2 | ||||
| LDTP19851 | Isochorismatase domain-containing protein 1 (ISOC1) | 7.2 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 7.1 | ||||
| LDTP05918 | Histone deacetylase 1 (HDAC1) | 7.1 | ||||
| LDTP01300 | Cartilage-associated protein (CRTAP) | 7.0 | ||||
| LDTP02799 | N-acetylglucosamine-6-sulfatase (GNS) | 7.0 | ||||
| LDTP11437 | Peroxisomal trans-2-enoyl-CoA reductase (PECR) | 7.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 58.1 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 52.7 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 44.6 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 22.8 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 21.7 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 18.6 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 18.5 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 18.3 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 17.5 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 15.8 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 15.7 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 14.8 | ||||
| LDTP12207 | Putative divalent cation/proton antiporter TMEM165 (TMEM165) | 14.0 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 13.8 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 13.3 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 13.1 | ||||
| LDTP01217 | Metaxin-2 (MTX2) | 12.0 | ||||
| LDTP07462 | MFS-type transporter SLC18B1 (SLC18B1) | 12.0 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 11.8 | ||||
| LDTP03546 | Translocator protein (TSPO) | 11.8 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 11.1 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 10.4 | ||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 10.3 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 10.1 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 10.1 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 10.1 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 9.8 | ||||
| LDTP10731 | Sodium-coupled neutral amino acid symporter 2 (SLC38A2) | 9.3 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 8.8 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 8.6 | ||||
| LDTP12383 | Protein GPR108 (GPR108) | 8.5 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 8.3 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 7.9 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 7.6 | ||||
| LDTP01366 | Flotillin-1 (FLOT1) | 7.6 | ||||
| LDTP18459 | StAR-related lipid transfer protein 7, mitochondrial (STARD7) | 7.4 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 7.2 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 7.1 | ||||
| LDTP09987 | Secretory carrier-associated membrane protein 4 (SCAMP4) | 7.0 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 7.0 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05065 | Y-box-binding protein 1 (YBX1) | 7.7 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP04720 | IgG receptor FcRn large subunit p51 (FCGRT) | 12.6 | ||||
| LDTP03772 | Basigin (BSG) | 8.4 | ||||
| LDTP02040 | HLA class I histocompatibility antigen, A alpha chain (HLA-A) | 7.9 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15269 | Large ribosomal subunit protein mL55 (MRPL55) | 99.7 | ||||
| LDTP02345 | Retinol-binding protein 1 (RBP1) | 99.7 | ||||
| LDTP13630 | Neudesin (NENF) | 57.3 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 29.9 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 28.4 | ||||
| LDTP19372 | Tetratricopeptide repeat protein 38 (TTC38) | 26.2 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 25.6 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 24.1 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 23.1 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 21.3 | ||||
| LDTP00871 | Microtubule nucleation factor SSNA1 (SSNA1) | 19.7 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 18.5 | ||||
| LDTP06390 | Protein transport protein Sec23A (SEC23A) | 16.3 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 15.6 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 15.2 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 14.3 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 13.5 | ||||
| LDTP16193 | Craniofacial development protein 1 (CFDP1) | 12.2 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 12.0 | ||||
| LDTP13125 | Protein UXT (UXT) | 10.7 | ||||
| LDTP00986 | Syntaxin-10 (STX10) | 10.5 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 10.3 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 10.3 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 10.2 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 10.2 | ||||
| LDTP05277 | Protein SET (SET) | 10.2 | ||||
| LDTP02351 | Tropomyosin alpha-1 chain (TPM1) | 10.2 | ||||
| LDTP12395 | Large ribosomal subunit protein mL40 (MRPL40) | 9.7 | ||||
| LDTP15714 | Mdm2-binding protein (MTBP) | 9.7 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 9.4 | ||||
| LDTP05226 | RNA-binding protein 3 (RBM3) | 9.4 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 9.3 | ||||
| LDTP09410 | Protein bicaudal D homolog 2 (BICD2) | 9.3 | ||||
| LDTP07031 | Collectin-12 (COLEC12) | 9.2 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 9.1 | ||||
| LDTP00573 | Prefoldin subunit 6 (PFDN6) | 9.1 | ||||
| LDTP00632 | Syntaxin-7 (STX7) | 9.1 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 9.0 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 8.9 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 8.9 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 8.9 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 8.8 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 8.8 | ||||
| LDTP11764 | Nuclear ubiquitous casein and cyclin-dependent kinase substrate 1 (NUCKS1) | 8.6 | ||||
| LDTP04111 | Small ribosomal subunit protein eS10 (RPS10) | 8.6 | ||||
| LDTP00887 | Calumenin (CALU) | 8.5 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 8.4 | ||||
| LDTP09069 | Kinetochore protein Spc24 (SPC24) | 8.3 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 8.3 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 8.1 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 8.1 | ||||
| LDTP02297 | Vimentin (VIM) | 8.1 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 7.9 | ||||
| LDTP09920 | Golgi apparatus protein 1 (GLG1) | 7.9 | ||||
| LDTP06022 | Cold-inducible RNA-binding protein (CIRBP) | 7.7 | ||||
| LDTP11044 | Polyadenylate-binding protein-interacting protein 2 (PAIP2) | 7.7 | ||||
| LDTP02869 | Stathmin (STMN1) | 7.6 | ||||
| LDTP04595 | Activated RNA polymerase II transcriptional coactivator p15 (SUB1) | 7.6 | ||||
| LDTP13311 | Poly(U)-binding-splicing factor PUF60 (PUF60) | 7.6 | ||||
| LDTP13519 | Proteasome activator complex subunit 2 (PSME2) | 7.5 | ||||
| LDTP01167 | Reticulon-2 (RTN2) | 7.5 | ||||
| LDTP06527 | Alpha-internexin (INA) | 7.5 | ||||
| LDTP09850 | Proline-rich protein PRCC (PRCC) | 7.4 | ||||
| LDTP12642 | CYFIP-related Rac1 interactor B (CYRIB) | 7.3 | ||||
| LDTP00913 | Mitochondrial import inner membrane translocase subunit Tim8 A (TIMM8A) | 7.3 | ||||
| LDTP01075 | Protein CutA (CUTA) | 7.2 | ||||
| LDTP04241 | Nuclear autoantigenic sperm protein (NASP) | 7.2 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 7.1 | ||||
| LDTP13309 | Prefoldin subunit 2 (PFDN2) | 7.0 | ||||
| LDTP02165 | Tropomyosin alpha-3 chain (TPM3) | 7.0 | ||||
