Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C270 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01300 | Cartilage-associated protein (CRTAP) | 37.5 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 35.8 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 29.0 | ||||
| LDTP01333 | Isocitrate dehydrogenase [NADP] cytoplasmic (IDH1) | 28.6 | ||||
| LDTP12415 | Adenosine 5'-monophosphoramidase HINT3 (HINT3) | 28.4 | ||||
| LDTP09666 | Reticulon-4-interacting protein 1, mitochondrial (RTN4IP1) | 20.8 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 20.4 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 19.8 | ||||
| LDTP04211 | Isocitrate dehydrogenase [NADP], mitochondrial (IDH2) | 17.5 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 17.3 | ||||
| LDTP03484 | Lysine-specific demethylase 5A (KDM5A) | 16.8 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 16.7 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 16.1 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 15.5 | ||||
| LDTP02569 | Glucose-6-phosphate 1-dehydrogenase (G6PD) | 14.7 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 14.0 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 13.9 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 13.7 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 12.4 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 12.4 | ||||
| LDTP10785 | Ubiquitin carboxyl-terminal hydrolase 28 (USP28) | 11.6 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 11.5 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 11.4 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 11.2 | ||||
| LDTP11016 | Dual specificity protein phosphatase 9 (DUSP9) | 11.2 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 11.2 | ||||
| LDTP10981 | Mitochondrial intermediate peptidase (MIPEP) | 11.2 | ||||
| LDTP12873 | CDGSH iron-sulfur domain-containing protein 1 (CISD1) | 11.0 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 10.9 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 10.8 | ||||
| LDTP04884 | Proteasome subunit alpha type-6 (PSMA6) | 10.6 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 10.5 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 10.4 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 10.3 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 9.8 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 9.6 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 9.5 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 9.3 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 9.1 | ||||
| LDTP07525 | Protein arginine N-methyltransferase 9 (PRMT9) | 9.1 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 8.9 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 8.9 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 8.9 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 8.9 | ||||
| LDTP06645 | Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial (HADH) | 8.8 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 8.7 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 8.5 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 8.3 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 8.3 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 8.2 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 8.1 | ||||
| LDTP17305 | Glycosyltransferase 8 domain-containing protein 1 (GLT8D1) | 7.9 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 7.8 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 7.8 | ||||
| LDTP17022 | Secernin-3 (SCRN3) | 7.8 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 7.7 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 7.6 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 7.6 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 7.6 | ||||
| LDTP06227 | Prostaglandin reductase 1 (PTGR1) | 7.5 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 7.5 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 7.5 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 7.4 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 7.4 | ||||
| LDTP12318 | Calcium-independent phospholipase A2-gamma (PNPLA8) | 7.4 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 7.4 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 7.3 | ||||
| LDTP13131 | 7-dehydrocholesterol reductase (DHCR7) | 7.3 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 7.2 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 7.0 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 7.0 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 7.0 | ||||
| LDTP09355 | Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma (PIP4K2C) | 7.0 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 6.9 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 6.9 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 6.9 | ||||
| LDTP05632 | Mitochondrial-processing peptidase subunit alpha (PMPCA) | 6.9 | ||||
| LDTP08265 | N-alpha-acetyltransferase 40 (NAA40) | 6.9 | ||||
| LDTP07577 | Serine/threonine-protein kinase ULK3 (ULK3) | 6.7 | ||||
| LDTP02260 | Beta-glucuronidase (GUSB) | 6.6 | ||||
| LDTP04634 | Alpha-N-acetylglucosaminidase (NAGLU) | 6.5 | ||||
| LDTP06501 | Ras-related protein Rab-11B (RAB11B) | 6.5 | ||||
| LDTP04196 | 26S proteasome non-ATPase regulatory subunit 8 (PSMD8) | 6.5 | ||||
| LDTP00886 | Nardilysin (NRDC) | 6.5 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 6.4 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 6.4 | ||||
| LDTP05140 | Arginase-2, mitochondrial (ARG2) | 6.3 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 6.3 | ||||
| LDTP09095 | Diacylglycerol lipase-beta (DAGLB) | 6.3 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 6.2 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 6.1 | ||||
| LDTP02833 | Short-chain specific acyl-CoA dehydrogenase, mitochondrial (ACADS) | 6.1 | ||||
| LDTP10182 | TLC domain-containing protein 1 (TLCD1) | 6.1 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 6.0 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 6.0 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 6.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 79.3 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 38.1 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 32.9 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 30.5 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 28.1 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 22.5 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 20.4 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 17.8 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 17.8 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 14.8 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 14.7 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 14.5 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 14.4 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 14.1 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 13.7 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 13.5 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 13.5 | ||||
| LDTP04956 | Mitochondrial import inner membrane translocase subunit Tim10 (TIMM10) | 13.1 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 12.9 | ||||
| LDTP06633 | Reticulon-1 (RTN1) | 12.8 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 12.6 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 12.6 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 12.1 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 11.7 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 11.6 | ||||
| LDTP11136 | Sugar transporter SWEET1 (SLC50A1) | 11.3 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 11.2 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 10.4 | ||||
| LDTP01217 | Metaxin-2 (MTX2) | 10.3 | ||||
| LDTP14099 | Mitochondrial import inner membrane translocase subunit Tim22 (TIMM22) | 10.1 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 9.3 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 9.3 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 8.8 | ||||
| LDTP14181 | Peroxisomal membrane protein PEX16 (PEX16) | 8.8 | ||||
| LDTP09261 | Major facilitator superfamily domain-containing protein 8 (MFSD8) | 8.5 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 8.5 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 8.2 | ||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 8.2 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 7.8 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 7.6 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 7.6 | ||||
| LDTP09515 | Importin-4 (IPO4) | 7.6 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 7.5 | ||||
| LDTP11615 | Protein tweety homolog 3 (TTYH3) | 7.4 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 7.3 | ||||
| LDTP02215 | Prosaposin (PSAP) | 7.1 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 7.0 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 6.9 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 6.8 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 6.8 | ||||
| LDTP11626 | Protein YIPF3 (YIPF3) | 6.8 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 6.6 | ||||
| LDTP05625 | AP-1 complex subunit beta-1 (AP1B1) | 6.5 | ||||
| LDTP12331 | Endoplasmic reticulum membrane protein complex subunit 7 (EMC7) | 6.5 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 6.5 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 6.3 | ||||
| LDTP09788 | Sorting nexin-19 (SNX19) | 6.1 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 6.1 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11076 | Apolipoprotein L2 (APOL2) | 41.4 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 38.6 | ||||
| LDTP00850 | ER lumen protein-retaining receptor 3 (KDELR3) | 27.5 | ||||
| LDTP14939 | Membralin (TMEM259) | 18.4 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 17.1 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 16.0 | ||||
| LDTP11277 | Tubulin beta-2B chain (TUBB2B) | 15.6 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 12.5 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 12.2 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 11.9 | ||||
| LDTP01075 | Protein CutA (CUTA) | 11.7 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 11.6 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 11.5 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 11.5 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 11.2 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 11.1 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 10.6 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 10.3 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 10.1 | ||||
| LDTP05076 | Tubulin beta-4B chain (TUBB4B) | 9.6 | ||||
| LDTP11233 | Tubulin beta-6 chain (TUBB6) | 9.3 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 8.9 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 8.9 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 8.8 | ||||
| LDTP02205 | Tubulin beta chain (TUBB) | 8.8 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 8.8 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 8.7 | ||||
| LDTP05998 | Tubulin beta-2A chain (TUBB2A) | 8.3 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 8.2 | ||||
| LDTP02927 | Ganglioside GM2 activator (GM2A) | 8.1 | ||||
| LDTP13797 | HIG1 domain family member 1A, mitochondrial (HIGD1A) | 8.1 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 8.1 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 8.0 | ||||
| LDTP10214 | Splicing factor ESS-2 homolog (ESS2) | 7.8 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 7.7 | ||||
| LDTP19859 | Small integral membrane protein 12 (SMIM12) | 7.4 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 7.0 | ||||
| LDTP02037 | Tubulin beta-4A chain (TUBB4A) | 7.0 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 6.9 | ||||
| LDTP07335 | Rho GTPase-activating protein 17 (ARHGAP17) | 6.9 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 6.8 | ||||
| LDTP07934 | Synaptic vesicle glycoprotein 2A (SV2A) | 6.5 | ||||
| LDTP00887 | Calumenin (CALU) | 6.5 | ||||
| LDTP09773 | Protein FAM3C (FAM3C) | 6.5 | ||||
| LDTP11115 | Leucine zipper putative tumor suppressor 2 (LZTS2) | 6.2 | ||||
| LDTP15398 | Protein FAM177A1 (FAM177A1) | 6.1 | ||||
