Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C017 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 34.8 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 27.5 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 25.6 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 23.8 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 20.5 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 18.9 | ||||
| LDTP06750 | Prolyl 3-hydroxylase 1 (P3H1) | 18.9 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 16.0 | ||||
| LDTP00428 | Tripeptidyl-peptidase 1 (TPP1) | 14.0 | ||||
| LDTP05588 | RNA cytosine C(5)-methyltransferase NSUN2 (NSUN2) | 13.4 | ||||
| LDTP13240 | Poly [ADP-ribose] polymerase 2 (PARP2) | 12.8 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 12.7 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 12.7 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 12.7 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 12.6 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 12.6 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 11.7 | ||||
| LDTP12444 | Xaa-Pro aminopeptidase 1 (XPNPEP1) | 11.7 | ||||
| LDTP11336 | Chitinase domain-containing protein 1 (CHID1) | 11.6 | ||||
| LDTP02188 | Protein disulfide-isomerase (P4HB) | 11.6 | ||||
| LDTP09056 | Inactive C-alpha-formylglycine-generating enzyme 2 (SUMF2) | 11.1 | ||||
| LDTP09031 | Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 (POMGNT2) | 11.0 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 10.9 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 10.6 | ||||
| LDTP13862 | GDP-fucose protein O-fucosyltransferase 2 (POFUT2) | 10.1 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 9.9 | ||||
| LDTP03418 | Proteasome subunit beta type-6 (PSMB6) | 9.9 | ||||
| LDTP17247 | 5'-nucleotidase domain-containing protein 1 (NT5DC1) | 9.8 | ||||
| LDTP06546 | Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform (PPP2R5E) | 9.4 | ||||
| LDTP08209 | Acyl-coenzyme A thioesterase 1 (ACOT1) | 9.4 | ||||
| LDTP01065 | E3 ubiquitin-protein ligase TRIM13 (TRIM13) | 9.4 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 9.3 | ||||
| LDTP12610 | Obg-like ATPase 1 (OLA1) | 9.2 | ||||
| LDTP08476 | 5'-3' exonuclease PLD3 (PLD3) | 9.1 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 9.1 | ||||
| LDTP08532 | Inositol 1,4,5-trisphosphate receptor-interacting protein (ITPRIP) | 9.1 | ||||
| LDTP02848 | NADPH--cytochrome P450 reductase (POR) | 8.8 | ||||
| LDTP05773 | Peroxiredoxin-4 (PRDX4) | 8.6 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 8.5 | ||||
| LDTP10101 | Peptidyl-prolyl cis-trans isomerase FKBP10 (FKBP10) | 8.4 | ||||
| LDTP09925 | COP9 signalosome complex subunit 5 (COPS5) | 8.3 | ||||
| LDTP11437 | Peroxisomal trans-2-enoyl-CoA reductase (PECR) | 8.1 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 8.1 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 8.1 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 7.9 | ||||
| LDTP11215 | Plasma alpha-L-fucosidase (FUCA2) | 7.9 | ||||
| LDTP02150 | ATP synthase subunit beta, mitochondrial (ATP5F1B) | 7.7 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 7.7 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 7.7 | ||||
| LDTP04211 | Isocitrate dehydrogenase [NADP], mitochondrial (IDH2) | 7.7 | ||||
| LDTP01300 | Cartilage-associated protein (CRTAP) | 7.6 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 7.6 | ||||
| LDTP07503 | Endoplasmic reticulum aminopeptidase 2 (ERAP2) | 7.5 | ||||
| LDTP04183 | Lanosterol synthase (LSS) | 7.5 | ||||
| LDTP06145 | Protein disulfide-isomerase A5 (PDIA5) | 7.5 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 7.4 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 7.3 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 7.3 | ||||
| LDTP03220 | NAD-dependent malic enzyme, mitochondrial (ME2) | 7.1 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 7.1 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 7.0 | ||||
| LDTP11273 | N-terminal Xaa-Pro-Lys N-methyltransferase 1 (NTMT1) | 7.0 | ||||
| LDTP08590 | DnaJ homolog subfamily C member 10 (DNAJC10) | 7.0 | ||||
| LDTP18123 | Isochorismatase domain-containing protein 2 (ISOC2) | 7.0 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 7.0 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 6.9 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 6.8 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 6.8 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 6.8 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 6.7 | ||||
| LDTP11216 | Dehydrogenase/reductase SDR family member 4 (DHRS4) | 6.7 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 6.7 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 6.7 | ||||
| LDTP11494 | Neurolysin, mitochondrial (NLN) | 6.7 | ||||
| LDTP08017 | Endoplasmic reticulum metallopeptidase 1 (ERMP1) | 6.6 | ||||
| LDTP06839 | NAD kinase 2, mitochondrial (NADK2) | 6.5 | ||||
| LDTP05920 | Calcium/calmodulin-dependent protein kinase type II subunit gamma (CAMK2G) | 6.5 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 6.5 | ||||
| LDTP02713 | Macrophage migration inhibitory factor (MIF) | 6.5 | ||||
| LDTP02260 | Beta-glucuronidase (GUSB) | 6.4 | ||||
| LDTP13220 | Phosphatidylserine decarboxylase proenzyme, mitochondrial (PISD) | 6.4 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 6.4 | ||||
| LDTP11178 | Chitobiosyldiphosphodolichol beta-mannosyltransferase (ALG1) | 6.4 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 6.4 | ||||
| LDTP13491 | E3 ubiquitin-protein ligase AMFR (AMFR) | 6.2 | ||||
| LDTP18414 | 5'-nucleotidase domain-containing protein 2 (NT5DC2) | 6.2 | ||||
| LDTP03417 | Proteasome subunit beta type-4 (PSMB4) | 6.2 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 6.1 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 6.1 | ||||
| LDTP00575 | Glutathione S-transferase A4 (GSTA4) | 6.1 | ||||
| LDTP12588 | Isoleucine--tRNA ligase, mitochondrial (IARS2) | 6.1 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 6.1 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 6.1 | ||||
| LDTP16025 | Ketosamine-3-kinase (FN3KRP) | 6.0 | ||||
| LDTP09835 | GPI-anchor transamidase (PIGK) | 5.9 | ||||
| LDTP08401 | All trans-polyprenyl-diphosphate synthase PDSS2 (PDSS2) | 5.9 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 5.9 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 5.9 | ||||
| LDTP00645 | Prolyl 4-hydroxylase subunit alpha-2 (P4HA2) | 5.9 | ||||
| LDTP14278 | Sulfide:quinone oxidoreductase, mitochondrial (SQOR) | 5.7 | ||||
| LDTP06977 | GPI ethanolamine phosphate transferase 2 (PIGG) | 5.7 | ||||
| LDTP00482 | Peripheral plasma membrane protein CASK (CASK) | 5.7 | ||||
| LDTP05624 | Polypeptide N-acetylgalactosaminyltransferase 1 (GALNT1) | 5.6 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 5.6 | ||||
| LDTP07868 | Protein O-mannosyl-transferase TMTC3 (TMTC3) | 5.5 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 53.8 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 53.1 | ||||
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 37.5 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 19.3 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 18.9 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 18.3 | ||||
| LDTP09278 | Multiple coagulation factor deficiency protein 2 (MCFD2) | 14.8 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 14.1 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 13.2 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 12.0 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 11.7 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 11.5 | ||||
| LDTP09180 | Zinc transporter 7 (SLC30A7) | 10.6 | ||||
| LDTP00592 | Surfeit locus protein 4 (SURF4) | 10.1 | ||||
| LDTP07156 | Protein wntless homolog (WLS) | 8.9 | ||||
| LDTP11927 | Essential MCU regulator, mitochondrial (SMDT1) | 8.3 | ||||
| LDTP05384 | Mitochondrial 2-oxoglutarate/malate carrier protein (SLC25A11) | 8.2 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 8.1 | ||||
| LDTP05871 | Protein OS-9 (OS9) | 7.8 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 7.7 | ||||
| LDTP14682 | Translocon-associated protein subunit beta (SSR2) | 7.7 | ||||
| LDTP05511 | Cytoskeleton-associated protein 4 (CKAP4) | 7.6 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 7.5 | ||||
| LDTP03546 | Translocator protein (TSPO) | 7.5 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 7.4 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 7.4 | ||||
| LDTP03405 | Calnexin (CANX) | 7.2 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 7.1 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 7.1 | ||||
| LDTP00262 | Acetyl-coenzyme A transporter 1 (SLC33A1) | 7.0 | ||||
| LDTP09949 | Transportin-1 (TNPO1) | 7.0 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 6.7 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 6.7 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 6.6 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 6.5 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 6.5 | ||||
| LDTP13256 | SUN domain-containing protein 2 (SUN2) | 6.3 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 6.2 | ||||
| LDTP09288 | Vang-like protein 1 (VANGL1) | 6.1 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 6.1 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 5.9 | ||||
| LDTP04462 | H(+)/Cl(-) exchange transporter 6 (CLCN6) | 5.9 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 5.9 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 5.8 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 5.7 | ||||
| LDTP10343 | Vacuole membrane protein 1 (VMP1) | 5.6 | ||||
| LDTP11291 | Transmembrane emp24 domain-containing protein 9 (TMED9) | 5.6 | ||||
| LDTP03952 | Reduced folate transporter (SLC19A1) | 5.5 | ||||
| LDTP10533 | Sorting nexin-27 (SNX27) | 5.5 | ||||
GPCR
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15303 | Membrane progestin receptor alpha (PAQR7) | 10.3 | ||||
Immunoglobulin
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03538 | HLA class I histocompatibility antigen, alpha chain F (HLA-F) | 24.8 | ||||
| LDTP02491 | HLA class I histocompatibility antigen, C alpha chain (HLA-C) | 10.7 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15623 | Neuferricin (CYB5D2) | 19.2 | ||||
| LDTP10184 | HAUS augmin-like complex subunit 1 (HAUS1) | 18.1 | ||||
| LDTP00887 | Calumenin (CALU) | 17.8 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 16.0 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 15.1 | ||||
| LDTP13630 | Neudesin (NENF) | 15.0 | ||||
| LDTP15634 | Ubiquinol-cytochrome c reductase complex assembly factor 5 (UQCC5) | 14.6 | ||||
| LDTP14939 | Membralin (TMEM259) | 13.4 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 12.9 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 11.2 | ||||
| LDTP11239 | Protein misato homolog 1 (MSTO1) | 11.1 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 10.2 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 10.1 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 9.8 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 9.6 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 9.3 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 9.1 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 8.9 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 8.4 | ||||
| LDTP10775 | Endoplasmic reticulum-Golgi intermediate compartment protein 2 (ERGIC2) | 8.3 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 8.1 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 8.0 | ||||
| LDTP05089 | Immunoglobulin-binding protein 1 (IGBP1) | 7.9 | ||||
| LDTP08606 | Nurim (NRM) | 7.9 | ||||
| LDTP17003 | Matrix-remodeling-associated protein 7 (MXRA7) | 7.7 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 7.7 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 7.6 | ||||
| LDTP15434 | ADP-ribosylation factor-like protein 6-interacting protein 6 (ARL6IP6) | 7.5 | ||||
| LDTP08573 | Ankyrin repeat and KH domain-containing protein 1 (ANKHD1) | 7.5 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 7.4 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 7.3 | ||||
| LDTP09297 | Large ribosomal subunit protein mL64 (GADD45GIP1) | 7.3 | ||||
| LDTP15110 | Protein C3orf33 (C3orf33) | 7.0 | ||||
| LDTP03545 | Alpha-2-macroglobulin receptor-associated protein (LRPAP1) | 6.9 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 6.8 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 6.7 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 6.6 | ||||
| LDTP06948 | Protein YIF1B (YIF1B) | 6.6 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 6.5 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 6.3 | ||||
| LDTP11979 | Coiled-coil domain-containing protein 134 (CCDC134) | 6.2 | ||||
| LDTP05789 | DnaJ homolog subfamily C member 3 (DNAJC3) | 6.2 | ||||
| LDTP10924 | Prohibitin-2 (PHB2) | 6.2 | ||||
| LDTP01608 | Proteasome assembly chaperone 1 (PSMG1) | 6.2 | ||||
| LDTP13982 | Mitochondrial fission 1 protein (FIS1) | 6.2 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 6.1 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 6.1 | ||||
| LDTP02734 | Endoplasmin (HSP90B1) | 6.0 | ||||
| LDTP11113 | Receptor expression-enhancing protein 2 (REEP2) | 5.9 | ||||
| LDTP15095 | Receptor expression-enhancing protein 3 (REEP3) | 5.9 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 5.9 | ||||
| LDTP16285 | Transducin beta-like protein 2 (TBL2) | 5.9 | ||||
| LDTP02230 | Laminin subunit beta-1 (LAMB1) | 5.9 | ||||
| LDTP06373 | Mitochondrial import receptor subunit TOM20 homolog (TOMM20) | 5.8 | ||||
| LDTP02297 | Vimentin (VIM) | 5.8 | ||||
| LDTP01938 | Apolipoprotein C-I (APOC1) | 5.8 | ||||
| LDTP15714 | Mdm2-binding protein (MTBP) | 5.8 | ||||
| LDTP06352 | Reticulocalbin-1 (RCN1) | 5.8 | ||||
| LDTP06072 | Dedicator of cytokinesis protein 1 (DOCK1) | 5.6 | ||||
