Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C361 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP03842 | Squalene synthase (FDFT1) | 82.1 | ||||
| LDTP10101 | Peptidyl-prolyl cis-trans isomerase FKBP10 (FKBP10) | 75.1 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 61.8 | ||||
| LDTP08598 | NAD-dependent protein deacetylase sirtuin-2 (SIRT2) | 61.8 | ||||
| LDTP01562 | Peptidyl-prolyl cis-trans isomerase FKBP9 (FKBP9) | 60.5 | ||||
| LDTP03198 | Ferrochelatase, mitochondrial (FECH) | 52.3 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 45.6 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 42.8 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 37.8 | ||||
| LDTP16070 | Epimerase family protein SDR39U1 (SDR39U1) | 36.0 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 34.3 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 34.3 | ||||
| LDTP12013 | dCTP pyrophosphatase 1 (DCTPP1) | 34.1 | ||||
| LDTP03692 | Bifunctional epoxide hydrolase 2 (EPHX2) | 33.6 | ||||
| LDTP13938 | Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial (COQ6) | 33.4 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 32.9 | ||||
| LDTP01419 | Retinal dehydrogenase 2 (ALDH1A2) | 32.9 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 32.7 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 30.7 | ||||
| LDTP12197 | Ethanolamine kinase 1 (ETNK1) | 30.7 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 29.9 | ||||
| LDTP09074 | UDP-glucuronic acid decarboxylase 1 (UXS1) | 27.7 | ||||
| LDTP03560 | Aldehyde dehydrogenase X, mitochondrial (ALDH1B1) | 26.9 | ||||
| LDTP04327 | Cytosolic purine 5'-nucleotidase (NT5C2) | 26.9 | ||||
| LDTP12603 | NAD-dependent protein deacetylase sirtuin-3, mitochondrial (SIRT3) | 26.5 | ||||
| LDTP05346 | Methylmalonate-semialdehyde/malonate-semialdehyde dehydrogenase [acylating], mitochondrial (ALDH6A1) | 26.4 | ||||
| LDTP11081 | NAD-capped RNA hydrolase NUDT12 (NUDT12) | 26.2 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 26.0 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 25.8 | ||||
| LDTP13240 | Poly [ADP-ribose] polymerase 2 (PARP2) | 25.8 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 25.8 | ||||
| LDTP05640 | Secernin-1 (SCRN1) | 25.8 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 25.6 | ||||
| LDTP03103 | Glutathione S-transferase Mu 3 (GSTM3) | 25.3 | ||||
| LDTP04114 | E3 ubiquitin-protein ligase NEDD4 (NEDD4) | 24.6 | ||||
| LDTP04471 | Ribosomal protein S6 kinase alpha-3 (RPS6KA3) | 23.9 | ||||
| LDTP06384 | Ribosomal protein S6 kinase alpha-1 (RPS6KA1) | 23.4 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 23.3 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 23.1 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 22.5 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 22.3 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 22.0 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 21.9 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 21.7 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 21.4 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 21.4 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 21.3 | ||||
| LDTP13703 | Histone lysine demethylase PHF8 (PHF8) | 21.0 | ||||
| LDTP08617 | Patatin-like phospholipase domain-containing protein 6 (PNPLA6) | 21.0 | ||||
| LDTP02375 | Poly [ADP-ribose] polymerase 1 (PARP1) | 21.0 | ||||
| LDTP05724 | Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial (ECH1) | 20.8 | ||||
| LDTP01515 | NADH dehydrogenase 1 beta subcomplex subunit 8, mitochondrial (NDUFB8) | 20.7 | ||||
| LDTP10785 | Ubiquitin carboxyl-terminal hydrolase 28 (USP28) | 20.5 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 20.1 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 20.1 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 20.0 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 19.8 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 19.8 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 19.7 | ||||
| LDTP03671 | Multidrug resistance-associated protein 1 (ABCC1) | 19.7 | ||||
| LDTP01665 | Geranylgeranyl pyrophosphate synthase (GGPS1) | 19.4 | ||||
| LDTP12868 | Endoplasmic reticulum aminopeptidase 1 (ERAP1) | 19.3 | ||||
| LDTP02123 | Protein kinase C beta type (PRKCB) | 19.2 | ||||
| LDTP07679 | Lysocardiolipin acyltransferase 1 (LCLAT1) | 19.0 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 19.0 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 19.0 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 18.9 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 18.9 | ||||
| LDTP04248 | Deoxyhypusine synthase (DHPS) | 18.8 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 18.6 | ||||
| LDTP12293 | Adipocyte plasma membrane-associated protein (APMAP) | 18.5 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 18.5 | ||||
| LDTP06343 | Serine/threonine-protein phosphatase 2A activator (PTPA) | 18.5 | ||||
| LDTP02640 | X-ray repair cross-complementing protein 6 (XRCC6) | 18.5 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 18.4 | ||||
| LDTP10032 | 7-methylguanosine phosphate-specific 5'-nucleotidase (NT5C3B) | 18.3 | ||||
| LDTP08017 | Endoplasmic reticulum metallopeptidase 1 (ERMP1) | 18.3 | ||||
| LDTP07259 | N-alpha-acetyltransferase 35, NatC auxiliary subunit (NAA35) | 18.3 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 18.1 | ||||
| LDTP06849 | Prolyl endopeptidase-like (PREPL) | 18.1 | ||||
| LDTP05240 | Transcription initiation factor IIB (GTF2B) | 18.1 | ||||
| LDTP01245 | Enoyl-CoA delta isomerase 2 (ECI2) | 18.0 | ||||
| LDTP02757 | Cytochrome b-c1 complex subunit 7 (UQCRB) | 17.9 | ||||
| LDTP06307 | Peroxisomal acyl-coenzyme A oxidase 1 (ACOX1) | 17.9 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 17.9 | ||||
| LDTP00836 | ATPase GET3 (GET3) | 17.6 | ||||
| LDTP12573 | E3 ubiquitin-protein ligase RAD18 (RAD18) | 17.6 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 17.5 | ||||
| LDTP04299 | Dual specificity protein kinase CLK3 (CLK3) | 17.5 | ||||
| LDTP07525 | Protein arginine N-methyltransferase 9 (PRMT9) | 17.5 | ||||
| LDTP03607 | RAC-alpha serine/threonine-protein kinase (AKT1) | 17.5 | ||||
| LDTP12227 | Methylcrotonoyl-CoA carboxylase beta chain, mitochondrial (MCCC2) | 17.4 | ||||
| LDTP15422 | Prostaglandin reductase 3 (PTGR3) | 17.3 | ||||
| LDTP03608 | RAC-beta serine/threonine-protein kinase (AKT2) | 17.1 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 17.0 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 17.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 76.6 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 63.1 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 46.2 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 38.3 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 38.1 | ||||
| LDTP10985 | Equilibrative nucleoside transporter 1 (SLC29A1) | 29.7 | ||||
| LDTP03546 | Translocator protein (TSPO) | 27.9 | ||||
| LDTP06198 | Major facilitator superfamily domain-containing protein 10 (MFSD10) | 24.6 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 23.3 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 22.9 | ||||
| LDTP10621 | Sideroflexin-2 (SFXN2) | 21.3 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 21.1 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 20.7 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 20.3 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 20.1 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 20.0 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 20.0 | ||||
| LDTP02071 | Amyloid-beta precursor protein (APP) | 19.6 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 19.2 | ||||
| LDTP12043 | Phosphorylated adapter RNA export protein (PHAX) | 18.5 | ||||
| LDTP07667 | Transmembrane protein 205 (TMEM205) | 18.4 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 18.1 | ||||
| LDTP11116 | 45 kDa calcium-binding protein (SDF4) | 18.0 | ||||
| LDTP14178 | Heme transporter FLVCR1 (FLVCR1) | 17.5 | ||||
| LDTP03839 | Nuclear pore glycoprotein p62 (NUP62) | 17.4 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 17.0 | ||||
| LDTP01200 | Peroxisomal membrane protein PEX14 (PEX14) | 17.0 | ||||
| LDTP07397 | THO complex subunit 7 homolog (THOC7) | 17.0 | ||||
GPCR
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP15303 | Membrane progestin receptor alpha (PAQR7) | 28.2 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP01362 | Survival of motor neuron-related-splicing factor 30 (SMNDC1) | 64.0 | ||||
| LDTP11533 | Oxysterol-binding protein-related protein 6 (OSBPL6) | 61.8 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 45.3 | ||||
| LDTP00871 | Microtubule nucleation factor SSNA1 (SSNA1) | 42.5 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 40.5 | ||||
| LDTP19860 | Coiled-coil domain-containing protein 97 (CCDC97) | 40.2 | ||||
| LDTP16078 | Heme-binding protein 1 (HEBP1) | 39.4 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 36.5 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 34.5 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 34.1 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 33.6 | ||||
| LDTP06022 | Cold-inducible RNA-binding protein (CIRBP) | 32.0 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 32.0 | ||||
| LDTP05226 | RNA-binding protein 3 (RBM3) | 32.0 | ||||
| LDTP14259 | Testis-expressed protein 264 (TEX264) | 29.4 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 29.2 | ||||
| LDTP03612 | Bifunctional purine biosynthesis protein ATIC (ATIC) | 27.1 | ||||
| LDTP02124 | Keratin, type I cytoskeletal 18 (KRT18) | 26.5 | ||||
| LDTP09850 | Proline-rich protein PRCC (PRCC) | 26.0 | ||||
| LDTP03850 | RNA-binding motif protein, X chromosome (RBMX) | 25.8 | ||||
| LDTP03614 | Heterogeneous nuclear ribonucleoprotein H3 (HNRNPH3) | 25.5 | ||||
| LDTP05277 | Protein SET (SET) | 24.8 | ||||
| LDTP12377 | Mediator of RNA polymerase II transcription subunit 4 (MED4) | 24.3 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 24.1 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 23.9 | ||||
| LDTP03247 | Eukaryotic translation initiation factor 4B (EIF4B) | 23.9 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 23.9 | ||||
| LDTP12468 | Diablo IAP-binding mitochondrial protein (DIABLO) | 23.8 | ||||
| LDTP02297 | Vimentin (VIM) | 23.8 | ||||
| LDTP04558 | Arfaptin-1 (ARFIP1) | 23.4 | ||||
| LDTP13987 | Hepatoma-derived growth factor-related protein 3 (HDGFL3) | 23.4 | ||||
| LDTP03775 | RNA-binding protein FUS (FUS) | 23.3 | ||||
| LDTP04668 | Microfibrillar-associated protein 1 (MFAP1) | 22.8 | ||||
| LDTP10251 | Protein Spindly (SPDL1) | 22.3 | ||||
| LDTP00880 | A-kinase anchor protein 8 (AKAP8) | 21.9 | ||||
| LDTP01359 | Dynactin subunit 3 (DCTN3) | 21.9 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 21.9 | ||||
| LDTP09881 | TATA-binding protein-associated factor 2N (TAF15) | 21.9 | ||||
| LDTP06298 | IQ calmodulin-binding motif-containing protein 1 (IQCB1) | 21.6 | ||||
| LDTP04514 | Heterogeneous nuclear ribonucleoprotein F (HNRNPF) | 21.3 | ||||
| LDTP06548 | Large ribosomal subunit protein uL23m (MRPL23) | 20.8 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 20.8 | ||||
| LDTP10184 | HAUS augmin-like complex subunit 1 (HAUS1) | 20.5 | ||||
| LDTP04714 | Heterogeneous nuclear ribonucleoprotein H2 (HNRNPH2) | 20.5 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 20.1 | ||||
| LDTP01361 | DnaJ homolog subfamily C member 8 (DNAJC8) | 20.0 | ||||
| LDTP03615 | Heterogeneous nuclear ribonucleoprotein H (HNRNPH1) | 20.0 | ||||
| LDTP07368 | Tetratricopeptide repeat protein 19, mitochondrial (TTC19) | 20.0 | ||||
| LDTP16730 | Rab GTPase-activating protein 1-like, isoform 10 (RABGAP1L) | 19.7 | ||||
| LDTP04595 | Activated RNA polymerase II transcriptional coactivator p15 (SUB1) | 19.2 | ||||
| LDTP02825 | Histone H2AX (H2AX) | 18.9 | ||||
| LDTP16249 | Protein angel homolog 1 (ANGEL1) | 18.9 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 18.9 | ||||
| LDTP13591 | A-kinase anchor protein 8-like (AKAP8L) | 18.8 | ||||
| LDTP08760 | Cell cycle and apoptosis regulator protein 2 (CCAR2) | 18.8 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 18.5 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 18.5 | ||||
| LDTP00573 | Prefoldin subunit 6 (PFDN6) | 18.5 | ||||
| LDTP01075 | Protein CutA (CUTA) | 18.5 | ||||
| LDTP04483 | Hepatoma-derived growth factor (HDGF) | 18.4 | ||||
| LDTP00500 | Heterogeneous nuclear ribonucleoprotein D-like (HNRNPDL) | 18.3 | ||||
| LDTP03182 | Heterogeneous nuclear ribonucleoproteins A2/B1 (HNRNPA2B1) | 18.3 | ||||
| LDTP11076 | Apolipoprotein L2 (APOL2) | 18.1 | ||||
| LDTP10962 | Heterogeneous nuclear ribonucleoprotein A/B (HNRNPAB) | 18.1 | ||||
| LDTP03065 | Lamin-B1 (LMNB1) | 18.1 | ||||
| LDTP00199 | HCLS1-associated protein X-1 (HAX1) | 18.0 | ||||
| LDTP08761 | NADH dehydrogenase 1 alpha subcomplex assembly factor 2 (NDUFAF2) | 18.0 | ||||
| LDTP13630 | Neudesin (NENF) | 18.0 | ||||
| LDTP18547 | Protein CDV3 homolog (CDV3) | 17.9 | ||||
| LDTP01582 | Pre-mRNA-splicing factor SLU7 (SLU7) | 17.8 | ||||
| LDTP11930 | Oxysterol-binding protein-related protein 3 (OSBPL3) | 17.6 | ||||
| LDTP05036 | Transformer-2 protein homolog beta (TRA2B) | 17.6 | ||||
| LDTP04979 | U6 snRNA-associated Sm-like protein LSm3 (LSM3) | 17.6 | ||||
| LDTP04290 | YLP motif-containing protein 1 (YLPM1) | 17.6 | ||||
| LDTP12285 | Charged multivesicular body protein 1a (CHMP1A) | 17.5 | ||||
| LDTP02181 | Neurofilament medium polypeptide (NEFM) | 17.5 | ||||
| LDTP04684 | Nucleosome assembly protein 1-like 1 (NAP1L1) | 17.1 | ||||
| LDTP10255 | Protein Hook homolog 2 (HOOK2) | 17.1 | ||||
| LDTP06587 | Survival motor neuron protein (SMN1; SMN2) | 17.1 | ||||
| LDTP07655 | Pre-mRNA 3'-end-processing factor FIP1 (FIP1L1) | 17.0 | ||||
| LDTP18494 | Tropomodulin-3 (TMOD3) | 17.0 | ||||
