Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C252 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 78.2 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 53.4 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 41.9 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 41.1 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 32.7 | ||||
| LDTP08565 | E3 ubiquitin-protein ligase UBR2 (UBR2) | 31.8 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 31.1 | ||||
| LDTP03842 | Squalene synthase (FDFT1) | 30.7 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 30.5 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 29.4 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 28.8 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 28.1 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 25.5 | ||||
| LDTP10550 | Dehydrogenase/reductase SDR family member 1 (DHRS1) | 25.3 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 24.8 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 24.1 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 23.6 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 23.4 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 22.3 | ||||
| LDTP01773 | Cytochrome c oxidase subunit 2 (MT-CO2) | 21.4 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 19.6 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 18.1 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 17.6 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 17.4 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 17.0 | ||||
| LDTP14218 | Peptidyl-prolyl cis-trans isomerase FKBP7 (FKBP7) | 16.4 | ||||
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 16.4 | ||||
| LDTP15328 | Dolichyldiphosphatase 1 (DOLPP1) | 15.2 | ||||
| LDTP06618 | ATP-dependent Clp protease proteolytic subunit, mitochondrial (CLPP) | 15.0 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 14.4 | ||||
| LDTP11187 | COP9 signalosome complex subunit 4 (COPS4) | 14.2 | ||||
| LDTP08385 | NADH dehydrogenase 1 alpha subcomplex subunit 11 (NDUFA11) | 13.9 | ||||
| LDTP03912 | Trifunctional enzyme subunit alpha, mitochondrial (HADHA) | 13.5 | ||||
| LDTP17410 | Cytochrome P450 20A1 (CYP20A1) | 13.4 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 13.0 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 12.9 | ||||
| LDTP02385 | Leukotriene A-4 hydrolase (LTA4H) | 12.9 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 12.8 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 12.7 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 12.7 | ||||
| LDTP04358 | Carnitine O-palmitoyltransferase 1, liver isoform (CPT1A) | 12.6 | ||||
| LDTP06849 | Prolyl endopeptidase-like (PREPL) | 12.6 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 12.6 | ||||
| LDTP01769 | Dihydrofolate reductase (DHFR) | 12.3 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 12.2 | ||||
| LDTP01641 | STAM-binding protein (STAMBP) | 12.1 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 12.0 | ||||
| LDTP04581 | Holocytochrome c-type synthase (HCCS) | 11.8 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 11.6 | ||||
| LDTP03145 | Catechol O-methyltransferase (COMT) | 11.4 | ||||
| LDTP12790 | Glutaminyl-peptide cyclotransferase-like protein (QPCTL) | 11.1 | ||||
| LDTP18414 | 5'-nucleotidase domain-containing protein 2 (NT5DC2) | 10.6 | ||||
| LDTP06617 | Ceramide glucosyltransferase (UGCG) | 10.6 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 10.6 | ||||
| LDTP10020 | Ras-related protein Rab-24 (RAB24) | 10.3 | ||||
| LDTP04689 | Adenosine kinase (ADK) | 10.3 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 10.1 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 10.1 | ||||
| LDTP06270 | Signal peptidase complex subunit 2 (SPCS2) | 10.0 | ||||
| LDTP09874 | Endoplasmic reticulum protein SC65 (P3H4) | 9.9 | ||||
| LDTP07990 | Heparan sulfate 2-O-sulfotransferase 1 (HS2ST1) | 9.9 | ||||
| LDTP03787 | Choline kinase alpha (CHKA) | 9.8 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 9.7 | ||||
| LDTP13486 | Long-chain-fatty-acid--CoA ligase 6 (ACSL6) | 9.6 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 9.5 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 9.5 | ||||
| LDTP03697 | Mannose-6-phosphate isomerase (MPI) | 9.4 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 9.4 | ||||
| LDTP06142 | Squalene monooxygenase (SQLE) | 9.4 | ||||
| LDTP03854 | Vitamin K-dependent gamma-carboxylase (GGCX) | 9.4 | ||||
| LDTP08666 | Xaa-Arg dipeptidase (PM20D2) | 9.4 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 9.3 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 9.2 | ||||
| LDTP13375 | 2-hydroxyacyl-CoA lyase 1 (HACL1) | 9.1 | ||||
| LDTP06303 | Kinesin-like protein KIF14 (KIF14) | 9.0 | ||||
| LDTP02679 | Prolyl 4-hydroxylase subunit alpha-1 (P4HA1) | 9.0 | ||||
| LDTP04284 | Proteasome subunit beta type-3 (PSMB3) | 9.0 | ||||
| LDTP06648 | Lanosterol 14-alpha demethylase (CYP51A1) | 8.9 | ||||
| LDTP12867 | Very-long-chain enoyl-CoA reductase (TECR) | 8.9 | ||||
| LDTP07154 | ATPase family AAA domain-containing protein 3B (ATAD3B) | 8.8 | ||||
| LDTP10495 | Ubiquitin carboxyl-terminal hydrolase 47 (USP47) | 8.8 | ||||
| LDTP12586 | Phenylalanine--tRNA ligase beta subunit (FARSB) | 8.8 | ||||
| LDTP12720 | Peptidyl-prolyl cis-trans isomerase FKBP14 (FKBP14) | 8.7 | ||||
| LDTP12040 | Prostaglandin E synthase 2 (PTGES2) | 8.7 | ||||
| LDTP05408 | Antigen peptide transporter 1 (TAP1) | 8.6 | ||||
| LDTP02713 | Macrophage migration inhibitory factor (MIF) | 8.5 | ||||
| LDTP07003 | Presequence protease, mitochondrial (PITRM1) | 8.5 | ||||
| LDTP00988 | Protein O-GlcNAcase (OGA) | 8.5 | ||||
| LDTP04893 | Ras-related protein Rab-5B (RAB5B) | 8.5 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 8.3 | ||||
| LDTP09188 | Lysophosphatidylcholine acyltransferase 1 (LPCAT1) | 8.3 | ||||
| LDTP11823 | Peptidyl-prolyl cis-trans isomerase-like 3 (PPIL3) | 8.3 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 99.7 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 52.3 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 42.2 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 39.7 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 32.9 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 31.8 | ||||
| LDTP06633 | Reticulon-1 (RTN1) | 31.3 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 29.0 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 23.8 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 23.4 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 20.8 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 19.8 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 19.7 | ||||
| LDTP07236 | Protein GPR107 (GPR107) | 19.7 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 19.2 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 18.1 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 17.9 | ||||
| LDTP18153 | Major facilitator superfamily domain-containing protein 3 (MFSD3) | 17.5 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 16.7 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 16.3 | ||||
| LDTP16069 | Peroxisomal membrane protein 2 (PXMP2) | 16.2 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 15.7 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 15.0 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 14.1 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 13.8 | ||||
| LDTP08878 | ER membrane protein complex subunit 5 (MMGT1) | 13.6 | ||||
| LDTP01060 | PRA1 family protein 2 (PRAF2) | 13.6 | ||||
| LDTP11634 | Derlin-2 (DERL2) | 13.0 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 12.9 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 12.6 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 12.0 | ||||
| LDTP18448 | Transmembrane 9 superfamily member 3 (TM9SF3) | 11.8 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 10.8 | ||||
| LDTP10343 | Vacuole membrane protein 1 (VMP1) | 10.6 | ||||
| LDTP10059 | PAT complex subunit CCDC47 (CCDC47) | 10.5 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 10.5 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 10.3 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 10.3 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 9.8 | ||||
| LDTP14235 | Mitochondrial carrier homolog 2 (MTCH2) | 9.6 | ||||
| LDTP00477 | Mitochondrial import inner membrane translocase subunit Tim23 (TIMM23) | 9.5 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 9.5 | ||||
| LDTP11095 | Mitochondrial 2-oxodicarboxylate carrier (SLC25A21) | 9.4 | ||||
| LDTP07058 | Transmembrane protein 201 (TMEM201) | 9.2 | ||||
| LDTP12909 | Mitochondrial carrier homolog 1 (MTCH1) | 9.1 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 8.9 | ||||
| LDTP17362 | Magnesium transporter NIPA3 (NIPAL1) | 8.8 | ||||
| LDTP01454 | SUN domain-containing protein 1 (SUN1) | 8.7 | ||||
| LDTP13824 | Voltage-dependent anion-selective channel protein 3 (VDAC3) | 8.6 | ||||
| LDTP08030 | Autophagy-related protein 9A (ATG9A) | 8.5 | ||||
| LDTP12210 | Mitochondrial thiamine pyrophosphate carrier (SLC25A19) | 8.5 | ||||
| LDTP00821 | Mitochondrial import inner membrane translocase subunit TIM44 (TIMM44) | 8.4 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 8.3 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 9.1 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 76.1 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 35.8 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 29.9 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 26.0 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 25.6 | ||||
| LDTP05960 | Trophoblast glycoprotein (TPBG) | 25.5 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 22.0 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 21.3 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 21.1 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 20.0 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 19.6 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 19.0 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 18.5 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 18.0 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 17.4 | ||||
| LDTP09970 | RNA-binding protein with multiple splicing (RBPMS) | 17.1 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 15.5 | ||||
| LDTP04853 | Eukaryotic translation initiation factor 3 subunit E (EIF3E) | 13.2 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 13.2 | ||||
| LDTP16323 | Signal recognition particle receptor subunit beta (SRPRB) | 12.8 | ||||
| LDTP15623 | Neuferricin (CYB5D2) | 12.6 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 12.2 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 12.0 | ||||
| LDTP15741 | Cytochrome c oxidase assembly protein COX14 (COX14) | 11.3 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 11.1 | ||||
| LDTP08606 | Nurim (NRM) | 11.1 | ||||
| LDTP00859 | Synaptogyrin-2 (SYNGR2) | 10.9 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 10.9 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 10.9 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 10.9 | ||||
| LDTP01494 | Protein YIF1A (YIF1A) | 10.8 | ||||
| LDTP05089 | Immunoglobulin-binding protein 1 (IGBP1) | 10.6 | ||||
| LDTP05318 | RNA-binding protein EWS (EWSR1) | 10.6 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 10.5 | ||||
| LDTP00716 | RNA binding protein fox-1 homolog 2 (RBFOX2) | 10.3 | ||||
| LDTP04652 | Eukaryotic translation initiation factor 5 (EIF5) | 10.0 | ||||
| LDTP11978 | HAUS augmin-like complex subunit 4 (HAUS4) | 9.9 | ||||
| LDTP11277 | Tubulin beta-2B chain (TUBB2B) | 9.8 | ||||
| LDTP16078 | Heme-binding protein 1 (HEBP1) | 9.8 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 9.8 | ||||
| LDTP14058 | Rap guanine nucleotide exchange factor 2 (RAPGEF2) | 9.6 | ||||
| LDTP10357 | RUS family member 1 (RUSF1) | 9.6 | ||||
| LDTP02869 | Stathmin (STMN1) | 9.6 | ||||
| LDTP03968 | Lamina-associated polypeptide 2, isoforms beta/gamma (TMPO) | 9.5 | ||||
| LDTP00417 | Programmed cell death protein 5 (PDCD5) | 9.0 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 9.0 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 8.8 | ||||
| LDTP05257 | Receptor expression-enhancing protein 5 (REEP5) | 8.7 | ||||
| LDTP02297 | Vimentin (VIM) | 8.4 | ||||
