Details of the Probe-central Interaction Altas
General Information of Experiment
| Probe Name | C082 | Probe Info | ||||
|---|---|---|---|---|---|---|
| Probe concentration | Probe:50uM; negative probe:50uM | |||||
| Criteria | Quantification: AfBPP Probe vs Negative Probe | |||||
| Quantitative Method |
TMT
|
|||||
| In Vivo Experiment Model | Model Type |
|
Living cell | |||
| Derived Tissue |
|
Peripheral blood | ||||
| Disease Model | Normal | |||||
| Model Name | Human normal cells (HEK-293T) | |||||
| Note | Negative probe:C#CCCC1(CCC(NC)=O)N=N1 | |||||
Interaction Altas of This Experiment [1]
Enzyme
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP13282 | Prenylcysteine oxidase 1 (PCYOX1) | 31.8 | ||||
| LDTP12363 | Lysophosphatidic acid phosphatase type 6 (ACP6) | 31.6 | ||||
| LDTP01803 | Adenosine deaminase (ADA) | 19.6 | ||||
| LDTP02175 | Epoxide hydrolase 1 (EPHX1) | 18.8 | ||||
| LDTP00832 | NADH dehydrogenase 1 beta subcomplex subunit 3 (NDUFB3) | 17.4 | ||||
| LDTP00697 | Cytochrome b5 type B (CYB5B) | 17.3 | ||||
| LDTP16032 | Retinoid-inducible serine carboxypeptidase (SCPEP1) | 16.6 | ||||
| LDTP15484 | Saccharopine dehydrogenase-like oxidoreductase (SCCPDH) | 16.6 | ||||
| LDTP15988 | Probable serine carboxypeptidase CPVL (CPVL) | 15.1 | ||||
| LDTP14030 | V-type proton ATPase 116 kDa subunit a 2 (ATP6V0A2) | 14.0 | ||||
| LDTP01613 | Sphingosine-1-phosphate lyase 1 (SGPL1) | 12.7 | ||||
| LDTP09396 | Minor histocompatibility antigen H13 (HM13) | 12.6 | ||||
| LDTP04008 | Endothelin-converting enzyme 1 (ECE1) | 12.4 | ||||
| LDTP03540 | Heme oxygenase 2 (HMOX2) | 12.3 | ||||
| LDTP13358 | Leucyl-cystinyl aminopeptidase (LNPEP) | 12.0 | ||||
| LDTP12279 | Endoplasmic reticulum transmembrane helix translocase (ATP13A1) | 11.6 | ||||
| LDTP02359 | Heme oxygenase 1 (HMOX1) | 11.3 | ||||
| LDTP02254 | ATP-dependent translocase ABCB1 (ABCB1) | 11.1 | ||||
| LDTP10188 | FAD-dependent oxidoreductase domain-containing protein 1 (FOXRED1) | 10.7 | ||||
| LDTP04004 | Lysosomal Pro-X carboxypeptidase (PRCP) | 10.6 | ||||
| LDTP13751 | Exonuclease 1 (EXO1) | 10.1 | ||||
| LDTP01039 | Protein-S-isoprenylcysteine O-methyltransferase (ICMT) | 10.1 | ||||
| LDTP06150 | DNA replication licensing factor MCM6 (MCM6) | 9.7 | ||||
| LDTP12253 | Glycerol-3-phosphate acyltransferase 1, mitochondrial (GPAM) | 9.6 | ||||
| LDTP13189 | Cytochrome b-c1 complex subunit 9 (UQCR10) | 9.6 | ||||
| LDTP07831 | Transmembrane protein with metallophosphoesterase domain (TMPPE) | 9.4 | ||||
| LDTP04051 | Nicotinamide phosphoribosyltransferase (NAMPT) | 9.3 | ||||
| LDTP04285 | Proteasome subunit beta type-2 (PSMB2) | 9.3 | ||||
| LDTP00486 | Cytochrome b-c1 complex subunit 8 (UQCRQ) | 9.2 | ||||
| LDTP01982 | NADH-ubiquinone oxidoreductase chain 1 (MT-ND1) | 9.1 | ||||
| LDTP05066 | Signal peptidase complex catalytic subunit SEC11A (SEC11A) | 9.1 | ||||
| LDTP01328 | CAAX prenyl protease 1 homolog (ZMPSTE24) | 9.0 | ||||
| LDTP13620 | Lysosomal thioesterase PPT2 (PPT2) | 8.8 | ||||
| LDTP08979 | Prostaglandin reductase 2 (PTGR2) | 8.5 | ||||
| LDTP04388 | Palmitoyl-protein thioesterase 1 (PPT1) | 8.4 | ||||
| LDTP08728 | Vitamin K epoxide reductase complex subunit 1-like protein 1 (VKORC1L1) | 8.4 | ||||
| LDTP09088 | Phospholipase A2 group XV (PLA2G15) | 8.1 | ||||
| LDTP04712 | Puromycin-sensitive aminopeptidase (NPEPPS) | 7.8 | ||||
| LDTP06200 | Delta(14)-sterol reductase LBR (LBR) | 7.7 | ||||
| LDTP02005 | Lysosomal acid glucosylceramidase (GBA1) | 7.7 | ||||
| LDTP14276 | NADH dehydrogenase 1 beta subcomplex subunit 9 (NDUFB9) | 7.6 | ||||
| LDTP01241 | Bis(monoacylglycero)phosphate synthase CLN5 (CLN5) | 7.3 | ||||
| LDTP09096 | Carbohydrate sulfotransferase 14 (CHST14) | 7.2 | ||||
| LDTP06787 | Inactive hydroxysteroid dehydrogenase-like protein 1 (HSDL1) | 7.2 | ||||
| LDTP05476 | 3-ketodihydrosphingosine reductase (KDSR) | 7.1 | ||||
| LDTP05862 | NAD(P) transhydrogenase, mitochondrial (NNT) | 7.1 | ||||
| LDTP03419 | Proteasome subunit beta type-5 (PSMB5) | 6.9 | ||||
| LDTP01687 | Apoptosis-inducing factor 1, mitochondrial (AIFM1) | 6.8 | ||||
| LDTP04437 | Aldehyde dehydrogenase family 3 member A2 (ALDH3A2) | 6.5 | ||||
| LDTP01462 | Endonuclease domain-containing 1 protein (ENDOD1) | 6.5 | ||||
| LDTP09256 | Putative phospholipase B-like 2 (PLBD2) | 6.5 | ||||
| LDTP10612 | Lysophospholipid acyltransferase 7 (MBOAT7) | 6.2 | ||||
| LDTP06477 | Methylsterol monooxygenase 1 (MSMO1) | 6.2 | ||||
| LDTP10329 | Ceramide synthase 2 (CERS2) | 6.1 | ||||
| LDTP02837 | Beta-galactosidase (GLB1) | 5.9 | ||||
| LDTP06375 | Delta(24)-sterol reductase (DHCR24) | 5.9 | ||||
| LDTP12020 | Histone-lysine N-methyltransferase SMYD3 (SMYD3) | 5.9 | ||||
| LDTP16007 | Lipid droplet-associated hydrolase (LDAH) | 5.9 | ||||
| LDTP03608 | RAC-beta serine/threonine-protein kinase (AKT2) | 5.7 | ||||
| LDTP03394 | Ceramide synthase 1 (CERS1) | 5.7 | ||||
| LDTP04120 | Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A (STT3A) | 5.7 | ||||
| LDTP11127 | ADP-dependent glucokinase (ADPGK) | 5.6 | ||||
| LDTP02150 | ATP synthase subunit beta, mitochondrial (ATP5F1B) | 5.6 | ||||
| LDTP02486 | Lysosomal alpha-glucosidase (GAA) | 5.6 | ||||
| LDTP06657 | 2-hydroxyacylsphingosine 1-beta-galactosyltransferase (UGT8) | 5.5 | ||||
| LDTP05758 | S-methyl-5'-thioadenosine phosphorylase (MTAP) | 5.5 | ||||
| LDTP06333 | Serum paraoxonase/arylesterase 2 (PON2) | 5.5 | ||||
| LDTP03257 | Carnitine O-palmitoyltransferase 2, mitochondrial (CPT2) | 5.4 | ||||
| LDTP06325 | 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase (EBP) | 5.3 | ||||
| LDTP05128 | Glutathione S-transferase omega-1 (GSTO1) | 5.3 | ||||
| LDTP05905 | Acid ceramidase (ASAH1) | 5.2 | ||||
| LDTP08859 | Polypeptide N-acetylgalactosaminyltransferase 4 (GALNT4) | 5.2 | ||||
| LDTP13367 | Glutathione hydrolase 7 (GGT7) | 5.2 | ||||
| LDTP00783 | Beta-1,4-glucuronyltransferase 1 (B4GAT1) | 5.1 | ||||
| LDTP10495 | Ubiquitin carboxyl-terminal hydrolase 47 (USP47) | 5.1 | ||||
| LDTP12954 | Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 (HACD3) | 5.1 | ||||
| LDTP02860 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 (ATP2A2) | 5.0 | ||||
| LDTP08790 | Mitochondrial cardiolipin hydrolase (PLD6) | 5.0 | ||||
| LDTP12628 | Palmitoyl-protein thioesterase ABHD10, mitochondrial (ABHD10) | 5.0 | ||||
Transporter and channel
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10913 | Mitochondrial import inner membrane translocase subunit Tim17-A (TIMM17A) | 31.3 | ||||
| LDTP03132 | Voltage-dependent anion-selective channel protein 1 (VDAC1) | 29.2 | ||||
| LDTP03277 | ER lumen protein-retaining receptor 1 (KDELR1) | 26.9 | ||||
| LDTP15481 | Transmembrane protein 87A (TMEM87A) | 25.1 | ||||
| LDTP02724 | Cytochrome c oxidase subunit 7A2, mitochondrial (COX7A2) | 22.9 | ||||
| LDTP01059 | Mitochondrial import inner membrane translocase subunit Tim17-B (TIMM17B) | 22.3 | ||||
| LDTP08881 | Transmembrane protein 199 (TMEM199) | 20.0 | ||||
| LDTP09968 | V-type proton ATPase 116 kDa subunit a 1 (ATP6V0A1) | 19.7 | ||||
| LDTP14952 | Mpv17-like protein 2 (MPV17L2) | 16.7 | ||||
| LDTP04033 | Translocon-associated protein subunit alpha (SSR1) | 16.2 | ||||
| LDTP04071 | Voltage-dependent anion-selective channel protein 2 (VDAC2) | 16.1 | ||||
| LDTP07885 | Mitochondrial S-adenosylmethionine carrier protein (SLC25A26) | 15.7 | ||||
| LDTP06034 | Lysosome membrane protein 2 (SCARB2) | 15.0 | ||||
| LDTP14511 | ATP synthase subunit g, mitochondrial (ATP5MG) | 14.6 | ||||
| LDTP03546 | Translocator protein (TSPO) | 13.9 | ||||
| LDTP00562 | Membrane-associated progesterone receptor component 2 (PGRMC2) | 13.2 | ||||
| LDTP01745 | Putative lipid scramblase CLPTM1 (CLPTM1) | 12.1 | ||||
| LDTP06945 | Sigma intracellular receptor 2 (TMEM97) | 11.6 | ||||
| LDTP15967 | Tetraspanin-10 (TSPAN10) | 11.4 | ||||
| LDTP00541 | NPC intracellular cholesterol transporter 1 (NPC1) | 10.6 | ||||
| LDTP11813 | Solute carrier family 25 member 32 (SLC25A32) | 10.4 | ||||
| LDTP00865 | Mitochondrial carnitine/acylcarnitine carrier protein (SLC25A20) | 9.4 | ||||
| LDTP15948 | Transmembrane protein 126A (TMEM126A) | 9.4 | ||||
| LDTP17641 | Solute carrier family 35 member F2 (SLC35F2) | 9.3 | ||||
| LDTP20002 | Transmembrane protein 160 (TMEM160) | 9.0 | ||||
| LDTP01804 | ATP synthase subunit a (MT-ATP6) | 8.9 | ||||
| LDTP16813 | Tetraspanin-3 (TSPAN3) | 8.6 | ||||
| LDTP13174 | Mitochondrial dicarboxylate carrier (SLC25A10) | 8.1 | ||||
| LDTP15648 | BRI3-binding protein (BRI3BP) | 7.7 | ||||
| LDTP09328 | Adenosine 3'-phospho 5'-phosphosulfate transporter 1 (SLC35B2) | 7.6 | ||||
| LDTP06426 | Translocating chain-associated membrane protein 1 (TRAM1) | 7.6 | ||||
| LDTP11162 | Solute carrier family 25 member 33 (SLC25A33) | 7.4 | ||||
| LDTP14200 | Mitochondrial ornithine transporter 1 (SLC25A15) | 7.1 | ||||
| LDTP11213 | Nucleoporin NDC1 (NDC1) | 7.0 | ||||
| LDTP02215 | Prosaposin (PSAP) | 7.0 | ||||
| LDTP11245 | Derlin-1 (DERL1) | 7.0 | ||||
| LDTP15733 | Solute carrier family 25 member 44 (SLC25A44) | 6.9 | ||||
| LDTP04789 | Synaptojanin-2-binding protein (SYNJ2BP) | 6.8 | ||||
| LDTP16201 | B-cell receptor-associated protein 29 (BCAP29) | 6.7 | ||||
| LDTP08769 | Nuclear pore complex protein Nup93 (NUP93) | 6.5 | ||||
| LDTP05900 | Metaxin-1 (MTX1) | 6.3 | ||||
| LDTP06308 | Mitochondrial inner membrane protein OXA1L (OXA1L) | 6.3 | ||||
| LDTP03559 | High affinity cationic amino acid transporter 1 (SLC7A1) | 6.1 | ||||
| LDTP04592 | Monocarboxylate transporter 1 (SLC16A1) | 5.9 | ||||
| LDTP16190 | Protein FAM8A1 (FAM8A1) | 5.9 | ||||
| LDTP10065 | Transmembrane protein 230 (TMEM230) | 5.8 | ||||
| LDTP06365 | Transmembrane emp24 domain-containing protein 2 (TMED2) | 5.7 | ||||
| LDTP09333 | Golgin subfamily A member 5 (GOLGA5) | 5.7 | ||||
| LDTP09547 | Scavenger receptor class B member 1 (SCARB1) | 5.7 | ||||
| LDTP10958 | Sigma non-opioid intracellular receptor 1 (SIGMAR1) | 5.6 | ||||
| LDTP13983 | Mitochondrial import inner membrane translocase subunit TIM16 (PAM16) | 5.5 | ||||
| LDTP01542 | Golgi SNAP receptor complex member 1 (GOSR1) | 5.5 | ||||
| LDTP00235 | Membrane-associated progesterone receptor component 1 (PGRMC1) | 5.5 | ||||
| LDTP10499 | Lipid scramblase CLPTM1L (CLPTM1L) | 5.3 | ||||
| LDTP10669 | Melanoma inhibitory activity protein 2 (MIA2) | 5.3 | ||||
| LDTP01525 | Mitochondrial proton/calcium exchanger protein (LETM1) | 5.2 | ||||
| LDTP02645 | Cytochrome c oxidase subunit 4 isoform 1, mitochondrial (COX4I1) | 5.2 | ||||
| LDTP03952 | Reduced folate transporter (SLC19A1) | 5.0 | ||||
| LDTP13164 | Protein sel-1 homolog 1 (SEL1L) | 4.9 | ||||
Transcription factor
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP10501 | DnaJ homolog subfamily C member 1 (DNAJC1) | 6.5 | ||||
| LDTP05065 | Y-box-binding protein 1 (YBX1) | 5.0 | ||||
Other
| Target ID | Target Name | Binding Ratio | ||||
|---|---|---|---|---|---|---|
| LDTP11076 | Apolipoprotein L2 (APOL2) | 39.9 | ||||
| LDTP12565 | Mitochondrial import receptor subunit TOM22 homolog (TOMM22) | 30.9 | ||||
| LDTP05160 | Nucleobindin-2 (NUCB2) | 25.3 | ||||
| LDTP15067 | Ubiquinol-cytochrome c reductase complex assembly factor 6 (UQCC6) | 23.8 | ||||
| LDTP03678 | ER lumen protein-retaining receptor 2 (KDELR2) | 19.3 | ||||
| LDTP15420 | Mitochondrial import receptor subunit TOM5 homolog (TOMM5) | 17.5 | ||||
| LDTP00281 | Golgi integral membrane protein 4 (GOLIM4) | 12.1 | ||||
| LDTP13902 | Cytochrome c oxidase assembly factor 3 homolog, mitochondrial (COA3) | 11.6 | ||||
| LDTP14458 | Tetraspanin-6 (TSPAN6) | 10.8 | ||||
| LDTP13828 | Endoplasmic reticulum-Golgi intermediate compartment protein 3 (ERGIC3) | 10.6 | ||||
| LDTP18883 | Protein CEBPZOS (CEBPZOS) | 10.5 | ||||
| LDTP19021 | EF-hand calcium-binding domain-containing protein 14 (EFCAB14) | 10.2 | ||||
| LDTP05375 | Nucleobindin-1 (NUCB1) | 10.1 | ||||
| LDTP16192 | Mitochondrial fission process protein 1 (MTFP1) | 9.7 | ||||
| LDTP00105 | Protein unc-119 homolog B (UNC119B) | 9.3 | ||||
| LDTP13630 | Neudesin (NENF) | 8.9 | ||||
| LDTP08689 | Dyslexia-associated protein KIAA0319-like protein (KIAA0319L) | 8.8 | ||||
| LDTP13086 | Syntaxin-18 (STX18) | 8.8 | ||||
| LDTP01522 | Reticulon-3 (RTN3) | 7.9 | ||||
| LDTP10469 | Engulfment and cell motility protein 2 (ELMO2) | 7.7 | ||||
| LDTP18373 | Thioredoxin-related transmembrane protein 4 (TMX4) | 7.7 | ||||
| LDTP12412 | Reticulon-4 (RTN4) | 7.6 | ||||
| LDTP08364 | Ankyrin repeat and LEM domain-containing protein 2 (ANKLE2) | 7.5 | ||||
| LDTP14486 | Clustered mitochondria protein homolog (CLUH) | 7.2 | ||||
| LDTP16080 | Protein FAM114A2 (FAM114A2) | 7.1 | ||||
| LDTP13606 | Mammalian ependymin-related protein 1 (EPDR1) | 7.0 | ||||
| LDTP13755 | Brain-specific angiogenesis inhibitor 1-associated protein 2 (BAIAP2) | 7.0 | ||||
| LDTP19963 | TraB domain-containing protein (TRABD) | 6.9 | ||||
| LDTP08606 | Nurim (NRM) | 6.7 | ||||
| LDTP10056 | Protein FAM162A (FAM162A) | 6.5 | ||||
| LDTP07906 | Mediator of RNA polymerase II transcription subunit 25 (MED25) | 6.4 | ||||
| LDTP08224 | Protein LYRIC (MTDH) | 6.2 | ||||
| LDTP06097 | Reticulocalbin-2 (RCN2) | 6.1 | ||||
| LDTP19780 | Keratinocyte-associated transmembrane protein 2 (KCT2) | 6.1 | ||||
| LDTP01652 | Centrosomal protein 43 (CEP43) | 5.8 | ||||
| LDTP16006 | Optic atrophy 3 protein (OPA3) | 5.8 | ||||
| LDTP10965 | Nucleosome assembly protein 1-like 4 (NAP1L4) | 5.7 | ||||
| LDTP04094 | Large proline-rich protein BAG6 (BAG6) | 5.6 | ||||
| LDTP00121 | Zinc finger SWIM domain-containing protein 8 (ZSWIM8) | 5.5 | ||||
| LDTP08000 | Dymeclin (DYM) | 5.2 | ||||
| LDTP07891 | Inhibitor of nuclear factor kappa-B kinase-interacting protein (IKBIP) | 5.0 | ||||
| LDTP12755 | OCIA domain-containing protein 1 (OCIAD1) | 5.0 | ||||
| LDTP05868 | Protein unc-119 homolog A (UNC119) | 5.0 | ||||
